{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f17f000c-372c-4082-a574-7aa610503c81",
          "code": "60752-63-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=60752-63-8",
          "code_system": "CAS",
          "references": [
            "3169250a-4062-4e69-902c-5bbc56e48889",
            "ebea8e19-3ddf-42d2-8aae-743530833dd8"
          ]
        },
        {
          "uuid": "537a2a31-7604-491f-9ac8-366bf2dd3865",
          "code": "40542948",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/40542948",
          "code_system": "PUBCHEM",
          "references": [
            "3169250a-4062-4e69-902c-5bbc56e48889"
          ]
        },
        {
          "uuid": "eb34ff0e-a525-4f57-a24f-0a08cbd35279",
          "code": "78F3VJ8QAJ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7f217d77-c564-f605-58a7-939d6f5e2599",
          "code": "DTXSID201018696",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID201018696",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "27aa2c08-774f-4fde-aa57-baee56ea6cf1",
          "name": "L-METHIONINE, N-(2-THIENYLCARBONYL)-",
          "stdName": "L-METHIONINE, N-(2-THIENYLCARBONYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7aa74eaf-8f29-49ab-90ac-2dd282b0824c",
            "8f49339d-b091-4e11-9ac9-c86bf0c56b8c"
          ],
          "display_name": false
        },
        {
          "uuid": "90dcb609-3177-4690-b484-5e05f966cfcd",
          "name": "N-2-THIENOYLMETHIONINE",
          "stdName": "N-2-THIENOYLMETHIONINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7aa74eaf-8f29-49ab-90ac-2dd282b0824c",
            "8f49339d-b091-4e11-9ac9-c86bf0c56b8c"
          ],
          "display_name": false
        },
        {
          "uuid": "ff4cbde6-0cc1-4275-a53a-37870ec6253e",
          "name": "T.A.M.",
          "stdName": "T.A.M.",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f49339d-b091-4e11-9ac9-c86bf0c56b8c",
            "9a771708-85b1-40e6-83cd-3cd3af53c3ae"
          ],
          "display_name": false
        },
        {
          "uuid": "a662263b-84a2-4d9b-be13-8b6821c71fcb",
          "name": "THENOYL METHIONATE",
          "stdName": "THENOYL METHIONATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f49339d-b091-4e11-9ac9-c86bf0c56b8c",
            "9a771708-85b1-40e6-83cd-3cd3af53c3ae",
            "fb7751b9-38b5-4415-b06f-bd87d75545a3"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "9366d16d-4533-4a10-9d5f-9efb7372bce1",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "9a771708-85b1-40e6-83cd-3cd3af53c3ae",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8f49339d-b091-4e11-9ac9-c86bf0c56b8c",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7aa74eaf-8f29-49ab-90ac-2dd282b0824c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3169250a-4062-4e69-902c-5bbc56e48889",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391623000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a937d4a7-bb79-4a9d-9858-d63b19521332",
          "citation": "SRS import [78F3VJ8QAJ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=78F3VJ8QAJ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391623000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb7751b9-38b5-4415-b06f-bd87d75545a3",
          "citation": "THENOYL METHIONATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ebea8e19-3ddf-42d2-8aae-743530833dd8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ac9062a8-3aaf-44cf-8f5e-2548cbe0be7a",
          "id": "ac9062a8-3aaf-44cf-8f5e-2548cbe0be7a",
          "molfile": "\n  Marvin  01132108572D          \n\n 16 16  0  0  1  0            999 V2000\n   12.0334   -7.7750    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   12.7480   -8.1872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4627   -7.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1773   -8.1872    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8919   -7.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3188   -8.1872    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6042   -7.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6042   -6.9504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8896   -8.1872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8071   -9.0118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0101   -9.1767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5978   -8.4620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1475   -7.8574    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0334   -6.9504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3188   -6.5381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7480   -6.5381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  6  1  6  0  0  0\n  1 14  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 13  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\nM  END",
          "smiles": "CSCC[C@@H](C(=O)O)NC(=O)c1cccs1",
          "formula": "C10H13NO3S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5210c24f-6068-445d-a061-7595871596d1"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "259.3477",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "59ad31e8-2bc3-431a-bbd7-3d116cab35be",
      "version": "6",
      "structure": {
        "id": "b0d06b7b-df58-4f67-802a-2e86b9b96797",
        "molfile": "\n  Marvin  01132109102D          \n\n 16 16  0  0  1  0            999 V2000\n   12.0334   -6.9504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0334   -7.7750    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.3188   -8.1872    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6042   -7.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6042   -6.9504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8896   -8.1872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8071   -9.0118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0101   -9.1767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5978   -8.4620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1475   -7.8574    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7480   -8.1872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4627   -7.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1773   -8.1872    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8919   -7.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3188   -6.5381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7480   -6.5381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  6  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n  6 10  1  0  0  0  0\n  2 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n  1 15  2  0  0  0  0\n  1 16  1  0  0  0  0\nM  END",
        "smiles": "CSCC[C@@H](C(=O)O)NC(=O)c1cccs1",
        "formula": "C10H13NO3S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "259.3477",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "7aa74eaf-8f29-49ab-90ac-2dd282b0824c",
          "a937d4a7-bb79-4a9d-9858-d63b19521332"
        ],
        "stereo_centers": 1
      },
      "unii": "78F3VJ8QAJ"
    }
  ]
}