{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6ee96d92-ec6a-4932-9b1f-105d8c24b8ee",
          "code": "40816-51-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=40816-51-1",
          "code_system": "CAS",
          "references": [
            "a77813cd-6e47-49ac-868b-e85749108e3f",
            "084fa68a-e18f-454f-b049-5954d7cd01f4"
          ]
        },
        {
          "uuid": "2da75d36-b4f6-4164-9990-814b32615fd9",
          "code": "SUB22618",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "a77813cd-6e47-49ac-868b-e85749108e3f"
          ]
        },
        {
          "uuid": "ebe77c0b-843c-4a0a-b443-87ca6efcaa2f",
          "code": "22788210",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/22788210",
          "code_system": "PUBCHEM",
          "references": [
            "a77813cd-6e47-49ac-868b-e85749108e3f"
          ]
        },
        {
          "uuid": "07d13d0b-ec6d-46f1-a116-9dc25da17fdb",
          "code": "60761",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/60761/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "a77813cd-6e47-49ac-868b-e85749108e3f"
          ]
        },
        {
          "uuid": "34c3f2e2-fbf3-47fc-9251-a5ba7be2fb57",
          "code": "764D511203",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1b71f761-1930-defc-ee38-0f97023e2b15",
          "code": "100000087972",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "d5a6f4ca-4f53-f96a-7d43-d0bc09749324"
          ]
        },
        {
          "uuid": "5e682425-b115-cb56-b74f-ab5e66fd53d8",
          "code": "DTXSID201033181",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID201033181",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "460781b5-87e3-77be-b13e-ef00f48ad42e",
          "code": "361066",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=361066",
          "code_system": "NSC",
          "references": [
            "a4e622b6-9b20-6eb0-abf9-afb4d2d25b56"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0ee11e53-63f9-40a0-aa68-ce2abdcbe5e4",
          "name": "(T-4)-BIS(L-METHIONINATO-.KAPPA.N,.KAPPA.O)ZINC",
          "stdName": "(T-4)-BIS(L-METHIONINATO-.KAPPA.N,.KAPPA.O)ZINC",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef150448-c30c-4aff-88f8-bf9d5a6d0547",
            "682b4c1e-2a68-46d6-870d-182642f1c4a1"
          ],
          "display_name": false
        },
        {
          "uuid": "1574e47b-72e0-4d75-a688-60f5c3badfc4",
          "name": "BIS(METHIONINATO)ZINC",
          "stdName": "BIS(METHIONINATO)ZINC",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef150448-c30c-4aff-88f8-bf9d5a6d0547",
            "682b4c1e-2a68-46d6-870d-182642f1c4a1"
          ],
          "display_name": false
        },
        {
          "uuid": "34a6926d-d4c0-43ef-bc77-c501b1f94d6b",
          "name": "METHIONINE ZINC CHELATE",
          "stdName": "METHIONINE ZINC CHELATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef150448-c30c-4aff-88f8-bf9d5a6d0547",
            "682b4c1e-2a68-46d6-870d-182642f1c4a1"
          ],
          "display_name": false
        },
        {
          "uuid": "6876aeb2-e759-4334-8134-aaa44a23f122",
          "name": "METHIONINE ZINC COMPLEX",
          "stdName": "METHIONINE ZINC COMPLEX",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57f49369-4644-4b9f-a057-b65e8f4f8398",
            "682b4c1e-2a68-46d6-870d-182642f1c4a1"
          ],
          "display_name": false
        },
        {
          "uuid": "fd1921e4-2a78-4e8b-878e-9cc64478375f",
          "name": "NSC-361066",
          "stdName": "NSC-361066",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef150448-c30c-4aff-88f8-bf9d5a6d0547",
            "682b4c1e-2a68-46d6-870d-182642f1c4a1"
          ],
          "display_name": false
        },
        {
          "uuid": "fc8137b6-9671-4c60-aaf8-42cbfbb1129e",
          "name": "ZINC METHIONINE",
          "stdName": "ZINC METHIONINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef150448-c30c-4aff-88f8-bf9d5a6d0547",
            "682b4c1e-2a68-46d6-870d-182642f1c4a1"
          ],
          "display_name": true
        },
        {
          "uuid": "2d19df5d-c217-45aa-95d0-ab31ba356d0a",
          "name": "ZINC, BIS(L-METHIONINATO-.KAPPA.N,.KAPPA.O)-, (T-4)-",
          "stdName": "ZINC, BIS(L-METHIONINATO-.KAPPA.N,.KAPPA.O)-, (T-4)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef150448-c30c-4aff-88f8-bf9d5a6d0547",
            "682b4c1e-2a68-46d6-870d-182642f1c4a1"
          ],
          "display_name": false
        },
        {
          "uuid": "bcb93b10-54a9-4c47-9b2b-8f54cb173867",
          "name": "ZINC, BIS(L-METHIONINATO-N,O)-, (T-4)-",
          "stdName": "ZINC, BIS(L-METHIONINATO-N,O)-, (T-4)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef150448-c30c-4aff-88f8-bf9d5a6d0547",
            "682b4c1e-2a68-46d6-870d-182642f1c4a1"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ef150448-c30c-4aff-88f8-bf9d5a6d0547",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "682b4c1e-2a68-46d6-870d-182642f1c4a1",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57f49369-4644-4b9f-a057-b65e8f4f8398",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a77813cd-6e47-49ac-868b-e85749108e3f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392246000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "73acb92b-d5a8-4bf2-9d6e-ab7dc95bc4d6",
          "citation": "SRS import [764D511203]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=764D511203",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392246000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d5a6f4ca-4f53-f96a-7d43-d0bc09749324",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "084fa68a-e18f-454f-b049-5954d7cd01f4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a4e622b6-9b20-6eb0-abf9-afb4d2d25b56",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "114b2c38-37a7-4312-88fa-98328f0a2a1c",
          "id": "114b2c38-37a7-4312-88fa-98328f0a2a1c",
          "molfile": "\n  Marvin  01132101072D          \n\n  1  0  0  0  1  0            999 V2000\n   10.9580   -6.6268    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Zn+2]",
          "formula": "Zn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1b2920fd-eefb-4b7f-9b84-88c566959e9d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "65.3956",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "8117c24c-15c4-414a-b712-384abbf93f2a",
          "id": "8117c24c-15c4-414a-b712-384abbf93f2a",
          "molfile": "\n  Marvin  01132106422D          \n\n  9  8  0  0  1  0            999 V2000\n    8.0918   -6.2051    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.8013   -5.7842    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3725   -5.8011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6630   -6.2220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9437   -5.8180    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2341   -6.2389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1016   -7.0300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8209   -7.4341    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.3920   -7.4510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  7  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\nM  CHG  1   8  -1\nM  END",
          "smiles": "CSCC[C@@H](C(=O)[O-])N",
          "formula": "C5H10NO2S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "3a15c103-4e89-48e6-8c8c-15bb226ab6b5"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "148.2047",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8484ae2e-8882-4436-8a23-13193e6d0000",
      "version": "6",
      "structure": {
        "id": "e572de92-2620-47cb-85b4-27e1d2fb974e",
        "molfile": "\n  Marvin  01132111532D          \n\n 19 16  0  0  1  0            999 V2000\n   10.9580   -6.6268    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\n    8.0918   -6.2051    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.8013   -5.7842    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3725   -5.8011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6630   -6.2220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9437   -5.8180    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2341   -6.2389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1016   -7.0300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8209   -7.4341    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.3920   -7.4510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0918   -6.2051    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.8013   -5.7842    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3725   -5.8011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6630   -6.2220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9437   -5.8180    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2341   -6.2389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1016   -7.0300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8209   -7.4341    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.3920   -7.4510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  6  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  2  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n 11 12  1  6  0  0  0\n 11 13  1  0  0  0  0\n 11 17  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  2  0  0  0  0\nM  CHG  3   1   2   9  -1  18  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 15   2   3   4   5   6   7   8   9  10  11  12  13  14  15  16\nM  SAL   1  3  17  18  19\nM  SPA   1  9   2   3   4   5   6   7   8   9  10\nM  SDI   1  4    4.8141   -7.8710    4.8141   -5.3642\nM  SDI   1  4    9.2409   -5.3642    9.2409   -7.8710\nM  SMT   1 2\nM  END",
        "smiles": "CSCC[C@@H](C(=O)[O-])N.CSCC[C@@H](C(=O)[O-])N.[Zn+2]",
        "formula": "2C5H10NO2S.Zn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "361.8049",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "73acb92b-d5a8-4bf2-9d6e-ab7dc95bc4d6",
          "57f49369-4644-4b9f-a057-b65e8f4f8398"
        ],
        "stereo_centers": 2
      },
      "unii": "764D511203"
    }
  ]
}