{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "d6917d30-f74d-41e5-89ac-46ec3e37d065", "code": "131929-63-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=131929-63-0", "code_system": "CAS", "references": [ "d6e802c4-6f29-47a3-a290-15e0e0ae1e2f", "46e87606-9825-4749-a894-d2d2ba683b86" ] }, { "uuid": "23d2dbb0-2b83-4573-ab23-1164f6ce7527", "code": "110004", "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL", "type": "PRIMARY", "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:23567", "code_system": "EPA PESTICIDE CODE", "references": [ "d6e802c4-6f29-47a3-a290-15e0e0ae1e2f" ] }, { "uuid": "06484853-15ff-4518-a27f-17a1cc680ec2", "code": "C84179", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C84179", "code_system": "NCI_THESAURUS", "references": [ "d6e802c4-6f29-47a3-a290-15e0e0ae1e2f" ] }, { "uuid": "96b3fd99-394c-4758-b072-00271456cbeb", "code": "m10147", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m10147?q=authorize", "code_system": "MERCK INDEX", "references": [ "d6e802c4-6f29-47a3-a290-15e0e0ae1e2f" ] }, { "uuid": "803bc427-7148-4fbf-a27c-ece1e8f63c41", "code": "183094", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/183094", "code_system": "PUBCHEM", "references": [ "d6e802c4-6f29-47a3-a290-15e0e0ae1e2f" ] }, { "uuid": "db26622e-37f4-8e4b-0c81-4d3bd05c6b7b", "code": "DTXSID3037599", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3037599", "code_system": "EPA CompTox", "references": [ "71a4bbfc-1015-d692-c879-fa2cd44d6134" ] }, { "uuid": "98741e63-4add-9f65-2982-ca053614819f", "code": "C737", "comments": "Industrial Aid[C45678]|Pesticide", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C737", "code_system": "NCI_THESAURUS", "references": [ "0cedae19-9769-a89d-2ef5-0aa896e467dc" ] }, { "uuid": "b2c82fa5-f632-40b0-9ecb-663c9ab360e3", "code": "78G4631RTT", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "52b23d3b-93c4-2a3a-b47d-ca24d17ba3d7", "code": "9232", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9232", "code_system": "CHEBI", "references": [ "0cedae19-9769-a89d-2ef5-0aa896e467dc" ] } ], "substance_class": "chemical", "names": [ { "uuid": "5145721c-e6ae-4740-b06b-f338719acf3b", "name": "SPINOSAD FACTOR D", "stdName": "SPINOSAD FACTOR D", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1f44bed1-9617-4f57-809d-d25546ec5505" ], "display_name": true }, { "uuid": "a235a5de-82a1-405b-a2ca-a5c2c6be3442", "name": "SPINOSYN D [MI]", "stdName": "SPINOSYN D [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ee2af2c8-4dec-4e16-83ed-2731572f8a88" ], "display_name": false } ], "references": [ { "uuid": "1f44bed1-9617-4f57-809d-d25546ec5505", "citation": "USP DICTIONARY 2009", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "ee2af2c8-4dec-4e16-83ed-2731572f8a88", "citation": "MERCK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d6e802c4-6f29-47a3-a290-15e0e0ae1e2f", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390150000, "tags": [ "NOMEN" ] }, { "uuid": "52615fc6-a3fa-435c-8979-0277c4f30b45", "citation": "SRS import [78G4631RTT]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=78G4631RTT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390150000, "tags": [ "NOMEN" ] }, { "uuid": "8066ba1f-3f07-4522-af69-446ebdb87576", "citation": "SPINOSYN D [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "71a4bbfc-1015-d692-c879-fa2cd44d6134", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=131929-63-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "0cedae19-9769-a89d-2ef5-0aa896e467dc", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "46e87606-9825-4749-a894-d2d2ba683b86", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "89f58e17-5320-4f91-b084-9d3e6a616703", "id": "89f58e17-5320-4f91-b084-9d3e6a616703", "molfile": "\n Marvin 01132107102D \n\n 53 58 0 0 1 0 999 V2000\n 6.2445 -2.4079 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 6.0631 -3.2140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2425 -3.2877 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 4.7507 -3.9514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0778 -4.7110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9322 -3.8527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6059 -3.0975 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 2.8286 -2.8374 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 2.1166 -3.2466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1102 -4.0734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8235 -4.4917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3932 -4.4819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6826 -4.0637 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n -0.0365 -4.4720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7497 -4.0535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6873 -3.2430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0205 -2.8345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0205 -2.0075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6892 -1.5926 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 0.6871 -0.7656 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0302 -0.3540 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n -0.7447 -0.7666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4624 -0.3506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4626 0.4774 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n -2.1779 0.8923 0.0000 N 0 0 2 0 0 0 0 0 0 0 0 0\n -2.1762 1.7193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8949 0.4803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7451 0.8874 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n -0.7442 1.7144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0320 0.4777 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4077 -2.0075 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 1.4079 -2.8345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1217 -1.5948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1241 -0.7679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8367 -2.0136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6230 -1.7664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0997 -2.4371 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 4.9179 -2.5277 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 5.5394 -1.9881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9546 -1.9900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9488 -1.1659 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 6.2324 -0.7613 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2302 0.0654 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 5.5140 0.4763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9428 0.4812 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 6.9371 1.3062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6501 1.7211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6575 0.0703 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 8.3660 0.4909 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0848 0.0847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6613 -0.7501 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 8.3777 -1.1543 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0878 -0.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 39 1 0 0 0 0\n 1 40 1 6 0 0 0\n 3 2 1 1 0 0 0\n 3 4 1 0 0 0 0\n 38 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 4 2 0 0 0 0\n 7 6 1 1 0 0 0\n 7 8 1 0 0 0 0\n 7 37 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 35 1 6 0 0 0\n 10 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 12 10 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 1 0 0 0\n 16 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 1 6 0 0 0\n 19 31 1 0 0 0 0\n 21 20 1 1 0 0 0\n 21 22 1 0 0 0 0\n 21 30 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 24 25 1 6 0 0 0\n 24 28 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 27 1 0 0 0 0\n 28 29 1 1 0 0 0\n 28 30 1 0 0 0 0\n 31 32 1 6 0 0 0\n 31 33 1 0 0 0 0\n 33 34 2 0 0 0 0\n 35 33 1 0 0 0 0\n 36 35 2 0 0 0 0\n 37 36 1 1 0 0 0\n 37 38 1 0 0 0 0\n 38 39 1 6 0 0 0\n 41 40 1 6 0 0 0\n 41 42 1 0 0 0 0\n 51 41 1 0 0 0 0\n 43 42 1 0 0 0 0\n 43 44 1 1 0 0 0\n 45 43 1 0 0 0 0\n 45 46 1 6 0 0 0\n 45 48 1 0 0 0 0\n 46 47 1 0 0 0 0\n 48 49 1 1 0 0 0\n 48 51 1 0 0 0 0\n 49 50 1 0 0 0 0\n 51 52 1 1 0 0 0\n 52 53 1 0 0 0 0\nM END", "smiles": "CC[C@H]1CCC[C@@H]([C@@H](C)C(=O)C2=C[C@@H]3[C@@H](C=C(C)[C@@H]4C[C@H](C[C@H]43)O[C@H]5[C@@H]([C@@H]([C@H]([C@H](C)O5)OC)OC)OC)[C@@H]2CC(=O)O1)O[C@H]6CC[C@@H]([C@@H](C)O6)N(C)C", "formula": "C42H67NO10", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "401d3ea9-7993-49cc-87fd-f612379fba68" }, "defined_stereo": 17, "ez_centers": 0, "molecular_weight": "745.9837", "optical_activity": "UNSPECIFIED", "stereo_centers": 17 } ], "definition_level": "COMPLETE", "uuid": "ebd6466e-2def-4985-bd16-258c59d9a905", "version": "5", "structure": { "id": "27072bcc-f029-48e6-9977-fd4d59befbf2", "molfile": "\n Marvin 01132102092D \n\n 60 65 0 0 1 0 999 V2000\n 6.2445 -2.4079 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.9546 -1.9900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9488 -1.1659 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.6613 -0.7501 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.6575 0.0703 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.9428 0.4812 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.2302 0.0654 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.2324 -0.7613 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2425 -3.2877 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.5671 -4.0476 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9208 -1.7007 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9179 -2.5277 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 4.1027 -1.6101 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0997 -2.4371 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 3.6059 -3.0975 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 3.6030 -3.9245 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8286 -2.8374 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 2.8256 -3.6643 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0205 -2.0075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0205 -2.8345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6892 -1.5926 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 1.4077 -2.0075 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 2.1217 -1.5948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6873 -3.2430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6826 -4.0637 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 1.3932 -4.4819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1102 -4.0734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1166 -3.2466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8367 -2.0136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6230 -1.7664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1241 -0.7679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4079 -2.8345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6871 -0.7656 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0302 -0.3540 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 2.8235 -4.4917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0365 -4.4720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7497 -4.0535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9322 -3.8527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7507 -3.9514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0631 -3.2140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5394 -1.9881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0778 -4.7110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0320 0.4777 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7451 0.8874 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n -1.4626 0.4774 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n -1.4624 -0.3506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7447 -0.7666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1779 0.8923 0.0000 N 0 0 2 0 0 0 0 0 0 0 0 0\n -2.1762 1.7193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8949 0.4803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7442 1.7144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0351 -1.1806 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3777 -1.1543 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0878 -0.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3660 0.4909 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0848 0.0847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9371 1.3062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6501 1.7211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5140 0.4763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6647 -1.5779 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 23 31 2 0 0 0 0\n 17 18 1 1 0 0 0\n 22 32 1 6 0 0 0\n 19 20 1 0 0 0 0\n 21 33 1 6 0 0 0\n 9 10 1 6 0 0 0\n 33 34 1 0 0 0 0\n 2 3 1 0 0 0 0\n 27 35 2 0 0 0 0\n 3 4 1 0 0 0 0\n 25 36 1 1 0 0 0\n 19 21 1 0 0 0 0\n 36 37 1 0 0 0 0\n 14 15 1 0 0 0 0\n 20 24 1 0 0 0 0\n 22 21 1 0 0 0 0\n 14 12 1 0 0 0 0\n 15 38 1 0 0 0 0\n 38 39 2 0 0 0 0\n 39 9 1 0 0 0 0\n 12 9 1 0 0 0 0\n 1 2 1 6 0 0 0\n 12 11 1 1 0 0 0\n 9 40 1 0 0 0 0\n 40 1 1 0 0 0 0\n 1 41 1 0 0 0 0\n 41 12 1 0 0 0 0\n 22 23 1 0 0 0 0\n 39 42 1 0 0 0 0\n 34 43 1 0 0 0 0\n 28 17 1 0 0 0 0\n 29 23 1 0 0 0 0\n 3 8 1 0 0 0 0\n 4 5 1 0 0 0 0\n 14 13 1 6 0 0 0\n 34 47 1 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 1 0 0 0 0\n 45 46 1 0 0 0 0\n 46 47 1 0 0 0 0\n 5 6 1 0 0 0 0\n 45 48 1 6 0 0 0\n 6 7 1 0 0 0 0\n 48 49 1 0 0 0 0\n 24 25 1 0 0 0 0\n 48 50 1 0 0 0 0\n 25 26 1 0 0 0 0\n 44 51 1 1 0 0 0\n 26 27 1 0 0 0 0\n 34 52 1 6 0 0 0\n 27 28 1 0 0 0 0\n 4 53 1 1 0 0 0\n 29 17 1 0 0 0 0\n 53 54 1 0 0 0 0\n 15 16 1 6 0 0 0\n 5 55 1 1 0 0 0\n 7 8 1 0 0 0 0\n 55 56 1 0 0 0 0\n 17 15 1 0 0 0 0\n 6 57 1 6 0 0 0\n 14 30 1 0 0 0 0\n 57 58 1 0 0 0 0\n 30 29 2 0 0 0 0\n 7 59 1 1 0 0 0\n 3 60 1 1 0 0 0\nM END", "smiles": "CC[C@H]1CCC[C@@H]([C@@H](C)C(=O)C2=C[C@]3([H])[C@@]([H])(C=C(C)[C@]4([H])C[C@H](C[C@]43[H])O[C@@]5([H])[C@@H]([C@@H]([C@H]([C@H](C)O5)OC)OC)OC)[C@]2([H])CC(=O)O1)O[C@@]6([H])CC[C@@H]([C@@H](C)O6)N(C)C", "formula": "C42H67NO10", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 17, "ez_centers": 0, "molecular_weight": "745.9837", "optical_activity": "UNSPECIFIED", "references": [ "1f44bed1-9617-4f57-809d-d25546ec5505", "52615fc6-a3fa-435c-8979-0277c4f30b45" ], "stereo_centers": 17 }, "unii": "78G4631RTT" } ] }