{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0e77811b-e748-43c4-b34b-48ea937d1aca",
          "code": "6159-41-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6159-41-7",
          "code_system": "CAS",
          "references": [
            "cbe5e39b-7a9a-432c-9c7a-6c20dc18e067",
            "9a4a1c89-f15f-4657-91e0-e11812772a10"
          ]
        },
        {
          "uuid": "f6c3b771-6cea-4bd1-9f3a-a26aed9fc583",
          "code": "1744166",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1744166/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "cbe5e39b-7a9a-432c-9c7a-6c20dc18e067"
          ]
        },
        {
          "uuid": "edc632aa-4d02-4a9c-baa1-ff9e3e38a8bc",
          "code": "23692638",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23692638",
          "code_system": "PUBCHEM",
          "references": [
            "cbe5e39b-7a9a-432c-9c7a-6c20dc18e067"
          ]
        },
        {
          "uuid": "97e0a203-aeb9-655d-52b3-9faa40209522",
          "code": "DTXSID50210591",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50210591",
          "code_system": "EPA CompTox",
          "references": [
            "38baf8f8-b39a-0aea-cef8-804a7587392b"
          ]
        },
        {
          "uuid": "cc9c6ab0-f54e-428f-8549-87824ecb670e",
          "code": "768M7EX694",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "0a245f6c-31e1-4aa7-8fb8-8b4485eca8d5",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "d9767e3a-7985-4de5-884b-72583844d9ff",
            "refuuid": "d897b1fa-cf4a-43ed-93e6-fd6503f9772b",
            "name": "UNDECYLENIC ACID",
            "unii": "K3D86KJ24N",
            "linking_id": "K3D86KJ24N",
            "ref_pname": "UNDECYLENIC ACID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "93a469f9-a92b-4dbc-8a5d-d0703cec7eb1",
          "name": "POTASSIUM UNDECYLENATE",
          "stdName": "POTASSIUM UNDECYLENATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "17fe29c1-c935-4a65-8ad5-0ba4dffbf962",
            "c11d04e9-1464-4e13-b1a6-a5ca7e0b0e55",
            "a11e8c5c-736f-4f89-86e8-14aabb3810f9",
            "cd4eee13-b556-4bd9-ae1f-9de19f915129"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "2d044154-f04e-4880-9927-b0c2f2268cfa",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "301f04eb-1c93-4fd1-b1d4-9f45461fcc3f",
          "name": "UNDECYLENIC ACID, POTASSIUM SALT",
          "stdName": "UNDECYLENIC ACID, POTASSIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd4eee13-b556-4bd9-ae1f-9de19f915129",
            "d9a2c805-2dc0-479e-89ed-86180dfee55a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c11d04e9-1464-4e13-b1a6-a5ca7e0b0e55",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cd4eee13-b556-4bd9-ae1f-9de19f915129",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d9a2c805-2dc0-479e-89ed-86180dfee55a",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "17fe29c1-c935-4a65-8ad5-0ba4dffbf962",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cbe5e39b-7a9a-432c-9c7a-6c20dc18e067",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389729000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5fe83393-4b8e-4e36-aaa3-e3b55ee42a1b",
          "citation": "SRS import [768M7EX694]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=768M7EX694",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389729000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a11e8c5c-736f-4f89-86e8-14aabb3810f9",
          "citation": "POTASSIUM UNDECYLENATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "38baf8f8-b39a-0aea-cef8-804a7587392b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6159-41-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9a4a1c89-f15f-4657-91e0-e11812772a10",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "91ad4390-a1cf-84b0-cd3f-5ade236b1e8d",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7dcdbe80-768d-4290-a977-8dfe6ffb1846",
          "id": "7dcdbe80-768d-4290-a977-8dfe6ffb1846",
          "molfile": "\n  Marvin  01132106322D          \n\n  1  0  0  0  0  0            999 V2000\n    0.0000   -0.2581    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[K+]",
          "formula": "K",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2bb33621-dcb2-4a87-ad5b-93c69851e515"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "39.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "4d499daa-5821-49b2-b8f7-8b980d262b36",
          "id": "4d499daa-5821-49b2-b8f7-8b980d262b36",
          "molfile": "\n  Marvin  01132104022D          \n\n 13 12  0  0  0  0            999 V2000\n    0.0387   -1.2339    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    0.7538   -0.8312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7538    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4558   -1.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1709   -0.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8988   -1.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6164   -0.8312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3159   -1.2416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0284   -0.8467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7537   -1.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4610   -0.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1812   -1.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8781   -0.8622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "C=CCCCCCCCCC(=O)[O-]",
          "formula": "C11H19O2",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ead3e436-e44a-4ffa-900a-2af3443c79c2"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "183.2678",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b6ac6bc7-ecab-4e6d-9b66-0a7c08356838",
      "version": "7",
      "structure": {
        "id": "4ffa949e-6e45-46e0-9bf8-6de76b123040",
        "molfile": "\n  Marvin  01132104102D          \n\n 14 12  0  0  0  0            999 V2000\n    0.7538   -0.8312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0387   -1.2339    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    0.7538    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1812   -1.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8781   -0.8622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4558   -1.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4610   -0.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1709   -0.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7537   -1.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8988   -1.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6164   -0.8312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3159   -1.2416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0284   -0.8467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.2581    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  7  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  1  1  0  0  0  0\n  7  9  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9 13  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\nM  CHG  2   2  -1  14   1\nM  END",
        "smiles": "C=CCCCCCCCCC(=O)[O-].[K+]",
        "formula": "C11H19O2.K",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "222.3661",
        "optical_activity": "NONE",
        "references": [
          "5fe83393-4b8e-4e36-aaa3-e3b55ee42a1b",
          "c11d04e9-1464-4e13-b1a6-a5ca7e0b0e55"
        ],
        "stereo_centers": 0
      },
      "unii": "768M7EX694"
    }
  ]
}