{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9b04da26-a0f8-42b0-9ed1-5e2048d7a0c3",
          "code": "31972-44-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=31972-44-8",
          "code_system": "CAS",
          "references": [
            "e1c251fe-6d72-4b0e-85e0-5e65779dcdbe",
            "961824fa-bf61-4541-9512-1e48c5d678c6"
          ]
        },
        {
          "uuid": "f047660e-a17b-4501-97f3-09c486e20e45",
          "code": "36028",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/36028",
          "code_system": "PUBCHEM",
          "references": [
            "e1c251fe-6d72-4b0e-85e0-5e65779dcdbe"
          ]
        },
        {
          "uuid": "64392fa1-7f1b-69fa-39fe-d48ebd4cee08",
          "code": "DTXSID3037547",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3037547",
          "code_system": "EPA CompTox",
          "references": [
            "7190f4e2-45c9-8de4-6a02-a3d54b897ee2"
          ]
        },
        {
          "uuid": "4e8a3314-454b-4888-8f2a-ec7cc930e378",
          "code": "77I51XA8L2",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4fa93096-33e2-4713-8a7e-bfecbb7eb45d",
          "name": "BAY-68138 SULFONE",
          "stdName": "BAY-68138 SULFONE",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "961824fa-bf61-4541-9512-1e48c5d678c6",
            "48d638e2-39ee-476e-b31f-093ada9251dc"
          ],
          "display_name": false
        },
        {
          "uuid": "652fa527-2ebe-423f-864e-a04e42bfdbd6",
          "name": "FENAMIPHOS SULFONE",
          "stdName": "FENAMIPHOS SULFONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "86ffbb20-2051-4f21-8ff1-b772f0ba462f"
          ],
          "display_name": true
        },
        {
          "uuid": "8ee74b1b-8880-44cc-9191-28b6ccf1cfd7",
          "name": "FENAMIPHOS SULFONE, (±)-",
          "stdName": "FENAMIPHOS SULFONE, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "961824fa-bf61-4541-9512-1e48c5d678c6",
            "d3695345-6411-468b-9cd7-a71b9cbbd59a"
          ],
          "display_name": false
        },
        {
          "uuid": "80f1766c-1b1e-44e2-b4c4-25df9e7ad24e",
          "name": "FENAMIPHOS SULPHONE",
          "stdName": "FENAMIPHOS SULPHONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d24fd37-fed6-4343-881f-8627a69f49f0"
          ],
          "display_name": false
        },
        {
          "uuid": "436c13cf-0122-481d-a420-9f4dd34c97f7",
          "name": "O-ETHYL O-(4-(METHYLSULFONYL)-M-TOLYL)ISOPROPYLPHOSPHORAMIDATE",
          "stdName": "O-ETHYL O-(4-(METHYLSULFONYL)-M-TOLYL)ISOPROPYLPHOSPHORAMIDATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "961824fa-bf61-4541-9512-1e48c5d678c6",
            "48d638e2-39ee-476e-b31f-093ada9251dc"
          ],
          "display_name": false
        },
        {
          "uuid": "80ad3797-8c6a-40de-9e51-9606a6127903",
          "name": "PHOSPHORAMIDIC ACID, N-(1-METHYLETHYL)-, ETHYL 3-METHYL-4-(METHYLSULFONYL)PHENYL ESTER",
          "stdName": "PHOSPHORAMIDIC ACID, N-(1-METHYLETHYL)-, ETHYL 3-METHYL-4-(METHYLSULFONYL)PHENYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "961824fa-bf61-4541-9512-1e48c5d678c6",
            "48d638e2-39ee-476e-b31f-093ada9251dc"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1d24fd37-fed6-4343-881f-8627a69f49f0",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "86ffbb20-2051-4f21-8ff1-b772f0ba462f",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48d638e2-39ee-476e-b31f-093ada9251dc",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "961824fa-bf61-4541-9512-1e48c5d678c6",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d3695345-6411-468b-9cd7-a71b9cbbd59a",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e1c251fe-6d72-4b0e-85e0-5e65779dcdbe",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391774000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5ecb1d65-d5ab-4463-a2e8-5231afac1104",
          "citation": "SRS import [77I51XA8L2]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=77I51XA8L2",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391774000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "efa59f58-27c5-415a-bf4a-942f689a0858",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7190f4e2-45c9-8de4-6a02-a3d54b897ee2",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=31972-44-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "931c8251-de91-431d-97af-10ffd69aaf31",
          "id": "931c8251-de91-431d-97af-10ffd69aaf31",
          "molfile": "\n  Marvin  01132107382D          \n\n 21 21  0  0  0  0            999 V2000\n   10.0343   -3.4272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6040   -4.1655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8003   -4.1655    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4025   -4.8810    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0163   -5.5806    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1257   -5.2955    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1257   -6.1236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8542   -6.4969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4459   -6.5166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6938   -4.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9586   -4.9008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9586   -5.7258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2422   -6.1357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5434   -5.7258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5434   -4.9008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8074   -4.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2422   -4.4879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8074   -6.1592    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0850   -6.5889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2348   -6.8710    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3967   -5.4437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  4 10  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 17  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  2  0  0  0  0\n 14 18  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 15  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n 18 21  2  0  0  0  0\nM  END",
          "smiles": "CCOP(=O)(NC(C)C)Oc1ccc(c(C)c1)S(=O)(=O)C",
          "formula": "C13H22NO5PS",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "aefd0aff-5387-4bd2-b0b9-95ecc6908a84"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "335.3578",
          "optical_activity": "NONE",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c60505a0-6190-4178-9967-085cb46bb2bf",
      "version": "4",
      "structure": {
        "id": "80004e7c-c826-4a61-97b8-da1ccfda11e0",
        "molfile": "\n  Marvin  01132106392D          \n\n 21 21  0  0  0  0            999 V2000\n    8.4025   -4.8810    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6938   -4.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9586   -4.9008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2422   -4.4879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5434   -4.9008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5434   -5.7258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8074   -6.1592    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0850   -6.5889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2348   -6.8710    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3967   -5.4437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2422   -6.1357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9586   -5.7258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8074   -4.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1257   -5.2955    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1257   -6.1236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8542   -6.4969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4459   -6.5166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8003   -4.1655    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6040   -4.1655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0343   -3.4272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0163   -5.5806    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n  7 10  2  0  0  0  0\n 11  6  2  0  0  0  0\n 12 11  1  0  0  0  0\n  3 12  2  0  0  0  0\n  5 13  1  0  0  0  0\n  1 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n  1 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n  1 21  2  0  0  0  0\nM  END",
        "smiles": "CCOP(=O)(NC(C)C)Oc1ccc(c(C)c1)S(=O)(=O)C",
        "formula": "C13H22NO5PS",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "335.3578",
        "optical_activity": "( + / - )",
        "references": [
          "5ecb1d65-d5ab-4463-a2e8-5231afac1104",
          "efa59f58-27c5-415a-bf4a-942f689a0858"
        ],
        "stereo_centers": 1
      },
      "unii": "77I51XA8L2"
    }
  ]
}