{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "2a4dd4e0-02af-4846-a701-7b8dbd956080", "code": "200-790-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.719", "code_system": "ECHA (EC/EINECS)", "references": [ "50b55432-5c74-4f10-ac0f-881997609b16" ] }, { "uuid": "a9c0c7c1-24aa-4d40-8cc0-55852d210550", "code": "444493", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/444493", "code_system": "PUBCHEM", "references": [ "50b55432-5c74-4f10-ac0f-881997609b16" ] }, { "uuid": "1c9fb868-6cba-450a-a3b4-1422799a901d", "code": "72-89-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=72-89-9", "code_system": "CAS", "references": [ "50b55432-5c74-4f10-ac0f-881997609b16", "da9eadbd-4dd8-437a-952e-0758ae1eba2b" ] }, { "uuid": "8a25c767-74bb-4c87-908a-937928a27a12", "code": "1490796", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1490796/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "50b55432-5c74-4f10-ac0f-881997609b16" ] }, { "uuid": "8d372596-ff9c-c8a0-1363-332c2f281fc8", "code": "Acetyl coenzyme A", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Acetyl_coenzyme%20A", "code_system": "WIKIPEDIA", "references": [ "6e7dca5c-5fe8-23dc-958b-ecb3af711275" ] }, { "uuid": "23b09d9f-5d00-de2e-6e9e-7d371cf983e0", "code": "C384", "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Nucleic Acids, Nucleosides, and Nucleotides[C708]|Nucleotide[C709]|Coenzyme A", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C384", "code_system": "NCI_THESAURUS", "references": [ "f2d4b0e5-8d9f-5da2-c2c1-dc747b9cdda0" ] }, { "uuid": "17c257a9-934a-78f7-a1fe-aa4b9287f40d", "code": "C199", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C199", "code_system": "NCI_THESAURUS", "references": [ "ad653eaa-364e-b45a-89cc-9d73a3a4fecc" ] }, { "uuid": "09e3f4c3-ec04-44ee-974c-3755e52cb1f4", "code": "76Q83YLO3O", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "f7bab157-e611-3071-41ee-6e8a3f05977a", "code": "15351", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:15351", "code_system": "CHEBI", "references": [ "f2d4b0e5-8d9f-5da2-c2c1-dc747b9cdda0" ] }, { "uuid": "01bc5be1-dc76-5464-802e-b5f5480e76ba", "code": "DTXSID30992686", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30992686", "code_system": "EPA CompTox", "references": [ "677fab9f-c1fd-4280-9f73-7f690c11ca16" ] }, { "uuid": "65a891e3-70ed-1f68-6414-f8e64b3105db", "code": "76Q83YLO3O", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=76Q83YLO3O", "code_system": "DAILYMED", "references": [ "5ae0c218-2081-4334-c0ff-a3728b7fe972" ] } ], "relationships": [ { "uuid": "f9c4c138-6201-4695-b14c-cd6ed70a014e", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "e3cb4301-517c-4326-9e14-57b82bbe7bb6", "refuuid": "f8d00ac1-e6b2-4550-a16d-3729615225bb", "name": "ACETYL COENZYME A", "unii": "76Q83YLO3O", "linking_id": "76Q83YLO3O", "ref_pname": "ACETYL COENZYME A", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "c34112aa-e6e5-4760-994e-9febc57f7e8b", "name": "ACETYL COA", "stdName": "ACETYL COA", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e77f3bfe-044a-4b36-86a1-6a62fe1bfbf1", "1b2975c3-013a-4f53-9e98-2ebf91fbfbe5" ], "display_name": false }, { "uuid": "abc81525-6f97-4a46-8302-785f1c2e4290", "name": "ACETYL COENZYME A", "stdName": "ACETYL COENZYME A", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e77f3bfe-044a-4b36-86a1-6a62fe1bfbf1", "1b2975c3-013a-4f53-9e98-2ebf91fbfbe5" ], "display_name": true }, { "uuid": "7035b9fb-4466-4e9c-9890-9eebadb6deaa", "name": "COENZYME A, S-ACETATE", "stdName": "COENZYME A, S-ACETATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e77f3bfe-044a-4b36-86a1-6a62fe1bfbf1", "1b2975c3-013a-4f53-9e98-2ebf91fbfbe5" ], "display_name": false }, { "uuid": "244f7ce5-7d12-4c23-836e-cce5a219de79", "name": "S-ACETYL COENZYME A", "stdName": "S-ACETYL COENZYME A", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e77f3bfe-044a-4b36-86a1-6a62fe1bfbf1", "1b2975c3-013a-4f53-9e98-2ebf91fbfbe5" ], "display_name": false } ], "references": [ { "uuid": "1b2975c3-013a-4f53-9e98-2ebf91fbfbe5", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "e77f3bfe-044a-4b36-86a1-6a62fe1bfbf1", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "50b55432-5c74-4f10-ac0f-881997609b16", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392688000, "tags": [ "NOMEN" ] }, { "uuid": "865ddf67-1738-4a51-9a15-33a420b252ca", "citation": "SRS import [76Q83YLO3O]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=76Q83YLO3O", "doc_type": "SRS", "public_domain": true, "document_date": 1493392688000, "tags": [ "NOMEN" ] }, { "uuid": "6e7dca5c-5fe8-23dc-958b-ecb3af711275", "citation": "WIKI", "url": "https://en.wikipedia.org/wiki/Acetyl_coenzyme%20A", "doc_type": "WIKI", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f2d4b0e5-8d9f-5da2-c2c1-dc747b9cdda0", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "ad653eaa-364e-b45a-89cc-9d73a3a4fecc", "citation": "NCIT", "doc_type": "NCI THESAURUS", "public_domain": true }, { "uuid": "da9eadbd-4dd8-437a-952e-0758ae1eba2b", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "5ae0c218-2081-4334-c0ff-a3728b7fe972", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "677fab9f-c1fd-4280-9f73-7f690c11ca16", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "5a61fcdb-43c8-4875-921d-4831501e12de", "id": "5a61fcdb-43c8-4875-921d-4831501e12de", "molfile": "\n Marvin 01132104412D \n\n 51 53 0 0 1 0 999 V2000\n 6.3521 -3.5088 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 6.3521 -2.6745 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6333 -3.9215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6333 -4.7512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9189 -3.5088 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2044 -3.9215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4812 -3.5088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7669 -3.9215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7669 -4.7512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0524 -3.5088 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3292 -3.9215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6192 -3.5088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0997 -3.9215 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8610 -3.4505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6133 -3.8367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7941 -2.6504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0710 -3.9215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4837 -4.6359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6540 -4.6359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7855 -3.5088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5042 -3.9215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3340 -3.9215 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3340 -4.7512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3340 -3.0917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1594 -3.9215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9892 -3.9215 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9892 -4.7512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9892 -3.0917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8190 -3.9215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5645 -3.5797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1635 -3.9703 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 13.7313 -3.5576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3039 -3.9747 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 14.3039 -2.7278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7387 -2.1554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3216 -1.5874 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6604 -1.8093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0126 -1.3877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0126 -0.6334 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3648 -1.7605 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3648 -2.5148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0126 -2.8875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6604 -2.5103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0997 -4.6359 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 14.4458 -5.2437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3897 -4.6359 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 13.0347 -5.2437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0347 -6.0691 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8646 -6.0691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2050 -6.0691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0347 -6.8989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 1 17 1 0 0 0 0\n 4 3 2 0 0 0 0\n 5 3 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 8 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 19 17 1 0 0 0 0\n 17 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 22 2 0 0 0 0\n 22 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 26 2 0 0 0 0\n 26 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 31 30 1 1 0 0 0\n 31 32 1 0 0 0 0\n 46 31 1 0 0 0 0\n 33 32 1 6 0 0 0\n 33 34 1 0 0 0 0\n 44 33 1 0 0 0 0\n 35 34 1 0 0 0 0\n 43 34 1 0 0 0 0\n 36 35 2 0 0 0 0\n 37 36 1 0 0 0 0\n 38 37 1 0 0 0 0\n 37 43 2 0 0 0 0\n 39 38 1 0 0 0 0\n 40 38 2 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 2 0 0 0 0\n 42 43 1 0 0 0 0\n 44 45 1 6 0 0 0\n 46 44 1 0 0 0 0\n 46 47 1 6 0 0 0\n 48 47 1 0 0 0 0\n 49 48 1 0 0 0 0\n 50 48 1 0 0 0 0\n 51 48 2 0 0 0 0\nM END", "smiles": "CC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc32)O1)O)OP(=O)(O)O)O", "formula": "C23H38N7O17P3S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "512024d1-0259-47a9-909c-5efa7d292f5e" }, "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "809.5729", "optical_activity": "UNSPECIFIED", "stereo_centers": 5 } ], "definition_level": "COMPLETE", "uuid": "f8d00ac1-e6b2-4550-a16d-3729615225bb", "version": "10", "structure": { "id": "017d1c76-b11d-49bc-8f65-aa9ed1dff218", "molfile": "\n Marvin 01132100242D \n\n 51 53 0 0 1 0 999 V2000\n 14.3039 -2.7278 0.0000 N 0 0 2 0 0 0 0 0 0 0 0 0\n 14.3039 -3.9747 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.0997 -4.6359 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 13.3897 -4.6359 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 13.0347 -5.2437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0347 -6.0691 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0347 -6.8989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8646 -6.0691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2050 -6.0691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1635 -3.9703 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 13.7313 -3.5576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5645 -3.5797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8190 -3.9215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9892 -3.9215 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1594 -3.9215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3340 -3.9215 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5042 -3.9215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7855 -3.5088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0710 -3.9215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3521 -3.5088 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.6333 -3.9215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6333 -4.7512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9189 -3.5088 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2044 -3.9215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4812 -3.5088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7669 -3.9215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7669 -4.7512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0524 -3.5088 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3292 -3.9215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6192 -3.5088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0997 -3.9215 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8610 -3.4505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7941 -2.6504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6133 -3.8367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3521 -2.6745 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4837 -4.6359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6540 -4.6359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3340 -3.0917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3340 -4.7512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9892 -3.0917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9892 -4.7512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4458 -5.2437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6604 -2.5103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6604 -1.8093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0126 -1.3877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0126 -0.6334 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3648 -1.7605 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3648 -2.5148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0126 -2.8875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3216 -1.5874 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7387 -2.1554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 1 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 6 0 0 0\n 6 5 1 0 0 0 0\n 7 6 2 0 0 0 0\n 8 6 1 0 0 0 0\n 9 6 1 0 0 0 0\n 4 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 2 1 0 0 0 0\n 10 12 1 1 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 2 0 0 0 0\n 23 21 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 2 0 0 0 0\n 28 26 1 0 0 0 0\n 29 28 1 0 0 0 0\n 30 29 1 0 0 0 0\n 31 30 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 32 34 1 0 0 0 0\n 20 35 1 6 0 0 0\n 36 19 1 0 0 0 0\n 37 19 1 0 0 0 0\n 38 16 2 0 0 0 0\n 39 16 1 0 0 0 0\n 40 14 2 0 0 0 0\n 41 14 1 0 0 0 0\n 3 42 1 6 0 0 0\n 43 1 1 0 0 0 0\n 44 43 2 0 0 0 0\n 45 44 1 0 0 0 0\n 46 45 1 0 0 0 0\n 47 45 2 0 0 0 0\n 47 48 1 0 0 0 0\n 48 49 2 0 0 0 0\n 49 43 1 0 0 0 0\n 44 50 1 0 0 0 0\n 50 51 2 0 0 0 0\n 51 1 1 0 0 0 0\nM END", "smiles": "CC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc32)O1)O)OP(=O)(O)O)O", "formula": "C23H38N7O17P3S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "809.5729", "optical_activity": "UNSPECIFIED", "references": [ "865ddf67-1738-4a51-9a15-33a420b252ca", "1b2975c3-013a-4f53-9e98-2ebf91fbfbe5" ], "stereo_centers": 5 }, "unii": "76Q83YLO3O" } ] }