{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "91338c73-8453-450b-a5e7-0929e8b7e19f",
          "code": "5779-54-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5779-54-4",
          "code_system": "CAS",
          "references": [
            "449ed87b-5c79-4736-b487-1fee9d6a04a6",
            "165ac423-a695-4959-85dc-201d8ca03291"
          ]
        },
        {
          "uuid": "45317005-12f4-4c50-ad04-38d2820e66cf",
          "code": "C77248",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C77248",
          "code_system": "NCI_THESAURUS",
          "references": [
            "449ed87b-5c79-4736-b487-1fee9d6a04a6"
          ]
        },
        {
          "uuid": "745a4591-111d-4f84-95ff-ed943f148245",
          "code": "C004637",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67004637",
          "code_system": "MESH",
          "references": [
            "449ed87b-5c79-4736-b487-1fee9d6a04a6"
          ]
        },
        {
          "uuid": "982a0aed-0e1e-4184-b157-d1327615efb3",
          "code": "SUB06842MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "449ed87b-5c79-4736-b487-1fee9d6a04a6"
          ]
        },
        {
          "uuid": "294ddb6c-053c-477d-a933-402fff91c5a1",
          "code": "1389",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1389",
          "code_system": "INN",
          "references": [
            "449ed87b-5c79-4736-b487-1fee9d6a04a6"
          ]
        },
        {
          "uuid": "29e2de82-7acf-4762-9236-f75e51bc54e4",
          "code": "m134",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m134?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "449ed87b-5c79-4736-b487-1fee9d6a04a6"
          ]
        },
        {
          "uuid": "d7c95bd0-c845-4fc6-99fa-8846f5d2f781",
          "code": "CHEMBL2104142",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2104142",
          "code_system": "ChEMBL",
          "references": [
            "449ed87b-5c79-4736-b487-1fee9d6a04a6"
          ]
        },
        {
          "uuid": "0ed41f25-b11f-4249-aee5-dfcdbc28ae05",
          "code": "227-302-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.024.821",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "449ed87b-5c79-4736-b487-1fee9d6a04a6"
          ]
        },
        {
          "uuid": "b078f548-b30f-4306-9205-e1b14e34c247",
          "code": "72076",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/72076",
          "code_system": "PUBCHEM",
          "references": [
            "449ed87b-5c79-4736-b487-1fee9d6a04a6"
          ]
        },
        {
          "uuid": "abf287c4-5423-9ef0-b6c6-87e1ea058af4",
          "code": "Cyclarbamate",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Cyclarbamate",
          "code_system": "WIKIPEDIA",
          "references": [
            "bf334988-38a3-dce6-a498-153f8367d978"
          ]
        },
        {
          "uuid": "1bcef941-9c53-9493-b786-6e5f669c1cf0",
          "code": "DTXSID60206480",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60206480",
          "code_system": "EPA CompTox",
          "references": [
            "567eff22-70ab-6602-f377-63fc02a392fd"
          ]
        },
        {
          "uuid": "2db05fcd-e96c-91bc-6c5c-120e3710629b",
          "code": "C264",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anticonvulsant Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C264",
          "code_system": "NCI_THESAURUS",
          "references": [
            "27ddcf91-871e-de7d-5a4c-b1f725a82764"
          ]
        },
        {
          "uuid": "3d0202c1-5c4c-4c07-ad64-5d2b229ea668",
          "code": "779291866J",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1f31612b-676c-2f3f-ecb6-c4e4b19b8e1c",
          "code": "3722",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3722",
          "code_system": "DRUG CENTRAL",
          "references": [
            "27ddcf91-871e-de7d-5a4c-b1f725a82764"
          ]
        },
        {
          "uuid": "473d620d-9b45-1f57-db0a-73041e44c150",
          "code": "100000083746",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "997575c2-837b-de78-c296-a6742e585c82"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "4383a7e4-a0e1-4805-9eaa-9f4e5ec62129",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "e8a920b4-b500-4ae3-8902-970308f61384",
            "refuuid": "77694814-009d-48d7-a6ce-9758cda78f64",
            "name": "CYCLARBAMATE",
            "unii": "779291866J",
            "linking_id": "779291866J",
            "ref_pname": "CYCLARBAMATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "84ffbd7a-c76e-46fc-bdfa-dff13bf98068",
          "name": "1,1-CYCLOPENTANEDIMETHANOL DICARBANILATE",
          "stdName": "1,1-CYCLOPENTANEDIMETHANOL DICARBANILATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de266679-6bbf-4ff7-af8c-207dd8bfbf5f"
          ],
          "display_name": false
        },
        {
          "uuid": "89c7d533-e7c4-4fbf-8f92-8e52c946426a",
          "name": "C-1428",
          "stdName": "C-1428",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de266679-6bbf-4ff7-af8c-207dd8bfbf5f"
          ],
          "display_name": false
        },
        {
          "uuid": "15770942-76e4-4fab-92bb-2e08c667196d",
          "name": "CYCLARBAMATE",
          "stdName": "CYCLARBAMATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de266679-6bbf-4ff7-af8c-207dd8bfbf5f",
            "7b926571-3595-4506-9e00-e31b14231368",
            "1ace6e43-8b3d-42bc-b3d4-092bc97d54e6",
            "dcfdbe38-c178-4ded-97a9-9406dd65dc75",
            "e0d14678-d963-4792-acbc-3089c5052345"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "af6604a4-ecca-469d-bb40-3da396b55a84",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "3df39481-b44d-4a8b-a5ee-9615e2f12796",
          "name": "CYCLARBAMATE [MI]",
          "stdName": "CYCLARBAMATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ace6e43-8b3d-42bc-b3d4-092bc97d54e6"
          ],
          "display_name": false
        },
        {
          "uuid": "10fc8cb3-ccb3-47f9-865d-50f599b29cf6",
          "name": "CYCLOPENTAPHENE",
          "stdName": "CYCLOPENTAPHENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de266679-6bbf-4ff7-af8c-207dd8bfbf5f"
          ],
          "display_name": false
        },
        {
          "uuid": "f231d0de-e8e1-467f-9426-a9e73b6a4d7f",
          "name": "cyclarbamate [INN]",
          "stdName": "CYCLARBAMATE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7b926571-3595-4506-9e00-e31b14231368"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "de266679-6bbf-4ff7-af8c-207dd8bfbf5f",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7b926571-3595-4506-9e00-e31b14231368",
          "citation": "INN Proposed List 13",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL13.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1ace6e43-8b3d-42bc-b3d4-092bc97d54e6",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "449ed87b-5c79-4736-b487-1fee9d6a04a6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390769000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7327dde7-364b-4972-bcfc-3707e8e68c3b",
          "citation": "SRS import [779291866J]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=779291866J",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390769000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e0d14678-d963-4792-acbc-3089c5052345",
          "citation": "CYCLARBAMATE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dcfdbe38-c178-4ded-97a9-9406dd65dc75",
          "citation": "CYCLARBAMATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bf334988-38a3-dce6-a498-153f8367d978",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Cyclarbamate",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "567eff22-70ab-6602-f377-63fc02a392fd",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5779-54-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "997575c2-837b-de78-c296-a6742e585c82",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "27ddcf91-871e-de7d-5a4c-b1f725a82764",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "165ac423-a695-4959-85dc-201d8ca03291",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "cfb904e3-47c2-4db2-b597-e6501a2546e3",
          "id": "cfb904e3-47c2-4db2-b597-e6501a2546e3",
          "molfile": "\n  Marvin  01132110442D          \n\n 27 29  0  0  0  0            999 V2000\n    7.2471   -3.0411    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5457   -2.6050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5467   -1.7435    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1989   -1.0564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9086   -1.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6230   -1.0682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6282   -0.2446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9130    0.1707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2015   -0.2383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8202   -2.9977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8177   -3.8126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0801   -4.2710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3724   -3.8439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3881   -3.0190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6816   -2.5930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9511   -2.9891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6688   -1.6877    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0030   -1.0270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0037   -0.2004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2886    0.2105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5738   -0.2041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5785   -1.0338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2941   -1.4410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7458   -4.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4897   -5.5428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6659   -5.5394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4097   -4.7561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  2  3  1  0  0  0  0\n 10  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  9  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 24 12  1  0  0  0  0\n 12 27  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 23 18  2  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)NC(=O)OCC2(CCCC2)COC(=O)Nc3ccccc3",
          "formula": "C21H24N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5a9e863c-c3f5-4ce5-9674-e539ce8b7c5c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "368.4271",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "77694814-009d-48d7-a6ce-9758cda78f64",
      "version": "8",
      "structure": {
        "id": "12ca07f4-50ab-41aa-a130-f4d8ce36691c",
        "molfile": "\n  Marvin  01132101112D          \n\n 27 29  0  0  0  0            999 V2000\n    5.4897   -5.5428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7458   -4.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0801   -4.2710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4097   -4.7561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6659   -5.5394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3724   -3.8439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8177   -3.8126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3881   -3.0190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6816   -2.5930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6688   -1.6877    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8202   -2.9977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5457   -2.6050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5467   -1.7435    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2471   -3.0411    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9511   -2.9891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0030   -1.0270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1989   -1.0564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0037   -0.2004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2886    0.2105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5738   -0.2041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5785   -1.0338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2941   -1.4410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9086   -1.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6230   -1.0682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6282   -0.2446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9130    0.1707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2015   -0.2383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 12 14  2  0  0  0  0\n  3  7  1  0  0  0  0\n  9 15  2  0  0  0  0\n  2  3  1  0  0  0  0\n 10 16  1  0  0  0  0\n  6  8  1  0  0  0  0\n 13 17  1  0  0  0  0\n  3  4  1  0  0  0  0\n 16 18  2  0  0  0  0\n  8  9  1  0  0  0  0\n 18 19  1  0  0  0  0\n  4  5  1  0  0  0  0\n 19 20  2  0  0  0  0\n  9 10  1  0  0  0  0\n 20 21  1  0  0  0  0\n  5  1  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 16  1  0  0  0  0\n  7 11  1  0  0  0  0\n 17 23  2  0  0  0  0\n  1  2  1  0  0  0  0\n 23 24  1  0  0  0  0\n 11 12  1  0  0  0  0\n 24 25  2  0  0  0  0\n  3  6  1  0  0  0  0\n 25 26  1  0  0  0  0\n 12 13  1  0  0  0  0\n 26 27  2  0  0  0  0\n 27 17  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)NC(=O)OCC2(CCCC2)COC(=O)Nc3ccccc3",
        "formula": "C21H24N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "368.4271",
        "optical_activity": "NONE",
        "references": [
          "de266679-6bbf-4ff7-af8c-207dd8bfbf5f",
          "7327dde7-364b-4972-bcfc-3707e8e68c3b",
          "7b926571-3595-4506-9e00-e31b14231368"
        ],
        "stereo_centers": 0
      },
      "unii": "779291866J"
    }
  ]
}