{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "dc3c1e95-472e-4cd5-83c2-d2cfebb5c6b3", "code": "246018-80-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=246018-80-4", "code_system": "CAS", "references": [ "dfaf9f71-15f7-4347-b982-87915bf6d982", "53eeb49d-73c2-4dbd-916e-a1738ab4d15e" ] }, { "uuid": "37237421-9590-40de-98d3-718872e8d4ef", "code": "5288703", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5288703", "code_system": "PUBCHEM", "references": [ "dfaf9f71-15f7-4347-b982-87915bf6d982" ] }, { "uuid": "69d3bad2-001f-4e01-b101-9d5aac02b814", "code": "74SSN124VK", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "fe30f743-6400-4db7-a193-75af4470d617", "name": "(+)-LOBELINE", "stdName": "(+)-LOBELINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d8930c15-28fd-4fcf-8467-407203d043b2", "10ea356b-a697-426e-bd0b-803d92ff8194" ], "display_name": false }, { "uuid": "25041dbc-039d-48e1-9dbe-5e82e72c6e76", "name": "ETHANONE, 2-((2S,6R)-6-((2R)-2-HYDROXY-2-PHENYLETHYL)-1-METHYL-2-PIPERIDINYL)-1-PHENYL-", "stdName": "ETHANONE, 2-((2S,6R)-6-((2R)-2-HYDROXY-2-PHENYLETHYL)-1-METHYL-2-PIPERIDINYL)-1-PHENYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d8930c15-28fd-4fcf-8467-407203d043b2", "10ea356b-a697-426e-bd0b-803d92ff8194" ], "display_name": false }, { "uuid": "9f9903d3-32ea-4606-8da9-9ddb56eccdfc", "name": "LOBELINE, (+)-", "stdName": "LOBELINE, (+)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d8930c15-28fd-4fcf-8467-407203d043b2", "397f4a3b-1bc9-4f78-9509-27900d8b2b9a" ], "display_name": true } ], "references": [ { "uuid": "397f4a3b-1bc9-4f78-9509-27900d8b2b9a", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "d8930c15-28fd-4fcf-8467-407203d043b2", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "10ea356b-a697-426e-bd0b-803d92ff8194", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "dfaf9f71-15f7-4347-b982-87915bf6d982", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392282000, "tags": [ "NOMEN" ] }, { "uuid": "25dae2d1-82db-4ace-8367-99c97f15c516", "citation": "SRS import [74SSN124VK]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=74SSN124VK", "doc_type": "SRS", "public_domain": true, "document_date": 1493392282000, "tags": [ "NOMEN" ] }, { "uuid": "53eeb49d-73c2-4dbd-916e-a1738ab4d15e", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "c5d297f8-10f1-4790-8b49-af2f9f83ee81", "id": "c5d297f8-10f1-4790-8b49-af2f9f83ee81", "molfile": "\n Marvin 01132110142D \n\n 25 27 0 0 1 0 999 V2000\n 10.8083 -7.8168 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 10.8083 -8.6476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5145 -7.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2345 -7.8168 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 12.2345 -8.6476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9452 -9.0630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6607 -8.6476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6607 -7.8168 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 14.3622 -7.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0869 -7.8168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0869 -8.6476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8069 -7.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5223 -7.8168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2423 -7.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2423 -6.5890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5223 -6.1782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8069 -6.5890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9452 -7.4199 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9452 -6.5890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0883 -7.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0883 -6.5890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3728 -6.1782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6528 -6.5890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6528 -7.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3728 -7.8168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 3 1 0 0 0 0\n 20 1 1 0 0 0 0\n 4 3 1 6 0 0 0\n 4 5 1 0 0 0 0\n 4 18 1 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 1 6 0 0 0\n 8 18 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 2 0 0 0 0\n 12 10 1 0 0 0 0\n 13 12 1 0 0 0 0\n 17 12 2 0 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 21 20 1 0 0 0 0\n 25 20 2 0 0 0 0\n 22 21 2 0 0 0 0\n 23 22 1 0 0 0 0\n 23 24 2 0 0 0 0\n 24 25 1 0 0 0 0\nM END", "smiles": "CN1[C@H](CCC[C@H]1CC(=O)c2ccccc2)C[C@H](c3ccccc3)O", "formula": "C22H27NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "a50a35f6-65c1-4278-a7de-20c1cd55a592" }, "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "337.4561", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "55f1620f-40df-4a25-a641-5d5bc1c25b44", "version": "2", "structure": { "id": "f8ea8156-9ca9-45d8-bc21-5d9158a36998", "molfile": "\n Marvin 01132112542D \n\n 25 27 0 0 1 0 999 V2000\n 12.9452 -7.4199 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6607 -7.8168 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 12.2345 -7.8168 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.3622 -7.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5145 -7.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0869 -7.8168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8083 -7.8168 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 15.0869 -8.6476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8069 -7.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0883 -7.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9452 -6.5890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8083 -8.6476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6607 -8.6476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2345 -8.6476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9452 -9.0630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5223 -7.8168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8069 -6.5890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3728 -7.8168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0883 -6.5890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3728 -6.1782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2423 -7.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5223 -6.1782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6528 -7.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6528 -6.5890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2423 -6.5890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 1 1 0 0 0 0\n 2 4 1 6 0 0 0\n 3 5 1 6 0 0 0\n 6 4 1 0 0 0 0\n 7 5 1 0 0 0 0\n 8 6 2 0 0 0 0\n 9 6 1 0 0 0 0\n 10 7 1 0 0 0 0\n 11 1 1 0 0 0 0\n 7 12 1 1 0 0 0\n 13 2 1 0 0 0 0\n 14 3 1 0 0 0 0\n 15 14 1 0 0 0 0\n 15 13 1 0 0 0 0\n 16 9 2 0 0 0 0\n 17 9 1 0 0 0 0\n 18 10 2 0 0 0 0\n 19 10 1 0 0 0 0\n 20 19 2 0 0 0 0\n 21 16 1 0 0 0 0\n 22 17 2 0 0 0 0\n 23 18 1 0 0 0 0\n 24 20 1 0 0 0 0\n 24 23 2 0 0 0 0\n 25 22 1 0 0 0 0\n 25 21 2 0 0 0 0\nM END", "smiles": "CN1[C@H](CCC[C@H]1CC(=O)c2ccccc2)C[C@H](c3ccccc3)O", "formula": "C22H27NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "337.4561", "optical_activity": "UNSPECIFIED", "references": [ "25dae2d1-82db-4ace-8367-99c97f15c516", "10ea356b-a697-426e-bd0b-803d92ff8194" ], "stereo_centers": 3 }, "unii": "74SSN124VK" } ] }