{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "7e3a8d4e-3516-4898-a9e9-7bd396913d07", "code": "101840-48-6", "type": "ALTERNATIVE", "url": "https://commonchemistry.cas.org/detail?cas_rn=101840-48-6", "code_system": "CAS", "references": [ "335e206b-3901-4215-9ae4-db795378d8d8", "c01383bc-b0b4-49db-ba24-b0486c2de809" ] }, { "uuid": "17d22ef3-11d3-4314-a802-fa9cb9a3d1cb", "code": "25615-05-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=25615-05-8", "code_system": "CAS", "references": [ "335e206b-3901-4215-9ae4-db795378d8d8", "15704e07-1f47-46e3-bd05-1001c7f5cfba" ] }, { "uuid": "186d39e6-a05d-43fc-bd80-ca93767a1ba5", "code": "5276454", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5276454", "code_system": "PUBCHEM", "references": [ "335e206b-3901-4215-9ae4-db795378d8d8" ] }, { "uuid": "5d814bb6-365b-458c-b5f8-dfb8e5564c35", "code": "78OW2GLG8Q", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "06eda066-c2ce-c737-fe42-a106e183f651", "code": "DTXSID501314340", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID501314340", "code_system": "EPA CompTox", "references": [ "02401782-caf7-2ced-53da-38e86e2f607a" ] }, { "uuid": "b897078c-97fe-e2c5-8fc2-2e43fde54ef9", "code": "300000013076", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "6393ffa8-da67-0b2c-111c-ffdc0fb04153" ] } ], "substance_class": "chemical", "names": [ { "uuid": "aa7cde73-5106-4bf0-9733-36e8b746595c", "name": "(+)-CATECHIN 3-GALLATE", "stdName": "(+)-CATECHIN 3-GALLATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7ef834df-1450-4181-93f3-287d080b55bc" ], "display_name": false }, { "uuid": "3848e84e-5b29-4f02-9b31-78f3d95cf64e", "name": "(+)-CATECHIN GALLATE", "stdName": "(+)-CATECHIN GALLATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7ef834df-1450-4181-93f3-287d080b55bc" ], "display_name": false }, { "uuid": "8d041d20-2301-48e2-8aee-eb11a05f1605", "name": "BENZOIC ACID, 3,4,5-TRIHYDROXY-, (2R,3S)-2-(3,4-DIHYDROXYPHENYL)-3,4-DIHYDRO-5,7-DIHYDROXY-2H-1-BENZOPYRAN-3-YL ESTER", "stdName": "BENZOIC ACID, 3,4,5-TRIHYDROXY-, (2R,3S)-2-(3,4-DIHYDROXYPHENYL)-3,4-DIHYDRO-5,7-DIHYDROXY-2H-1-BENZOPYRAN-3-YL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7ef834df-1450-4181-93f3-287d080b55bc" ], "display_name": false }, { "uuid": "eecf1bc6-4b01-4f7d-a528-9758d12ea310", "name": "CATECHIN GALLATE", "stdName": "CATECHIN GALLATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "75cd3218-39bb-4eac-8170-ee0043dc7176" ], "display_name": false }, { "uuid": "e19f9bcc-ca35-4149-91ad-434db77e524d", "name": "CATECHIN GALLATE, (+)-", "stdName": "CATECHIN GALLATE, (+)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7ef834df-1450-4181-93f3-287d080b55bc" ], "display_name": true } ], "references": [ { "uuid": "75cd3218-39bb-4eac-8170-ee0043dc7176", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "7ef834df-1450-4181-93f3-287d080b55bc", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "335e206b-3901-4215-9ae4-db795378d8d8", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392223000, "tags": [ "NOMEN" ] }, { "uuid": "3c189284-49fc-459f-8772-17e99c9959f3", "citation": "SRS import [78OW2GLG8Q]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=78OW2GLG8Q", "doc_type": "SRS", "public_domain": true, "document_date": 1493392223000, "tags": [ "NOMEN" ] }, { "uuid": "6393ffa8-da67-0b2c-111c-ffdc0fb04153", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "c01383bc-b0b4-49db-ba24-b0486c2de809", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "15704e07-1f47-46e3-bd05-1001c7f5cfba", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "02401782-caf7-2ced-53da-38e86e2f607a", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "be4098f7-a2fb-4b73-8e25-a47c8daf2067", "id": "be4098f7-a2fb-4b73-8e25-a47c8daf2067", "molfile": "\n Marvin 01132109502D \n\n 32 35 0 0 1 0 999 V2000\n 7.7014 -4.5119 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 6.9343 -4.9523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1675 -4.5119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4527 -4.9191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4527 -5.8044 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7426 -4.5073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7426 -3.6741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9757 -3.2385 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4621 -3.2669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1675 -3.6882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9439 -3.1817 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7014 -3.6362 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 8.4729 -3.1865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1972 -3.5841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8743 -3.1865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8269 -2.4006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5986 -1.9651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1072 -2.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1072 -1.1272 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4257 -2.4006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4635 -4.9523 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4635 -5.8423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7014 -6.2825 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2304 -6.2825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2304 -7.1110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9311 -7.4991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9311 -8.3891 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5890 -7.0683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3607 -7.5087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5890 -6.2399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3323 -5.8044 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8885 -5.8470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 12 1 1 0 0 0 0\n 1 21 1 1 0 0 0\n 2 3 1 0 0 0 0\n 4 3 1 0 0 0 0\n 3 10 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 4 2 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 1 0 0 0 0\n 7 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 1 6 0 0 0\n 12 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 20 13 2 0 0 0 0\n 15 14 2 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 16 18 2 0 0 0 0\n 19 18 1 0 0 0 0\n 18 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 2 0 0 0 0\n 24 22 1 0 0 0 0\n 25 24 1 0 0 0 0\n 32 24 2 0 0 0 0\n 26 25 2 0 0 0 0\n 27 26 1 0 0 0 0\n 28 26 1 0 0 0 0\n 29 28 1 0 0 0 0\n 28 30 2 0 0 0 0\n 31 30 1 0 0 0 0\n 30 32 1 0 0 0 0\nM END", "smiles": "c1cc(c(cc1[C@@H]2[C@H](Cc3c(cc(cc3O2)O)O)OC(=O)c4cc(c(c(c4)O)O)O)O)O", "formula": "C22H18O10", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "7ae84317-1dd6-49a3-be40-906e795b138d" }, "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "442.3732", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "58ac9526-c52b-4333-8735-cd06bcaa3362", "version": "5", "structure": { "id": "8b452117-c11a-436c-9aa2-65818c21eaac", "molfile": "\n Marvin 01132107142D \n\n 32 35 0 0 1 0 999 V2000\n 6.9439 -3.1817 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1675 -3.6882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1675 -4.5119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4527 -4.9191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4527 -5.8044 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7426 -4.5073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7426 -3.6741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4621 -3.2669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9757 -3.2385 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9343 -4.9523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7014 -4.5119 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.7014 -3.6362 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.4729 -3.1865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4257 -2.4006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1072 -2.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1072 -1.1272 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8269 -2.4006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8743 -3.1865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1972 -3.5841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5986 -1.9651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4635 -4.9523 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4635 -5.8423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2304 -6.2825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2304 -7.1110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9311 -7.4991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9311 -8.3891 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5890 -7.0683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5890 -6.2399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8885 -5.8470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3323 -5.8044 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3607 -7.5087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7014 -6.2825 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 2 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 4 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 2 1 0 0 0 0\n 9 7 1 0 0 0 0\n 10 3 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 1 1 0 0 0 0\n 12 13 1 6 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 15 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 13 1 0 0 0 0\n 20 17 1 0 0 0 0\n 11 21 1 1 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 2 0 0 0 0\n 26 25 1 0 0 0 0\n 27 25 1 0 0 0 0\n 27 28 2 0 0 0 0\n 28 29 1 0 0 0 0\n 29 23 2 0 0 0 0\n 30 28 1 0 0 0 0\n 31 27 1 0 0 0 0\n 32 22 2 0 0 0 0\nM END", "smiles": "c1cc(c(cc1[C@@H]2[C@H](Cc3c(cc(cc3O2)O)O)OC(=O)c4cc(c(c(c4)O)O)O)O)O", "formula": "C22H18O10", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "442.3732", "optical_activity": "UNSPECIFIED", "references": [ "7ef834df-1450-4181-93f3-287d080b55bc", "3c189284-49fc-459f-8772-17e99c9959f3" ], "stereo_centers": 2 }, "unii": "78OW2GLG8Q" } ] }