{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "065a884a-dcd8-470d-940b-31b0572f0df9", "code": "36015-30-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=36015-30-2", "code_system": "CAS", "references": [ "6e10aaab-67c0-4774-8e30-2c917ded6a8c", "90f9c3b3-f468-4de5-8944-dcf3450b39c9" ] }, { "uuid": "1f198602-58f3-42fe-8326-b772013df0de", "code": "D011419", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/68011419", "code_system": "MESH", "references": [ "6e10aaab-67c0-4774-8e30-2c917ded6a8c" ] }, { "uuid": "85c333df-7363-2ea4-caaa-3fa3194956f4", "code": "Propidium", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Propidium", "code_system": "WIKIPEDIA", "references": [ "edf271d8-050f-9a7e-af6c-3eece96ecd96" ] }, { "uuid": "04d9fdf0-f374-90ab-808d-6339421b46f7", "code": "DTXSID20189583", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20189583", "code_system": "EPA CompTox", "references": [ "829c7095-7d6a-0c3e-f425-729ed7fa3d8a" ] }, { "uuid": "55284a64-9088-3149-3779-367125f4f4da", "code": "4939", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4939", "code_system": "PUBCHEM", "references": [ "d6514048-49c5-ea8d-e414-d899d59f7df2" ] }, { "uuid": "f6513ee0-fd7b-5c88-550f-6a45b5042ef6", "code": "DB02166", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB02166", "code_system": "DRUG BANK", "references": [ "81da7b84-e6ce-bd95-a069-aba13cd82f4e" ] }, { "uuid": "b60c5484-f907-4b9a-b183-4ffba4df5633", "code": "74NX23J96Y", "type": "PRIMARY", "code_system": "FDA UNII" } ], "relationships": [ { "uuid": "a9d32f2c-0352-18fb-12df-2465878bf657", "type": "IONIC MOIETY", "references": [ "90f9c3b3-f468-4de5-8944-dcf3450b39c9" ], "related_substance": { "uuid": "1ff9194f-b56a-4af4-9f0b-22ff35f2fc35", "refuuid": "010b75b1-e31e-4ed1-8a15-23f771776e3f", "name": "PROPIDIUM", "unii": "74NX23J96Y", "linking_id": "74NX23J96Y", "ref_pname": "PROPIDIUM" } } ], "substance_class": "chemical", "names": [ { "uuid": "d80743ef-20fc-4a4c-a352-36b27856bdd6", "name": "PHENANTHRIDINIUM, 3,8-DIAMINO-5-(3-(DIETHYLMETHYLAMMONIO)PROPYL)-6-PHENYL-", "stdName": "PHENANTHRIDINIUM, 3,8-DIAMINO-5-(3-(DIETHYLMETHYLAMMONIO)PROPYL)-6-PHENYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d6ee67c6-0c43-4aa4-a24f-c94f969b8ed1", "d62c0bcb-2d75-4a21-aec6-7dd9a57c9ea4" ], "display_name": false }, { "uuid": "871dde53-0728-4123-b4b4-9a403b194c24", "name": "PROPIDIUM", "stdName": "PROPIDIUM", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "69e48a27-43da-4513-accb-00cc892ca362", "3004115f-f584-4e8c-8f09-87669f097fb4" ], "display_name": true }, { "uuid": "a2d4dbdc-41d3-4b17-a06a-d5d00b20b824", "name": "PROPIDIUM CATION", "stdName": "PROPIDIUM CATION", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a3092990-7fbd-4326-83da-1b66fc9058f9", "d62c0bcb-2d75-4a21-aec6-7dd9a57c9ea4" ], "display_name": false }, { "uuid": "1bc93a33-622a-47a7-b9a3-f7522c281a22", "name": "PROPIDIUM ION", "stdName": "PROPIDIUM ION", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a3092990-7fbd-4326-83da-1b66fc9058f9", "d62c0bcb-2d75-4a21-aec6-7dd9a57c9ea4" ], "display_name": false } ], "references": [ { "uuid": "3004115f-f584-4e8c-8f09-87669f097fb4", "citation": "CHEMID 2011 Drugportal", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "69e48a27-43da-4513-accb-00cc892ca362", "citation": "DRUGPORTAL 2011", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d6ee67c6-0c43-4aa4-a24f-c94f969b8ed1", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d62c0bcb-2d75-4a21-aec6-7dd9a57c9ea4", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a3092990-7fbd-4326-83da-1b66fc9058f9", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6e10aaab-67c0-4774-8e30-2c917ded6a8c", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391214000, "tags": [ "NOMEN" ] }, { "uuid": "d59a9d8c-8871-4bcc-abc1-122c47130abc", "citation": "SRS import [74NX23J96Y]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=74NX23J96Y", "doc_type": "SRS", "public_domain": true, "document_date": 1493391214000, "tags": [ "NOMEN" ] }, { "uuid": "1e084bfb-8292-407f-810c-c24f3eab5e78", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "edf271d8-050f-9a7e-af6c-3eece96ecd96", "citation": "WIKI", "url": "https://en.wikipedia.org/wiki/Propidium", "doc_type": "WIKI", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "829c7095-7d6a-0c3e-f425-729ed7fa3d8a", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=36015-30-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "d6514048-49c5-ea8d-e414-d899d59f7df2", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "90f9c3b3-f468-4de5-8944-dcf3450b39c9", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "81da7b84-e6ce-bd95-a069-aba13cd82f4e", "doc_type": "SYSTEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "6726114d-934c-4b8a-8afe-cf76227e7130", "id": "6726114d-934c-4b8a-8afe-cf76227e7130", "molfile": "\n Marvin 01132105222D \n\n 31 34 0 0 0 0 999 V2000\n 1.7853 -1.7149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9603 -1.7149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5478 -2.4294 0.0000 N 0 3 0 0 0 0 0 0 0 3 0 0\n 0.1353 -3.1439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2623 -2.8419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2623 -3.6669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1666 -2.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1666 -1.1919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8811 -0.7794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8811 0.0456 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1666 0.4581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5478 0.0456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5478 -0.7794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2623 -1.1919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9768 -0.7794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9768 0.0456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2623 0.4581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1666 1.2831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5478 1.6956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5478 2.5206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2623 2.9331 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1666 2.9331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8811 2.5206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8811 1.6956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5956 1.2831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3101 1.6956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0245 1.2831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0245 0.4581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.7390 0.0456 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3101 0.0456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5956 0.4581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 5 1 0 0 0 0\n 7 3 1 0 0 0 0\n 5 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 31 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 18 2 0 0 0 0\n 12 13 1 0 0 0 0\n 17 12 2 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 17 16 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 24 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 20 22 1 0 0 0 0\n 23 22 2 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 2 0 0 0 0\n 25 26 1 0 0 0 0\n 31 25 1 0 0 0 0\n 26 27 2 0 0 0 0\n 28 27 1 0 0 0 0\n 28 29 2 0 0 0 0\n 30 28 1 0 0 0 0\n 31 30 2 0 0 0 0\nM CHG 1 3 1\nM END", "smiles": "CC[N+](C)(CC)CCCn1c-2cc(=N)ccc2c3ccc(cc3c1-c4ccccc4)N", "formula": "C27H33N4", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "093a86ca-f6c1-4dc5-ab83-8ff4a4034d04" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "413.5787", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "010b75b1-e31e-4ed1-8a15-23f771776e3f", "version": "8", "structure": { "id": "d8181712-fd47-4e9d-8344-3318aeaf88a9", "molfile": "\n Marvin 01132111122D \n\n 31 34 0 0 0 0 999 V2000\n -0.8811 0.0456 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n -0.1666 0.4581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5956 0.4581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1666 1.2831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8811 -0.7794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5956 1.2831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3101 0.0456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8811 1.6956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5478 1.6956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1666 -1.1919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3101 1.6956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0245 0.4581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8811 2.5206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5478 2.5206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1666 -2.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0245 1.2831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.7390 0.0456 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1666 2.9331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2623 2.9331 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5478 -2.4294 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 0.9603 -1.7149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2623 -2.8419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1353 -3.1439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7853 -1.7149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2623 -3.6669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5478 0.0456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2623 0.4581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5478 -0.7794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2623 -1.1919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9768 -0.7794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9768 0.0456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 1 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 3 6 2 0 0 0 0\n 3 7 1 0 0 0 0\n 4 8 2 0 0 0 0\n 4 9 1 0 0 0 0\n 5 10 1 0 0 0 0\n 6 11 1 0 0 0 0\n 7 12 2 0 0 0 0\n 8 13 1 0 0 0 0\n 9 14 2 0 0 0 0\n 10 15 1 0 0 0 0\n 11 16 2 0 0 0 0\n 12 17 1 0 0 0 0\n 13 18 2 0 0 0 0\n 14 19 1 0 0 0 0\n 15 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 22 1 0 0 0 0\n 20 23 1 0 0 0 0\n 21 24 1 0 0 0 0\n 22 25 1 0 0 0 0\n 6 8 1 0 0 0 0\n 12 16 1 0 0 0 0\n 14 18 1 0 0 0 0\n 1 5 1 0 0 0 0\n 2 26 1 0 0 0 0\n 27 26 2 0 0 0 0\n 26 28 1 0 0 0 0\n 27 31 1 0 0 0 0\n 28 29 2 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\nM CHG 2 1 1 20 1\nM END", "smiles": "CC[N+](C)(CC)CCC[n+]1c2cc(ccc2c3ccc(cc3c1-c4ccccc4)N)N", "formula": "C27H34N4", "atropisomerism": "No", "charge": 2, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "414.5867", "optical_activity": "NONE", "references": [ "d59a9d8c-8871-4bcc-abc1-122c47130abc", "1e084bfb-8292-407f-810c-c24f3eab5e78" ], "stereo_centers": 0 }, "unii": "74NX23J96Y" } ] }