{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7348b903-39ad-4694-bf5c-49a91380d5a1",
          "code": "3179-90-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3179-90-6",
          "code_system": "CAS",
          "references": [
            "c86df10d-bd7f-4a98-9573-5f5e4a2adaca",
            "9e05dc8f-4d1d-4dbe-8e28-76dac0d82dcb"
          ]
        },
        {
          "uuid": "4b8d9fcb-6d57-404c-a79f-6349df98d6be",
          "code": "221-666-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.019.697",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c86df10d-bd7f-4a98-9573-5f5e4a2adaca"
          ]
        },
        {
          "uuid": "0a79edef-67f9-43a1-bf33-3ebb99a30f0d",
          "code": "18514",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18514",
          "code_system": "PUBCHEM",
          "references": [
            "c86df10d-bd7f-4a98-9573-5f5e4a2adaca"
          ]
        },
        {
          "uuid": "739607eb-0041-79a3-9f1c-d08d677e7e81",
          "code": "DTXSID8025208",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8025208",
          "code_system": "EPA CompTox",
          "references": [
            "01a5557e-feed-7ca3-b543-502d87ccf878"
          ]
        },
        {
          "uuid": "f7bdb7b4-bd12-4d88-b439-9cb92aaf7d97",
          "code": "77Q1DI38FQ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0a6f4a28-3d18-1019-f85f-70eee301b558",
          "code": "227207",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=227207",
          "code_system": "NSC",
          "references": [
            "cde6d5ef-3203-ea0b-9fc5-0fc657762b50"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9c23a05a-0ce0-40f2-bd90-012585e639e6",
          "name": "9,10-ANTHRACENEDIONE, 1,4-DIHYDROXY-5,8-BIS((2-HYDROXYETHYL)AMINO)-",
          "stdName": "9,10-ANTHRACENEDIONE, 1,4-DIHYDROXY-5,8-BIS((2-HYDROXYETHYL)AMINO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2696ac93-8a11-4ccf-b74b-68264dbeb17b",
            "9a70cf90-f0ec-4d6d-b7a4-826de0cf7c71"
          ],
          "display_name": false
        },
        {
          "uuid": "005499a7-b577-468a-9676-51290ad432a0",
          "name": "ANTHRAQUINONE, 1,4-DIHYDROXY-5,8-BIS((2-HYDROXYETHYL)AMINO)-",
          "stdName": "ANTHRAQUINONE, 1,4-DIHYDROXY-5,8-BIS((2-HYDROXYETHYL)AMINO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2696ac93-8a11-4ccf-b74b-68264dbeb17b",
            "9a70cf90-f0ec-4d6d-b7a4-826de0cf7c71"
          ],
          "display_name": false
        },
        {
          "uuid": "48e15131-5a80-4e38-aa6c-d47244027039",
          "name": "ARTISIL BLUE GREEN GP",
          "stdName": "ARTISIL BLUE GREEN GP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2696ac93-8a11-4ccf-b74b-68264dbeb17b",
            "9a70cf90-f0ec-4d6d-b7a4-826de0cf7c71"
          ],
          "display_name": false
        },
        {
          "uuid": "7ac3d50e-a0ae-4478-939c-0b94664c28d9",
          "name": "C.I. DISPERSE BLUE 7",
          "stdName": "C.I. DISPERSE BLUE 7",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e9c389a-eada-4119-a3f6-60b1343ae2dc",
            "2696ac93-8a11-4ccf-b74b-68264dbeb17b"
          ],
          "display_name": false
        },
        {
          "uuid": "4ed62dbe-af3d-47f6-b564-81da1920ca17",
          "name": "CELLITON FAST BLUE GREEN B",
          "stdName": "CELLITON FAST BLUE GREEN B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2696ac93-8a11-4ccf-b74b-68264dbeb17b",
            "9a70cf90-f0ec-4d6d-b7a4-826de0cf7c71"
          ],
          "display_name": false
        },
        {
          "uuid": "818220be-dd79-4b4b-8974-62e3fc1d19f0",
          "name": "CI DISPERSE BLUE 7",
          "stdName": "CI DISPERSE BLUE 7",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "867edcc5-155d-40f2-93cb-fe1eaa6e7378"
          ],
          "display_name": false
        },
        {
          "uuid": "1b28a4db-2a0f-4e0c-aa03-7aef5c27e07d",
          "name": "DISPERSE BLUE 7",
          "stdName": "DISPERSE BLUE 7",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "866c8927-3503-4617-8994-0b7e39f2903b",
            "5b90084f-4ff6-468b-ace4-527bef3f1594",
            "2696ac93-8a11-4ccf-b74b-68264dbeb17b"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "514e71d8-1437-458a-b9d3-f7d35ae333d5",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "8e07b52e-929a-4578-9c4b-d5cf1b46b02b",
          "name": "FENACET FAST TURQUOISE B",
          "stdName": "FENACET FAST TURQUOISE B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2696ac93-8a11-4ccf-b74b-68264dbeb17b",
            "9a70cf90-f0ec-4d6d-b7a4-826de0cf7c71"
          ],
          "display_name": false
        },
        {
          "uuid": "c86654bc-25a0-40ff-b710-1f5bcb0e9444",
          "name": "LOWADENE BLUE 62500",
          "stdName": "LOWADENE BLUE 62500",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "866c8927-3503-4617-8994-0b7e39f2903b",
            "2696ac93-8a11-4ccf-b74b-68264dbeb17b"
          ],
          "display_name": false
        },
        {
          "uuid": "10b9ed0a-629a-4d16-b9e2-e6206a100b06",
          "name": "LOWADENE BLUE 7",
          "stdName": "LOWADENE BLUE 7",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "866c8927-3503-4617-8994-0b7e39f2903b",
            "2696ac93-8a11-4ccf-b74b-68264dbeb17b"
          ],
          "display_name": false
        },
        {
          "uuid": "74390951-5d2e-4762-be19-c78077a0ffed",
          "name": "NSC-227207",
          "stdName": "NSC-227207",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2696ac93-8a11-4ccf-b74b-68264dbeb17b",
            "a1312bde-b257-46e8-8db3-61782c018d0f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "867edcc5-155d-40f2-93cb-fe1eaa6e7378",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "866c8927-3503-4617-8994-0b7e39f2903b",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2696ac93-8a11-4ccf-b74b-68264dbeb17b",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e9c389a-eada-4119-a3f6-60b1343ae2dc",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a70cf90-f0ec-4d6d-b7a4-826de0cf7c71",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a1312bde-b257-46e8-8db3-61782c018d0f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c86df10d-bd7f-4a98-9573-5f5e4a2adaca",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393333000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff570ce2-c5dd-47e0-ac04-c59d19ff674a",
          "citation": "SRS import [77Q1DI38FQ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=77Q1DI38FQ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393333000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f43ed4bb-ecf5-4dd1-a668-932a90611603",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5b90084f-4ff6-468b-ace4-527bef3f1594",
          "citation": "DISPERSE BLUE 7 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "01a5557e-feed-7ca3-b543-502d87ccf878",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3179-90-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9e05dc8f-4d1d-4dbe-8e28-76dac0d82dcb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "cde6d5ef-3203-ea0b-9fc5-0fc657762b50",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6b51bf4e-1c02-4245-baab-0f046969dc41",
          "id": "6b51bf4e-1c02-4245-baab-0f046969dc41",
          "molfile": "\n  Marvin  01132105352D          \n\n 26 28  0  0  0  0            999 V2000\n    4.2586   -3.1915    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9555   -3.5965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6621   -3.1915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3825   -3.5965    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3825   -4.4204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6621   -4.8303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6621   -5.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3825   -6.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3825   -6.8600    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6807   -7.2698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9839   -6.8600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2916   -7.2698    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1031   -5.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8235   -6.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8235   -7.0483    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5347   -5.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2600   -6.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2600   -6.9449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9760   -5.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9760   -4.8303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2600   -4.4204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2600   -3.6575    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5347   -4.8303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8235   -4.4204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8235   -3.6575    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1031   -4.8303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n 26  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 13  8  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 26 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 23 16  2  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n 21 22  1  0  0  0  0\n 23 21  1  0  0  0  0\n 24 23  1  0  0  0  0\n 24 25  2  0  0  0  0\n 26 24  1  0  0  0  0\nM  END",
          "smiles": "c1cc(c2c(c1NCCO)C(=O)c3c(ccc(c3C2=O)O)O)NCCO",
          "formula": "C18H18N2O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5ac12043-0a2c-4c67-aaa4-7d46e86404cf"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "358.346",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c07251a6-d13a-48e1-bcb8-8c57c7694c70",
      "version": "5",
      "structure": {
        "id": "bb52acdc-1777-4696-9f1e-418c09fcd416",
        "molfile": "\n  Marvin  01132109412D          \n\n 26 28  0  0  0  0            999 V2000\n    7.1031   -4.8303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1031   -5.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3825   -6.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6621   -5.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6621   -4.8303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3825   -4.4204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3825   -3.5965    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6621   -3.1915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9555   -3.5965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2586   -3.1915    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3825   -6.8600    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6807   -7.2698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9839   -6.8600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2916   -7.2698    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8235   -6.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5347   -5.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2600   -6.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9760   -5.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9760   -4.8303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2600   -4.4204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5347   -4.8303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8235   -4.4204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8235   -3.6575    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2600   -3.6575    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2600   -6.9449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8235   -7.0483    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  3 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n  2 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n  1 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 21 16  1  0  0  0  0\n 20 24  1  0  0  0  0\n 17 25  1  0  0  0  0\n 15 26  2  0  0  0  0\nM  END",
        "smiles": "c1cc(c2c(c1NCCO)C(=O)c3c(ccc(c3C2=O)O)O)NCCO",
        "formula": "C18H18N2O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "358.346",
        "optical_activity": "NONE",
        "references": [
          "ff570ce2-c5dd-47e0-ac04-c59d19ff674a",
          "f43ed4bb-ecf5-4dd1-a668-932a90611603"
        ],
        "stereo_centers": 0
      },
      "unii": "77Q1DI38FQ"
    }
  ]
}