{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0d8c9d51-6341-4a00-8ed1-4388b5b6b003",
          "code": "69198-10-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=69198-10-3",
          "code_system": "CAS",
          "references": [
            "9675c636-9f75-4428-9e64-579148b79fcc",
            "d5cfa256-78bd-4bed-afd8-b759e64025cc"
          ]
        },
        {
          "uuid": "4f99b686-6de3-4ce0-937c-a0a1e966447e",
          "code": "C48005",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C48005",
          "code_system": "NCI_THESAURUS",
          "references": [
            "9675c636-9f75-4428-9e64-579148b79fcc"
          ]
        },
        {
          "uuid": "7dee379a-cd19-46fe-ae70-beb24b6170b7",
          "code": "82047",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/82047/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "9675c636-9f75-4428-9e64-579148b79fcc"
          ]
        },
        {
          "uuid": "f5a3c462-b2a5-4819-a8e4-e5f711d077bb",
          "code": "m7506",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7506?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "9675c636-9f75-4428-9e64-579148b79fcc"
          ]
        },
        {
          "uuid": "25483611-a7de-46eb-9955-15d4876d200b",
          "code": "SUB14570MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "9675c636-9f75-4428-9e64-579148b79fcc"
          ]
        },
        {
          "uuid": "918a56d2-a344-4cf9-a2b2-761e1bb570f1",
          "code": "CHEMBL137",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL137",
          "code_system": "ChEMBL",
          "references": [
            "9675c636-9f75-4428-9e64-579148b79fcc"
          ]
        },
        {
          "uuid": "bff4865b-fc2f-4a9c-b5a0-243b31f7f435",
          "code": "68592",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/68592",
          "code_system": "PUBCHEM",
          "references": [
            "9675c636-9f75-4428-9e64-579148b79fcc"
          ]
        },
        {
          "uuid": "45ed1177-0937-bdb5-151a-24c541c33db4",
          "code": "DTXSID70219228",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70219228",
          "code_system": "EPA CompTox",
          "references": [
            "a7e71dad-4d0a-4444-9188-b4382c4f8b04"
          ]
        },
        {
          "uuid": "b4c74d41-2617-c13a-3a46-0ae9c8d82849",
          "code": "C784",
          "comments": "Pharmacologic Substance[C1909]|Protein Synthesis Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C784",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2b8cebb0-c12e-0bac-57fb-7c18aa4f153b"
          ]
        },
        {
          "uuid": "8fc19b94-1a2e-d751-50e0-c482a6608c7e",
          "code": "C279",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antiparasitic Agent[C276]|Antiprotozoal Agent[C277]|Trichomonacide Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C279",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2b8cebb0-c12e-0bac-57fb-7c18aa4f153b"
          ]
        },
        {
          "uuid": "ce8c02bf-28e5-e314-18da-e9dcaf63b090",
          "code": "DBSALT000362",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DBSALT000362",
          "code_system": "DRUG BANK",
          "references": [
            "2b8cebb0-c12e-0bac-57fb-7c18aa4f153b"
          ]
        },
        {
          "uuid": "e0c12100-d732-42e4-93b1-497bcb0ca5f0",
          "code": "76JC1633UF",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8439302b-ad57-f51e-7e95-17e51a3eaeeb",
          "code": "50687",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:50687",
          "code_system": "CHEBI",
          "references": [
            "2b8cebb0-c12e-0bac-57fb-7c18aa4f153b"
          ]
        },
        {
          "uuid": "b77a9044-09bf-6530-d2e8-a6d212e73607",
          "code": "100000076224",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "f97ff9cc-bb39-c6b0-7001-b8e06784d8f8"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "8fc68db1-c15a-4f9e-afca-4dc4e7e89aed",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "f7066a7e-1bbd-4a5d-82a6-dccdc997873f",
            "refuuid": "6a8b7893-3216-4541-a338-54e2a9a76933",
            "name": "METRONIDAZOLE",
            "unii": "140QMO216E",
            "linking_id": "140QMO216E",
            "ref_pname": "METRONIDAZOLE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "07d166b1-80f8-4c06-9af2-a5ad4e441e76",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "fb85bafc-3566-445a-a4e1-2ec02ad4c8dc",
            "refuuid": "6a8b7893-3216-4541-a338-54e2a9a76933",
            "name": "METRONIDAZOLE",
            "unii": "140QMO216E",
            "linking_id": "140QMO216E",
            "ref_pname": "METRONIDAZOLE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8da53b42-3077-4cb1-894a-f91c1cacd467",
          "name": "1H-IMIDAZOLE-1-ETHANOL, 2-METHYL-5-NITRO-, HYDROCHLORIDE",
          "stdName": "1H-IMIDAZOLE-1-ETHANOL, 2-METHYL-5-NITRO-, HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15973a58-2eb0-41ff-949c-59a0d37c01a5"
          ],
          "display_name": false
        },
        {
          "uuid": "3ae3b9c1-495a-4f4d-bb71-0ee38d8747d2",
          "name": "2-Methyl-5-nitroimidazole-1-ethanol monohydrochloride",
          "stdName": "2-METHYL-5-NITROIMIDAZOLE-1-ETHANOL MONOHYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15973a58-2eb0-41ff-949c-59a0d37c01a5"
          ],
          "display_name": false
        },
        {
          "uuid": "7a2ec9cd-f935-4730-90cb-80e9b22db8c2",
          "name": "FLAGYL I.V.",
          "stdName": "FLAGYL I.V.",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04d7e537-3621-4eb1-9a47-1f96beceb9be",
            "34ce2979-374a-4db2-a6f6-d3f2bba52e7b"
          ],
          "display_name": false
        },
        {
          "uuid": "8cda1a9a-4de6-4cfd-89b8-3b942e7315e7",
          "name": "METRONIDAZOLE HCL",
          "stdName": "METRONIDAZOLE HCL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c72df8b0-a15b-4bfd-84e6-9d365e003b72"
          ],
          "display_name": false
        },
        {
          "uuid": "1cb36f04-06d2-4a3c-b81d-6d0c81918b42",
          "name": "METRONIDAZOLE HYDROCHLORIDE",
          "stdName": "METRONIDAZOLE HYDROCHLORIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cc56107-ba86-4346-90f9-3ae3e6ec2da5",
            "23c37fed-81d2-4360-bc4b-b80636d625f3",
            "10ef7032-667d-4ac9-bd22-7dcc5c66eb5d",
            "d4bbd10d-7e93-44f0-b479-08b3779ee595",
            "b9721641-f1fe-4a34-ab25-ab24c9d60ece",
            "fed33888-42dd-487f-9360-009871ae60c3",
            "7146fac2-c76c-4100-a4b5-cfd5815850b8",
            "02815e29-02bb-4b56-881a-9aba934ea2de",
            "d3478017-6032-4cbc-a978-1e348ec1fd39",
            "563e3181-0ae6-4622-a191-d892dfc35eaf",
            "020c7605-202c-4b6e-9687-2fa331871800",
            "59c21628-dbc4-4138-b02d-aa54ba72e1de",
            "818f0c07-a72e-45ad-bb8e-d09715ba0369"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "133166fe-4a56-44f5-8385-7f2bc3317e43",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "eb3b8d9f-dd6a-4884-8407-0cc78e9702bd",
          "name": "METRONIDAZOLE HYDROCHLORIDE [MART.]",
          "stdName": "METRONIDAZOLE HYDROCHLORIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "563e3181-0ae6-4622-a191-d892dfc35eaf"
          ],
          "display_name": false
        },
        {
          "uuid": "141932f2-c4e6-4a0b-88a3-e08985d4c63e",
          "name": "METRONIDAZOLE HYDROCHLORIDE [MI]",
          "stdName": "METRONIDAZOLE HYDROCHLORIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59c21628-dbc4-4138-b02d-aa54ba72e1de"
          ],
          "display_name": false
        },
        {
          "uuid": "6fe2bf62-aaed-4e3c-a274-70c4035daf7c",
          "name": "METRONIDAZOLE HYDROCHLORIDE [ORANGE BOOK]",
          "stdName": "METRONIDAZOLE HYDROCHLORIDE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4bbd10d-7e93-44f0-b479-08b3779ee595"
          ],
          "display_name": false
        },
        {
          "uuid": "a3530794-5598-41af-8b0f-562c3cea5596",
          "name": "METRONIDAZOLE HYDROCHLORIDE [USAN]",
          "stdName": "METRONIDAZOLE HYDROCHLORIDE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "818f0c07-a72e-45ad-bb8e-d09715ba0369"
          ],
          "display_name": false
        },
        {
          "uuid": "b4f77eee-ad01-48cf-b6cf-8227f3273214",
          "name": "METRONIDAZOLE HYDROCHLORIDE [VANDF]",
          "stdName": "METRONIDAZOLE HYDROCHLORIDE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fed33888-42dd-487f-9360-009871ae60c3"
          ],
          "display_name": false
        },
        {
          "uuid": "32c8bf79-2bf1-c096-c88f-f4b1137d0581",
          "name": "Metronidazole hydrochloride [WHO-DD]",
          "stdName": "METRONIDAZOLE HYDROCHLORIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8682892-c2a9-3b25-76bc-e042067574ec"
          ],
          "display_name": false
        },
        {
          "uuid": "53fe8b9a-1018-4956-a5c4-c21d0d697b0a",
          "name": "SC-32642",
          "stdName": "SC-32642",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15973a58-2eb0-41ff-949c-59a0d37c01a5"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b9721641-f1fe-4a34-ab25-ab24c9d60ece",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "15973a58-2eb0-41ff-949c-59a0d37c01a5",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c72df8b0-a15b-4bfd-84e6-9d365e003b72",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "818f0c07-a72e-45ad-bb8e-d09715ba0369",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4bbd10d-7e93-44f0-b479-08b3779ee595",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "563e3181-0ae6-4622-a191-d892dfc35eaf",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "34ce2979-374a-4db2-a6f6-d3f2bba52e7b",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "04d7e537-3621-4eb1-9a47-1f96beceb9be",
          "citation": "D05016",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02815e29-02bb-4b56-881a-9aba934ea2de",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fed33888-42dd-487f-9360-009871ae60c3",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "59c21628-dbc4-4138-b02d-aa54ba72e1de",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9675c636-9f75-4428-9e64-579148b79fcc",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389736000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d45d8c9f-a7fa-4c3b-bd64-21b2e5727019",
          "citation": "SRS import [76JC1633UF]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=76JC1633UF",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389736000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d3478017-6032-4cbc-a978-1e348ec1fd39",
          "citation": "METRONIDAZOLE HYDROCHLORIDE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "10ef7032-667d-4ac9-bd22-7dcc5c66eb5d",
          "citation": "METRONIDAZOLE HYDROCHLORIDE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7146fac2-c76c-4100-a4b5-cfd5815850b8",
          "citation": "METRONIDAZOLE HYDROCHLORIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "020c7605-202c-4b6e-9687-2fa331871800",
          "citation": "METRONIDAZOLE HYDROCHLORIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3cc56107-ba86-4346-90f9-3ae3e6ec2da5",
          "citation": "METRONIDAZOLE HYDROCHLORIDE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "23c37fed-81d2-4360-bc4b-b80636d625f3",
          "citation": "METRONIDAZOLE HYDROCHLORIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a7e71dad-4d0a-4444-9188-b4382c4f8b04",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=69198-10-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f97ff9cc-bb39-c6b0-7001-b8e06784d8f8",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "2b8cebb0-c12e-0bac-57fb-7c18aa4f153b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d5cfa256-78bd-4bed-afd8-b759e64025cc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d8682892-c2a9-3b25-76bc-e042067574ec",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d0aa4217-8bd0-4974-bf70-52c4fe3dffe5",
          "id": "d0aa4217-8bd0-4974-bf70-52c4fe3dffe5",
          "molfile": "\n  Marvin  01132110472D          \n\n  1  0  0  0  0  0            999 V2000\n    3.0054   -1.4541    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "35aef157-5acd-4e74-9fad-7fb6db2d2ea7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "d99ca974-9c10-4cb3-8bd0-d846fed72a7e",
          "id": "d99ca974-9c10-4cb3-8bd0-d846fed72a7e",
          "molfile": "\n  Marvin  01132111172D          \n\n 12 12  0  0  0  0            999 V2000\n    0.1024   -2.8278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5094   -2.2261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.5150    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5325   -0.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3076   -1.1387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3076   -1.9830    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0034   -2.4719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7561   -2.1340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4493   -2.6358    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0034   -0.6472    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    2.7663   -0.9851    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.0034    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  6  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  5  1  0  0  0  0\n 10  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  2  0  0  0  0\nM  CHG  2  10   1  11  -1\nM  END",
          "smiles": "Cc1ncc(n1CCO)[N+](=O)[O-]",
          "formula": "C6H9N3O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4f7adbf8-0f6b-45b4-ade9-7c1c98fb36e8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "171.1542",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "54ee5b1f-f5fd-44f9-ab23-844c9f0d905c",
      "version": "14",
      "structure": {
        "id": "622abde2-7a00-459d-bc6d-6657919be171",
        "molfile": "\n  Marvin  01132105052D          \n\n 13 12  0  0  0  0            999 V2000\n    1.3077   -1.1388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3077   -1.9832    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0036   -0.6473    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    0.5325   -0.8751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.5151    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5094   -2.2263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7665   -0.9852    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.0036    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0036   -2.4721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1024   -2.8280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4496   -2.6360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7563   -2.1342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0046   -1.4537    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  3  1  0  0  0  0\n  8  3  2  0  0  0  0\n  9  2  1  0  0  0  0\n 10  6  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12  9  1  0  0  0  0\n  5  6  2  0  0  0  0\nM  CHG  2   3   1   7  -1\nM  END",
        "smiles": "Cc1ncc(n1CCO)[N+](=O)[O-].Cl",
        "formula": "C6H9N3O3.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "207.6151",
        "optical_activity": "NONE",
        "references": [
          "b9721641-f1fe-4a34-ab25-ab24c9d60ece",
          "d45d8c9f-a7fa-4c3b-bd64-21b2e5727019"
        ],
        "stereo_centers": 0
      },
      "unii": "76JC1633UF"
    }
  ]
}