{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8a02e177-63a6-4b64-a63a-2b858a53d93b",
          "code": "572-03-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=572-03-2",
          "code_system": "CAS",
          "references": [
            "7fc0f54b-02ec-428e-8f51-17f295d7a9eb",
            "685f1129-64c8-4803-ab80-6a1c5afeb7d7"
          ]
        },
        {
          "uuid": "86b4cd42-f24e-401e-8fe4-fe4c3e529481",
          "code": "C474837",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67474837",
          "code_system": "MESH",
          "references": [
            "7fc0f54b-02ec-428e-8f51-17f295d7a9eb"
          ]
        },
        {
          "uuid": "5968145f-4fae-4394-83a7-7f74883ba771",
          "code": "4871",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4871",
          "code_system": "PUBCHEM",
          "references": [
            "7fc0f54b-02ec-428e-8f51-17f295d7a9eb"
          ]
        },
        {
          "uuid": "b6a4f585-b795-6f83-66ca-9687ca33a927",
          "code": "Pomiferin",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Pomiferin",
          "code_system": "WIKIPEDIA",
          "references": [
            "38a77bc1-425b-cdfb-d8aa-e9f0f75eef34"
          ]
        },
        {
          "uuid": "e147e3f0-0ad4-eadb-7f77-1d5c20ef0826",
          "code": "DTXSID00205831",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00205831",
          "code_system": "EPA CompTox",
          "references": [
            "33c18642-c448-a627-fe1a-1b6ff2033d65"
          ]
        },
        {
          "uuid": "568151d1-88ca-4eab-b0cb-43101ee061ff",
          "code": "74YIS40APM",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d7178ee6-20c9-d0c4-6e82-4108c5fb2d8d",
          "code": "2593691",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2593691/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "ef583427-9a8f-4675-8cda-286c2ac8be21"
          ]
        },
        {
          "uuid": "690567fc-72ec-6187-e8d1-0aa95d19642e",
          "code": "74YIS40APM",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=74YIS40APM",
          "code_system": "DAILYMED",
          "references": [
            "591a5431-6e7b-9a00-5b73-49eacebb4ae4"
          ]
        },
        {
          "uuid": "ca0b5ede-a6ba-f027-a8de-d3b2bf21671c",
          "code": "5113",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=5113",
          "code_system": "NSC",
          "references": [
            "0ae6504a-5754-5b38-601d-49b15a4698fd"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3408c446-b61a-4db5-b71a-0d94b6a2e599",
          "name": "3'-HYDROXYOSAJIN",
          "stdName": "3'-HYDROXYOSAJIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6edb7e51-1099-43e3-8c7e-6d40fc0c5c4d",
            "c7f00470-cbac-4039-a927-69b66158dab8"
          ],
          "display_name": false
        },
        {
          "uuid": "91efed44-685e-42ef-bf09-d8868cc6d2ec",
          "name": "4H,8H-BENZO(1,2-B:3,4-B')DIPYRAN-4-ONE, 3-(3,4-DIHYDROXYPHENYL)-5-HYDROXY-8,8-DIMETHYL-6-(3-METHYL-2-BUTEN-1-YL)-",
          "stdName": "4H,8H-BENZO(1,2-B:3,4-B')DIPYRAN-4-ONE, 3-(3,4-DIHYDROXYPHENYL)-5-HYDROXY-8,8-DIMETHYL-6-(3-METHYL-2-BUTEN-1-YL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6edb7e51-1099-43e3-8c7e-6d40fc0c5c4d",
            "c7f00470-cbac-4039-a927-69b66158dab8"
          ],
          "display_name": false
        },
        {
          "uuid": "24421e1b-3935-4706-9610-16e8c8a1cbf0",
          "name": "4H,8H-BENZO(1,2-B:3,4-B')DIPYRAN-4-ONE, 3-(3,4-DIHYDROXYPHENYL)-5-HYDROXY-8,8-DIMETHYL-6-(3-METHYL-2-BUTENYL)-",
          "stdName": "4H,8H-BENZO(1,2-B:3,4-B')DIPYRAN-4-ONE, 3-(3,4-DIHYDROXYPHENYL)-5-HYDROXY-8,8-DIMETHYL-6-(3-METHYL-2-BUTENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6edb7e51-1099-43e3-8c7e-6d40fc0c5c4d",
            "c7f00470-cbac-4039-a927-69b66158dab8"
          ],
          "display_name": false
        },
        {
          "uuid": "c635561c-e197-450d-96c1-6389e8779dd4",
          "name": "NSC-5113",
          "stdName": "NSC-5113",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6edb7e51-1099-43e3-8c7e-6d40fc0c5c4d",
            "c7f00470-cbac-4039-a927-69b66158dab8"
          ],
          "display_name": false
        },
        {
          "uuid": "88b8a4cc-d86d-4ab0-8b4b-d02a8e79ea9b",
          "name": "POMIFERIN",
          "stdName": "POMIFERIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6edb7e51-1099-43e3-8c7e-6d40fc0c5c4d",
            "391c7412-3863-477f-8272-ac1ed1bb091d",
            "9de9eb26-a879-4458-b29b-3dbdb88a43c8",
            "3ae8a910-bc5e-441a-9f3e-607464749ed0"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "f770d413-63b7-46bb-8d77-8ded2459cde4",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "9de9eb26-a879-4458-b29b-3dbdb88a43c8",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3ae8a910-bc5e-441a-9f3e-607464749ed0",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6edb7e51-1099-43e3-8c7e-6d40fc0c5c4d",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c7f00470-cbac-4039-a927-69b66158dab8",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7fc0f54b-02ec-428e-8f51-17f295d7a9eb",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391119000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a783fdf-17f9-4287-ab86-b4b339eecdac",
          "citation": "SRS import [74YIS40APM]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=74YIS40APM",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391119000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48f74a48-23c8-4424-8f86-df7a396a2a94",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "391c7412-3863-477f-8272-ac1ed1bb091d",
          "citation": "POMIFERIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "38a77bc1-425b-cdfb-d8aa-e9f0f75eef34",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Pomiferin",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "33c18642-c448-a627-fe1a-1b6ff2033d65",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=572-03-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ef583427-9a8f-4675-8cda-286c2ac8be21",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "685f1129-64c8-4803-ab80-6a1c5afeb7d7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0ae6504a-5754-5b38-601d-49b15a4698fd",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "591a5431-6e7b-9a00-5b73-49eacebb4ae4",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f4e6bfb6-54e3-46aa-93cb-9d5d5d91e989",
          "id": "f4e6bfb6-54e3-46aa-93cb-9d5d5d91e989",
          "molfile": "\n  Marvin  01132112422D          \n\n 31 34  0  0  0  0            999 V2000\n    3.0076   -4.9944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7199   -4.5828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7199   -3.7549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4414   -4.9897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1536   -4.5735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8704   -4.9897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5874   -4.5735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5874   -3.7502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2996   -4.9897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2996   -5.8129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0119   -6.2246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7286   -5.8129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7286   -4.9897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4408   -4.5735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1531   -4.9897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8700   -4.5735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8700   -3.7457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5962   -3.3294    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1531   -3.3340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1531   -2.5108    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4408   -3.7457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0119   -4.5735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0119   -3.7502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5874   -6.2246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5874   -7.0524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8751   -7.4641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1582   -7.0524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4460   -6.7565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8762   -7.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1582   -6.2246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8704   -5.8129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n 31  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n 22  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 24 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 13  1  0  0  0  0\n 13 22  1  0  0  0  0\n 15 14  1  0  0  0  0\n 21 14  2  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 17 19  2  0  0  0  0\n 20 19  1  0  0  0  0\n 19 21  1  0  0  0  0\n 23 22  2  0  0  0  0\n 25 24  1  0  0  0  0\n 31 24  1  0  0  0  0\n 26 25  2  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 29 27  1  0  0  0  0\n 27 30  1  0  0  0  0\n 30 31  1  0  0  0  0\nM  END",
          "smiles": "CC(=CCc1c(c2c(=O)c(coc2c3C=CC(C)(C)Oc13)-c4ccc(c(c4)O)O)O)C",
          "formula": "C25H24O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e2b0fc9f-1af8-4b1b-aa88-26b51ef65d82"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "420.4554",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "99260b00-30a9-4dfa-9f0d-bc784759398e",
      "version": "11",
      "structure": {
        "id": "5419aa19-40e3-48fa-a964-ba164c282e69",
        "molfile": "\n  Marvin  01132104232D          \n\n 31 34  0  0  0  0            999 V2000\n    7.2996   -4.9897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0119   -4.5735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7286   -4.9897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7286   -5.8129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0119   -6.2246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2996   -5.8129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5874   -6.2246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5874   -7.0524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8751   -7.4641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1582   -7.0524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1582   -6.2246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8704   -5.8129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8704   -4.9897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5874   -4.5735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5874   -3.7502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1536   -4.5735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4414   -4.9897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7199   -4.5828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0076   -4.9944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7199   -3.7549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4460   -6.7565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8762   -7.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4408   -4.5735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4408   -3.7457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1531   -3.3340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1531   -2.5108    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8700   -3.7457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8700   -4.5735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1531   -4.9897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5962   -3.3294    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0119   -3.7502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14  1  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 13  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 18  1  0  0  0  0\n 12  7  1  0  0  0  0\n 21 10  1  0  0  0  0\n 22 10  1  0  0  0  0\n 23  3  1  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 25  2  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  2  0  0  0  0\n 29 23  1  0  0  0  0\n 30 27  1  0  0  0  0\n 31  2  2  0  0  0  0\nM  END",
        "smiles": "CC(=CCc1c(c2c(=O)c(coc2c3C=CC(C)(C)Oc13)-c4ccc(c(c4)O)O)O)C",
        "formula": "C25H24O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "420.4554",
        "optical_activity": "NONE",
        "references": [
          "1a783fdf-17f9-4287-ab86-b4b339eecdac",
          "48f74a48-23c8-4424-8f86-df7a396a2a94"
        ],
        "stereo_centers": 0
      },
      "unii": "74YIS40APM"
    }
  ]
}