{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fc5ef248-4dc1-45a7-8e56-567154b840fe",
          "code": "N0000185506",
          "comments": "Cytochrome P450 3A4 Inducers [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000185506",
          "code_system": "NDF-RT",
          "references": [
            "2eb29873-9cae-4273-9cf1-c44444d0f82d"
          ]
        },
        {
          "uuid": "588a108c-31ed-42ea-bf81-82f106b9ecb8",
          "code": "4211",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4211",
          "code_system": "PUBCHEM",
          "references": [
            "2eb29873-9cae-4273-9cf1-c44444d0f82d"
          ]
        },
        {
          "uuid": "09dea660-279e-4d12-af83-bdde0b710214",
          "code": "L01XX23",
          "comments": "ATC|ANTINEOPLASTIC AND IMMUNOMODULATING AGENTS|ANTINEOPLASTIC AGENTS|OTHER ANTINEOPLASTIC AGENTS|Other antineoplastic agents|mitotane",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=L01XX23&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "2eb29873-9cae-4273-9cf1-c44444d0f82d"
          ]
        },
        {
          "uuid": "e2d8aaa0-5310-420d-8387-6f4cb5a994a8",
          "code": "QL01XX23",
          "comments": "VATC|ANTINEOPLASTIC AGENTS|OTHER ANTINEOPLASTIC AGENTS|Other antineoplastic agents|mitotane",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QL01XX23&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "2eb29873-9cae-4273-9cf1-c44444d0f82d"
          ]
        },
        {
          "uuid": "49c8ecbe-dc31-47d0-8019-0091bc4e777d",
          "code": "53-19-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=53-19-0",
          "code_system": "CAS",
          "references": [
            "2eb29873-9cae-4273-9cf1-c44444d0f82d",
            "31be6341-8f98-4e31-8c10-ac846d92f666"
          ]
        },
        {
          "uuid": "502a1e8e-0df8-4e79-8964-400a322db879",
          "code": "C664",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C664",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2eb29873-9cae-4273-9cf1-c44444d0f82d"
          ]
        },
        {
          "uuid": "3b40dd75-5f72-4b49-8999-623368068c6a",
          "code": "D008939",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68008939",
          "code_system": "MESH",
          "references": [
            "2eb29873-9cae-4273-9cf1-c44444d0f82d"
          ]
        },
        {
          "uuid": "75ceb104-69d2-4460-836d-0f13b40e55e6",
          "code": "NBK548445",
          "comments": "LiverTox|Antineoplastic|Adrenal Carcinoma|Corticosteroid antagonist",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548445/",
          "code_system": "LIVERTOX",
          "references": [
            "0d965728-347e-74f1-3c01-5a9cd1b7be4d"
          ]
        },
        {
          "uuid": "bbb9ef34-a75c-40ab-a5f8-17ae480b19aa",
          "code": "MITOTANE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Mitotane",
          "code_system": "WIKIPEDIA",
          "references": [
            "2eb29873-9cae-4273-9cf1-c44444d0f82d"
          ]
        },
        {
          "uuid": "334623e5-d925-483e-a035-44fa5b9eb862",
          "code": "SUB09010MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "2eb29873-9cae-4273-9cf1-c44444d0f82d"
          ]
        },
        {
          "uuid": "a82715d6-cdae-43eb-868a-a7a24522b60e",
          "code": "2597",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2597",
          "code_system": "INN",
          "references": [
            "2eb29873-9cae-4273-9cf1-c44444d0f82d"
          ]
        },
        {
          "uuid": "6e0a87ec-4ebf-4ec7-adc9-834af0f998a0",
          "code": "200-166-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.152",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "2eb29873-9cae-4273-9cf1-c44444d0f82d"
          ]
        },
        {
          "uuid": "2a9ca9d8-0b8d-4064-8b37-deb2ea7aa415",
          "code": "6957",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=6957",
          "code_system": "IUPHAR",
          "references": [
            "2eb29873-9cae-4273-9cf1-c44444d0f82d"
          ]
        },
        {
          "uuid": "c382d4b7-14d9-4385-9c13-ae3b2df7f147",
          "code": "7004",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/7004/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "2eb29873-9cae-4273-9cf1-c44444d0f82d"
          ]
        },
        {
          "uuid": "711ff72d-f9bf-4ab6-9285-59eb8e6754d8",
          "code": "m7571",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7571?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "2eb29873-9cae-4273-9cf1-c44444d0f82d"
          ]
        },
        {
          "uuid": "8637dea7-2b96-4bf3-a750-7249791ea6b8",
          "code": "DB00648",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00648",
          "code_system": "DRUG BANK",
          "references": [
            "2eb29873-9cae-4273-9cf1-c44444d0f82d"
          ]
        },
        {
          "uuid": "530b6dac-df1a-435f-b5ff-fe33733154c9",
          "code": "LYSODREN (AUTHORIZED: ADRENAL CORTEX NEOPLASMS)",
          "comments": "EMA EMPR|DISEASES|HORMONAL DISEASES|ENDOCRINE GLAND NEOPLASMS|ADRENAL GLAND NEOPLASMS|ADRENAL CORTEX NEOPLASMS",
          "type": "PRIMARY",
          "url": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/000521/human_med_000895.jsp&mid=WC0b01ac058001d124",
          "code_system": "EMA ASSESSMENT REPORTS",
          "references": [
            "2eb29873-9cae-4273-9cf1-c44444d0f82d"
          ]
        },
        {
          "uuid": "b55a3f02-4876-4302-a902-7c743a492437",
          "code": "CHEMBL1670",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1670",
          "code_system": "ChEMBL",
          "references": [
            "2eb29873-9cae-4273-9cf1-c44444d0f82d"
          ]
        },
        {
          "uuid": "e41f3685-e99a-1b26-b0dc-2a1f5028985c",
          "code": "3240",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3240",
          "code_system": "HSDB",
          "references": [
            "928902a4-895b-f806-6638-0efd2f580604"
          ]
        },
        {
          "uuid": "54999122-d8b9-9082-81db-026ae15a2d41",
          "code": "DTXSID9020372",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9020372",
          "code_system": "EPA CompTox",
          "references": [
            "f850629f-e639-cddf-3315-4ae43685e717"
          ]
        },
        {
          "uuid": "986df4f4-6834-7354-8db4-080803cfb580",
          "code": "C2355",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Hormone Antagonist[C547]|Anti-Adrenal",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2355",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0d965728-347e-74f1-3c01-5a9cd1b7be4d"
          ]
        },
        {
          "uuid": "db3553e2-c22d-59ff-9ebc-cb2af2be5726",
          "code": "EU/3/02/102",
          "comments": "EU ORPHAN DRUG|Expired|Treatment of adrenal cortical carcinoma",
          "type": "PRIMARY",
          "url": "https://www.ema.europa.eu/en/medicines/human/orphan-designations/eu302102",
          "code_system": "EU-Orphan Drug",
          "references": [
            "0d965728-347e-74f1-3c01-5a9cd1b7be4d"
          ]
        },
        {
          "uuid": "d838b434-5e6b-4040-9459-7f216062fca1",
          "code": "78E4J5IB5J",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "768bff79-003a-83e0-dab6-a0d4be6486b4",
          "code": "1445007",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1445007",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "0d965728-347e-74f1-3c01-5a9cd1b7be4d"
          ]
        },
        {
          "uuid": "009f6c37-e0c8-e31e-1e04-853a034d8d53",
          "code": "1820",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1820",
          "code_system": "DRUG CENTRAL",
          "references": [
            "0d965728-347e-74f1-3c01-5a9cd1b7be4d"
          ]
        },
        {
          "uuid": "63f17030-1f85-49f7-cf26-be62204b6a52",
          "code": "100000085449",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c1a37955-a85f-7dca-1cab-fe2fdc260c9e"
          ]
        },
        {
          "uuid": "f46deb7b-5b83-46f0-b703-6cd543dc9c09",
          "code": "38721",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=38721",
          "code_system": "NSC",
          "references": [
            "0f8f9ea8-00f9-0cfd-c78d-453fd5f7d84e"
          ]
        },
        {
          "uuid": "587cc8f1-d9fc-538d-ef8f-6d044da5a94e",
          "code": "78E4J5IB5J",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=78E4J5IB5J",
          "code_system": "DAILYMED",
          "references": [
            "0904f545-bbd1-302f-519a-8cd03c54cb74"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "c1bff611-5efc-4f13-8dfc-1bdcd296df83",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "971cd759-bc88-443c-9dc9-4a541762a885",
            "refuuid": "954e329a-dd45-4799-95dc-7117ad23003b",
            "name": "MITOTANE",
            "unii": "78E4J5IB5J",
            "linking_id": "78E4J5IB5J",
            "ref_pname": "MITOTANE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "088adcf4-1aad-43ed-9d5c-12e9982ecf91",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "9c272971-acaa-48d1-8cef-a2b3684e7402",
            "refuuid": "8b8cef12-f219-4052-b48e-b251e7907727",
            "name": "MITOTANE, (R)-",
            "unii": "AOV2407208",
            "linking_id": "AOV2407208",
            "ref_pname": "MITOTANE, (R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c97c4f04-8c7a-47e1-9982-a51cbef7b4f4",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "bb3e0df5-97a5-492b-935e-4ee57e745fd9",
            "refuuid": "856314f4-3628-48ea-811b-89e0f065e56d",
            "name": "MITOTANE, (S)-",
            "unii": "B2J688UBOB",
            "linking_id": "B2J688UBOB",
            "ref_pname": "MITOTANE, (S)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "da65459b-b98e-4025-a1e1-8423ec58bdf1",
          "amount": {
            "uuid": "38a07755-63ed-434d-bf2f-4c16114fe44b"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "5edf7b2e-66a0-4c79-814a-135ce89308f5"
          ],
          "related_substance": {
            "uuid": "e02c8383-3673-4819-8ae0-7f5ec2d9f4d9",
            "refuuid": "c5f92497-54a0-4407-a065-9747d9b9d164",
            "name": "O,P'-DDE",
            "unii": "DM084YLQ1L",
            "linking_id": "DM084YLQ1L",
            "ref_pname": "O,P'-DDE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e6433869-c4b6-4283-93d4-d3321a0a901a",
          "name": "(±)-1,1-DICHLORO-2-(O-CHLOROPHENYL)-2-(P-CHLOROPHENYL)ETHANE",
          "stdName": "(+/-)-1,1-DICHLORO-2-(O-CHLOROPHENYL)-2-(P-CHLOROPHENYL)ETHANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ad12572-73d0-4269-bd1c-debeb5173cff"
          ],
          "display_name": false
        },
        {
          "uuid": "fa4fcc4d-634f-4781-bc9f-a068a6ca5849",
          "name": "BENZENE, 1-CHLORO-2-(2,2-DICHLORO-1-(4-CHLOROPHENYL)ETHYL)-",
          "stdName": "BENZENE, 1-CHLORO-2-(2,2-DICHLORO-1-(4-CHLOROPHENYL)ETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a996c54c-4835-3e42-e910-83cba304f708"
          ],
          "display_name": false
        },
        {
          "uuid": "d9f5e7bc-6368-4ffe-b86b-0fb1f89af201",
          "name": "BENZENE, 1-CHLORO-2-(2,2-DICHLORO-1-(4-CHLOROPHENYL)ETHYL)-, (±)-",
          "stdName": "BENZENE, 1-CHLORO-2-(2,2-DICHLORO-1-(4-CHLOROPHENYL)ETHYL)-, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ad12572-73d0-4269-bd1c-debeb5173cff"
          ],
          "display_name": false
        },
        {
          "uuid": "9549a36f-4cf2-478c-954a-1f6967b0fd03",
          "name": "CB 313",
          "stdName": "CB 313",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3012e0a-b321-4c63-8a23-c9e7a5c15a1e"
          ],
          "display_name": false
        },
        {
          "uuid": "476f4450-bd45-4d23-8786-1fe5d89f94a1",
          "name": "CB-313",
          "stdName": "CB-313",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b687c10-57b5-455a-b556-6586aed5d043"
          ],
          "display_name": false
        },
        {
          "uuid": "1b1171d0-11b0-4e35-9fd2-1b35571690fc",
          "name": "CHLODITAN",
          "stdName": "CHLODITAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11d1ca44-6a50-405b-8133-0f218456737b"
          ],
          "display_name": false
        },
        {
          "uuid": "aed9a6e5-6ef6-4405-a22b-5a5562cf67ca",
          "name": "CHLODITHANE",
          "stdName": "CHLODITHANE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11d1ca44-6a50-405b-8133-0f218456737b"
          ],
          "display_name": false
        },
        {
          "uuid": "e7d00ed1-0bf7-4326-86b7-d3b4033788b3",
          "name": "LYSODREN",
          "stdName": "LYSODREN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3012e0a-b321-4c63-8a23-c9e7a5c15a1e"
          ],
          "display_name": false
        },
        {
          "uuid": "a3ee40a5-92e2-4a77-b65e-f1d786a043ac",
          "name": "MITOTAN",
          "stdName": "MITOTAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11d1ca44-6a50-405b-8133-0f218456737b"
          ],
          "display_name": false
        },
        {
          "uuid": "c2ce34b7-1728-4580-ac25-da8ad69c6495",
          "name": "MITOTANE",
          "stdName": "MITOTANE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "358c2ec1-1304-4e9e-ae29-dbad082ab42e",
            "2e924796-7000-4329-b309-57e4c2763304",
            "ad21d93f-5b3a-49e3-bcd7-830112b9bba6",
            "86edd5f8-a27a-4ea9-b30c-beefd9b3e75f",
            "5c5a26f9-f5a1-4d2c-9332-fc2e4a9c8707",
            "89f46a34-1f0c-4cfc-b116-87c5f164ddee",
            "760e74b0-beca-488a-8bb5-a9b9183d740c",
            "1d9d129b-8d9c-465a-932f-8cb4c7f1e4f3",
            "276cec0b-bee0-4355-9019-bf6b0e5edc86",
            "0f90d159-b3b1-44d9-ad6d-c9fe7e15a51d",
            "625978a0-28a0-4b4a-bd69-9e6d3f30f105",
            "5b5a2e75-8379-49b8-b38d-4408e2244625",
            "aacc85e5-2ed7-4fb8-9fac-b43b146a1777",
            "6ad12572-73d0-4269-bd1c-debeb5173cff",
            "2620f72f-5ba4-4a97-9d7c-0d8dacdd3732",
            "e5b6cfea-d56a-4f10-9c57-20eb9e3c3350",
            "4aaf37d1-b2dd-4a79-a0ba-fb0819b602da",
            "01a4cafd-1f17-4bbe-a05e-bca0de03ccbd",
            "9a0cd810-7f2f-419c-a865-b4be0df489f4",
            "6e5b4361-c282-4b86-a54c-b1a478f6c142",
            "a63e5d1c-a22e-4072-b7fa-1ff2bfa66f7b",
            "32d29404-6e91-4ea0-8d7b-6ceb17759e57",
            "9d5ad537-280d-4178-966f-18cafd4c1948",
            "e6a1bedb-cfe4-4a00-af08-9fe5fb577d5f",
            "504c279b-99d4-4b26-ad84-6f6a529daee7"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "06426729-b939-40b0-978d-34deab5a14e0",
              "name_org": "INN"
            },
            {
              "uuid": "757bf3f9-2984-4eff-be5a-06d7c7409d49",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "0579be82-9843-4798-a9bb-fd7eedf3f082",
          "name": "MITOTANE [EMA EPAR]",
          "stdName": "MITOTANE [EMA EPAR]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "625978a0-28a0-4b4a-bd69-9e6d3f30f105"
          ],
          "display_name": false
        },
        {
          "uuid": "9d625641-8055-4de6-8207-dbaa4807fb4f",
          "name": "MITOTANE [HSDB]",
          "stdName": "MITOTANE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5b6cfea-d56a-4f10-9c57-20eb9e3c3350"
          ],
          "display_name": false
        },
        {
          "uuid": "d27c9fa9-c389-4879-8789-55ce746f0da7",
          "name": "MITOTANE [JAN]",
          "stdName": "MITOTANE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a63e5d1c-a22e-4072-b7fa-1ff2bfa66f7b"
          ],
          "display_name": false
        },
        {
          "uuid": "978486f5-05e4-4202-8012-6a60e6e1422f",
          "name": "MITOTANE [MART.]",
          "stdName": "MITOTANE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "276cec0b-bee0-4355-9019-bf6b0e5edc86"
          ],
          "display_name": false
        },
        {
          "uuid": "16a387c0-1734-4ea1-8bb3-151ae6c7a277",
          "name": "MITOTANE [MI]",
          "stdName": "MITOTANE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9a0cd810-7f2f-419c-a865-b4be0df489f4"
          ],
          "display_name": false
        },
        {
          "uuid": "2567b2e8-2502-42e5-a413-363f93b4c147",
          "name": "MITOTANE [ORANGE BOOK]",
          "stdName": "MITOTANE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5b5a2e75-8379-49b8-b38d-4408e2244625"
          ],
          "display_name": false
        },
        {
          "uuid": "0df1ea48-1a6b-4243-a9b5-1426703b6fea",
          "name": "MITOTANE [USAN]",
          "stdName": "MITOTANE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e5b4361-c282-4b86-a54c-b1a478f6c142"
          ],
          "display_name": false
        },
        {
          "uuid": "231cc9ad-411d-56fa-360f-51e9e9ab3d1e",
          "name": "MITOTANE [USP IMPURITY]",
          "stdName": "MITOTANE [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad21d93f-5b3a-49e3-bcd7-830112b9bba6"
          ],
          "display_name": false
        },
        {
          "uuid": "e890e135-8e1d-d0ac-b715-3a1f3a49a00e",
          "name": "MITOTANE [USP MONOGRAPH]",
          "stdName": "MITOTANE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f2a82a4-95af-3a49-6f58-e9d7560195a3"
          ],
          "display_name": false
        },
        {
          "uuid": "d8e1267f-1226-4720-bdbf-4d038ed0d36d",
          "name": "MITOTANE [USP-RS]",
          "stdName": "MITOTANE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c5a26f9-f5a1-4d2c-9332-fc2e4a9c8707"
          ],
          "display_name": false
        },
        {
          "uuid": "fcbc19f5-c0e3-436f-81cc-b9fb67416c77",
          "name": "MITOTANE [VANDF]",
          "stdName": "MITOTANE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9d5ad537-280d-4178-966f-18cafd4c1948"
          ],
          "display_name": false
        },
        {
          "uuid": "00fa5087-a6eb-2e76-b17f-a4186ed1d5cd",
          "name": "Mitotane [WHO-DD]",
          "stdName": "MITOTANE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a23f45b4-b580-4f15-ae68-bac3509e051c"
          ],
          "display_name": false
        },
        {
          "uuid": "6657b0aa-d67c-40cc-b595-f7821920680f",
          "name": "NSC-38721",
          "stdName": "NSC-38721",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3012e0a-b321-4c63-8a23-c9e7a5c15a1e"
          ],
          "display_name": false
        },
        {
          "uuid": "165827d2-1b72-4cdd-b5cf-cc09db7a8087",
          "name": "O,P'-DDD",
          "stdName": "O,P'-DDD",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11d1ca44-6a50-405b-8133-0f218456737b"
          ],
          "display_name": false
        },
        {
          "uuid": "9be6658f-a4f5-8b66-3cbc-45cc3bf26f13",
          "name": "O,P'-DDD,O P'-TDE",
          "stdName": "O,P'-DDD,O P'-TDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a996c54c-4835-3e42-e910-83cba304f708"
          ],
          "display_name": false
        },
        {
          "uuid": "5e6f9405-dcd6-4e75-8863-5cf6dceeb5f4",
          "name": "O,P'-TDE",
          "stdName": "O,P'-TDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11d1ca44-6a50-405b-8133-0f218456737b"
          ],
          "display_name": false
        },
        {
          "uuid": "d1e31d01-6422-45d8-b558-4a04e28d0503",
          "name": "OPEPRIM",
          "stdName": "OPEPRIM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11d1ca44-6a50-405b-8133-0f218456737b"
          ],
          "display_name": false
        },
        {
          "uuid": "6c5765b5-9559-440e-82c4-50ef01dc644c",
          "name": "mitotane [INN]",
          "stdName": "MITOTANE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aacc85e5-2ed7-4fb8-9fac-b43b146a1777"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6ad12572-73d0-4269-bd1c-debeb5173cff",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f3012e0a-b321-4c63-8a23-c9e7a5c15a1e",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b687c10-57b5-455a-b556-6586aed5d043",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aacc85e5-2ed7-4fb8-9fac-b43b146a1777",
          "citation": "INN Proposed List 21",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL21.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6e5b4361-c282-4b86-a54c-b1a478f6c142",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad21d93f-5b3a-49e3-bcd7-830112b9bba6",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a63e5d1c-a22e-4072-b7fa-1ff2bfa66f7b",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5b5a2e75-8379-49b8-b38d-4408e2244625",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "276cec0b-bee0-4355-9019-bf6b0e5edc86",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "625978a0-28a0-4b4a-bd69-9e6d3f30f105",
          "citation": "EMA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11d1ca44-6a50-405b-8133-0f218456737b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e5b6cfea-d56a-4f10-9c57-20eb9e3c3350",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c5a26f9-f5a1-4d2c-9332-fc2e4a9c8707",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a0cd810-7f2f-419c-a865-b4be0df489f4",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01a4cafd-1f17-4bbe-a05e-bca0de03ccbd",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9d5ad537-280d-4178-966f-18cafd4c1948",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2eb29873-9cae-4273-9cf1-c44444d0f82d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391892000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "110a32eb-7410-481d-8735-51ddc0530bc5",
          "citation": "USP 36 MITOTANE MONOGRAPH",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b9067d7e-4932-4c7d-be90-72ef0fa6469e",
          "citation": "SRS import [78E4J5IB5J]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=78E4J5IB5J",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391892000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4aaf37d1-b2dd-4a79-a0ba-fb0819b602da",
          "citation": "MITOTANE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "86edd5f8-a27a-4ea9-b30c-beefd9b3e75f",
          "citation": "MITOTANE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2e924796-7000-4329-b309-57e4c2763304",
          "citation": "MITOTANE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "760e74b0-beca-488a-8bb5-a9b9183d740c",
          "citation": "MITOTANE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1d9d129b-8d9c-465a-932f-8cb4c7f1e4f3",
          "citation": "MITOTANE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "358c2ec1-1304-4e9e-ae29-dbad082ab42e",
          "citation": "MITOTANE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2620f72f-5ba4-4a97-9d7c-0d8dacdd3732",
          "citation": "MITOTANE [EMA EPAR]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "32d29404-6e91-4ea0-8d7b-6ceb17759e57",
          "citation": "MITOTANE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "89f46a34-1f0c-4cfc-b116-87c5f164ddee",
          "citation": "MITOTANE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e6a1bedb-cfe4-4a00-af08-9fe5fb577d5f",
          "citation": "MITOTANE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0f90d159-b3b1-44d9-ad6d-c9fe7e15a51d",
          "citation": "MITOTANE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "504c279b-99d4-4b26-ad84-6f6a529daee7",
          "citation": "MITOTANE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "928902a4-895b-f806-6638-0efd2f580604",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+53-19-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f850629f-e639-cddf-3315-4ae43685e717",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=53-19-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a996c54c-4835-3e42-e910-83cba304f708",
          "citation": "TKB",
          "doc_type": "TOBACCO KNOWLEDGE BASE",
          "public_domain": true
        },
        {
          "uuid": "0d965728-347e-74f1-3c01-5a9cd1b7be4d",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "31be6341-8f98-4e31-8c10-ac846d92f666",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4f2a82a4-95af-3a49-6f58-e9d7560195a3",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "5edf7b2e-66a0-4c79-814a-135ce89308f5",
          "citation": "Clin Chim Acta 1987;170(2-3):305",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a23f45b4-b580-4f15-ae68-bac3509e051c",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "0f8f9ea8-00f9-0cfd-c78d-453fd5f7d84e",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "0904f545-bbd1-302f-519a-8cd03c54cb74",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "c1a37955-a85f-7dca-1cab-fe2fdc260c9e",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ab34c261-efc9-48a1-a293-23f36f62a7fa",
          "id": "ab34c261-efc9-48a1-a293-23f36f62a7fa",
          "molfile": "\n  Marvin  01132108532D          \n\n 18 19  0  0  0  0            999 V2000\n    3.5048   -2.5223    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.1934   -2.9400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9155   -2.5377    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.1934   -3.7808    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.4920   -4.1547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4920   -4.9826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7724   -5.3926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0580   -4.9800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3411   -5.3926    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.0580   -4.1470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7802   -3.7653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9078   -4.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6273   -3.7808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3468   -4.1702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3468   -4.9903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6273   -5.4081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9078   -4.9980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1805   -5.4081    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n 12  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n 11  5  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\n 10 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 17 12  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(c(c1)C(c2ccc(cc2)Cl)C(Cl)Cl)Cl",
          "formula": "C14H10Cl4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bf840082-6fe0-4c06-90b0-7c73bccc2890"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "320.0415",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "954e329a-dd45-4799-95dc-7117ad23003b",
      "version": "27",
      "structure": {
        "id": "6d87ebc0-e9e0-49bb-a26f-f45dc7ca17ad",
        "molfile": "\n  Marvin  01132105412D          \n\n 18 19  0  0  0  0            999 V2000\n    4.1934   -3.7808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9078   -4.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1934   -2.9400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4920   -4.1547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9078   -4.9980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7802   -3.7653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4920   -4.9826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5048   -2.5223    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.9155   -2.5377    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.0580   -4.9800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1805   -5.4081    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.7724   -5.3926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0580   -4.1470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3411   -5.3926    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.6273   -3.7808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6273   -5.4081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3468   -4.1702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3468   -4.9903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  1  3  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  2  0  0  0  0\n  6  4  2  0  0  0  0\n  7  4  1  0  0  0  0\n  8  3  1  0  0  0  0\n  9  3  1  0  0  0  0\n 10 12  1  0  0  0  0\n 11  5  1  0  0  0  0\n 12  7  2  0  0  0  0\n 13  6  1  0  0  0  0\n 14 10  1  0  0  0  0\n 15  2  1  0  0  0  0\n 16  5  1  0  0  0  0\n 17 15  2  0  0  0  0\n 18 17  1  0  0  0  0\n 13 10  2  0  0  0  0\n 16 18  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(c(c1)C(c2ccc(cc2)Cl)C(Cl)Cl)Cl",
        "formula": "C14H10Cl4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "320.0415",
        "optical_activity": "( + / - )",
        "references": [
          "b9067d7e-4932-4c7d-be90-72ef0fa6469e",
          "6ad12572-73d0-4269-bd1c-debeb5173cff",
          "aacc85e5-2ed7-4fb8-9fac-b43b146a1777"
        ],
        "stereo_centers": 1
      },
      "unii": "78E4J5IB5J"
    }
  ]
}