{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8e309ba4-e3f3-4941-8d5e-8a99f3c8e9d3",
          "code": "27841-06-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=27841-06-1",
          "code_system": "CAS",
          "references": [
            "0ef80ebe-4e59-4667-922f-3dc00e458d9f",
            "51c3043b-8e16-4e97-afe0-50ebdaf80b9d"
          ]
        },
        {
          "uuid": "669ff6a2-bbc1-45a0-be60-7b867a12080e",
          "code": "1367144",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1367144/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "0ef80ebe-4e59-4667-922f-3dc00e458d9f"
          ]
        },
        {
          "uuid": "4e5677ae-9584-4808-8f82-0c2f6d4e054e",
          "code": "248-688-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.044.247",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "0ef80ebe-4e59-4667-922f-3dc00e458d9f"
          ]
        },
        {
          "uuid": "a8267b9a-b79a-442c-80be-d91adade3140",
          "code": "119729",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/119729",
          "code_system": "PUBCHEM",
          "references": [
            "0ef80ebe-4e59-4667-922f-3dc00e458d9f"
          ]
        },
        {
          "uuid": "24d5326c-fe6d-4ca8-8e5e-25aacc4c399e",
          "code": "77T908SE82",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7cf9450e-aa2b-828e-6c60-621a261c8b12",
          "code": "DTXSID70865401",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70865401",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "07971800-ce79-66ab-9639-a7d91a61bb73",
          "code": "77T908SE82",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=77T908SE82",
          "code_system": "DAILYMED",
          "references": [
            "4f759c36-395d-b23c-0532-971f9a2ae8a3"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f353bf95-9596-42ba-a390-5d0752b83b33",
          "name": "2,2-DIMETHYLPROPANE-1,3-DIOL DIDECANOATE",
          "stdName": "2,2-DIMETHYLPROPANE-1,3-DIOL DIDECANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81ac793e-aa96-41d1-9a19-f9706722a0c8",
            "ffa14350-60e7-4a09-a61b-3143fdb630ad"
          ],
          "display_name": false
        },
        {
          "uuid": "cc53ee36-ee7b-44e5-ad32-0a46f0b421f2",
          "name": "DERMOL NGDC",
          "stdName": "DERMOL NGDC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81ac793e-aa96-41d1-9a19-f9706722a0c8",
            "ffa14350-60e7-4a09-a61b-3143fdb630ad"
          ],
          "display_name": false
        },
        {
          "uuid": "d93f6a36-5457-4f6d-99ea-835fe6b7ea03",
          "name": "ESTEMOL N-01",
          "stdName": "ESTEMOL N-01",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81ac793e-aa96-41d1-9a19-f9706722a0c8",
            "ffa14350-60e7-4a09-a61b-3143fdb630ad"
          ],
          "display_name": false
        },
        {
          "uuid": "d6f347c7-9cef-48ee-8934-518c20e744c7",
          "name": "NEOPENTYL GLYCOL DICAPRATE",
          "stdName": "NEOPENTYL GLYCOL DICAPRATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f478ad95-fbe7-4672-b500-166df0b7bb99",
            "0d6ca12e-e68b-4bfa-9b0c-d9aac66ba3e6",
            "81ac793e-aa96-41d1-9a19-f9706722a0c8",
            "ffa14350-60e7-4a09-a61b-3143fdb630ad"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "c5b894c8-7789-4dd9-a7d0-93c0c83b987a",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "77b721ab-79b9-4ef5-a045-4c6d23df5aa5",
          "name": "NEOPENTYL GLYCOL DIDECANOATE",
          "stdName": "NEOPENTYL GLYCOL DIDECANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81ac793e-aa96-41d1-9a19-f9706722a0c8",
            "ffa14350-60e7-4a09-a61b-3143fdb630ad"
          ],
          "display_name": false
        },
        {
          "uuid": "9c4fd1f7-7ed2-4f2d-bc30-f03adff72ee0",
          "name": "SCHERCEMOL NGDC ESTER",
          "stdName": "SCHERCEMOL NGDC ESTER",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81ac793e-aa96-41d1-9a19-f9706722a0c8",
            "ffa14350-60e7-4a09-a61b-3143fdb630ad"
          ],
          "display_name": false
        },
        {
          "uuid": "185c3312-7267-4636-a112-6921af8fa0aa",
          "name": "VISTANOL NPGC",
          "stdName": "VISTANOL NPGC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81ac793e-aa96-41d1-9a19-f9706722a0c8",
            "ffa14350-60e7-4a09-a61b-3143fdb630ad"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ffa14350-60e7-4a09-a61b-3143fdb630ad",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "81ac793e-aa96-41d1-9a19-f9706722a0c8",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f478ad95-fbe7-4672-b500-166df0b7bb99",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ef80ebe-4e59-4667-922f-3dc00e458d9f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391033000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36c66422-41eb-4f45-819a-8fc3aae1cd5e",
          "citation": "SRS import [77T908SE82]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=77T908SE82",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391033000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86f7a418-f71c-4cf3-be92-8ccbf8d95281",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0d6ca12e-e68b-4bfa-9b0c-d9aac66ba3e6",
          "citation": "NEOPENTYL GLYCOL DICAPRATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "51c3043b-8e16-4e97-afe0-50ebdaf80b9d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4f759c36-395d-b23c-0532-971f9a2ae8a3",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "40fbf462-32b5-49fb-9e2a-225782b0f125",
          "id": "40fbf462-32b5-49fb-9e2a-225782b0f125",
          "molfile": "\n  Marvin  01132103262D          \n\n 29 28  0  0  0  0            999 V2000\n   16.9385   -0.2196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1404    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5308   -0.5734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7327   -0.3513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1593   -0.9479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3457   -0.7077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7542   -1.3018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9742   -1.1003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3621   -1.6763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5691   -1.4361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3625   -0.6431    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9906   -2.0301    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1615   -1.8080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5881   -2.3866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2131   -2.8928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1283   -3.0478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9062   -1.9630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1778   -2.3711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4701   -1.9630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4701   -1.1339    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7417   -2.3504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0289   -1.9630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3186   -2.3504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5902   -1.9475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8618   -2.3349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1645   -1.9294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4206   -2.3349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7077   -1.9294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.3194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17 14  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 19  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 29 28  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCCCCC(=O)OCC(C)(C)COC(=O)CCCCCCCCC",
          "formula": "C25H48O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5e6be0b7-4d8c-4b84-a502-b3c695824dc7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "412.6472",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b801cddf-80d5-4f87-be48-38b3e2a827c1",
      "version": "6",
      "structure": {
        "id": "049dab65-28c9-45d6-ac0a-789a2d966328",
        "molfile": "\n  Marvin  01132100322D          \n\n 29 28  0  0  0  0            999 V2000\n   10.5691   -1.4361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4701   -1.9630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5881   -2.3866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4701   -1.1339    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3625   -0.6431    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9906   -2.0301    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1778   -2.3711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9062   -1.9630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1615   -1.8080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3621   -1.6763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7417   -2.3504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2131   -2.8928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1283   -3.0478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9742   -1.1003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0289   -1.9630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1404    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7077   -1.9294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4206   -2.3349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5308   -0.5734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1593   -0.9479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3457   -0.7077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3186   -2.3504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5902   -1.9475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8618   -2.3349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1645   -1.9294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7542   -1.3018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7327   -0.3513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9385   -0.2196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.3194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  7  1  0  0  0  0\n  3  9  1  0  0  0  0\n  4  2  2  0  0  0  0\n  5  1  2  0  0  0  0\n  6  1  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  3  1  0  0  0  0\n  9  6  1  0  0  0  0\n 10  1  1  0  0  0  0\n 11  2  1  0  0  0  0\n 12  3  1  0  0  0  0\n 13  3  1  0  0  0  0\n 14 10  1  0  0  0  0\n 15 11  1  0  0  0  0\n 16 19  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 25  1  0  0  0  0\n 19 27  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 26  1  0  0  0  0\n 22 15  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 14  1  0  0  0  0\n 27 20  1  0  0  0  0\n 28 16  1  0  0  0  0\n 29 17  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCCCCC(=O)OCC(C)(C)COC(=O)CCCCCCCCC",
        "formula": "C25H48O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "412.6472",
        "optical_activity": "NONE",
        "references": [
          "36c66422-41eb-4f45-819a-8fc3aae1cd5e",
          "86f7a418-f71c-4cf3-be92-8ccbf8d95281"
        ],
        "stereo_centers": 0
      },
      "unii": "77T908SE82"
    }
  ]
}