{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7e44e0b2-d020-4e81-bc23-7f34a3db7b78",
          "code": "QC03AB04",
          "comments": "VATC|DIURETICS|LOW-CEILING DIURETICS, THIAZIDES|Thiazides and potassium in combination|chlorothiazide and potassium",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC03AB04&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "98878c9c-3715-4f0d-893b-3d5d8453007d"
          ]
        },
        {
          "uuid": "8d22dbb1-4d19-4bd3-913e-3734bcefa9d2",
          "code": "58-94-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=58-94-6",
          "code_system": "CAS",
          "references": [
            "98878c9c-3715-4f0d-893b-3d5d8453007d",
            "bbc8d455-c006-44ae-b2ab-587f6b863f34"
          ]
        },
        {
          "uuid": "f76744fb-3493-4172-a78c-b8f8146bd0e2",
          "code": "C28924",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28924",
          "code_system": "NCI_THESAURUS",
          "references": [
            "98878c9c-3715-4f0d-893b-3d5d8453007d"
          ]
        },
        {
          "uuid": "57948a29-09fe-4fdc-b94a-8c1352aeac57",
          "code": "D002740",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68002740",
          "code_system": "MESH",
          "references": [
            "98878c9c-3715-4f0d-893b-3d5d8453007d"
          ]
        },
        {
          "uuid": "bb375346-fb24-4f1f-b995-e7ad1ed23f86",
          "code": "194",
          "comments": "LiverTox|Cardiac|Diuretic|Thiazide",
          "type": "PRIMARY",
          "url": "https://livertox.nlm.nih.gov/ThiazideDiuretics.htm",
          "code_system": "LIVERTOX",
          "references": [
            "98878c9c-3715-4f0d-893b-3d5d8453007d"
          ]
        },
        {
          "uuid": "6c0ea49b-20e4-4dc3-81f4-c91663e6a24c",
          "code": "CHLOROTHIAZIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Chlorothiazide",
          "code_system": "WIKIPEDIA",
          "references": [
            "98878c9c-3715-4f0d-893b-3d5d8453007d"
          ]
        },
        {
          "uuid": "33a2bdaa-f99a-4c8f-8e11-230de3810461",
          "code": "C03AB04",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|DIURETICS|LOW-CEILING DIURETICS, THIAZIDES|Thiazides and potassium in combination|chlorothiazide and potassium",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C03AB04&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "98878c9c-3715-4f0d-893b-3d5d8453007d"
          ]
        },
        {
          "uuid": "f8b3676e-9b24-4929-8fdc-43dbd40b0e3d",
          "code": "C03AH01",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|DIURETICS|LOW-CEILING DIURETICS, THIAZIDES|Thiazides, combinations with psycholeptics and/or analgesics|chlorothiazide, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C03AH01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "98878c9c-3715-4f0d-893b-3d5d8453007d"
          ]
        },
        {
          "uuid": "3b97d44b-2acd-43ec-b782-bbc481d4163b",
          "code": "SUB06198MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "98878c9c-3715-4f0d-893b-3d5d8453007d"
          ]
        },
        {
          "uuid": "2fa14577-0817-4123-bfa3-12d313947525",
          "code": "636",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=636",
          "code_system": "INN",
          "references": [
            "98878c9c-3715-4f0d-893b-3d5d8453007d"
          ]
        },
        {
          "uuid": "7f55d900-fe94-41d0-8d8b-a5e2f33c534f",
          "code": "200-404-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.368",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "98878c9c-3715-4f0d-893b-3d5d8453007d"
          ]
        },
        {
          "uuid": "f14d9272-d1cc-4421-b875-fdfae926d91e",
          "code": "4835",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=4835",
          "code_system": "IUPHAR",
          "references": [
            "98878c9c-3715-4f0d-893b-3d5d8453007d"
          ]
        },
        {
          "uuid": "ee1fa10b-fb01-4fd2-aa69-cdab89560024",
          "code": "2396",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2396/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "98878c9c-3715-4f0d-893b-3d5d8453007d"
          ]
        },
        {
          "uuid": "ada1e36d-791b-44ec-86c3-8f39d56bf3d7",
          "code": "m3441",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3441?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "98878c9c-3715-4f0d-893b-3d5d8453007d"
          ]
        },
        {
          "uuid": "7fb486d2-c6f4-4026-9e2a-b526d292c449",
          "code": "DB00880",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00880",
          "code_system": "DRUG BANK",
          "references": [
            "98878c9c-3715-4f0d-893b-3d5d8453007d"
          ]
        },
        {
          "uuid": "ac4ee7ce-1c75-458e-9c4f-1e41d7091967",
          "code": "21 CFR 520.420",
          "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 520 ORAL DOSAGE FORM NEW ANIMAL DRUGS|Sec. 520.420 Chlorothiazide tablets and boluses.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=520.420",
          "code_system": "CFR",
          "references": [
            "98878c9c-3715-4f0d-893b-3d5d8453007d"
          ]
        },
        {
          "uuid": "a5ca562c-6f24-4b3f-8866-ad0a66af2ebb",
          "code": "CHEMBL842",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL842",
          "code_system": "ChEMBL",
          "references": [
            "98878c9c-3715-4f0d-893b-3d5d8453007d"
          ]
        },
        {
          "uuid": "f8597668-8e24-4942-b963-95b69342b363",
          "code": "2720",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2720",
          "code_system": "PUBCHEM",
          "references": [
            "98878c9c-3715-4f0d-893b-3d5d8453007d"
          ]
        },
        {
          "uuid": "6084b31e-71a7-4649-ae45-7fe668f165a3",
          "code": "N0000166469",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Organic Chemicals [Chemical/Ingredient]|Sulfur Compounds [Chemical/Ingredient]|Thiazides [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000166469",
          "code_system": "NDF-RT",
          "references": [
            "98878c9c-3715-4f0d-893b-3d5d8453007d"
          ]
        },
        {
          "uuid": "b126a21b-046a-4999-a0c8-a4bb894fb4f4",
          "code": "N0000166469",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Inorganic Chemicals [Chemical/Ingredient]|Sulfur Compounds [Chemical/Ingredient]|Thiazides [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000166469",
          "code_system": "NDF-RT",
          "references": [
            "98878c9c-3715-4f0d-893b-3d5d8453007d"
          ]
        },
        {
          "uuid": "48311dc1-f0ad-4aa5-8ff5-f75041cca81a",
          "code": "C03AA04",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|DIURETICS|LOW-CEILING DIURETICS, THIAZIDES|Thiazides, plain|chlorothiazide",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C03AA04&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "98878c9c-3715-4f0d-893b-3d5d8453007d"
          ]
        },
        {
          "uuid": "9c5fdd5b-c3bd-49df-9a7f-6b625353092f",
          "code": "N0000175419",
          "comments": "Established Pharmacologic Class [EPC]|Thiazide Diuretic [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175419",
          "code_system": "NDF-RT",
          "references": [
            "98878c9c-3715-4f0d-893b-3d5d8453007d"
          ]
        },
        {
          "uuid": "cf3c875b-7f51-4bf9-9bf7-5401a459483e",
          "code": "N0000175359",
          "comments": "Physiological Effects [PE]|Organ System Specific Effects [PE]|Renal/Urological Activity Alteration [PE]|Diuresis Alteration [PE]|Increased Diuresis [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175359",
          "code_system": "NDF-RT",
          "references": [
            "98878c9c-3715-4f0d-893b-3d5d8453007d"
          ]
        },
        {
          "uuid": "c3e13569-3116-45a0-8a1a-85a3bca1f920",
          "code": "QC03AH01",
          "comments": "VATC|DIURETICS|LOW-CEILING DIURETICS, THIAZIDES|Thiazides, combinations with psycholeptics and/or analgesics|chlorothiazide, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC03AH01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "98878c9c-3715-4f0d-893b-3d5d8453007d"
          ]
        },
        {
          "uuid": "aec54149-1127-49d5-be81-5a016a2fe21f",
          "code": "QC03AA04",
          "comments": "VATC|DIURETICS|LOW-CEILING DIURETICS, THIAZIDES|Thiazides, plain|chlorothiazide",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC03AA04&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "98878c9c-3715-4f0d-893b-3d5d8453007d"
          ]
        },
        {
          "uuid": "740bc6d7-9ee9-ab0e-a1dd-6a2576db822f",
          "code": "3030",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3030",
          "code_system": "HSDB",
          "references": [
            "2ae168d7-4014-c33b-7a68-c65dfb28223e"
          ]
        },
        {
          "uuid": "82a6ac09-b927-db00-289c-29149921a88b",
          "code": "DTXSID0022800",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0022800",
          "code_system": "EPA CompTox",
          "references": [
            "536375d9-66cf-b6cc-001f-ec3663fa7950"
          ]
        },
        {
          "uuid": "987c2974-9d9e-a98d-78d0-3a5a1193b5b3",
          "code": "C49185",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Blood or Body Fluid[C78275]|Diuretic[C448]|Thiazide Diuretic",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C49185",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5740be30-a4d2-61b8-5139-0ebed4c0ed3a"
          ]
        },
        {
          "uuid": "0fb6d128-c03c-4909-9cf3-45eca7456c86",
          "code": "77W477J15H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "86426187-e63f-65b7-6fdf-d7fc04786dcd",
          "code": "Chlorothiazide",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM63/",
          "code_system": "LACTMED",
          "references": [
            "5740be30-a4d2-61b8-5139-0ebed4c0ed3a"
          ]
        },
        {
          "uuid": "ae854d17-85f6-27c4-8c00-59b8f764bfcc",
          "code": "609",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/609",
          "code_system": "DRUG CENTRAL",
          "references": [
            "5740be30-a4d2-61b8-5139-0ebed4c0ed3a"
          ]
        },
        {
          "uuid": "13d6196b-766d-4ca2-4f0e-4ec85430aa90",
          "code": "3640",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3640",
          "code_system": "CHEBI",
          "references": [
            "5740be30-a4d2-61b8-5139-0ebed4c0ed3a"
          ]
        },
        {
          "uuid": "c82e8dec-00e3-0825-7166-c9ec4beae3bf",
          "code": "1121005",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1121005",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "5740be30-a4d2-61b8-5139-0ebed4c0ed3a"
          ]
        },
        {
          "uuid": "db791071-6745-c19a-4ca3-99c282f30122",
          "code": "100000081850",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "9f62fd37-d841-af33-7443-7cc3f198bb4c"
          ]
        },
        {
          "uuid": "f7109cbe-7b14-44e2-db7e-6dd1af9403b8",
          "code": "25693",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=25693",
          "code_system": "NSC",
          "references": [
            "0d37e7c6-a72f-9835-23f5-18ab66f13ca9"
          ]
        },
        {
          "uuid": "7f17894a-b044-523f-b215-5a6728eec07d",
          "code": "77W477J15H",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=77W477J15H",
          "code_system": "DAILYMED",
          "references": [
            "9bb167bb-6ad2-ed18-9c75-3aeb843f01cf"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "77ee62dc-3ab8-4d8f-9b96-ad75759e95a5",
          "citation": "usp dictionary 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a71f00f0-4cd3-48dd-8db5-081e625ba925",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c60cd921-d76c-4463-b869-82ab37283277",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cefda36f-9a26-47b5-9602-9f73cb64fdf2",
          "citation": "INN Proposed List 8",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL08.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "292e6a4c-e54b-4abf-96d8-099b79790966",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ac280b0-4c98-4969-b7e6-ce00ad45d1fb",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4fb8a12b-9e21-4d69-ba31-7c00909f6fec",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f9cf44ba-52ca-4fc3-bb8d-5484dbab7368",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f9958d9c-0579-4598-a36f-a4c3e653e2e6",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "88d5a747-3b9e-4c7d-9e9b-b269ac790b9b",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d39630f-1cec-4033-9f01-362ed6b3f5e3",
          "citation": "FDA SRS 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38a1de09-8667-4470-a5c8-9a2a57b027cf",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33e703f3-8c6b-4120-bd25-fb2bda4d283d",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1280e53a-8337-4fce-8ef3-8214efb72773",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3a2cba77-e398-4510-9cd6-33017ccc4fd3",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b519204a-fd04-4dca-a2a7-70accd24ce91",
          "citation": "EP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2e7fef55-ad14-4b48-8650-3777c19e6c44",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "98878c9c-3715-4f0d-893b-3d5d8453007d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389721000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "58aaf95f-f0d6-4c46-a131-43b38c6710ae",
          "citation": "SRS import [77W477J15H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=77W477J15H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389721000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "45dfb5e8-104e-4f24-8d6e-95270262e585",
          "citation": "CHLOROTHIAZIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "28dc3ca6-6526-42f9-945b-9b258a03645c",
          "citation": "CHLOROTHIAZIDE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1c1d0210-9655-462e-b911-fbaea3734f86",
          "citation": "CHLOROTHIAZIDE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e6954e8c-6bbc-4a54-aed4-5f485c8d756f",
          "citation": "CHLOROTHIAZIDE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d37d81cc-fc6f-4da4-9e85-eee29e2a83c0",
          "citation": "CHLOROTHIAZIDE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9363ef9d-f0bc-4094-a934-602612777bdc",
          "citation": "CHLOROTHIAZIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "86bed9c5-ccc0-4795-8844-bec1b09545ee",
          "citation": "CHLOROTHIAZIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d512a7e2-87ea-4ca3-98a1-ee09fa2f95c4",
          "citation": "CHLOROTHIAZIDE [GREEN BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "06891387-ae12-4edb-a87c-e4acb81463a0",
          "citation": "CHLOROTHIAZIDE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b00303eb-1243-4cd3-9da7-c7034b037f48",
          "citation": "CHLOROTHIAZIDE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "38296f4b-64ab-45c8-a130-fb239be9dca5",
          "citation": "CHLOROTHIAZIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c924933d-ad72-4c00-8de5-73cfb36851c9",
          "citation": "CHLOROTHIAZIDE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2ae168d7-4014-c33b-7a68-c65dfb28223e",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+58-94-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "536375d9-66cf-b6cc-001f-ec3663fa7950",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=58-94-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4b157e80-4724-25a8-ee14-22fd4ffda3e6",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+58-94-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d01fa367-5975-009a-6179-fe4b7c6ac45f",
          "citation": "https://www.clinicalkey.com/pharmacology/monograph/1249?sec=monphar",
          "doc_type": "LEPINDEX",
          "public_domain": true
        },
        {
          "uuid": "2c22a88e-dc82-43cd-b2be-91d38d9f0312",
          "citation": "Organic Chemistry of Drug Degradation, Min Li, 2012, ISBN 978‐1‐84973‐421‐9",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fa275b81-723b-cc53-4926-03b29d6602a1",
          "citation": "EPU",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "1bbfc82f-d136-3316-e3f1-d838fb29f058",
          "citation": "EP",
          "url": "http://online6.edqm.eu/ep907/mobile/#documentPage",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5740be30-a4d2-61b8-5139-0ebed4c0ed3a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "bbc8d455-c006-44ae-b2ab-587f6b863f34",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8e2b125d-f8c6-6696-1b3a-dcb2436707d7",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "f421f6a8-67bd-985d-24dd-69d1fc77f54a",
          "citation": "EP 10.6",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "686a0887-0feb-458e-890b-05e5fa6fee68",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1afbfacf-ec39-4521-83e2-ea3ef7bbda0d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "12d9ac88-85b4-0261-c0e7-6e7fb13a0214",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "0d37e7c6-a72f-9835-23f5-18ab66f13ca9",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "9bb167bb-6ad2-ed18-9c75-3aeb843f01cf",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "9f62fd37-d841-af33-7443-7cc3f198bb4c",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "99a0db6a-5af1-4af4-8fc0-f1892c453516",
          "id": "99a0db6a-5af1-4af4-8fc0-f1892c453516",
          "molfile": "\n  Marvin  01132107592D          \n\n 17 18  0  0  0  0            999 V2000\n    4.4357   -6.4318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1501   -6.0192    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5627   -6.7334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7375   -5.3048    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8644   -5.6066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5786   -6.0192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2930   -5.6066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2930   -4.7814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0073   -4.3688    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7215   -4.7814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7215   -5.6066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0073   -6.0192    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5383   -6.6509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4762   -6.6509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5786   -4.3688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8644   -4.7814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1501   -4.3688    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  2  0  0  0  0\n  5  2  1  0  0  0  0\n  5  6  1  0  0  0  0\n 16  5  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n 12  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 15  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "c1c(c(cc2c1NC=NS2(=O)=O)S(=O)(=O)N)Cl",
          "formula": "C7H6ClN3O4S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "664dbf76-e426-4f2f-bb75-a11a1957d8a6"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "295.7256",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ec9dc6b4-c86d-42a6-9875-66f794903fcc",
      "version": "48",
      "structure": {
        "id": "f804deb2-1b05-46ef-9675-b86e879302a5",
        "molfile": "\n  Marvin  01132112512D          \n\n 17 18  0  0  0  0            999 V2000\n    8.0073   -6.0192    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7215   -5.6066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7215   -4.7814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0073   -4.3688    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2930   -4.7814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2930   -5.6066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5786   -6.0192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8644   -5.6066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8644   -4.7814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5786   -4.3688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1501   -4.3688    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.1501   -6.0192    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5627   -6.7334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7375   -5.3048    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4357   -6.4318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5383   -6.6509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4762   -6.6509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n  5 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n  8 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  2  0  0  0  0\n 12 15  1  0  0  0  0\n  1 16  2  0  0  0  0\n  1 17  2  0  0  0  0\nM  END",
        "smiles": "c1c(c(cc2c1N=CNS2(=O)=O)S(=O)(=O)N)Cl",
        "formula": "C7H6ClN3O4S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "295.7256",
        "optical_activity": "NONE",
        "references": [
          "a71f00f0-4cd3-48dd-8db5-081e625ba925",
          "58aaf95f-f0d6-4c46-a131-43b38c6710ae",
          "cefda36f-9a26-47b5-9602-9f73cb64fdf2"
        ],
        "stereo_centers": 0
      },
      "unii": "77W477J15H",
      "relationships": [
        {
          "uuid": "ed3576c0-2eb1-4c48-a85b-29ce82300c13",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "adb603b2-5a56-4a71-afcd-5788ec89c898",
            "refuuid": "ec9dc6b4-c86d-42a6-9875-66f794903fcc",
            "name": "CHLOROTHIAZIDE",
            "unii": "77W477J15H",
            "linking_id": "77W477J15H",
            "ref_pname": "CHLOROTHIAZIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e2005dbc-148e-4e40-a19e-8049793a84ac",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "37c9b29e-18bb-4411-bdde-5042a21fb9ca",
            "refuuid": "f600980a-725d-4a38-bc19-89d63e0dd15f",
            "name": "CHLOROTHIAZIDE SODIUM",
            "unii": "SN86FG7N2K",
            "linking_id": "SN86FG7N2K",
            "ref_pname": "CHLOROTHIAZIDE SODIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7a3a48cc-205d-4cc9-8cd4-4ebf81dca75e",
          "type": "DEGRADENT->PARENT",
          "related_substance": {
            "uuid": "1938db4b-8a28-4dd9-93d8-103bc2603f99",
            "refuuid": "1c80a3fc-d526-48a2-be6c-985bae83b002",
            "name": "N-(2-AMINO-4-CHLORO-5-SULFAMOYL-PHENYL)SULFONYLFORMAMIDE",
            "unii": "FP87NW6U02",
            "linking_id": "FP87NW6U02",
            "ref_pname": "N-(2-AMINO-4-CHLORO-5-SULFAMOYL-PHENYL)SULFONYLFORMAMIDE"
          }
        },
        {
          "uuid": "98f0e041-f083-43e1-ac4e-32679ff835be",
          "type": "TARGET->INHIBITOR",
          "references": [
            "2ae168d7-4014-c33b-7a68-c65dfb28223e"
          ],
          "related_substance": {
            "uuid": "d53c1381-e6af-4f30-8a5e-e9da2181dfde",
            "refuuid": "5d9ea0eb-14a9-410c-9d98-5b22af37df6a",
            "name": "CARBONIC ANHYDRASE 1",
            "unii": "31F7ZV0E20",
            "linking_id": "31F7ZV0E20",
            "ref_pname": "CARBONIC ANHYDRASE 1",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f754f922-3135-4662-9904-7dbfda7e49ef",
          "amount": {
            "uuid": "d77a93b1-085c-4394-bc50-819c17c62030"
          },
          "comments": "Produced thru Hydrolytic degradation in acidic conditions.",
          "type": "DEGRADENT->PARENT",
          "references": [
            "2c22a88e-dc82-43cd-b2be-91d38d9f0312"
          ],
          "related_substance": {
            "uuid": "9c43acd4-2562-47e2-88bb-9a43959c5bb5",
            "refuuid": "cb9ce2c7-c62b-4e6a-9fa9-6a12c544ff6d",
            "name": "4-Chloro-6-(formylamino)-1,3-benzenedisulfonamide",
            "unii": "Y14C9ND9HE",
            "linking_id": "Y14C9ND9HE",
            "ref_pname": "4-Chloro-6-(formylamino)-1,3-benzenedisulfonamide"
          }
        },
        {
          "uuid": "a7317079-f247-4686-b3e2-d780b2c483e9",
          "amount": {
            "uuid": "c912fb78-0fc8-4116-9944-a5e3853a5208",
            "type": "WEIGHT PERCENT",
            "units": "%",
            "high_limit": 0.5,
            "non_numeric_value": "peak area"
          },
          "qualification": "EP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "fa275b81-723b-cc53-4926-03b29d6602a1"
          ],
          "related_substance": {
            "uuid": "6ff60927-abec-4416-8b30-538550d185f5",
            "refuuid": "ec9dc6b4-c86d-42a6-9875-66f794903fcc",
            "name": "CHLOROTHIAZIDE",
            "unii": "77W477J15H",
            "linking_id": "77W477J15H",
            "ref_pname": "CHLOROTHIAZIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "004b6f5f-11b2-490d-a723-f04f313c733c",
          "amount": {
            "uuid": "9381c3ef-9ac1-4f4c-b1d5-129123cc206d"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "1afbfacf-ec39-4521-83e2-ea3ef7bbda0d"
          ],
          "related_substance": {
            "uuid": "0b6bbffc-b2b9-4cc2-8bf7-7745c3edd888",
            "refuuid": "ca468007-c106-4747-85fe-1e781965cc12",
            "name": "CHLOROTHIAZIDE HYDROCHLORIDE",
            "unii": "JCS5G4J7AC",
            "linking_id": "JCS5G4J7AC",
            "ref_pname": "CHLOROTHIAZIDE HYDROCHLORIDE"
          }
        }
      ],
      "names": [
        {
          "uuid": "968f6316-5212-4e49-a3b8-d8d35d5f25be",
          "name": "2H-1,2,4-BENZOTHIADIAZINE-7-SULFONAMIDE, 6-CHLORO-, 1,1-DIOXIDE",
          "stdName": "2H-1,2,4-BENZOTHIADIAZINE-7-SULFONAMIDE, 6-CHLORO-, 1,1-DIOXIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77ee62dc-3ab8-4d8f-9b96-ad75759e95a5"
          ],
          "display_name": false
        },
        {
          "uuid": "3c4507dc-f684-4d1f-b22c-d9579ca9c195",
          "name": "6-Chloro-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide",
          "stdName": "6-CHLORO-2H-1,2,4-BENZOTHIADIAZINE-7-SULFONAMIDE 1,1-DIOXIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77ee62dc-3ab8-4d8f-9b96-ad75759e95a5",
            "fa275b81-723b-cc53-4926-03b29d6602a1"
          ],
          "display_name": false
        },
        {
          "uuid": "341c9d9d-da38-4cbe-b264-09019f13d948",
          "name": "CHLOROTHIAZIDE",
          "stdName": "CHLOROTHIAZIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a71f00f0-4cd3-48dd-8db5-081e625ba925",
            "cefda36f-9a26-47b5-9602-9f73cb64fdf2",
            "292e6a4c-e54b-4abf-96d8-099b79790966",
            "7ac280b0-4c98-4969-b7e6-ce00ad45d1fb",
            "4fb8a12b-9e21-4d69-ba31-7c00909f6fec",
            "f9cf44ba-52ca-4fc3-bb8d-5484dbab7368",
            "f9958d9c-0579-4598-a36f-a4c3e653e2e6",
            "88d5a747-3b9e-4c7d-9e9b-b269ac790b9b",
            "2d39630f-1cec-4033-9f01-362ed6b3f5e3",
            "38a1de09-8667-4470-a5c8-9a2a57b027cf",
            "33e703f3-8c6b-4120-bd25-fb2bda4d283d",
            "1280e53a-8337-4fce-8ef3-8214efb72773",
            "3a2cba77-e398-4510-9cd6-33017ccc4fd3",
            "45dfb5e8-104e-4f24-8d6e-95270262e585",
            "28dc3ca6-6526-42f9-945b-9b258a03645c",
            "1c1d0210-9655-462e-b911-fbaea3734f86",
            "e6954e8c-6bbc-4a54-aed4-5f485c8d756f",
            "d37d81cc-fc6f-4da4-9e85-eee29e2a83c0",
            "9363ef9d-f0bc-4094-a934-602612777bdc",
            "86bed9c5-ccc0-4795-8844-bec1b09545ee",
            "d512a7e2-87ea-4ca3-98a1-ee09fa2f95c4",
            "06891387-ae12-4edb-a87c-e4acb81463a0",
            "b00303eb-1243-4cd3-9da7-c7034b037f48",
            "38296f4b-64ab-45c8-a130-fb239be9dca5",
            "c924933d-ad72-4c00-8de5-73cfb36851c9",
            "fa275b81-723b-cc53-4926-03b29d6602a1"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "c9dd8a3a-294c-4e75-afc0-0bc10ecbd697",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "ef8d415b-d3f8-f3c7-f9f8-3c829eb12c28",
          "name": "CHLOROTHIAZIDE [EP IMPURITY]",
          "stdName": "CHLOROTHIAZIDE [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ac280b0-4c98-4969-b7e6-ce00ad45d1fb"
          ],
          "display_name": false
        },
        {
          "uuid": "75022aba-e0d9-4ea8-aec3-e0692c34e15a",
          "name": "CHLOROTHIAZIDE [GREEN BOOK]",
          "stdName": "CHLOROTHIAZIDE [GREEN BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d39630f-1cec-4033-9f01-362ed6b3f5e3"
          ],
          "display_name": false
        },
        {
          "uuid": "9648370d-4b86-4ed4-94f9-53676fad525d",
          "name": "CHLOROTHIAZIDE [HSDB]",
          "stdName": "CHLOROTHIAZIDE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38a1de09-8667-4470-a5c8-9a2a57b027cf"
          ],
          "display_name": false
        },
        {
          "uuid": "2493d25a-a95f-416a-931f-ef7f60f72dff",
          "name": "CHLOROTHIAZIDE [JAN]",
          "stdName": "CHLOROTHIAZIDE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fb8a12b-9e21-4d69-ba31-7c00909f6fec"
          ],
          "display_name": false
        },
        {
          "uuid": "ba4040c0-6696-4827-b30c-51936e414d50",
          "name": "CHLOROTHIAZIDE [MART.]",
          "stdName": "CHLOROTHIAZIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9958d9c-0579-4598-a36f-a4c3e653e2e6"
          ],
          "display_name": false
        },
        {
          "uuid": "ea22a10f-8034-41bd-93d0-8efac3e54ec4",
          "name": "CHLOROTHIAZIDE [MI]",
          "stdName": "CHLOROTHIAZIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "88d5a747-3b9e-4c7d-9e9b-b269ac790b9b"
          ],
          "display_name": false
        },
        {
          "uuid": "1e35f7ab-e651-4072-b802-d424a12a0d89",
          "name": "CHLOROTHIAZIDE [ORANGE BOOK]",
          "stdName": "CHLOROTHIAZIDE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9cf44ba-52ca-4fc3-bb8d-5484dbab7368"
          ],
          "display_name": false
        },
        {
          "uuid": "b6987bcb-a8d6-f095-68db-bef7f2ee58a2",
          "name": "CHLOROTHIAZIDE [USP IMPURITY]",
          "stdName": "CHLOROTHIAZIDE [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "292e6a4c-e54b-4abf-96d8-099b79790966"
          ],
          "display_name": false
        },
        {
          "uuid": "a26ca4e3-dbb2-4b9b-56c9-67926c909aa3",
          "name": "CHLOROTHIAZIDE [USP MONOGRAPH]",
          "stdName": "CHLOROTHIAZIDE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e2b125d-f8c6-6696-1b3a-dcb2436707d7"
          ],
          "display_name": false
        },
        {
          "uuid": "244529a3-56e0-449a-8fc8-486c577bc4d5",
          "name": "CHLOROTHIAZIDE [VANDF]",
          "stdName": "CHLOROTHIAZIDE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3a2cba77-e398-4510-9cd6-33017ccc4fd3"
          ],
          "display_name": false
        },
        {
          "uuid": "dcfb90ec-7179-2f8f-80b6-bbb77c572706",
          "name": "Chlorothiazide [WHO-DD]",
          "stdName": "CHLOROTHIAZIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "12d9ac88-85b4-0261-c0e7-6e7fb13a0214"
          ],
          "display_name": false
        },
        {
          "uuid": "7c8f38ed-6b10-4a5c-bfc4-cd7ec8b62bd4",
          "name": "DIURIL",
          "stdName": "DIURIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c60cd921-d76c-4463-b869-82ab37283277"
          ],
          "display_name": false
        },
        {
          "uuid": "d7613c76-b695-3527-3a74-df4b6b3bffb8",
          "name": "HYDROCHLOROTHIAZIDE IMPURITY A [EP IMPURITY]",
          "stdName": "HYDROCHLOROTHIAZIDE IMPURITY A [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f421f6a8-67bd-985d-24dd-69d1fc77f54a"
          ],
          "display_name": false
        },
        {
          "uuid": "91d6eec0-85e5-0810-60ce-ec6c363e278c",
          "name": "HYDROCHLOROTHIAZIDE IMPURITY, CHLOROTHIAZIDE- [USP IMPURITY]",
          "stdName": "HYDROCHLOROTHIAZIDE IMPURITY, CHLOROTHIAZIDE- [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33e703f3-8c6b-4120-bd25-fb2bda4d283d"
          ],
          "display_name": false
        },
        {
          "uuid": "967ce80e-0e02-4cc6-9735-f84912e872ec",
          "name": "NSC-25693",
          "stdName": "NSC-25693",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e7fef55-ad14-4b48-8650-3777c19e6c44"
          ],
          "display_name": false
        },
        {
          "uuid": "9ecd1e42-aa75-4b27-a354-2eab6118af8f",
          "name": "chlorothiazide [INN]",
          "stdName": "CHLOROTHIAZIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cefda36f-9a26-47b5-9602-9f73cb64fdf2"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "c3684f8b-2d3c-4329-9879-9e959a782e16",
          "name": "Biological Half-life",
          "value": {
            "uuid": "9a2b9506-c88c-4286-925b-f557f5cdf2a9",
            "high": 120,
            "low": 45,
            "units": "minutes"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "d01fa367-5975-009a-6179-fe4b7c6ac45f"
          ]
        }
      ]
    }
  ]
}