{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a7d7390d-e060-455b-a3fa-8128ee8d7dab",
          "code": "26538-44-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=26538-44-3",
          "code_system": "CAS",
          "references": [
            "c647369c-b0a0-42fa-ad31-973a1cf452c0",
            "9c6c5e89-bb64-4b38-b50c-ea539ba5e6df"
          ]
        },
        {
          "uuid": "efd42c8f-dbc5-4c4d-8d27-3685f9eb6d47",
          "code": "C76826",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76826",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c647369c-b0a0-42fa-ad31-973a1cf452c0"
          ]
        },
        {
          "uuid": "0f295752-b85b-4643-b323-908c4922f36f",
          "code": "D015029",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68015029",
          "code_system": "MESH",
          "references": [
            "c647369c-b0a0-42fa-ad31-973a1cf452c0"
          ]
        },
        {
          "uuid": "c80e3994-2644-4b2a-a351-b31e530cd685",
          "code": "ZERANOL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Zeranol",
          "code_system": "WIKIPEDIA",
          "references": [
            "c647369c-b0a0-42fa-ad31-973a1cf452c0"
          ]
        },
        {
          "uuid": "b4414a15-16ea-47f8-a0f2-ee89a724a992",
          "code": "21 CFR 522.2680",
          "comments": "PART 522 IMPLANTATION OR INJECTABLE DOSAGE FORM NEW ANIMAL DRUGS|Sec. 522.2680 Zeranol.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=522.2680",
          "code_system": "CFR",
          "references": [
            "c647369c-b0a0-42fa-ad31-973a1cf452c0"
          ]
        },
        {
          "uuid": "39fdabfc-bd8a-4de7-bed8-4a73a57bd93b",
          "code": "SUB00148MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "c647369c-b0a0-42fa-ad31-973a1cf452c0"
          ]
        },
        {
          "uuid": "6adaf92c-9aea-470c-af36-bfe097bf146c",
          "code": "2844",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2844",
          "code_system": "INN",
          "references": [
            "c647369c-b0a0-42fa-ad31-973a1cf452c0"
          ]
        },
        {
          "uuid": "17530afd-ea84-4fc2-ada5-c81b7cfa6555",
          "code": "247-769-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.043.411",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c647369c-b0a0-42fa-ad31-973a1cf452c0"
          ]
        },
        {
          "uuid": "17f2c804-79f6-45d2-8215-8d64d3e7b4a8",
          "code": "1368476",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1368476/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "c647369c-b0a0-42fa-ad31-973a1cf452c0"
          ]
        },
        {
          "uuid": "3c4909a7-5977-4e26-bc5b-cb61e3e334f6",
          "code": "m11589",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11589?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "c647369c-b0a0-42fa-ad31-973a1cf452c0"
          ]
        },
        {
          "uuid": "153e5374-a4e0-41bd-870e-2b12bd9a8329",
          "code": "21 CFR 556.760",
          "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 556 -- TOLERANCES FOR RESIDUES OF NEW ANIMAL DRUGS IN FOOD|Subpart B--Specific Tolerances for Residues of New Animal Drugs|Sec. 556.760 Zeranol.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=556.760",
          "code_system": "CFR",
          "references": [
            "c647369c-b0a0-42fa-ad31-973a1cf452c0"
          ]
        },
        {
          "uuid": "605a7ba1-765d-40c6-ad53-7151096eb23e",
          "code": "CHEMBL450613",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL450613",
          "code_system": "ChEMBL",
          "references": [
            "c647369c-b0a0-42fa-ad31-973a1cf452c0"
          ]
        },
        {
          "uuid": "82c98465-4194-44a1-a8a9-49b8d6581c6e",
          "code": "2999413",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2999413",
          "code_system": "PUBCHEM",
          "references": [
            "c647369c-b0a0-42fa-ad31-973a1cf452c0"
          ]
        },
        {
          "uuid": "8af687dd-3554-8e7e-771f-c5d347cbb10c",
          "code": "DTXSID4022315",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4022315",
          "code_system": "EPA CompTox",
          "references": [
            "2d5151d3-0c1d-58a9-6603-4c3bd1b6a149"
          ]
        },
        {
          "uuid": "45c6589e-27b4-bd00-db97-3e2dab1d3e5f",
          "code": "C2182",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Therapeutic Estrogen[C483]|Non-Steroidal Estrogen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2182",
          "code_system": "NCI_THESAURUS",
          "references": [
            "957a837d-859a-28a3-5bdd-a6d4258472cb"
          ]
        },
        {
          "uuid": "f5732e74-ba53-4710-904c-82c08a877979",
          "code": "76LO2L2V39",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8311d528-bc37-c16d-5ce8-871f93d67031",
          "code": "2860",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2860",
          "code_system": "DRUG CENTRAL",
          "references": [
            "957a837d-859a-28a3-5bdd-a6d4258472cb"
          ]
        },
        {
          "uuid": "066fe0f4-8140-8cab-03d2-2eea1932bfb1",
          "code": "DB11478",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11478",
          "code_system": "DRUG BANK",
          "references": [
            "957a837d-859a-28a3-5bdd-a6d4258472cb"
          ]
        },
        {
          "uuid": "fb45a67e-661b-a64d-d68d-d86d9485dc86",
          "code": "76LO2L2V39",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=76LO2L2V39",
          "code_system": "DAILYMED",
          "references": [
            "72913ce4-732c-70d9-946d-2c0c55538e4b"
          ]
        },
        {
          "uuid": "510eab61-6211-e9e5-a9e0-3a1842d4b3fa",
          "code": "100000079414",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "6955eef9-88e5-00c5-ebc5-132b93f25496"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "8a517886-0770-4d91-af06-56d04c46ff9a",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "e8fba2ba-9ac9-4f4b-a0de-a989271df39f",
            "refuuid": "af91272b-c964-485e-b0fe-f816a97e159a",
            "name": "ZERANOL",
            "unii": "76LO2L2V39",
            "linking_id": "76LO2L2V39",
            "ref_pname": "ZERANOL",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6adb0599-553e-4a2b-82ce-34561780f7b3",
          "name": "(-)-.ALPHA.-ZEARALANOL",
          "stdName": "(-)-.ALPHA.-ZEARALANOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0fa6d4e3-b6c9-4374-9789-3cf70b6958bc"
          ],
          "display_name": false
        },
        {
          "uuid": "eafd087a-5933-486d-aba5-6e47df1c8c18",
          "name": "1H-2-BENZOXACYCLOTETRADECIN-1-ONE, 3,4,5,6,7,8,9,10,11,12-DECAHYDRO-7,14,16-TRIHYDROXY-3-METHYL-, (3S,7R)-",
          "stdName": "1H-2-BENZOXACYCLOTETRADECIN-1-ONE, 3,4,5,6,7,8,9,10,11,12-DECAHYDRO-7,14,16-TRIHYDROXY-3-METHYL-, (3S,7R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0fa6d4e3-b6c9-4374-9789-3cf70b6958bc"
          ],
          "display_name": false
        },
        {
          "uuid": "e91fa1e7-9cb2-42b1-8237-b1c0f986488b",
          "name": "MK-188",
          "stdName": "MK-188",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "07c8ad3f-1702-4ad6-b77c-430ebf5384ba"
          ],
          "display_name": false
        },
        {
          "uuid": "209859b9-9893-409e-b23f-4101077f8bbd",
          "name": "P-1496",
          "stdName": "P-1496",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "07c8ad3f-1702-4ad6-b77c-430ebf5384ba"
          ],
          "display_name": false
        },
        {
          "uuid": "c41cd66b-fc5f-4c8a-afda-d770a42c2d78",
          "name": "RALABOL",
          "stdName": "RALABOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "07c8ad3f-1702-4ad6-b77c-430ebf5384ba"
          ],
          "display_name": false
        },
        {
          "uuid": "c8447840-dc70-4198-b370-11e711185478",
          "name": "RALGRO",
          "stdName": "RALGRO",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "07c8ad3f-1702-4ad6-b77c-430ebf5384ba"
          ],
          "display_name": false
        },
        {
          "uuid": "1ed834ed-d1f4-4ef6-ac11-dbfc3e17c819",
          "name": "THFES (HM)",
          "stdName": "THFES (HM)",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "07c8ad3f-1702-4ad6-b77c-430ebf5384ba"
          ],
          "display_name": false
        },
        {
          "uuid": "18aea82e-8790-4ebb-8ee1-742906dbcd1b",
          "name": "ZERANOL",
          "stdName": "ZERANOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "16135c93-8117-4e37-8bba-839a3847ed47",
            "b76633cb-2c2c-4c74-963b-03e53caced04",
            "6d911122-76cd-4b84-8eba-079613db123e",
            "203bf80b-29de-4bc8-bde2-552c7ac47aee",
            "3bce7889-7a10-48bf-8c42-b74f429e6ab1",
            "bc44540d-e569-45f9-be25-4d3fa81f953e",
            "e1d5d6ed-1de2-4333-b087-2b026d94988a",
            "342411e9-9f79-4f14-9adb-7bb14e84e62f",
            "9bca554c-d90c-450a-972f-672dc1f8ccbd",
            "09d52b00-2f6b-4ec0-a3ca-6d942f6014ee",
            "d40fcb9b-ae6e-40df-a626-96cbf9c351dd"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "e89f28f3-2762-4621-af64-e8fa2e397e51",
              "name_org": "INN"
            },
            {
              "uuid": "4f98e748-7a10-4738-9fa5-10addfed46cf",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "c1f30c2c-782e-4041-9554-8aff892e1df7",
          "name": "ZERANOL [GREEN BOOK]",
          "stdName": "ZERANOL [GREEN BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9bca554c-d90c-450a-972f-672dc1f8ccbd"
          ],
          "display_name": false
        },
        {
          "uuid": "66068c56-99c1-4c2a-b623-a457009d9eab",
          "name": "ZERANOL [MART.]",
          "stdName": "ZERANOL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "203bf80b-29de-4bc8-bde2-552c7ac47aee"
          ],
          "display_name": false
        },
        {
          "uuid": "c8f4093d-4766-459e-b3da-f2c3358875a4",
          "name": "ZERANOL [MI]",
          "stdName": "ZERANOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d40fcb9b-ae6e-40df-a626-96cbf9c351dd"
          ],
          "display_name": false
        },
        {
          "uuid": "325a3385-2992-48ef-bac3-4be7315fda6b",
          "name": "ZERANOL [USAN]",
          "stdName": "ZERANOL [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d911122-76cd-4b84-8eba-079613db123e"
          ],
          "display_name": false
        },
        {
          "uuid": "81c580e1-b5bf-489c-b02f-b3818276fd17",
          "name": "zeranol [INN]",
          "stdName": "ZERANOL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09d52b00-2f6b-4ec0-a3ca-6d942f6014ee"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b76633cb-2c2c-4c74-963b-03e53caced04",
          "citation": "USP Dictionary 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0fa6d4e3-b6c9-4374-9789-3cf70b6958bc",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ff597ac-9911-439e-b5fb-596a01e74123",
          "citation": "ccd 2007",
          "doc_type": "COMBINED CHEMICAL DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "07c8ad3f-1702-4ad6-b77c-430ebf5384ba",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "09d52b00-2f6b-4ec0-a3ca-6d942f6014ee",
          "citation": "INN Proposed List 33",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL33.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6d911122-76cd-4b84-8eba-079613db123e",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "203bf80b-29de-4bc8-bde2-552c7ac47aee",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d40fcb9b-ae6e-40df-a626-96cbf9c351dd",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9bca554c-d90c-450a-972f-672dc1f8ccbd",
          "citation": "FDA SRS 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c647369c-b0a0-42fa-ad31-973a1cf452c0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389651000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4487160f-0908-43cf-aaac-c1a8eeb0bc37",
          "citation": "SRS import [76LO2L2V39]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=76LO2L2V39",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389651000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e491754-9f6d-4c57-8aec-7f31aac4d5fb",
          "citation": "USP Dictionary 2007",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3bce7889-7a10-48bf-8c42-b74f429e6ab1",
          "citation": "ZERANOL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "16135c93-8117-4e37-8bba-839a3847ed47",
          "citation": "ZERANOL [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "342411e9-9f79-4f14-9adb-7bb14e84e62f",
          "citation": "ZERANOL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bc44540d-e569-45f9-be25-4d3fa81f953e",
          "citation": "ZERANOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e1d5d6ed-1de2-4333-b087-2b026d94988a",
          "citation": "ZERANOL [GREEN BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2d5151d3-0c1d-58a9-6603-4c3bd1b6a149",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=26538-44-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6955eef9-88e5-00c5-ebc5-132b93f25496",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "957a837d-859a-28a3-5bdd-a6d4258472cb",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "9c6c5e89-bb64-4b38-b50c-ea539ba5e6df",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "72913ce4-732c-70d9-946d-2c0c55538e4b",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fddac8db-4869-4d53-b75f-7e4de716fe7d",
          "id": "fddac8db-4869-4d53-b75f-7e4de716fe7d",
          "molfile": "\n  Marvin  01132113092D          \n\n 23 24  0  0  1  0            999 V2000\n    4.3675   -7.7667    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.3675   -6.9433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0831   -8.1751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7940   -7.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5005   -8.1751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5005   -9.0050    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.2122   -9.4178    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7940   -9.4236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0831   -9.0050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3675   -9.4236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6538   -9.0050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9501   -9.4236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2364   -9.0050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5251   -9.4236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8070   -9.0050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0972   -9.4282    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8070   -8.1751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5251   -7.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5251   -6.9459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2364   -8.1751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9501   -7.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9501   -6.9433    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6538   -8.1751    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 23  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 20  2  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 18  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 21 23  1  0  0  0  0\nM  END",
          "smiles": "C[C@H]1CCC[C@@H](CCCCCc2cc(cc(c2C(=O)O1)O)O)O",
          "formula": "C18H26O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "74692871-1976-4a19-8d64-d4eb85fed170"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "322.3967",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "af91272b-c964-485e-b0fe-f816a97e159a",
      "version": "10",
      "structure": {
        "id": "c2e32a16-c06f-4707-a0cd-e0c10cacbc42",
        "molfile": "\n  Marvin  01132110042D          \n\n 23 24  0  0  1  0            999 V2000\n    2.2364   -9.0050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2364   -8.1751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5251   -9.4236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9501   -9.4236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5251   -7.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9501   -7.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8070   -9.0050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6538   -9.0050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8070   -8.1751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5251   -6.9459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6538   -8.1751    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9501   -6.9433    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0972   -9.4282    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3675   -9.4236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3675   -7.7667    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.0831   -9.0050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0831   -8.1751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3675   -6.9433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7940   -9.4236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7940   -7.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5005   -9.0050    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.5005   -8.1751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2122   -9.4178    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  2  0  0  0  0\n  4  8  1  0  0  0  0\n  5  9  2  0  0  0  0\n  5 10  1  0  0  0  0\n  6 11  1  0  0  0  0\n  6 12  2  0  0  0  0\n  7 13  1  0  0  0  0\n  8 14  1  0  0  0  0\n 11 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 15 18  1  1  0  0  0\n 16 19  1  0  0  0  0\n 17 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 21 23  1  6  0  0  0\n  7  9  1  0  0  0  0\n 21 22  1  0  0  0  0\nM  END",
        "smiles": "C[C@H]1CCC[C@@H](CCCCCc2cc(cc(c2C(=O)O1)O)O)O",
        "formula": "C18H26O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "322.3967",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "4e491754-9f6d-4c57-8aec-7f31aac4d5fb",
          "4487160f-0908-43cf-aaac-c1a8eeb0bc37",
          "09d52b00-2f6b-4ec0-a3ca-6d942f6014ee"
        ],
        "stereo_centers": 2
      },
      "unii": "76LO2L2V39"
    }
  ]
}