{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "22f25078-de56-4e39-aa3c-f367439c9300",
          "code": "1272719-08-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1272719-08-0",
          "code_system": "CAS",
          "references": [
            "264e1f20-9b46-4e1b-9c84-e1ac2e345f3e"
          ]
        },
        {
          "uuid": "a2497baa-e43a-f1a6-190a-3ebcd159d1d5",
          "code": "51002556",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/51002556",
          "code_system": "PUBCHEM",
          "references": [
            "0fd42b5f-c64f-a7b5-e500-25b116fc361a"
          ]
        },
        {
          "uuid": "5e535d1c-9516-4863-b477-2fd7fa49da54",
          "code": "77SI04TT7L",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a48a4e48-000d-4d9e-8e88-d1b937756736",
          "code": "12450",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=12450",
          "code_system": "INN"
        },
        {
          "uuid": "28162c21-f421-0645-9195-f52376cc7574",
          "code": "C199048",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C199048",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2995ad3f-21a7-345e-c5e5-3c886332fb33"
          ]
        },
        {
          "uuid": "cac01a73-cd87-ff24-d315-73bfeb7c425f",
          "code": "300000050021",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "540c34af-b609-ca08-595c-0b18eb7970a0"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "3941b218-ee3a-415f-a2ab-22619b140cd5",
          "amount": {
            "uuid": "860bbf78-af2b-4d86-a537-2aca8cde15fc",
            "average": 55,
            "units": "NANOMOLAR"
          },
          "qualification": "IC50",
          "type": "TARGET->INHIBITOR",
          "related_substance": {
            "uuid": "12c89428-7fa3-4a1d-a74b-366fba9913de",
            "refuuid": "53389a82-61c4-4a11-84b6-1be471e934b3",
            "name": "ANDROGEN RECEPTOR",
            "unii": "EJC4C3UYXH",
            "linking_id": "EJC4C3UYXH",
            "ref_pname": "ANDROGEN RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fd5b0d7a-db66-4ba6-acc9-420ebad66a63",
          "amount": {
            "uuid": "9aa3039d-629f-4569-9d42-e818b8ab2af6",
            "average": 97,
            "high": 98,
            "low": 96,
            "units": "%"
          },
          "type": "BINDER->LIGAND",
          "interaction_type": "BINDING",
          "related_substance": {
            "uuid": "9882b3cb-c348-40c1-9289-d61d73598469",
            "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30",
            "name": "PLASMA PROTEIN FRACTION (HUMAN)",
            "unii": "6D53G0FD0Z",
            "linking_id": "6D53G0FD0Z",
            "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "68747906-0735-4f8e-b8ff-97c1c7520194",
          "amount": {
            "uuid": "6ae8e10d-c331-4485-a1c8-435f5bf94c98"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "76275cdf-38b9-47c5-9b39-ade89eb35456",
            "refuuid": "d03e4594-27bc-47ec-a7ee-75a45aa9cb63",
            "name": "Faznolutamide",
            "unii": "77SI04TT7L",
            "linking_id": "77SI04TT7L",
            "ref_pname": "Faznolutamide",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e100eed4-87fa-86fc-cb72-f9a5653b0871",
          "name": "4-[4,4-dimethyl-3-(6-methylpyridin-3-yl)-5-oxo-2- sulfanylidenimidazolidin-1-yl]-3-fluoro-2- methoxybenzonitrile",
          "stdName": "4-(4,4-DIMETHYL-3-(6-METHYLPYRIDIN-3-YL)-5-OXO-2- SULFANYLIDENIMIDAZOLIDIN-1-YL)-3-FLUORO-2- METHOXYBENZONITRILE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5827c47b-2696-a1a7-7d2c-7ac55aa77726"
          ],
          "display_name": false
        },
        {
          "uuid": "57715c88-13fc-31dc-d4de-9beb32b39686",
          "name": "BENZONITRILE, 4-(4,4-DIMETHYL-3-(6-METHYL-3-PYRIDINYL)-5-OXO-2-THIOXO-1-IMIDAZOLIDINYL)-3-FLUORO-2-METHOXY-",
          "stdName": "BENZONITRILE, 4-(4,4-DIMETHYL-3-(6-METHYL-3-PYRIDINYL)-5-OXO-2-THIOXO-1-IMIDAZOLIDINYL)-3-FLUORO-2-METHOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8705e6dd-0db8-8012-8cb8-3c7f7d03b0d1"
          ],
          "display_name": false
        },
        {
          "uuid": "f3a6a9bb-8e34-4717-850f-17c2eab53a00",
          "name": "Faznolutamide",
          "stdName": "FAZNOLUTAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1aa772e-9a1e-48ec-9c98-7b8b3eefc892"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "20807019-bc1d-48fc-9850-520a87fee6d0",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "11e578d5-3a43-40e5-a2b4-265d9c0bf70c",
          "name": "faznolutamide [INN]",
          "stdName": "FAZNOLUTAMIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1aa772e-9a1e-48ec-9c98-7b8b3eefc892"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a1aa772e-9a1e-48ec-9c98-7b8b3eefc892",
          "citation": "INN LIST 128",
          "url": "https://cdn.who.int/media/docs/default-source/international-nonproprietary-names-(inn)/pl128.pdf?sfvrsn=889fe54b_3&download=true",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8705e6dd-0db8-8012-8cb8-3c7f7d03b0d1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0fd42b5f-c64f-a7b5-e500-25b116fc361a",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "264e1f20-9b46-4e1b-9c84-e1ac2e345f3e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5827c47b-2696-a1a7-7d2c-7ac55aa77726",
          "citation": "P128",
          "doc_type": "INN_LIST",
          "public_domain": true
        },
        {
          "uuid": "2995ad3f-21a7-345e-c5e5-3c886332fb33",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "540c34af-b609-ca08-595c-0b18eb7970a0",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "413980ef-2252-4a36-1c45-2ff387d7d918",
          "id": "413980ef-2252-4a36-1c45-2ff387d7d918",
          "molfile": "\n  Marvin  01132103272D          \n\n 27 29  0  0  0  0            999 V2000\n   19.3424   -3.7825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6279   -4.1950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9135   -3.7825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9135   -2.9575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1991   -2.5450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4846   -2.9575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4846   -3.7825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7701   -4.1950    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0165   -3.8594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8449   -3.0525    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4644   -4.4725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6439   -4.3863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1590   -5.0537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3386   -4.9675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0031   -4.2138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1826   -4.1276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4880   -3.5464    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3084   -3.6326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8769   -5.1870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9632   -6.0075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2095   -5.6719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6839   -5.0155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2970   -5.5675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1991   -4.1950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1991   -5.0200    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6279   -2.5450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3424   -2.1325    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3 24  2  0  0  0  0\n  4  5  2  0  0  0  0\n 26  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n 24  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 22  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 19  1  0  0  0  0\n 12 13  1  0  0  0  0\n 18 12  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 19 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 24 25  1  0  0  0  0\n 26 27  3  0  0  0  0\nM  END",
          "smiles": "Cc1ccc(cn1)N2C(=S)N(c3ccc(C#N)c(c3F)OC)C(=O)C2(C)C",
          "formula": "C19H17FN4O2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3e870417-182d-4c41-ba59-79d01f4798b7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "384.4291",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d03e4594-27bc-47ec-a7ee-75a45aa9cb63",
      "version": "10",
      "structure": {
        "id": "fdb9016f-7a5c-5849-de2d-8747750b58b6",
        "molfile": "results1.mol\n  Marvin  01132113082D          \n\n 27 29  0  0  0  0            999 V2000\n   18.6279   -2.5450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9135   -2.9575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9135   -3.7825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1991   -4.1950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4846   -3.7825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4846   -2.9575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1991   -2.5450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3424   -2.1325    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6279   -4.1950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3424   -3.7825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1991   -5.0200    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0165   -3.8594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4644   -4.4725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8769   -5.1870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6839   -5.0155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7701   -4.1950    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8449   -3.0525    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2970   -5.5675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3084   -3.6326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6439   -4.3863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1590   -5.0537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3386   -4.9675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0031   -4.2138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4880   -3.5464    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1826   -4.1276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9632   -6.0075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2095   -5.6719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  2  7  2  0  0  0  0\n  1  8  3  0  0  0  0\n  9 10  1  0  0  0  0\n  3  9  1  0  0  0  0\n  4 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 12 16  1  0  0  0  0\n 12 17  2  0  0  0  0\n 15 18  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 19 24  2  0  0  0  0\n 23 25  1  0  0  0  0\n 13 20  1  0  0  0  0\n 14 26  1  0  0  0  0\n 14 27  1  0  0  0  0\n  5 16  1  0  0  0  0\nM  END",
        "smiles": "Cc1ccc(cn1)N2C(=S)N(c3ccc(C#N)c(c3F)OC)C(=O)C2(C)C",
        "formula": "C19H17FN4O2S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "384.4291",
        "optical_activity": "NONE",
        "references": [
          "a1aa772e-9a1e-48ec-9c98-7b8b3eefc892"
        ],
        "stereo_centers": 0
      },
      "unii": "77SI04TT7L"
    }
  ]
}