{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9f3fa3df-e0bd-412f-a112-c7cdf553eb2b",
          "code": "75S5T5T7QX",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f7c43c26-a3b2-452d-838b-7c0457e4463e",
          "code": "F-2 (drug)",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/F-2_(drug)",
          "code_system": "WIKIPEDIA"
        },
        {
          "uuid": "2a5d5601-3e0c-49c6-9615-e35b583a273e",
          "code": "PiHKAL",
          "comments": "Wikipedia|PiHKAL|Phenethylamines",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/PiHKAL",
          "code_system": "WIKIPEDIA"
        },
        {
          "uuid": "54abc286-1a79-4da3-8bfe-7cf5e31e9c7d",
          "code": "99355-74-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=99355-74-5",
          "code_system": "CAS",
          "references": [
            "567c337e-1650-4fd7-83c1-33e01999a416"
          ]
        },
        {
          "uuid": "6bc6caef-7c29-4e23-b59f-2590cc59265a",
          "code": "13056773",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13056773",
          "code_system": "PUBCHEM",
          "references": [
            "834a7df5-74ec-42a8-8e55-1c395010f862"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "187faf2e-f3eb-4f91-a0fa-9c2a561cb065",
          "citation": "https://en.wikipedia.org/wiki/F-2_(drug)",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "567c337e-1650-4fd7-83c1-33e01999a416",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "834a7df5-74ec-42a8-8e55-1c395010f862",
          "citation": "PUBCHEM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b71f47f9-9757-4daa-bcd9-b3c61ff65724",
          "citation": "SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7bd224d5-5c3b-4ed5-9737-3a68287cd11c",
          "id": "7bd224d5-5c3b-4ed5-9737-3a68287cd11c",
          "molfile": "\n  Marvin  03022118072D          \n\n 16 17  0  0  0  0            999 V2000\n   -0.2275    0.8766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9420    0.4641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9420   -0.3609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2275   -0.7734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4870   -0.3609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4870    0.4641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2014    0.8766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9159    0.4641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9159   -0.3609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6304    0.8766    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2014   -0.7734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2014   -1.5984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7266   -0.6159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2115    0.0516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7266    0.7190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0365    0.0516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  6  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 15  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3 13  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5 11  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\nM  END",
          "smiles": "CC(Cc1cc2c(CC(C)O2)cc1OC)N",
          "formula": "C13H19NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "35db9cae-f527-48a2-b836-1fbcdf2271fa"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "221.296",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a8962e29-a564-497b-8b2d-047ae3b8d54b",
      "version": "14",
      "structure": {
        "id": "b0774ef0-082b-4b5b-ac69-ab85df959176",
        "molfile": "\n   JSDraw203022113072D\n\n 16 17  0  0  0  0              0 V2000\n   25.1218   -5.3560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7707   -6.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7707   -7.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1218   -8.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.4728   -7.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.4728   -6.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8237   -5.3560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.1747   -6.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.1747   -7.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.5258   -5.3560    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8237   -8.4760    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8237  -10.0360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.2871   -8.1782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.3702   -6.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.2871   -5.6540    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8102   -6.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  5 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n  3 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n  2 15  1  0  0  0  0\n 14 16  1  0  0  0  0\nM  END",
        "smiles": "CC(Cc1cc2c(CC(C)O2)cc1OC)N",
        "formula": "C13H19NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "221.296",
        "optical_activity": "( + / - )",
        "references": [
          "567c337e-1650-4fd7-83c1-33e01999a416",
          "187faf2e-f3eb-4f91-a0fa-9c2a561cb065"
        ],
        "stereo_centers": 2
      },
      "unii": "75S5T5T7QX",
      "relationships": [
        {
          "uuid": "559afbbc-c566-4555-91b0-2589742ef1cd",
          "amount": {
            "uuid": "cad04554-44ce-4894-9f1b-c480fc5f9e4e"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "c1c93a71-f371-4274-a2ab-440a95d5c4bd",
            "refuuid": "4e0f4d9b-eb05-460b-84d3-f0fed15802ff",
            "name": "F-2 HYDROCHLORIDE",
            "unii": "WQV6N9QB6Q",
            "linking_id": "WQV6N9QB6Q",
            "ref_pname": "F-2 HYDROCHLORIDE"
          }
        },
        {
          "uuid": "e8fa8248-835f-498b-b016-1f790b4c15e1",
          "amount": {
            "uuid": "c4d231bf-97ba-49e1-9890-c22837aaea1b"
          },
          "type": "ACTIVE MOIETY",
          "references": [
            "187faf2e-f3eb-4f91-a0fa-9c2a561cb065"
          ],
          "related_substance": {
            "uuid": "ae508461-9cd1-4376-a5bf-a23fc07e43f7",
            "refuuid": "a8962e29-a564-497b-8b2d-047ae3b8d54b",
            "name": "F-2",
            "unii": "75S5T5T7QX",
            "linking_id": "75S5T5T7QX",
            "ref_pname": "F-2",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "7cce938b-5689-4299-b33b-824ea9c6a1d1",
          "name": "1-(5-METHOXY-2-METHYL-2,3-DIHYDRO-1-BENZOFURAN-6-YL)PROPAN-2-AMINE",
          "stdName": "1-(5-METHOXY-2-METHYL-2,3-DIHYDRO-1-BENZOFURAN-6-YL)PROPAN-2-AMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "567c337e-1650-4fd7-83c1-33e01999a416"
          ],
          "display_name": false
        },
        {
          "uuid": "69c2cf19-fb02-4cec-9989-5a73ffd8e52b",
          "name": "2,3-DIHYDRO-5-METHOXY-.ALPHA.,2-DIMETHYL-6-BENZOFURANETHANAMINE",
          "stdName": "2,3-DIHYDRO-5-METHOXY-.ALPHA.,2-DIMETHYL-6-BENZOFURANETHANAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "567c337e-1650-4fd7-83c1-33e01999a416"
          ],
          "display_name": false
        },
        {
          "uuid": "275356cc-6ce5-447b-bcd2-9cda0d59d0c6",
          "name": "6-(2-AMINOPROPYL)-5-METHOXY-2-METHYL-2,3-DIHYDROBENZOFURAN",
          "stdName": "6-(2-AMINOPROPYL)-5-METHOXY-2-METHYL-2,3-DIHYDROBENZOFURAN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "187faf2e-f3eb-4f91-a0fa-9c2a561cb065"
          ],
          "display_name": false
        },
        {
          "uuid": "3d0c61a4-ac93-4875-b176-4bd79a642a46",
          "name": "6-BENZOFURANETHANAMINE, 2,3-DIHYDRO-5-METHOXY-.ALPHA.,2-DIMETHYL-",
          "stdName": "6-BENZOFURANETHANAMINE, 2,3-DIHYDRO-5-METHOXY-.ALPHA.,2-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "567c337e-1650-4fd7-83c1-33e01999a416"
          ],
          "display_name": false
        },
        {
          "uuid": "3e915ff3-5620-4303-a568-b2d345dbf6ee",
          "name": "F-2",
          "stdName": "F-2",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "187faf2e-f3eb-4f91-a0fa-9c2a561cb065"
          ],
          "display_name": true
        },
        {
          "uuid": "50f9f47c-e6e0-4da9-8530-fae7faa4f203",
          "name": "F-2 (DRUG)",
          "stdName": "F-2 (DRUG)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "187faf2e-f3eb-4f91-a0fa-9c2a561cb065"
          ],
          "display_name": false
        },
        {
          "uuid": "f4d025bd-c990-43e5-a8dc-8fdd1cd10623",
          "name": "F-2 (PSYCHEDELIC)",
          "stdName": "F-2 (PSYCHEDELIC)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b71f47f9-9757-4daa-bcd9-b3c61ff65724"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "7a65d0fe-dee9-43a5-81f6-6ad3dc61af99"
      }
    }
  ]
}