{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f0385a41-4e1b-4ceb-ba34-c3b8edf51047",
          "code": "219714-96-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=219714-96-2",
          "code_system": "CAS",
          "references": [
            "8f1bf953-1f5d-4872-99e1-21a84d9e7fc6",
            "29d6f889-9d5d-461e-952a-2fd5c4f85298"
          ]
        },
        {
          "uuid": "66de9dcd-8104-40a3-94f0-e5141aef8321",
          "code": "C504402",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67504402",
          "code_system": "MESH",
          "references": [
            "8f1bf953-1f5d-4872-99e1-21a84d9e7fc6"
          ]
        },
        {
          "uuid": "dd217887-79ab-4911-80c8-a305e4a1fc1d",
          "code": "C007886",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67007886",
          "code_system": "MESH",
          "references": [
            "8f1bf953-1f5d-4872-99e1-21a84d9e7fc6"
          ]
        },
        {
          "uuid": "5648da6c-1161-44d0-a0b7-2411559d097d",
          "code": "119031",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3234",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "8f1bf953-1f5d-4872-99e1-21a84d9e7fc6"
          ]
        },
        {
          "uuid": "8bafaff8-e19c-435a-a73c-c63a3eab7537",
          "code": "1482792",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1482792/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "8f1bf953-1f5d-4872-99e1-21a84d9e7fc6"
          ]
        },
        {
          "uuid": "6db99e92-4516-42cc-b988-e3f4001f48c7",
          "code": "m8482",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8482?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "8f1bf953-1f5d-4872-99e1-21a84d9e7fc6"
          ]
        },
        {
          "uuid": "c4b12553-7036-4752-8614-06c251523c38",
          "code": "11784975",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11784975",
          "code_system": "PUBCHEM",
          "references": [
            "8f1bf953-1f5d-4872-99e1-21a84d9e7fc6"
          ]
        },
        {
          "uuid": "ef4eb5c7-bc8a-21be-6b7d-21c7b1b17079",
          "code": "7887",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7887",
          "code_system": "HSDB",
          "references": [
            "d1f39e10-4395-7401-4df6-41214114515f"
          ]
        },
        {
          "uuid": "e6097b06-14a4-aeb8-db8b-2d475535c862",
          "code": "DTXSID0034803",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0034803",
          "code_system": "EPA CompTox",
          "references": [
            "438a213c-dcea-1458-eb93-f8c0db25af66"
          ]
        },
        {
          "uuid": "66bdc138-d3c2-4a98-be9a-a6ac188e33a9",
          "code": "784ELC1SCZ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f9d837fd-339c-511a-06fd-d534b2d7bc93",
          "code": "784ELC1SCZ",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=784ELC1SCZ",
          "code_system": "DAILYMED",
          "references": [
            "9f93f95c-c83f-38f2-5b93-2460c88a89f6"
          ]
        },
        {
          "uuid": "38582e13-df6d-6ede-3319-de2e0a01e81d",
          "code": "penoxsulam",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/penoxsulam.html",
          "code_system": "ALANWOOD",
          "references": [
            "3b94337b-88bf-84be-402a-095bed957a3b"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "18280f15-2674-4da9-b28b-7be3e0568fdf",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "b8250bca-b7b3-4b6a-9a6d-791977261a60",
            "refuuid": "097a2379-a906-43dc-aaaa-2a7421385393",
            "name": "PENOXSULAM",
            "unii": "784ELC1SCZ",
            "linking_id": "784ELC1SCZ",
            "ref_pname": "PENOXSULAM",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "480a21c1-8528-43c6-b71f-ca75a0ca6c75",
          "name": "2-(2,2-DIFLUOROETHOXY)-N-(5,8-DIMETHOXY(1,2,4)TRIAZOLO(1,5-C)PYRIMIDIN-2-YL)-6-(TRIFLUOROMETHYL)BENZENESULFONAMIDE",
          "stdName": "2-(2,2-DIFLUOROETHOXY)-N-(5,8-DIMETHOXY(1,2,4)TRIAZOLO(1,5-C)PYRIMIDIN-2-YL)-6-(TRIFLUOROMETHYL)BENZENESULFONAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7f48ff96-b585-475f-a5e1-c547843bd819",
            "ce6fe016-5e4d-4db2-9c23-5812af319a5d"
          ],
          "display_name": false
        },
        {
          "uuid": "091b47ab-9792-42a6-9326-d370d3d32ff1",
          "name": "3-(2,2-DIFLUOROETHOXY)-N-(5,8-DIMETHOXY(1,2,4)TRIAZOLO(1,5-C)PYRIMIDIN-2-YL)-.ALPHA.,.ALPHA.,.ALPHA.-TRIFLUOROTOLUENE-2-SULFONAMIDE",
          "stdName": "3-(2,2-DIFLUOROETHOXY)-N-(5,8-DIMETHOXY(1,2,4)TRIAZOLO(1,5-C)PYRIMIDIN-2-YL)-.ALPHA.,.ALPHA.,.ALPHA.-TRIFLUOROTOLUENE-2-SULFONAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce6fe016-5e4d-4db2-9c23-5812af319a5d",
            "641290f9-128e-4234-9195-2838212a08fe"
          ],
          "display_name": false
        },
        {
          "uuid": "c1c8b3b5-92ac-452f-a3a5-c47dc06832c3",
          "name": "DE 638",
          "stdName": "DE 638",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "491f04f1-1a6c-4c83-b647-ee537bb34ada",
            "17b7ca1c-741f-4c46-9b79-fc93dceec626"
          ],
          "display_name": false
        },
        {
          "uuid": "2929b2ce-b015-4cd3-bc5a-2cd786c72fd8",
          "name": "DE-638",
          "stdName": "DE-638",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "491f04f1-1a6c-4c83-b647-ee537bb34ada",
            "17b7ca1c-741f-4c46-9b79-fc93dceec626"
          ],
          "display_name": false
        },
        {
          "uuid": "a1491565-d101-4e5a-aaf0-cc52fb5cc00c",
          "name": "GRANITE",
          "stdName": "GRANITE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "491f04f1-1a6c-4c83-b647-ee537bb34ada",
            "17b7ca1c-741f-4c46-9b79-fc93dceec626"
          ],
          "display_name": false
        },
        {
          "uuid": "4f4d3f77-9f2c-41ec-9ff1-b2633948c773",
          "name": "GRASP",
          "stdName": "GRASP",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "491f04f1-1a6c-4c83-b647-ee537bb34ada",
            "17b7ca1c-741f-4c46-9b79-fc93dceec626"
          ],
          "display_name": false
        },
        {
          "uuid": "2f6f5c66-2eab-4a42-859e-dc2533ff27a9",
          "name": "PENOXSULAM",
          "stdName": "PENOXSULAM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2cda424b-73a3-4b45-bc2d-eeb8c4230d3f",
            "f7e1898d-899b-4bfa-9247-32bfe26b2cf4",
            "ca3a3b3c-d3f4-4adc-80d6-88acfba70daa",
            "e974eb37-bea3-406e-b280-99c19fe279d4",
            "17b7ca1c-741f-4c46-9b79-fc93dceec626",
            "cb1ff10e-8dfb-4bd2-9a0b-ca3ec8882ca9"
          ],
          "display_name": true
        },
        {
          "uuid": "d5f6f000-8b06-4202-84af-756d098dc8df",
          "name": "PENOXSULAM [ISO]",
          "stdName": "PENOXSULAM [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e974eb37-bea3-406e-b280-99c19fe279d4",
            "17b7ca1c-741f-4c46-9b79-fc93dceec626"
          ],
          "display_name": false
        },
        {
          "uuid": "eb8e0e1f-93f0-4b33-99fb-8828e9c7cfe8",
          "name": "PENOXSULAM [MI]",
          "stdName": "PENOXSULAM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca3a3b3c-d3f4-4adc-80d6-88acfba70daa",
            "17b7ca1c-741f-4c46-9b79-fc93dceec626"
          ],
          "display_name": false
        },
        {
          "uuid": "164c8d0d-c09c-4090-aed2-02133878aaca",
          "name": "VIPER",
          "stdName": "VIPER",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "491f04f1-1a6c-4c83-b647-ee537bb34ada",
            "17b7ca1c-741f-4c46-9b79-fc93dceec626"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2cda424b-73a3-4b45-bc2d-eeb8c4230d3f",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ce6fe016-5e4d-4db2-9c23-5812af319a5d",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f48ff96-b585-475f-a5e1-c547843bd819",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "641290f9-128e-4234-9195-2838212a08fe",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca3a3b3c-d3f4-4adc-80d6-88acfba70daa",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "17b7ca1c-741f-4c46-9b79-fc93dceec626",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "491f04f1-1a6c-4c83-b647-ee537bb34ada",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e974eb37-bea3-406e-b280-99c19fe279d4",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f1bf953-1f5d-4872-99e1-21a84d9e7fc6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390956000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "24a8f1e5-eb41-487c-856d-15d4e08130a6",
          "citation": "SRS import [784ELC1SCZ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=784ELC1SCZ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390956000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d82ca09e-d8a7-4de2-98b3-056b04efa6f8",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f7e1898d-899b-4bfa-9247-32bfe26b2cf4",
          "citation": "PENOXSULAM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cb1ff10e-8dfb-4bd2-9a0b-ca3ec8882ca9",
          "citation": "PENOXSULAM [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d1f39e10-4395-7401-4df6-41214114515f",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+219714-96-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "438a213c-dcea-1458-eb93-f8c0db25af66",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=219714-96-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3b94337b-88bf-84be-402a-095bed957a3b",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "29d6f889-9d5d-461e-952a-2fd5c4f85298",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9f93f95c-c83f-38f2-5b93-2460c88a89f6",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a0e59424-748f-42ac-bbf2-9cc1fe572c70",
          "id": "a0e59424-748f-42ac-bbf2-9cc1fe572c70",
          "molfile": "\n  Marvin  01132108212D          \n\n 32 34  0  0  0  0            999 V2000\n    4.1803   -7.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8972   -7.2168    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8972   -6.3919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1803   -5.9794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1803   -5.1544    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8972   -4.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8972   -3.9126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1803   -3.5001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6098   -5.1544    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3948   -4.8970    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8822   -5.5670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7072   -5.5670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1196   -4.8499    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6970   -5.2899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4552   -4.4147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5322   -4.1330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5322   -3.3081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8196   -2.8956    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1025   -3.3081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3854   -2.8956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6730   -3.3081    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3854   -2.0707    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2491   -2.8956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9616   -3.3081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9616   -4.1330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2491   -4.5499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6615   -5.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2491   -5.9794    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4863   -5.2625    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0740   -5.9794    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3948   -6.2323    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6098   -5.9794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  3 32  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  6  9  1  0  0  0  0\n  7  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 32  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 31 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  2  0  0  0  0\n 13 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 16 26  2  0  0  0  0\n 17 18  1  0  0  0  0\n 23 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 23 24  1  0  0  0  0\n 25 24  2  0  0  0  0\n 26 25  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 27 29  1  0  0  0  0\n 27 30  1  0  0  0  0\n 32 31  2  0  0  0  0\nM  END",
          "smiles": "COc1cnc(n2c1nc(n2)NS(=O)(=O)c3c(cccc3OCC(F)F)C(F)(F)F)OC",
          "formula": "C16H14F5N5O5S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5c84326e-b26c-4a52-8106-7ef869081ad7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "483.3716",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "097a2379-a906-43dc-aaaa-2a7421385393",
      "version": "8",
      "structure": {
        "id": "35133c2a-3a64-48a6-b157-501d2bc07ac3",
        "molfile": "\n  Marvin  01132102502D          \n\n 32 34  0  0  0  0            999 V2000\n    4.8972   -4.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1803   -5.1544    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1803   -5.9794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8972   -6.3919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6098   -5.9794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3948   -6.2323    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8822   -5.5670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3948   -4.8970    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6098   -5.1544    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7072   -5.5670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1196   -4.8499    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6970   -5.2899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4552   -4.4147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5322   -4.1330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5322   -3.3081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2491   -2.8956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9616   -3.3081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9616   -4.1330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2491   -4.5499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6615   -5.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2491   -5.9794    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4863   -5.2625    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0740   -5.9794    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8196   -2.8956    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1025   -3.3081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3854   -2.8956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6730   -3.3081    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3854   -2.0707    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8972   -7.2168    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1803   -7.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8972   -3.9126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1803   -3.5001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n  1  9  1  0  0  0  0\n  9  5  1  0  0  0  0\n  7 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  2  0  0  0  0\n 11 14  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 14 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 20 23  1  0  0  0  0\n 15 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 26 28  1  0  0  0  0\n  4 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n  1 31  1  0  0  0  0\n 31 32  1  0  0  0  0\nM  END",
        "smiles": "COc1cnc(n2c1nc(n2)NS(=O)(=O)c3c(cccc3OCC(F)F)C(F)(F)F)OC",
        "formula": "C16H14F5N5O5S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "483.3716",
        "optical_activity": "NONE",
        "references": [
          "d82ca09e-d8a7-4de2-98b3-056b04efa6f8",
          "24a8f1e5-eb41-487c-856d-15d4e08130a6"
        ],
        "stereo_centers": 0
      },
      "unii": "784ELC1SCZ"
    }
  ]
}