{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c1c01f93-48b5-4e13-8a34-c0283f2224dd",
          "code": "33892-18-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=33892-18-1",
          "code_system": "CAS",
          "references": [
            "3f0e5a25-45b0-4621-82b0-b8d201956515",
            "565955a9-ad03-4b28-a2c7-bbfa2e7204ad"
          ]
        },
        {
          "uuid": "97a4edc5-d773-4049-b00f-f36727b5e28c",
          "code": "1600931",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1600931/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "3f0e5a25-45b0-4621-82b0-b8d201956515"
          ]
        },
        {
          "uuid": "66086942-d75d-4939-89c9-74630d5dd019",
          "code": "22216196",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/22216196",
          "code_system": "PUBCHEM",
          "references": [
            "3f0e5a25-45b0-4621-82b0-b8d201956515"
          ]
        },
        {
          "uuid": "383182d9-1a49-4633-ad55-b9976d6343a7",
          "code": "7666FJ0J9F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a23734f4-f81b-3a8d-4e33-569a52175491",
          "code": "7666FJ0J9F",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=7666FJ0J9F",
          "code_system": "DAILYMED",
          "references": [
            "d9ffa1a0-e04a-643a-369f-f2f37295dcb3"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9eb4a275-06ac-4c31-bced-d279cc87a154",
          "name": "1-PHENANTHRENECARBOXYLIC ACID, 1,2,3,4,4A,4B,5,6,8A,9,10,10A-DODECAHYDRO-1,4A-DIMETHYL-7-(1-METHYLETHYL)-, METHYL ESTER, (1R,4AR,4BS,8AS,10AR)-",
          "stdName": "1-PHENANTHRENECARBOXYLIC ACID, 1,2,3,4,4A,4B,5,6,8A,9,10,10A-DODECAHYDRO-1,4A-DIMETHYL-7-(1-METHYLETHYL)-, METHYL ESTER, (1R,4AR,4BS,8AS,10AR)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb9cb9bc-d21d-4d95-b891-adb883889ca2"
          ],
          "display_name": false
        },
        {
          "uuid": "d8de5c39-382d-4772-88a5-c9361de1e1c9",
          "name": "METHYL DIHYDROABIETATE",
          "stdName": "METHYL DIHYDROABIETATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6219500-03cb-4865-8615-43e6ffccc95b",
            "e68c1519-8886-459e-9773-2cf14bbd11d1",
            "cb9cb9bc-d21d-4d95-b891-adb883889ca2"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "afb14768-41c6-4cb5-bcd1-fee307cf4dc1",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "e68c1519-8886-459e-9773-2cf14bbd11d1",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cb9cb9bc-d21d-4d95-b891-adb883889ca2",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3f0e5a25-45b0-4621-82b0-b8d201956515",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390733000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a4936e92-f86f-4a79-ab6d-ef630ca38739",
          "citation": "SRS import [7666FJ0J9F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7666FJ0J9F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390733000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "231b1aff-072c-46fd-8c6c-781becca8e31",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a6219500-03cb-4865-8615-43e6ffccc95b",
          "citation": "METHYL DIHYDROABIETATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "565955a9-ad03-4b28-a2c7-bbfa2e7204ad",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d9ffa1a0-e04a-643a-369f-f2f37295dcb3",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d9cb56ea-e1ae-4068-b091-b5bbe7ede029",
          "id": "d9cb56ea-e1ae-4068-b091-b5bbe7ede029",
          "molfile": "\n  Marvin  01132111182D          \n\n 23 25  0  0  1  0            999 V2000\n    5.2820   -2.1931    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.2820   -3.0181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5675   -3.4306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8530   -3.0181    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.1386   -3.4306    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.6689   -4.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4241   -3.0181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4241   -2.1931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1386   -1.7806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8530   -2.1931    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.8530   -1.3681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5675   -1.7806    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.5675   -0.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2820   -0.5432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9965   -0.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9965   -1.7806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7109   -0.5432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4254   -0.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7109    0.2818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6083   -4.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7958   -3.9193    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8905   -4.8379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3602   -5.4699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 12  1  0  0  0  0\n  1 16  1  6  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  1  0  0  0\n  4  5  1  0  0  0  0\n 10  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  5 20  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  1  0  0  0\n 12 10  1  0  0  0  0\n 12 13  1  1  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 17 15  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 17  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 20  1  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
          "smiles": "CC(C)C1=C[C@@H]2CC[C@@H]3[C@](C)(CCC[C@@]3(C)C(=O)OC)[C@H]2CC1",
          "formula": "C21H34O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4950b9b9-dea5-4fee-8b23-e7c1fb01a6cd"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "318.4942",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "696441c6-f984-4513-8145-62b0bda206d3",
      "version": "4",
      "structure": {
        "id": "c59224ab-f90b-4457-b47c-5f086abf74d3",
        "molfile": "\n  Marvin  01132110132D          \n\n 26 28  0  0  1  0            999 V2000\n    4.5675   -2.6056    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5675   -1.7806    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.8530   -2.1931    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.8530   -1.3681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1386   -1.7806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4241   -2.1931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4241   -3.0181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1386   -3.4306    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.6689   -4.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6083   -4.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8905   -4.8379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3602   -5.4699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7958   -3.9193    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8530   -3.0181    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.8530   -3.8431    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5675   -3.4306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2820   -3.0181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2820   -2.1931    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.9965   -1.7806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9965   -0.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2820   -0.5432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5675   -0.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7109   -0.5432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4254   -0.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7109    0.2818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2820   -1.3681    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  6  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  1  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  1  0  0  0\n  8 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 10  2  0  0  0  0\n  8 14  1  0  0  0  0\n 14 15  1  6  0  0  0\n 14  3  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22  2  1  0  0  0  0\n 23 20  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 23  1  0  0  0  0\n 18  2  1  0  0  0  0\n 18 26  1  1  0  0  0\nM  END",
        "smiles": "CC(C)C1=C[C@]2([H])CC[C@]3([H])[C@](C)(CCC[C@@]3(C)C(=O)OC)[C@@]2([H])CC1",
        "formula": "C21H34O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "318.4942",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "a4936e92-f86f-4a79-ab6d-ef630ca38739",
          "231b1aff-072c-46fd-8c6c-781becca8e31"
        ],
        "stereo_centers": 5
      },
      "unii": "7666FJ0J9F"
    }
  ]
}