{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "0657938c-f1a1-42a6-b899-4d660f6d79ea", "code": "91-50-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=91-50-9", "code_system": "CAS", "references": [ "8325380c-8aa0-4408-b69a-060648ec3750", "c9562648-214b-481e-b75d-a02d4a0d480f" ] }, { "uuid": "e30e377b-3a50-458d-944d-78a8983c627e", "code": "202-072-0", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.884", "code_system": "ECHA (EC/EINECS)", "references": [ "8325380c-8aa0-4408-b69a-060648ec3750" ] }, { "uuid": "ea01bbbd-19e0-4a5e-af72-83dd7c862d97", "code": "78J2J6IE6R", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "b41ed440-e4ad-aa40-ca8b-ccd40e4d0b7a", "code": "DTXSID70861685", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70861685", "code_system": "EPA CompTox", "references": [ "ea9adfe3-b1bf-3933-d928-1df30c2ff3d4" ] } ], "substance_class": "chemical", "names": [ { "uuid": "0bff55a5-0b6c-4ca9-9f1c-aac77234e076", "name": "ANTHRANILIC ACID, N-(3-P-CUMENYL-2-METHYLPROPYLIDENE)-, METHYL ESTER", "stdName": "ANTHRANILIC ACID, N-(3-P-CUMENYL-2-METHYLPROPYLIDENE)-, METHYL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "096f47e9-a34a-413a-8327-88f61928a5f7", "4b51079b-e7b6-43d5-9f17-c3b9daaed8ee" ], "display_name": false }, { "uuid": "1dc9d81c-d8f3-4a7a-aca9-33a70d4cf404", "name": "BENZOIC ACID, 2-((2-METHYL-3-(4-(1-METHYLETHYL)PHENYL)PROPYLIDENE)AMINO)-, METHYL ESTER", "stdName": "BENZOIC ACID, 2-((2-METHYL-3-(4-(1-METHYLETHYL)PHENYL)PROPYLIDENE)AMINO)-, METHYL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "096f47e9-a34a-413a-8327-88f61928a5f7", "4b51079b-e7b6-43d5-9f17-c3b9daaed8ee" ], "display_name": false }, { "uuid": "eef50dc9-6cf4-4f72-bb22-d1003a69f1b0", "name": "CYCLAMEN ALDEHYDE METHYL ANTHRANILATE", "stdName": "CYCLAMEN ALDEHYDE METHYL ANTHRANILATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1d7301c9-4e5a-44ee-bd92-baee069e84b4", "4b51079b-e7b6-43d5-9f17-c3b9daaed8ee" ], "display_name": true }, { "uuid": "2a34d66c-1941-4a37-b3c7-9c3a96de402e", "name": "CYRANTIOL", "stdName": "CYRANTIOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "096f47e9-a34a-413a-8327-88f61928a5f7", "4b51079b-e7b6-43d5-9f17-c3b9daaed8ee" ], "display_name": false } ], "references": [ { "uuid": "096f47e9-a34a-413a-8327-88f61928a5f7", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "4b51079b-e7b6-43d5-9f17-c3b9daaed8ee", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1d7301c9-4e5a-44ee-bd92-baee069e84b4", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8325380c-8aa0-4408-b69a-060648ec3750", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392231000, "tags": [ "NOMEN" ] }, { "uuid": "8ef81c93-cb63-44e3-ae2a-a52f7f424f54", "citation": "SRS import [78J2J6IE6R]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=78J2J6IE6R", "doc_type": "SRS", "public_domain": true, "document_date": 1493392231000, "tags": [ "NOMEN" ] }, { "uuid": "c9562648-214b-481e-b75d-a02d4a0d480f", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "ea9adfe3-b1bf-3933-d928-1df30c2ff3d4", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "3e2e833c-870c-4453-b3ba-9620d83452a0", "id": "3e2e833c-870c-4453-b3ba-9620d83452a0", "molfile": "\n Marvin 01132103182D \n\n 24 25 0 0 0 0 999 V2000\n 8.5938 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8805 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1586 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4453 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1586 -2.0711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8805 -2.4836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8805 -3.3086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1586 -3.7211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4453 -3.3086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4453 -2.4836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7321 -2.0711 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0102 -2.4836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2969 -2.0711 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 4.2969 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5836 -2.4836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8617 -2.0711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1484 -2.4836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4352 -2.0711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4352 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1484 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8617 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7133 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7133 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 2 0 0 0 0\n 5 3 1 0 0 0 0\n 5 6 1 0 0 0 0\n 10 5 2 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 13 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 16 21 2 0 0 0 0\n 18 17 2 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 2 0 0 0 0\n 19 22 1 0 0 0 0\n 20 21 1 0 0 0 0\n 22 23 1 0 0 0 0\n 22 24 1 0 0 0 0\nM END", "smiles": "CC(C)c1ccc(cc1)CC(C)/C=N/c2ccccc2C(=O)OC", "formula": "C21H25NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e3fd7ad6-c280-41de-bdc5-37937ac76dc6" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "323.4295", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "a2a84b48-f219-430b-90dd-2b00de8814da", "version": "7", "structure": { "id": "43410673-3923-459e-8aa3-1916ce2be7c4", "molfile": "\n Marvin 01132103332D \n\n 24 25 0 0 0 0 999 V2000\n 6.4453 -2.4836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1586 -2.0711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8805 -2.4836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8805 -3.3086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1586 -3.7211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4453 -3.3086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1484 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4352 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4352 -2.0711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1484 -2.4836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8617 -2.0711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8617 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7133 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7133 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5836 -2.4836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2969 -2.0711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2969 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0102 -2.4836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7321 -2.0711 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1586 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4453 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8805 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5938 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 1 6 1 0 0 0 0\n 1 20 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 21 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 7 8 2 0 0 0 0\n 7 12 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 13 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 16 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 21 22 2 0 0 0 0\n 21 23 1 0 0 0 0\n 23 24 1 0 0 0 0\nM END", "smiles": "CC(C)c1ccc(cc1)CC(C)/C=N/c2ccccc2C(=O)OC", "formula": "C21H25NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "323.4295", "optical_activity": "( + / - )", "references": [ "8ef81c93-cb63-44e3-ae2a-a52f7f424f54", "1d7301c9-4e5a-44ee-bd92-baee069e84b4" ], "stereo_centers": 1 }, "unii": "78J2J6IE6R" } ] }