{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "cbe7a18c-2e29-4425-a1f1-3595087a67f3",
          "code": "131-54-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=131-54-4",
          "code_system": "CAS",
          "references": [
            "cb361802-7a6e-4cac-93fb-755aaad71a26",
            "2779cadd-779d-46f6-ba25-824708349ec2"
          ]
        },
        {
          "uuid": "ea18eac8-ef1a-4cee-b058-5d499a48c33a",
          "code": "205-027-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.572",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "cb361802-7a6e-4cac-93fb-755aaad71a26"
          ]
        },
        {
          "uuid": "92802140-1acb-4f2e-a962-83721781eacd",
          "code": "m2371",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2371?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "cb361802-7a6e-4cac-93fb-755aaad71a26"
          ]
        },
        {
          "uuid": "125d13b0-0ae5-43b2-afe0-a30671d78445",
          "code": "8570",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8570",
          "code_system": "PUBCHEM",
          "references": [
            "cb361802-7a6e-4cac-93fb-755aaad71a26"
          ]
        },
        {
          "uuid": "08a26770-4175-25c7-e197-80fbab1db2fe",
          "code": "DTXSID6038875",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6038875",
          "code_system": "EPA CompTox",
          "references": [
            "46f29520-9f6b-7dda-72f2-0878414a7d42"
          ]
        },
        {
          "uuid": "88382739-3473-4891-8a55-da8e7f87e1bb",
          "code": "SUB12675MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "ed0280be-d453-ba48-df0c-35b3f6a83505"
          ]
        },
        {
          "uuid": "c1bf2193-b065-4871-b645-ceb43aab9e51",
          "code": "7813J9CS1G",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ecec43dd-f516-eaf0-7dda-cb2c4cb3cd53",
          "code": "100000078252",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "be282f78-abec-59ac-f8e0-2250f5bd8bea"
          ]
        },
        {
          "uuid": "0651aef1-7716-9780-569d-f4b4a477df66",
          "code": "40149",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=40149",
          "code_system": "NSC",
          "references": [
            "d59d51fd-ef4a-7b64-ecc0-6563d5de315f"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "d38c5a30-f49a-4d44-9f23-a5495492a421",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "b2a68925-9c7a-463f-9a62-b967e676042f",
            "refuuid": "e82483c0-eb0b-4a25-9f97-9ecc7f0434d3",
            "name": "BENZOPHENONE-6",
            "unii": "7813J9CS1G",
            "linking_id": "7813J9CS1G",
            "ref_pname": "BENZOPHENONE-6",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "24e280ae-0e73-4c80-9ace-117ece3c19ae",
          "name": "2,2'-DIHYDROXY-4,4'-DIMETHOXYBENZOPHENONE",
          "stdName": "2,2'-DIHYDROXY-4,4'-DIMETHOXYBENZOPHENONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "640f3e07-d8a9-49bf-9096-7a470e133590",
            "8498c7df-af68-46da-9762-870b3e1c9f00"
          ],
          "display_name": false
        },
        {
          "uuid": "1a1aeb59-2593-464f-ae07-a764742b1f48",
          "name": "BENZOPHENONE 6",
          "stdName": "BENZOPHENONE 6",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8498c7df-af68-46da-9762-870b3e1c9f00",
            "6adabe3a-c99f-4513-8679-2132aff8d45f"
          ],
          "display_name": false
        },
        {
          "uuid": "1bc77d05-a317-42fe-9d29-4d1ac6c4c850",
          "name": "BENZOPHENONE-6",
          "stdName": "BENZOPHENONE-6",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8498c7df-af68-46da-9762-870b3e1c9f00",
            "2c303e96-6f18-4030-8bda-b500da1a1fa1",
            "e5a0ddbf-2894-4fe7-8cbe-ec27168985c2",
            "39df37a2-e3ae-4bfe-bc1a-b7e14a671369",
            "640f3e07-d8a9-49bf-9096-7a470e133590",
            "545de24c-effe-4ef2-9f23-889dbf655124",
            "16f73f63-3574-4a67-8713-6c5c19cde3db",
            "38c11dff-40bc-43fe-b8c6-72252e29d3f6",
            "5bde30ac-130a-4566-9d4b-4f6f0e3ad506",
            "9021b30b-dbd9-48df-a76d-279cc56e4d0c"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "4fa84944-4475-4dfc-9285-a5f4ac98077a",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "f88e5704-cca8-4d9f-b59a-dd55de23c9e9",
          "name": "BENZOPHENONE-6 [MART.]",
          "stdName": "BENZOPHENONE-6 [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38c11dff-40bc-43fe-b8c6-72252e29d3f6"
          ],
          "display_name": false
        },
        {
          "uuid": "ef1b5330-39e1-4faf-9a12-9138f0c7aeff",
          "name": "BENZOPHENONE-6 [MI]",
          "stdName": "BENZOPHENONE-6 [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8498c7df-af68-46da-9762-870b3e1c9f00",
            "9021b30b-dbd9-48df-a76d-279cc56e4d0c"
          ],
          "display_name": false
        },
        {
          "uuid": "52032573-cb1b-4b7e-b28b-9f8441db87a3",
          "name": "BIS(2-HYDROXY-4-METHOXYPHENYL)METHANONE",
          "stdName": "BIS(2-HYDROXY-4-METHOXYPHENYL)METHANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "640f3e07-d8a9-49bf-9096-7a470e133590",
            "8498c7df-af68-46da-9762-870b3e1c9f00"
          ],
          "display_name": false
        },
        {
          "uuid": "0c966a1d-baca-be9c-f299-199df0ee5562",
          "name": "Benzophenone-6 [WHO-DD]",
          "stdName": "BENZOPHENONE-6 [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7afe30f5-bb55-f62c-09dc-1e21c840414f"
          ],
          "display_name": false
        },
        {
          "uuid": "ca80fed9-a160-4e31-93bc-5ba0201f526a",
          "name": "HELISORB 11",
          "stdName": "HELISORB 11",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "640f3e07-d8a9-49bf-9096-7a470e133590",
            "8498c7df-af68-46da-9762-870b3e1c9f00"
          ],
          "display_name": false
        },
        {
          "uuid": "747f15ba-14d2-4bdb-917e-367cc930e984",
          "name": "METHANONE, BIS(2-HYDROXY-4-METHOXYPHENYL)-",
          "stdName": "METHANONE, BIS(2-HYDROXY-4-METHOXYPHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "640f3e07-d8a9-49bf-9096-7a470e133590",
            "8498c7df-af68-46da-9762-870b3e1c9f00"
          ],
          "display_name": false
        },
        {
          "uuid": "8bf2c8a1-708a-43ca-a4aa-8fa65177519f",
          "name": "NSC-40149",
          "stdName": "NSC-40149",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7b8433f0-b23a-4261-b71a-3e058865a10c",
            "8498c7df-af68-46da-9762-870b3e1c9f00"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "640f3e07-d8a9-49bf-9096-7a470e133590",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8498c7df-af68-46da-9762-870b3e1c9f00",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38c11dff-40bc-43fe-b8c6-72252e29d3f6",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9021b30b-dbd9-48df-a76d-279cc56e4d0c",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "39df37a2-e3ae-4bfe-bc1a-b7e14a671369",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6adabe3a-c99f-4513-8679-2132aff8d45f",
          "citation": "SWISS MEDIC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e5a0ddbf-2894-4fe7-8cbe-ec27168985c2",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7b8433f0-b23a-4261-b71a-3e058865a10c",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb361802-7a6e-4cac-93fb-755aaad71a26",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390811000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1abff187-703a-485f-8c3f-85a5455f1e90",
          "citation": "SRS import [7813J9CS1G]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7813J9CS1G",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390811000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "16f73f63-3574-4a67-8713-6c5c19cde3db",
          "citation": "BENZOPHENONE-6 [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2c303e96-6f18-4030-8bda-b500da1a1fa1",
          "citation": "BENZOPHENONE-6 [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5bde30ac-130a-4566-9d4b-4f6f0e3ad506",
          "citation": "BENZOPHENONE-6 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "545de24c-effe-4ef2-9f23-889dbf655124",
          "citation": "BENZOPHENONE-6 [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "46f29520-9f6b-7dda-72f2-0878414a7d42",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=131-54-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ed0280be-d453-ba48-df0c-35b3f6a83505",
          "citation": "EVMPD",
          "doc_type": "EVMPD",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2779cadd-779d-46f6-ba25-824708349ec2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7afe30f5-bb55-f62c-09dc-1e21c840414f",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d59d51fd-ef4a-7b64-ecc0-6563d5de315f",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "7d552b05-99f6-52de-4c18-09c0bbe4cbcc",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "be282f78-abec-59ac-f8e0-2250f5bd8bea",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "73ae111b-7282-48ab-9595-a52f6cbeaeb1",
          "id": "73ae111b-7282-48ab-9595-a52f6cbeaeb1",
          "molfile": "\n  Marvin  01132106002D          \n\n 20 21  0  0  0  0            999 V2000\n    3.8222    2.6800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0218    2.4636    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0218    1.6348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3126    1.2133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3126    0.3930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0218   -0.0285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0218   -0.8573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3126   -1.2731    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7310   -1.2788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4402   -0.8573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1494   -1.2788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1494   -2.1076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8642   -2.5234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5791   -2.1076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4402   -2.5234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7310   -2.1076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0218   -2.5234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7310    0.3930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4402   -0.0285    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7310    1.2133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 20  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n 18  6  2  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 16  9  2  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 15  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 18  1  0  0  0  0\nM  END",
          "smiles": "COc1ccc(c(c1)O)C(=O)c2ccc(cc2O)OC",
          "formula": "C15H14O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cedfc4f5-5a72-4e0f-a130-8288d6850c2e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "274.2692",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e82483c0-eb0b-4a25-9f97-9ecc7f0434d3",
      "version": "11",
      "structure": {
        "id": "95fce122-1776-4949-8a52-14e3e91d27c6",
        "molfile": "\n  Marvin  01132107472D          \n\n 20 21  0  0  0  0            999 V2000\n    3.0218   -0.8573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0218   -0.0285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7310   -1.2788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7310    0.3930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7310   -2.1076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4402   -0.8573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3126    0.3930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4402   -2.5234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7310    1.2133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3126   -1.2731    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1494   -2.1076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0218    1.6348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4402   -0.0285    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0218   -2.5234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1494   -1.2788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3126    1.2133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0218    2.4636    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8642   -2.5234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8222    2.6800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5791   -2.1076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  2  0  0  0  0\n  5  3  2  0  0  0  0\n  6  3  1  0  0  0  0\n  7  2  1  0  0  0  0\n  8  5  1  0  0  0  0\n  9  4  1  0  0  0  0\n 10  1  2  0  0  0  0\n 11 15  1  0  0  0  0\n 12 16  1  0  0  0  0\n 13  4  1  0  0  0  0\n 14  5  1  0  0  0  0\n 15  6  2  0  0  0  0\n 16  7  2  0  0  0  0\n 17 12  1  0  0  0  0\n 18 11  1  0  0  0  0\n 11  8  2  0  0  0  0\n 12  9  2  0  0  0  0\n 17 19  1  0  0  0  0\n  2  1  1  0  0  0  0\n 18 20  1  0  0  0  0\nM  END",
        "smiles": "COc1ccc(c(c1)O)C(=O)c2ccc(cc2O)OC",
        "formula": "C15H14O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "274.2692",
        "optical_activity": "NONE",
        "references": [
          "1abff187-703a-485f-8c3f-85a5455f1e90",
          "39df37a2-e3ae-4bfe-bc1a-b7e14a671369"
        ],
        "stereo_centers": 0
      },
      "unii": "7813J9CS1G"
    }
  ]
}