{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bca2b967-0515-43f3-a07f-effc6b33a921",
          "code": "10060-26-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=10060-26-1",
          "code_system": "CAS",
          "references": [
            "7ab50e0c-7aa3-4768-9a46-55279af2d72a",
            "56c847bf-925c-484b-ae92-221e0214cb37"
          ]
        },
        {
          "uuid": "b1026de5-040c-460b-8a45-1b1e4c592e22",
          "code": "10024-66-5",
          "type": "NON-SPECIFIC STOICHIOMETRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=10024-66-5",
          "code_system": "CAS",
          "references": [
            "7ab50e0c-7aa3-4768-9a46-55279af2d72a",
            "ba7310ba-04c2-4f33-bd0c-225f6c7b1616"
          ]
        },
        {
          "uuid": "f599918d-7919-42a8-a86c-dcf36e061dc5",
          "code": "233-193-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.030.163",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7ab50e0c-7aa3-4768-9a46-55279af2d72a"
          ]
        },
        {
          "uuid": "8c1e7fbf-e3e2-4def-a7d7-4432b6da1410",
          "code": "233-027-3",
          "type": "ALTERNATIVE",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.030.013",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7ab50e0c-7aa3-4768-9a46-55279af2d72a"
          ]
        },
        {
          "uuid": "3ed8307d-98c5-4bac-a151-28f4ddcc6eb8",
          "code": "9937209",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9937209",
          "code_system": "PUBCHEM",
          "references": [
            "7ab50e0c-7aa3-4768-9a46-55279af2d72a"
          ]
        },
        {
          "uuid": "3413782a-52aa-4869-9b6b-c7a5f7990cce",
          "code": "74NE0422XH",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b9e911b5-8b33-2ba6-78cb-d511991761f2",
          "code": "100000076487",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a4dcfa00-950d-639d-0897-43b27b8702bd"
          ]
        },
        {
          "uuid": "33c79f8d-7e7f-206c-792c-1c695ddbfe91",
          "code": "DTXSID6047496",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6047496",
          "code_system": "EPA CompTox",
          "references": [
            "ed258606-27ab-ed06-a3ca-8a3aa5f01f37"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "cf32a24c-f40f-4170-bdf8-4448f9c13c13",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "6e1ba6a7-9b0b-4202-8871-3dc81bac44e5",
            "refuuid": "8248332c-8739-4872-8639-9ac1fb9d7f19",
            "name": "MANGANOUS CATION",
            "unii": "H6EP7W5457",
            "linking_id": "H6EP7W5457",
            "ref_pname": "MANGANOUS CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d4dd646a-542d-f189-15c4-f04f86823e1c",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "ba7310ba-04c2-4f33-bd0c-225f6c7b1616"
          ],
          "related_substance": {
            "uuid": "5ed2195c-c838-48b2-a97c-0c9fa325c697",
            "refuuid": "93bcfd5b-6576-4c6f-882c-263ad0a9a2ed",
            "name": "MANGANESE CITRATE DECAHYDRATE",
            "unii": "4Z2OA6A13N",
            "linking_id": "4Z2OA6A13N",
            "ref_pname": "MANGANESE CITRATE DECAHYDRATE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bd2b12d8-729e-44cb-8ad3-792a7a2723ae",
          "name": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, MANGANESE(2+) SALT (2:3)",
          "stdName": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, MANGANESE(2+) SALT (2:3)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2fa25dc-160a-40df-862a-61c04cb0ff2b",
            "0bd9ff70-8ef8-435e-9588-829f2187d6ee"
          ],
          "display_name": false
        },
        {
          "uuid": "62b7ce8d-3d96-4880-9975-180425fb4b41",
          "name": "MANGANESE CITRATE ANHYDROUS",
          "stdName": "MANGANESE CITRATE ANHYDROUS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e443106-50db-47e3-a539-b6fcaac9e8c1",
            "d2fa25dc-160a-40df-862a-61c04cb0ff2b"
          ],
          "display_name": true
        },
        {
          "uuid": "1f25b021-c29c-406e-9e73-3fe6d3bc377e",
          "name": "TRIMANGANESE DICITRATE",
          "stdName": "TRIMANGANESE DICITRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2fa25dc-160a-40df-862a-61c04cb0ff2b",
            "0bd9ff70-8ef8-435e-9588-829f2187d6ee"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2e443106-50db-47e3-a539-b6fcaac9e8c1",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d2fa25dc-160a-40df-862a-61c04cb0ff2b",
          "citation": "USP FOOD CHEMICALS CODEX",
          "doc_type": "USP FOOD CHEMICALS CODEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0bd9ff70-8ef8-435e-9588-829f2187d6ee",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c1ece2d-006b-4b07-b547-2d45808b6f97",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ab50e0c-7aa3-4768-9a46-55279af2d72a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391745000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8838d3a4-7870-4707-bb4c-8d740b757c00",
          "citation": "SRS import [74NE0422XH]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=74NE0422XH",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391745000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9d5d60f0-5869-224a-009a-4a24f62ab480",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=10024-66-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a4dcfa00-950d-639d-0897-43b27b8702bd",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "ba7310ba-04c2-4f33-bd0c-225f6c7b1616",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "56c847bf-925c-484b-ae92-221e0214cb37",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ed258606-27ab-ed06-a3ca-8a3aa5f01f37",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "104e25cc-282f-4f16-b4f1-cf3bb4f46be4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c859e4e0-be52-44d9-9ec5-48d862fde954",
          "id": "c859e4e0-be52-44d9-9ec5-48d862fde954",
          "molfile": "\n  Marvin  01132110212D          \n\n  1  0  0  0  0  0            999 V2000\n    8.4550   -4.0501    0.0000 Mn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Mn+2]",
          "formula": "Mn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 3,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 3,
            "units": "MOL RATIO",
            "uuid": "d01c1f02-d63e-47eb-8fc6-dcf9f07a7f36"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "54.938",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "b2800345-a7c4-4ce7-94dd-72ce8df39e19",
          "id": "b2800345-a7c4-4ce7-94dd-72ce8df39e19",
          "molfile": "\n  Marvin  01132109152D          \n\n 13 12  0  0  0  0            999 V2000\n    4.1794   -2.8100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1837   -3.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4697   -4.0501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7557   -3.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0375   -4.0501    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.7515   -2.8100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8976   -4.0501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6116   -3.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3256   -4.0501    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.6033   -2.8100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1794   -4.4592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4614   -4.8643    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.8934   -4.8726    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  7  1  0  0  0  0\n  2 11  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\nM  CHG  3   5  -1   9  -1  12  -1\nM  END",
          "smiles": "C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O",
          "formula": "C6H5O7",
          "atropisomerism": "No",
          "charge": -3,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "52eaf2c2-482c-41f3-921e-37ce70eed826"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "189.1",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7c317b82-b24e-4936-a107-4f5139bab6d7",
      "version": "10",
      "structure": {
        "id": "71af9007-4b6a-469e-bb72-e66a63e6ecd2",
        "molfile": "\n  Marvin  01132105542D          \n\n 29 24  0  0  0  0            999 V2000\n    8.4550   -4.0501    0.0000 Mn  0  2  0  0  0  0  0  0  0  0  0  0\n    2.0375   -4.0501    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.7557   -3.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4697   -4.0501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1837   -3.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8976   -4.0501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6116   -3.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3256   -4.0501    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.7515   -2.8100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1794   -2.8100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1794   -4.4592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6033   -2.8100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4614   -4.8643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8934   -4.8726    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.4550   -4.0501    0.0000 Mn  0  2  0  0  0  0  0  0  0  0  0  0\n    8.4550   -4.0501    0.0000 Mn  0  2  0  0  0  0  0  0  0  0  0  0\n    2.0375   -4.0501    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.7557   -3.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4697   -4.0501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1837   -3.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8976   -4.0501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6116   -3.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3256   -4.0501    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.7515   -2.8100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1794   -2.8100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1794   -4.4592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6033   -2.8100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4614   -4.8643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8934   -4.8726    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  3  9  2  0  0  0  0\n  5 10  1  0  0  0  0\n  5 11  1  0  0  0  0\n  7 12  2  0  0  0  0\n 11 13  2  0  0  0  0\n 11 14  1  0  0  0  0\n  2  3  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 24  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 25  1  0  0  0  0\n 20 26  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 27  2  0  0  0  0\n 26 28  2  0  0  0  0\n 26 29  1  0  0  0  0\nM  CHG  8   1   2   2  -1   8  -1  14  -1  15   2  16   2  17  -1  23  -1\nM  CHG  1  29  -1\nM  STY  2   1 MUL   2 MUL\nM  SCN  1   1 HT \nM  SAL   1 15   2   3   4   5   6   7   8   9  10  11  12  13  14  17  18\nM  SAL   1 11  19  20  21  22  23  24  25  26  27  28  29\nM  SPA   1 13   2   3   4   5   6   7   8   9  10  11  12  13  14\nM  SDI   1  4    1.6175   -5.2926    1.6175   -2.3900\nM  SDI   1  4    6.7456   -2.3900    6.7456   -5.2926\nM  SMT   1 2\nM  SCN  1   2 HT \nM  SAL   2  3   1  15  16\nM  SPA   2  1   1\nM  SDI   2  4    8.0350   -4.4701    8.0350   -3.6301\nM  SDI   2  4    8.8750   -3.6301    8.8750   -4.4701\nM  SMT   2 3\nM  END",
        "smiles": "C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.[Mn+2].[Mn+2].[Mn+2]",
        "formula": "2C6H5O7.3Mn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "543.014",
        "optical_activity": "NONE",
        "references": [
          "0bd9ff70-8ef8-435e-9588-829f2187d6ee",
          "8838d3a4-7870-4707-bb4c-8d740b757c00"
        ],
        "stereo_centers": 0
      },
      "unii": "74NE0422XH"
    }
  ]
}