{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e436c086-59bc-4a7c-8878-c91afae7eb51",
          "code": "529-44-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=529-44-2",
          "code_system": "CAS",
          "references": [
            "a25725ad-f66f-4cf4-a712-87631bb01e2b",
            "08a6f825-5a9b-4fea-a975-35d825cd9da8"
          ]
        },
        {
          "uuid": "6b2040d2-5ff7-4fa4-a5c2-9fc0856bc760",
          "code": "C68458",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68458",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a25725ad-f66f-4cf4-a712-87631bb01e2b"
          ]
        },
        {
          "uuid": "a73f35a4-bad1-4b25-b2d0-c1f9f2986979",
          "code": "C040015",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67040015",
          "code_system": "MESH",
          "references": [
            "a25725ad-f66f-4cf4-a712-87631bb01e2b"
          ]
        },
        {
          "uuid": "c10b72cd-46d0-4e9a-a360-2139f5bb5615",
          "code": "MYRICETIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Myricetin",
          "code_system": "WIKIPEDIA",
          "references": [
            "a25725ad-f66f-4cf4-a712-87631bb01e2b"
          ]
        },
        {
          "uuid": "7f2d11d5-f7b9-4786-91e0-2caefe95750f",
          "code": "208-463-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.695",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a25725ad-f66f-4cf4-a712-87631bb01e2b"
          ]
        },
        {
          "uuid": "d3c6242b-ad7d-414d-bdca-d7862e6a44f2",
          "code": "1368374",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1368374/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "a25725ad-f66f-4cf4-a712-87631bb01e2b"
          ]
        },
        {
          "uuid": "e0baf18d-4c3d-4956-99e0-401bb807ebb5",
          "code": "m7687",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7687?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "a25725ad-f66f-4cf4-a712-87631bb01e2b"
          ]
        },
        {
          "uuid": "b6fc9818-a449-409b-b4df-6f773126c642",
          "code": "5281672",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5281672",
          "code_system": "PUBCHEM",
          "references": [
            "a25725ad-f66f-4cf4-a712-87631bb01e2b"
          ]
        },
        {
          "uuid": "edf725fd-383b-c1ae-97b8-4b163cc9427a",
          "code": "7682",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7682",
          "code_system": "HSDB",
          "references": [
            "8b23fb04-6a71-bf8d-b0ac-950d02e250b2"
          ]
        },
        {
          "uuid": "c1926dff-c224-685d-97f1-f03cee1507c4",
          "code": "DTXSID8022400",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8022400",
          "code_system": "EPA CompTox",
          "references": [
            "b5b16294-181b-d67e-63ee-af9ded39f6d8"
          ]
        },
        {
          "uuid": "49e3510a-d204-ef57-4c6c-0896aed1b4bd",
          "code": "C792",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Dietary Polyphenol[C70553]|Dietary Flavonoid[C70554]|Flavonol[C68456]|Kaempferol[C68457]|Quercetin",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C792",
          "code_system": "NCI_THESAURUS",
          "references": [
            "955f2cc2-2489-2ce3-84ac-554c7992910f"
          ]
        },
        {
          "uuid": "e7a6e9b4-c4fd-2b7c-a5a4-9564c1a825de",
          "code": "1291 (Number of products:23)",
          "comments": "Dietary Supplement Label Database|Botanical|Myricetin",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1291&item=Myricetin",
          "code_system": "DSLD",
          "references": [
            "955f2cc2-2489-2ce3-84ac-554c7992910f"
          ]
        },
        {
          "uuid": "7706b1a1-c018-0e4f-700a-71510c67b21f",
          "code": "DB02375",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB02375",
          "code_system": "DRUG BANK",
          "references": [
            "955f2cc2-2489-2ce3-84ac-554c7992910f"
          ]
        },
        {
          "uuid": "8628f0d1-e45a-40ef-a07d-cd85757acfd0",
          "code": "76XC01FTOJ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5d394d46-e4ce-e8c5-e170-3371d6d2bd12",
          "code": "58395",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:58395",
          "code_system": "CHEBI",
          "references": [
            "955f2cc2-2489-2ce3-84ac-554c7992910f"
          ]
        },
        {
          "uuid": "4bf04ea1-1040-cec5-49ad-1d8a182511a8",
          "code": "18152",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:18152",
          "code_system": "CHEBI",
          "references": [
            "955f2cc2-2489-2ce3-84ac-554c7992910f"
          ]
        },
        {
          "uuid": "a9dc9915-8c7c-8c06-9069-6d62c17667ff",
          "code": "76XC01FTOJ",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=76XC01FTOJ",
          "code_system": "DAILYMED",
          "references": [
            "bef30c4d-6c22-405d-10cb-af608a4bf430"
          ]
        },
        {
          "uuid": "e865c6e0-4858-3553-4ccf-03039dda89a4",
          "code": "407290",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=407290",
          "code_system": "NSC",
          "references": [
            "aa716d9d-e2d5-16a7-857f-2a9f06ea97a6"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7f10755d-e427-4445-bcb5-6e8ed8f26a58",
          "name": "3,3',4',5,5',7-HEXAHYDROXYFLAVONE",
          "stdName": "3,3',4',5,5',7-HEXAHYDROXYFLAVONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2be5c691-f745-465c-a334-e693fe5bd667",
            "c73ae8e0-ed0e-409d-a88b-dff6dba7e26f"
          ],
          "display_name": false
        },
        {
          "uuid": "e47596e0-5015-492e-a3ff-5cfca85a1782",
          "name": "3,5,7-TRIHYDROXY-2-(3,4,5-TRIHYDROXYPHENYL)-4H-1-BENZOPYRAN-4-ONE",
          "stdName": "3,5,7-TRIHYDROXY-2-(3,4,5-TRIHYDROXYPHENYL)-4H-1-BENZOPYRAN-4-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2be5c691-f745-465c-a334-e693fe5bd667",
            "c73ae8e0-ed0e-409d-a88b-dff6dba7e26f"
          ],
          "display_name": false
        },
        {
          "uuid": "b8a3ab78-daa6-4db6-9a36-4b408690344d",
          "name": "CANNABISCETIN",
          "stdName": "CANNABISCETIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2be5c691-f745-465c-a334-e693fe5bd667",
            "c73ae8e0-ed0e-409d-a88b-dff6dba7e26f"
          ],
          "display_name": false
        },
        {
          "uuid": "5c87479f-8bdd-460b-a77c-e2397b4d4ec4",
          "name": "DELPHIDENOLON 1575",
          "stdName": "DELPHIDENOLON 1575",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2be5c691-f745-465c-a334-e693fe5bd667",
            "c73ae8e0-ed0e-409d-a88b-dff6dba7e26f"
          ],
          "display_name": false
        },
        {
          "uuid": "3db10c5b-79ff-48b2-ae66-91a843f814a5",
          "name": "MYRICETIN",
          "stdName": "MYRICETIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6830deac-eabe-41fb-8b86-c1c2c8bb9676",
            "c5d370e8-951a-43b9-8f98-eee10306c28c",
            "281bf6b2-4332-4319-ae99-0738f5c43472",
            "c1556b63-2778-4acc-bb6b-e9ea76bece40",
            "2be5c691-f745-465c-a334-e693fe5bd667",
            "db2d025d-da1c-4889-a9b9-64c418ffe992",
            "784a13ec-6f2b-4688-915a-8fd2432adcc5",
            "a204b911-5eb8-48bb-b0e7-005ba6f572d8"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "090b54ba-d6ae-44c3-8d8b-96a290905b4b",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "bec91a9b-21dc-45f0-8e4a-56d396b4e09e",
          "name": "MYRICETIN [HSDB]",
          "stdName": "MYRICETIN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6830deac-eabe-41fb-8b86-c1c2c8bb9676",
            "2be5c691-f745-465c-a334-e693fe5bd667"
          ],
          "display_name": false
        },
        {
          "uuid": "7e68087f-aa55-4da7-8836-e46c3d1fee8c",
          "name": "MYRICETIN [MI]",
          "stdName": "MYRICETIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2be5c691-f745-465c-a334-e693fe5bd667",
            "784a13ec-6f2b-4688-915a-8fd2432adcc5"
          ],
          "display_name": false
        },
        {
          "uuid": "8919e3ca-4b92-4961-aeb4-bf5e633ba6b3",
          "name": "NSC-407290",
          "stdName": "NSC-407290",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a7366d76-f7f3-461b-bbfb-1423693a7f5e",
            "2be5c691-f745-465c-a334-e693fe5bd667"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c5d370e8-951a-43b9-8f98-eee10306c28c",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "784a13ec-6f2b-4688-915a-8fd2432adcc5",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2be5c691-f745-465c-a334-e693fe5bd667",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c73ae8e0-ed0e-409d-a88b-dff6dba7e26f",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a7366d76-f7f3-461b-bbfb-1423693a7f5e",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c1556b63-2778-4acc-bb6b-e9ea76bece40",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6830deac-eabe-41fb-8b86-c1c2c8bb9676",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a25725ad-f66f-4cf4-a712-87631bb01e2b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390939000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4cfd6dcc-1a72-4893-8878-401f71135a68",
          "citation": "SRS import [76XC01FTOJ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=76XC01FTOJ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390939000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c4f335aa-34a3-4891-8cd8-822148db7a27",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "281bf6b2-4332-4319-ae99-0738f5c43472",
          "citation": "MYRICETIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a204b911-5eb8-48bb-b0e7-005ba6f572d8",
          "citation": "MYRICETIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "db2d025d-da1c-4889-a9b9-64c418ffe992",
          "citation": "MYRICETIN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8b23fb04-6a71-bf8d-b0ac-950d02e250b2",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+529-44-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b5b16294-181b-d67e-63ee-af9ded39f6d8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=529-44-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "955f2cc2-2489-2ce3-84ac-554c7992910f",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "08a6f825-5a9b-4fea-a975-35d825cd9da8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "aa716d9d-e2d5-16a7-857f-2a9f06ea97a6",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "bef30c4d-6c22-405d-10cb-af608a4bf430",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "f89df173-d952-43e3-adf5-e0673827d9f1",
          "citation": "Journal of Ethnopharmacology Volume 148, Issue 3, 30 July 2013, Pages 804-811",
          "url": "https://www.sciencedirect.com/science/article/pii/S0378874113003450",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9fc5a0bb-2ab4-4a0b-ae75-d3dd4a54d6b4",
          "citation": "Journal of Ethnopharmacology Volume 148, Issue 3, 30 July 2013, Pages 804-811",
          "url": "https://www.sciencedirect.com/science/article/pii/S0378874113003450",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "77a79f2c-dd68-43b6-a088-3245b9af60cc",
          "id": "77a79f2c-dd68-43b6-a088-3245b9af60cc",
          "molfile": "\n  Marvin  01132106132D          \n\n 23 25  0  0  0  0            999 V2000\n    3.8272   -5.1192    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5602   -5.5194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5602   -6.3155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2784   -6.7402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2784   -7.5574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9818   -6.3155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9818   -5.4949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2784   -5.0947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6967   -5.0947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4149   -5.5194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1254   -5.0947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1254   -4.2742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8468   -3.8674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8468   -3.0502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5650   -4.2742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2948   -3.8674    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5650   -5.0947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2948   -5.4949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8468   -5.4949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4149   -6.3155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1434   -6.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6967   -6.7402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6967   -7.5574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  8  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  2  0  0  0  0\n  6 22  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 20  2  0  0  0  0\n 11 12  1  0  0  0  0\n 11 19  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 15  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 17  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 20  1  0  0  0  0\n 22 23  2  0  0  0  0\nM  END",
          "smiles": "c1c(cc(c(c1O)O)O)-c2c(c(=O)c3c(cc(cc3o2)O)O)O",
          "formula": "C15H10O8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ad7c5352-0fc0-4b6a-8aec-a77c28c9b8bf"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "318.2357",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5cbea2ee-e7d4-44e3-aa54-20e3c2fe5019",
      "version": "16",
      "structure": {
        "id": "a19e5a53-3b08-4502-88b3-f8f08b45f6a1",
        "molfile": "\n  Marvin  01132108242D          \n\n 23 25  0  0  0  0            999 V2000\n    5.9818   -5.4949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9818   -6.3155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6967   -6.7402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4149   -6.3155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1434   -6.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4149   -5.5194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6967   -5.0947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1254   -5.0947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8468   -5.4949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5650   -5.0947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5650   -4.2742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2948   -3.8674    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8468   -3.8674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1254   -4.2742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8468   -3.0502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2948   -5.4949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6967   -7.5574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2784   -6.7402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5602   -6.3155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5602   -5.5194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2784   -5.0947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8272   -5.1192    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2784   -7.5574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  2  0  0  0  0\n  7  6  1  0  0  0  0\n  1  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 11  2  0  0  0  0\n 14 13  1  0  0  0  0\n  8 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 10 16  1  0  0  0  0\n  3 17  2  0  0  0  0\n  2 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n  1 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 18 23  1  0  0  0  0\nM  END",
        "smiles": "c1c(cc(c(c1O)O)O)-c2c(c(=O)c3c(cc(cc3o2)O)O)O",
        "formula": "C15H10O8",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "318.2357",
        "optical_activity": "NONE",
        "references": [
          "4cfd6dcc-1a72-4893-8878-401f71135a68",
          "c4f335aa-34a3-4891-8cd8-822148db7a27"
        ],
        "stereo_centers": 0
      },
      "unii": "76XC01FTOJ"
    }
  ]
}