{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a481e843-41bc-448e-84ba-6c036b327817",
          "code": "130306-02-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=130306-02-4",
          "code_system": "CAS",
          "references": [
            "1dd7687d-4092-4931-96b7-71dc524c59e3",
            "1a8cab0b-1f2b-46ad-9df4-d8c3631fa2b3"
          ]
        },
        {
          "uuid": "04ac47e9-03f7-4897-b876-d01a6ed73738",
          "code": "8003",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=8003",
          "code_system": "INN",
          "references": [
            "1dd7687d-4092-4931-96b7-71dc524c59e3"
          ]
        },
        {
          "uuid": "e1b610bd-d601-43ce-a95b-a48ae1343c1f",
          "code": "C95916",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C95916",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1dd7687d-4092-4931-96b7-71dc524c59e3"
          ]
        },
        {
          "uuid": "eca0d6bc-0bdb-4293-81f8-02f82d8a02c9",
          "code": "171233-40-2",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=171233-40-2",
          "code_system": "CAS",
          "references": [
            "1dd7687d-4092-4931-96b7-71dc524c59e3",
            "6bdbfc07-7eae-4775-ab9f-06aceeb53e1f"
          ]
        },
        {
          "uuid": "e85b499d-2c2c-4d10-9396-460008cd4935",
          "code": "6435808",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6435808",
          "code_system": "PUBCHEM",
          "references": [
            "1dd7687d-4092-4931-96b7-71dc524c59e3"
          ]
        },
        {
          "uuid": "26e5983a-e675-8b0d-0b41-f6f5e5686bc4",
          "code": "DTXSID10156446",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10156446",
          "code_system": "EPA CompTox",
          "references": [
            "bd1e78c5-e819-08c0-f881-cae8a4219eac"
          ]
        },
        {
          "uuid": "6d1cd8c9-dadf-3065-bf9c-b47f07533a1d",
          "code": "C1557",
          "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Antimetabolite[C272]|Pyrimidine Antagonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1557",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7e6d7e3d-1a0e-7d41-d28c-cd2c0a52dd1e"
          ]
        },
        {
          "uuid": "f30345e0-b106-ea2d-6fb2-78f8cc0776ca",
          "code": "C2150",
          "comments": "Pharmacologic Substance[C1909]|Enzyme Inhibitor[C471]|Ribonucleotide Reductase Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2150",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7e6d7e3d-1a0e-7d41-d28c-cd2c0a52dd1e"
          ]
        },
        {
          "uuid": "091e4de0-712e-44b4-9fd4-82e71c66c7db",
          "code": "7607Y95N9S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "394dcc0c-f877-3004-8e4a-4112fcd85d40",
          "code": "300000036939",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "bd95b255-8310-c320-e69d-7cabbc7e5bbc"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "6a32b3bb-eb0b-4c7a-b8c2-bc86b28750c7",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "4698f215-d332-4333-a3a5-9643b668d24a",
            "refuuid": "1d7cd038-85dd-4edf-9b09-8afc933b7f9a",
            "name": "TEZACITABINE ANHYDROUS",
            "unii": "7607Y95N9S",
            "linking_id": "7607Y95N9S",
            "ref_pname": "TEZACITABINE ANHYDROUS",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d25eff30-4be5-4d96-8ccf-c76f24aa84e5",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "f0396b6d-49ae-4025-9928-6e48b911ac06",
            "refuuid": "bb88d8fa-3493-47bc-90fc-2870779a8f62",
            "name": "TEZACITABINE",
            "unii": "UCC4EQS7WL",
            "linking_id": "UCC4EQS7WL",
            "ref_pname": "TEZACITABINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f21a6cf6-3fd2-4f70-9dd7-69b98d64aca0",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "a4265384-48ff-431b-81e0-0ab5ca7ae2d5",
            "refuuid": "b680f909-a8cd-41c2-8679-0394855097ea",
            "name": "TEZACITABINE HYDROCHLORIDE",
            "unii": "Y19296N8M6",
            "linking_id": "Y19296N8M6",
            "ref_pname": "TEZACITABINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a04c5763-d72a-17c5-3fcf-4652ee56f287",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "1a8cab0b-1f2b-46ad-9df4-d8c3631fa2b3"
          ],
          "related_substance": {
            "uuid": "2b120842-b351-4fc2-836f-8f10a71ea304",
            "refuuid": "bb88d8fa-3493-47bc-90fc-2870779a8f62",
            "name": "TEZACITABINE",
            "unii": "UCC4EQS7WL",
            "linking_id": "UCC4EQS7WL",
            "ref_pname": "TEZACITABINE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4a469660-7b23-4909-b0af-e1d82d882908",
          "name": "(2'E)-2'-DEOXY-2'-(FLUOROMETHYLENE)CYTIDINE",
          "stdName": "(2'E)-2'-DEOXY-2'-(FLUOROMETHYLENE)CYTIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e85a0110-38c8-4ce6-8267-922ba7bb4f9b",
            "395fa92e-a1f9-49e6-a8f4-063bca0ab46b"
          ],
          "display_name": false
        },
        {
          "uuid": "ac6360c6-7b36-4c9d-be97-358080d8d683",
          "name": "2'-DEOXY-2'-((E)-FLUOROMETHYLENE)CYTIDINE",
          "stdName": "2'-DEOXY-2'-((E)-FLUOROMETHYLENE)CYTIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f20e15d6-f0f3-4f7b-aeb3-b43065a41ca0"
          ],
          "display_name": false
        },
        {
          "uuid": "ec192d04-086d-40f5-91ef-e177c657bcf3",
          "name": "CYTIDINE, 2'-DEOXY-2'-(FLUOROMETHYLENE)-, (2'E)-",
          "stdName": "CYTIDINE, 2'-DEOXY-2'-(FLUOROMETHYLENE)-, (2'E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e85a0110-38c8-4ce6-8267-922ba7bb4f9b",
            "395fa92e-a1f9-49e6-a8f4-063bca0ab46b"
          ],
          "display_name": false
        },
        {
          "uuid": "89f08546-f125-46cd-9e3b-1e47f3d99eed",
          "name": "KW-2331",
          "stdName": "KW-2331",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e85a0110-38c8-4ce6-8267-922ba7bb4f9b",
            "395fa92e-a1f9-49e6-a8f4-063bca0ab46b"
          ],
          "display_name": false
        },
        {
          "uuid": "b6e2b1b0-0a98-4a06-a4ae-bcf66e0733c8",
          "name": "MDL 101,731",
          "stdName": "MDL 101,731",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c90808de-c46b-442b-b72d-45496902e3a9",
            "395fa92e-a1f9-49e6-a8f4-063bca0ab46b"
          ],
          "display_name": false
        },
        {
          "uuid": "9fbd39ed-a9c8-4db4-9627-2e3b047d5033",
          "name": "MDL-101731",
          "stdName": "MDL-101731",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c90808de-c46b-442b-b72d-45496902e3a9",
            "395fa92e-a1f9-49e6-a8f4-063bca0ab46b"
          ],
          "display_name": false
        },
        {
          "uuid": "5b0868a6-1cba-47cb-8c3a-113252b83704",
          "name": "TEZACITABINE ANHYDROUS",
          "stdName": "TEZACITABINE ANHYDROUS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f20e15d6-f0f3-4f7b-aeb3-b43065a41ca0"
          ],
          "display_name": true
        },
        {
          "uuid": "04879ddb-e546-28e2-6663-d47dcdd007c9",
          "name": "Tezacitabine [WHO-DD]",
          "stdName": "TEZACITABINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e24e825a-496e-8032-881e-5c8326c3ceb1"
          ],
          "display_name": false
        },
        {
          "uuid": "5e8153dd-2325-4356-86cb-21e6fe6a74f2",
          "name": "tezacitabine [INN]",
          "stdName": "TEZACITABINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4336b5cf-623b-49ac-a13d-7bff9ee18332",
            "395fa92e-a1f9-49e6-a8f4-063bca0ab46b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f20e15d6-f0f3-4f7b-aeb3-b43065a41ca0",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4336b5cf-623b-49ac-a13d-7bff9ee18332",
          "citation": "INN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "395fa92e-a1f9-49e6-a8f4-063bca0ab46b",
          "citation": "INN",
          "doc_type": "INN",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "74527e56-61b0-46cd-9315-77386c055c51",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e85a0110-38c8-4ce6-8267-922ba7bb4f9b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c90808de-c46b-442b-b72d-45496902e3a9",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1dd7687d-4092-4931-96b7-71dc524c59e3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390972000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b707e4a2-9728-4443-bdfa-1ad205425d56",
          "citation": "SRS import [7607Y95N9S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7607Y95N9S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390972000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "155d9c24-ed95-43d2-993c-6695ba18ab26",
          "citation": "INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bd1e78c5-e819-08c0-f881-cae8a4219eac",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=130306-02-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7e6d7e3d-1a0e-7d41-d28c-cd2c0a52dd1e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "1a8cab0b-1f2b-46ad-9df4-d8c3631fa2b3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6bdbfc07-7eae-4775-ab9f-06aceeb53e1f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e24e825a-496e-8032-881e-5c8326c3ceb1",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c927c271-48e5-4e74-8651-934770c150a0",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "bd95b255-8310-c320-e69d-7cabbc7e5bbc",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "38bdff32-cd8f-4c6e-ac58-0c7818ae20fe",
          "id": "38bdff32-cd8f-4c6e-ac58-0c7818ae20fe",
          "molfile": "\n  Marvin  01132103012D          \n\n 18 19  0  0  1  0            999 V2000\n    3.1492   -6.2458    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    2.3695   -5.9761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7461   -6.5165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8256   -5.7735    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4839   -6.2709    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.2141   -7.0506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6864   -7.7270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3367   -8.4743    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3892   -7.0350    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    2.8919   -7.6933    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2731   -6.0308    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4598   -5.2272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2490   -4.9871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8517   -5.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6409   -5.3104    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6649   -6.3541    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8757   -6.5943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6890   -7.3979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  4  1  0  0  0  0\n  9  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  5  4  1  1  0  0  0\n  6  5  1  0  0  0  0\n  5 11  1  0  0  0  0\n  7  6  2  0  0  0  0\n  9  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9 10  1  6  0  0  0\n 12 11  1  0  0  0  0\n 17 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\nM  END",
          "smiles": "c1cn([C@H]2/C(=C/F)/[C@@H]([C@@H](CO)O2)O)c(=O)nc1N",
          "formula": "C10H12FN3O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b73ec4b1-7dce-468b-8bd3-03e7d86be77d"
          },
          "defined_stereo": 3,
          "ez_centers": 1,
          "molecular_weight": "257.2188",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1d7cd038-85dd-4edf-9b09-8afc933b7f9a",
      "version": "12",
      "structure": {
        "id": "21d64e29-5123-4993-9c70-0d38508a419f",
        "molfile": "\n  Marvin  01132101542D          \n\n 18 19  0  0  1  0            999 V2000\n    5.2731   -6.0308    0.0000 N   0  0  1  0  0  0  0  0  0  0  0  0\n    4.4839   -6.2709    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.2141   -7.0506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3892   -7.0350    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.8919   -7.6933    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1492   -6.2458    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.8256   -5.7735    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3695   -5.9761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7461   -6.5165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6864   -7.7270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3367   -8.4743    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8757   -6.5943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6649   -6.3541    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8517   -5.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2490   -4.9871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4598   -5.2272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6409   -5.3104    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6890   -7.3979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  6  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  2  1  0  0  0  0\n  6  8  1  1  0  0  0\n  9  8  1  0  0  0  0\n 10  3  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12  1  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16  1  1  0  0  0  0\n 17 14  1  0  0  0  0\n 18 12  2  0  0  0  0\nM  END",
        "smiles": "c1cn([C@H]2/C(=C/F)/[C@@H]([C@@H](CO)O2)O)c(=O)nc1N",
        "formula": "C10H12FN3O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 1,
        "molecular_weight": "257.2188",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b707e4a2-9728-4443-bdfa-1ad205425d56",
          "155d9c24-ed95-43d2-993c-6695ba18ab26"
        ],
        "stereo_centers": 3
      },
      "unii": "7607Y95N9S"
    }
  ]
}