{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "e13b8721-cf7b-4a3d-99f0-787b466735b4", "code": "6994-46-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=6994-46-3", "code_system": "CAS", "references": [ "abc94a42-4d92-45a3-817d-ff419a7b8f76", "2f70abb9-65c6-4035-a331-3343f612ec49" ] }, { "uuid": "bc5986e1-728c-437f-af25-476961f6f10d", "code": "230-263-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.027.513", "code_system": "ECHA (EC/EINECS)", "references": [ "abc94a42-4d92-45a3-817d-ff419a7b8f76" ] }, { "uuid": "93c78fad-adf4-453c-bf57-889ce5d02b2a", "code": "81473", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/81473", "code_system": "PUBCHEM", "references": [ "abc94a42-4d92-45a3-817d-ff419a7b8f76" ] }, { "uuid": "2fe464ec-7218-f30c-fde5-145caf1b5eb3", "code": "DTXSID6041559", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6041559", "code_system": "EPA CompTox", "references": [ "ba92fc62-2c6a-900c-815c-52bbb0da5966" ] }, { "uuid": "1a5ff7d3-eb0e-482f-9c5f-71b88c610b63", "code": "76MJF7P20V", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "258827d1-72c6-49d5-968f-bfd2735986d3", "name": "1,4-BIS(ETHYLAMINO)-9,10-ANTHRACENEDIONE", "stdName": "1,4-BIS(ETHYLAMINO)-9,10-ANTHRACENEDIONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d2cb2967-1e66-4125-bd6d-73cde5b57fdd", "38a82bdc-884a-4a66-b734-41601ea691f8" ], "display_name": false }, { "uuid": "699d79a1-bcff-4c94-b894-51a2d5f609ac", "name": "1,4-BIS(ETHYLAMINO)ANTHRAQUINONE", "stdName": "1,4-BIS(ETHYLAMINO)ANTHRAQUINONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "38a82bdc-884a-4a66-b734-41601ea691f8" ], "display_name": true }, { "uuid": "9f088d88-ca03-4fd2-a0a6-5e286ecdc34c", "name": "SOLVENT BLUE 59", "stdName": "SOLVENT BLUE 59", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d2cb2967-1e66-4125-bd6d-73cde5b57fdd", "38a82bdc-884a-4a66-b734-41601ea691f8" ], "display_name": false } ], "references": [ { "uuid": "38a82bdc-884a-4a66-b734-41601ea691f8", "citation": "http://www.chemblink.com/products/6994-46-3.htm", "url": "http://www.chemblink.com/products/6994-46-3.htm", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "d2cb2967-1e66-4125-bd6d-73cde5b57fdd", "citation": "WEB PAGE", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "abc94a42-4d92-45a3-817d-ff419a7b8f76", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391048000, "tags": [ "NOMEN" ] }, { "uuid": "70b2f5d9-8999-4196-969b-4779a16191d0", "citation": "SRS import [76MJF7P20V]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=76MJF7P20V", "doc_type": "SRS", "public_domain": true, "document_date": 1493391048000, "tags": [ "NOMEN" ] }, { "uuid": "bef5505b-74ad-4d7d-a09d-3b5e94bb9362", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ba92fc62-2c6a-900c-815c-52bbb0da5966", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6994-46-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "2f70abb9-65c6-4035-a331-3343f612ec49", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "4b4d9895-ecba-4875-abda-543fb1cac9c6", "id": "4b4d9895-ecba-4875-abda-543fb1cac9c6", "molfile": "\n Marvin 01132103562D \n\n 22 24 0 0 0 0 999 V2000\n 8.8401 -8.1381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8401 -7.3141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1196 -6.9039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1196 -6.0787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8320 -5.6627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8320 -4.8336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1128 -4.4303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1128 -3.6051 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8251 -3.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8251 -2.3681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4002 -4.8415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6844 -4.4314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6844 -3.6062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9692 -4.8455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2533 -4.4354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5396 -4.8446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5396 -5.6737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2554 -6.0883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9692 -5.6696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6911 -6.0798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6911 -6.9050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4002 -5.6704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 22 4 2 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 11 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 22 1 0 0 0 0\n 13 12 2 0 0 0 0\n 12 14 1 0 0 0 0\n 15 14 1 0 0 0 0\n 14 19 2 0 0 0 0\n 16 15 2 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 2 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 20 22 1 0 0 0 0\nM END", "smiles": "CCNc1ccc(c2c1C(=O)c3ccccc3C2=O)NCC", "formula": "C18H18N2O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "5f2a98dc-da23-4476-a218-a615fd7f33be" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "294.3484", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "c2f9ea23-1392-483d-af8f-f38cb5fdeeec", "version": "3", "structure": { "id": "242c4bd0-700e-4031-8ca4-55ed226dd360", "molfile": "\n Marvin 01132102012D \n\n 22 24 0 0 0 0 999 V2000\n 6.6844 -3.6062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6844 -4.4314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9692 -4.8455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9692 -5.6696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6911 -6.0798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6911 -6.9050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4002 -5.6704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1196 -6.0787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1196 -6.9039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8401 -7.3141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8401 -8.1381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8320 -5.6627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8320 -4.8336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1128 -4.4303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1128 -3.6051 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8251 -3.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8251 -2.3681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4002 -4.8415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2554 -6.0883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5396 -5.6737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5396 -4.8446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2533 -4.4354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 5 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 8 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 14 18 1 0 0 0 0\n 18 2 1 0 0 0 0\n 18 7 2 0 0 0 0\n 4 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 22 3 2 0 0 0 0\nM END", "smiles": "CCNc1ccc(c2c1C(=O)c3ccccc3C2=O)NCC", "formula": "C18H18N2O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "294.3484", "optical_activity": "NONE", "references": [ "bef5505b-74ad-4d7d-a09d-3b5e94bb9362", "70b2f5d9-8999-4196-969b-4779a16191d0" ], "stereo_centers": 0 }, "unii": "76MJF7P20V" } ] }