{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bea9b0a9-d8c4-4d1f-abad-9bd0d3942443",
          "code": "1085-98-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1085-98-9",
          "code_system": "CAS",
          "references": [
            "f694dadc-c454-4a40-a901-8f6f84023481",
            "c5c86d71-f6d4-468b-9c57-f1075eacf545"
          ]
        },
        {
          "uuid": "c62820e1-fc4c-4cfb-ab09-a491c8ff724f",
          "code": "128844",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:74",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "f694dadc-c454-4a40-a901-8f6f84023481"
          ]
        },
        {
          "uuid": "32f9a68a-aeae-4258-bee3-b4279eef684f",
          "code": "214-118-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.012.835",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f694dadc-c454-4a40-a901-8f6f84023481"
          ]
        },
        {
          "uuid": "af210511-dd19-4fdb-863c-6fa6cdcba9a2",
          "code": "m4323",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4323?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "f694dadc-c454-4a40-a901-8f6f84023481"
          ]
        },
        {
          "uuid": "4d9bc772-f120-46ab-b81b-89ad9bd6b756",
          "code": "14145",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/14145",
          "code_system": "PUBCHEM",
          "references": [
            "f694dadc-c454-4a40-a901-8f6f84023481"
          ]
        },
        {
          "uuid": "0db2954b-f4f3-06d9-3c35-07d596b8c4f9",
          "code": "1565",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1565",
          "code_system": "HSDB",
          "references": [
            "9de3540a-6910-07a5-f88d-ee80b9856efa"
          ]
        },
        {
          "uuid": "fc92b42a-2a38-4105-66c3-33e38cf50e40",
          "code": "DTXSID5041851",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5041851",
          "code_system": "EPA CompTox",
          "references": [
            "2b2c4430-1566-6df7-a5a1-07f191bd31ee"
          ]
        },
        {
          "uuid": "f74bf239-fdfd-fb6e-e4d3-42dc8e7b6cce",
          "code": "74875",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:74875",
          "code_system": "CHEBI",
          "references": [
            "e939acee-2a15-81ad-f746-f34090ec6eb1"
          ]
        },
        {
          "uuid": "83bde31e-3d2c-5050-ef86-44fe257f4dfc",
          "code": "Dichlofluanid",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Dichlofluanid",
          "code_system": "WIKIPEDIA",
          "references": [
            "4bc0f36f-3e7b-469a-8805-1465dea1310c"
          ]
        },
        {
          "uuid": "1b8bdb39-fb31-4799-8b58-96587b16b757",
          "code": "76A92XU36Y",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "07c6dc62-ad58-ca0d-a9b6-737192f9c926",
          "code": "dichlofluanid",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/dichlofluanid.html",
          "code_system": "ALANWOOD",
          "references": [
            "ce6a30d0-1b3e-9d8d-fbd1-a3782634c65d"
          ]
        },
        {
          "uuid": "3dd7e1ed-ab5b-4f11-cd44-e4b5fc44e7b6",
          "code": "218451",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=218451",
          "code_system": "NSC",
          "references": [
            "1efd4c4d-c390-bdc6-213d-7a96575e74e7"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "279a0385-fef3-4a1c-bb29-b2156c535d39",
          "name": "1,1-DICHLORO-N-((DIMETHYLAMINO)SULFONYL)-1-FLUORO-N-PHENYLMETHANESULFENAMIDE",
          "stdName": "1,1-DICHLORO-N-((DIMETHYLAMINO)SULFONYL)-1-FLUORO-N-PHENYLMETHANESULFENAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a53960e5-50cb-4b9c-84a0-b44d73d12404",
            "973192b2-450b-4b5e-ae23-4e7ee527814e"
          ],
          "display_name": false
        },
        {
          "uuid": "077f4681-deb8-4ade-938b-e06697b67e18",
          "name": "BAYER 47531",
          "stdName": "BAYER 47531",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7431505-8802-4b6d-a764-9c861c4c7b39",
            "652e50ef-fddc-4db9-a26f-1eb50f7b5c57"
          ],
          "display_name": false
        },
        {
          "uuid": "9ac6f60d-0cbb-4233-a849-454aee719d20",
          "name": "BAYER-47531",
          "stdName": "BAYER-47531",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "652e50ef-fddc-4db9-a26f-1eb50f7b5c57",
            "3dd75522-8f08-4d86-be1c-376a3d0c2b30"
          ],
          "display_name": false
        },
        {
          "uuid": "0f224e8c-d812-4c11-9ce8-ca094aa8320b",
          "name": "DICHLOFLUANID",
          "stdName": "DICHLOFLUANID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "789fdfa9-c787-47e7-8763-bae55afbe11f",
            "05fa4676-057b-4221-979d-13b9169ef35b",
            "52b2e7b1-f212-4406-80a7-d0d105967920",
            "652e50ef-fddc-4db9-a26f-1eb50f7b5c57",
            "91b97431-efdf-4314-902e-ae08eba3831e",
            "d16c403f-3171-4fdd-a08c-2780600c19b1",
            "cf65d5bc-426f-4e56-978a-335ccec583dd",
            "8da02436-f1bc-4835-9f6b-eb33ffa1e1e5"
          ],
          "display_name": true
        },
        {
          "uuid": "835828a4-531e-4246-9289-4c7b01be15cb",
          "name": "DICHLOFLUANID [HSDB]",
          "stdName": "DICHLOFLUANID [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "789fdfa9-c787-47e7-8763-bae55afbe11f",
            "652e50ef-fddc-4db9-a26f-1eb50f7b5c57"
          ],
          "display_name": false
        },
        {
          "uuid": "aad1fc05-c293-4f1b-be00-a12bef2da231",
          "name": "DICHLOFLUANID [ISO]",
          "stdName": "DICHLOFLUANID [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "52b2e7b1-f212-4406-80a7-d0d105967920",
            "652e50ef-fddc-4db9-a26f-1eb50f7b5c57"
          ],
          "display_name": false
        },
        {
          "uuid": "5f47c694-9774-4e50-a571-29e5eb16f4b3",
          "name": "DICHLOFLUANID [MI]",
          "stdName": "DICHLOFLUANID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "652e50ef-fddc-4db9-a26f-1eb50f7b5c57",
            "d16c403f-3171-4fdd-a08c-2780600c19b1"
          ],
          "display_name": false
        },
        {
          "uuid": "a98204eb-3135-4936-b79c-4567b137fb22",
          "name": "ELVARON",
          "stdName": "ELVARON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "652e50ef-fddc-4db9-a26f-1eb50f7b5c57",
            "4016f457-9c12-4307-9ad5-7663bd41b5e3"
          ],
          "display_name": false
        },
        {
          "uuid": "19fca919-f74c-4b49-b502-5410199d2957",
          "name": "EUPAREN",
          "stdName": "EUPAREN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "652e50ef-fddc-4db9-a26f-1eb50f7b5c57",
            "4016f457-9c12-4307-9ad5-7663bd41b5e3"
          ],
          "display_name": false
        },
        {
          "uuid": "41a7d90e-519d-4437-bf4c-bd1667aed960",
          "name": "KUE 13032C",
          "stdName": "KUE 13032C",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7431505-8802-4b6d-a764-9c861c4c7b39",
            "652e50ef-fddc-4db9-a26f-1eb50f7b5c57"
          ],
          "display_name": false
        },
        {
          "uuid": "909b81b1-7906-4cb5-a5af-f4a79d4492f8",
          "name": "KUE-13032C",
          "stdName": "KUE-13032C",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "652e50ef-fddc-4db9-a26f-1eb50f7b5c57",
            "3dd75522-8f08-4d86-be1c-376a3d0c2b30"
          ],
          "display_name": false
        },
        {
          "uuid": "e82600c5-623a-43cb-93fd-27cd53e09fcf",
          "name": "N-((DICHLOROFLUOROMETHYL)THIO)-N',N'-DIMETHYL-N-PHENYLSULFAMIDE",
          "stdName": "N-((DICHLOROFLUOROMETHYL)THIO)-N',N'-DIMETHYL-N-PHENYLSULFAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7431505-8802-4b6d-a764-9c861c4c7b39",
            "652e50ef-fddc-4db9-a26f-1eb50f7b5c57"
          ],
          "display_name": false
        },
        {
          "uuid": "42339192-1b88-4db0-b033-27862ba71786",
          "name": "N-DICHLOROFLUOROMETHYLTHIO-N',N'-DIMETHYL-N-PHENYLSULFAMIDE",
          "stdName": "N-DICHLOROFLUOROMETHYLTHIO-N',N'-DIMETHYL-N-PHENYLSULFAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a53960e5-50cb-4b9c-84a0-b44d73d12404",
            "33f357d4-6b2d-4378-9845-35e9629161f1"
          ],
          "display_name": false
        },
        {
          "uuid": "9f856950-f5c0-43f5-bebf-97f5b537525d",
          "name": "NSC-218451",
          "stdName": "NSC-218451",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cdc87af6-468f-4941-bfff-fa68f7774172",
            "652e50ef-fddc-4db9-a26f-1eb50f7b5c57"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8da02436-f1bc-4835-9f6b-eb33ffa1e1e5",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a53960e5-50cb-4b9c-84a0-b44d73d12404",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "973192b2-450b-4b5e-ae23-4e7ee527814e",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33f357d4-6b2d-4378-9845-35e9629161f1",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d16c403f-3171-4fdd-a08c-2780600c19b1",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "652e50ef-fddc-4db9-a26f-1eb50f7b5c57",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7431505-8802-4b6d-a764-9c861c4c7b39",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cdc87af6-468f-4941-bfff-fa68f7774172",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4016f457-9c12-4307-9ad5-7663bd41b5e3",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3dd75522-8f08-4d86-be1c-376a3d0c2b30",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "789fdfa9-c787-47e7-8763-bae55afbe11f",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "52b2e7b1-f212-4406-80a7-d0d105967920",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f694dadc-c454-4a40-a901-8f6f84023481",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390933000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a4a5e6b0-1942-4c80-825c-3519a59d5734",
          "citation": "SRS import [76A92XU36Y]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=76A92XU36Y",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390933000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4579cf1e-cbaa-4afa-8825-5ea2540aecde",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf65d5bc-426f-4e56-978a-335ccec583dd",
          "citation": "DICHLOFLUANID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "91b97431-efdf-4314-902e-ae08eba3831e",
          "citation": "DICHLOFLUANID [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "05fa4676-057b-4221-979d-13b9169ef35b",
          "citation": "DICHLOFLUANID [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9de3540a-6910-07a5-f88d-ee80b9856efa",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+1085-98-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2b2c4430-1566-6df7-a5a1-07f191bd31ee",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1085-98-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4bc0f36f-3e7b-469a-8805-1465dea1310c",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "ce6a30d0-1b3e-9d8d-fbd1-a3782634c65d",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "e939acee-2a15-81ad-f746-f34090ec6eb1",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "c5c86d71-f6d4-468b-9c57-f1075eacf545",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1efd4c4d-c390-bdc6-213d-7a96575e74e7",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "92bc1ce0-a4fe-4d9a-a11a-5646a4e6d557",
          "id": "92bc1ce0-a4fe-4d9a-a11a-5646a4e6d557",
          "molfile": "\n  Marvin  01132107362D          \n\n 18 18  0  0  0  0            999 V2000\n    7.8297   -3.1794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1312   -3.6286    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4135   -3.1944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1312   -4.4232    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7824   -4.4232    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4307   -4.4232    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1312   -5.2443    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8555   -5.6439    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8555   -6.4519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1161   -6.4519    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5774   -6.4519    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.8555   -7.1391    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.4307   -5.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7239   -5.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0107   -5.6719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0107   -6.5013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7326   -6.9009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4307   -6.4883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  2  0  0  0  0\n  7  4  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 13  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 18  2  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\nM  END",
          "smiles": "CN(C)S(=O)(=O)N(c1ccccc1)SC(Cl)(Cl)F",
          "formula": "C9H11Cl2FN2O2S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2f59069e-4002-4dd6-b805-669813888061"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "333.2326",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "30b6b907-4f46-48fd-aad5-f714d1261359",
      "version": "8",
      "structure": {
        "id": "15448a5d-93e9-44e0-a9b4-83018d777b13",
        "molfile": "\n  Marvin  01132101182D          \n\n 18 18  0  0  0  0            999 V2000\n    7.1305   -5.2438    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4301   -5.6583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7233   -5.2566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0102   -5.6713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0102   -6.5006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7320   -6.9002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4301   -6.4876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1305   -4.4228    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1305   -3.6282    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8289   -3.1791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4129   -3.1941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7816   -4.4228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4301   -4.4228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8547   -5.6433    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8547   -6.4512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1154   -6.4512    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5765   -6.4512    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.8547   -7.1384    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  2  7  2  0  0  0  0\n  1  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  8 12  2  0  0  0  0\n  8 13  2  0  0  0  0\n  1 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 15 18  1  0  0  0  0\nM  END",
        "smiles": "CN(C)S(=O)(=O)N(c1ccccc1)SC(Cl)(Cl)F",
        "formula": "C9H11Cl2FN2O2S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "333.2326",
        "optical_activity": "NONE",
        "references": [
          "4579cf1e-cbaa-4afa-8825-5ea2540aecde",
          "a4a5e6b0-1942-4c80-825c-3519a59d5734"
        ],
        "stereo_centers": 0
      },
      "unii": "76A92XU36Y"
    }
  ]
}