{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3961f087-ab39-428d-af8f-e9210458db6c",
          "code": "16009-13-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=16009-13-5",
          "code_system": "CAS",
          "references": [
            "56a21d48-32f2-419b-9078-72c233a4c96f",
            "29350901-6d98-4598-bc35-765465fac20a"
          ]
        },
        {
          "uuid": "3c6ee911-93e4-474e-85f5-74feaf6ed42a",
          "code": "D006427",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68006427",
          "code_system": "MESH",
          "references": [
            "56a21d48-32f2-419b-9078-72c233a4c96f"
          ]
        },
        {
          "uuid": "624e7aa8-de49-4350-b391-d639910ebced",
          "code": "HEMIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Hemin",
          "code_system": "WIKIPEDIA",
          "references": [
            "56a21d48-32f2-419b-9078-72c233a4c96f"
          ]
        },
        {
          "uuid": "d35691d5-1951-49b0-833e-8219b536933a",
          "code": "5175",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/5175/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "56a21d48-32f2-419b-9078-72c233a4c96f"
          ]
        },
        {
          "uuid": "9a21a1bd-bc31-45b0-beff-6f795cc5f148",
          "code": "m5949",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5949?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "56a21d48-32f2-419b-9078-72c233a4c96f"
          ]
        },
        {
          "uuid": "2390cac3-ae74-4ed4-9dff-cf26747dcb8c",
          "code": "DB03404",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB03404",
          "code_system": "DRUG BANK",
          "references": [
            "56a21d48-32f2-419b-9078-72c233a4c96f"
          ]
        },
        {
          "uuid": "4bc58108-ffd6-48a5-9be8-b5fc8529f936",
          "code": "SUB14075MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "56a21d48-32f2-419b-9078-72c233a4c96f"
          ]
        },
        {
          "uuid": "37c9a247-4fbb-4894-b0b5-1c0fe2a1d858",
          "code": "240-140-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.036.475",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "56a21d48-32f2-419b-9078-72c233a4c96f"
          ]
        },
        {
          "uuid": "faf939b5-055c-299d-b69e-ac8efc0f80df",
          "code": "DTXSID9037662",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9037662",
          "code_system": "EPA CompTox",
          "references": [
            "0dfc371b-9480-891d-d0a5-22453dc9011f"
          ]
        },
        {
          "uuid": "0585247c-9147-c67a-5536-f0be72188bd9",
          "code": "683",
          "comments": "ORPHAN DRUG|Designated/Approved|Amelioration of recurrent attacks of acute intermittent porphyria (AIP) temporarily related to the menstrual cycle in susceptible women and similar symptoms which occur in other patients with AIP, porphyria variegata and hereditary coproporphyria.",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=683",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "be4a265d-8c73-e201-94c5-56672edc7864",
          "code": "77393",
          "comments": "ORPHAN DRUG|Designated|Treatment of acute porphyric syndromes.",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=77393",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "0d17b11c-ac23-1987-2cfa-2f10d9457135",
          "code": "5117",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/5117",
          "code_system": "DRUG CENTRAL",
          "references": [
            "09b414a9-a8b7-9d43-1a1e-1e2673715c0f"
          ]
        },
        {
          "uuid": "50472e0b-d1e5-4297-8981-43f6dc480b28",
          "code": "743LRP9S7N",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e2558350-a506-616a-ed5b-9c54e37c5340",
          "code": "50385",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:50385",
          "code_system": "CHEBI",
          "references": [
            "09b414a9-a8b7-9d43-1a1e-1e2673715c0f"
          ]
        },
        {
          "uuid": "ee78b460-ef20-9a52-31f1-2c64444fd151",
          "code": "122707",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=122707",
          "code_system": "NSC",
          "references": [
            "3138b356-6b43-0ca5-f727-7042c32013b5"
          ]
        },
        {
          "uuid": "d6562cba-7f41-20a0-f169-293dc032e74d",
          "code": "100000077913",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "b4fe09bf-5412-b328-0e37-76fa75695d6c"
          ]
        },
        {
          "uuid": "066eab96-902d-e128-ff72-f10e7db44fa2",
          "code": "743LRP9S7N",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=743LRP9S7N",
          "code_system": "DAILYMED",
          "references": [
            "dfc0dfdb-e949-0aa4-8cc0-db6267535026"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "1f678a78-98c8-4c78-9be6-2b21d69c1aa5",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "02efc9d7-0319-4738-8806-9ea63c9edad0",
            "refuuid": "e8d477e7-4443-4dd6-815f-e3c05a320696",
            "name": "HEMIN",
            "unii": "743LRP9S7N",
            "linking_id": "743LRP9S7N",
            "ref_pname": "HEMIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c0016042-6dca-4b93-bc34-7cd2e929e9d9",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "cf87ce62-2c14-4950-9631-d3dd0b80717a",
            "refuuid": "09831261-7932-4198-8602-985e0102057e",
            "name": "FERRIC CATION",
            "unii": "91O4LML611",
            "linking_id": "91O4LML611",
            "ref_pname": "FERRIC CATION",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fed15982-34f2-4788-9c1d-216ed2dc9fd0",
          "name": "CHLOROHEMIN",
          "stdName": "CHLOROHEMIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e13abb51-89f2-411b-beca-96ac35bd92f1",
            "f613a757-93b1-4a69-b0a0-43a11abb7aae"
          ],
          "display_name": false
        },
        {
          "uuid": "d9eafd46-d563-4c69-8363-f0dc5cbd0f21",
          "name": "FERRATE(2-), CHLORO(7,12-DIETHENYL-3,8,13,17-TETRAMETHYL-21H,23H-PORPHINE-2,18-DIPROPANOATO(4-)-N21,N22,N23,N24)-, DIHYDROGEN",
          "stdName": "FERRATE(2-), CHLORO(7,12-DIETHENYL-3,8,13,17-TETRAMETHYL-21H,23H-PORPHINE-2,18-DIPROPANOATO(4-)-N21,N22,N23,N24)-, DIHYDROGEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e13abb51-89f2-411b-beca-96ac35bd92f1",
            "f613a757-93b1-4a69-b0a0-43a11abb7aae"
          ],
          "display_name": false
        },
        {
          "uuid": "21d5ae70-d4b0-46a8-8773-b11d0340d737",
          "name": "FERRIPROTOPORPHYRIN CHLORIDE",
          "stdName": "FERRIPROTOPORPHYRIN CHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e13abb51-89f2-411b-beca-96ac35bd92f1",
            "f613a757-93b1-4a69-b0a0-43a11abb7aae"
          ],
          "display_name": false
        },
        {
          "uuid": "e7997906-f175-4d8c-b412-5eb35e20ed87",
          "name": "HEMIN",
          "stdName": "HEMIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e13abb51-89f2-411b-beca-96ac35bd92f1",
            "2ec524a2-87db-4340-829b-ca42a4cca513",
            "f613a757-93b1-4a69-b0a0-43a11abb7aae",
            "6efe51de-8783-4fc6-bbdb-63b3006d0e2a",
            "9bfb7664-d5bf-4221-ad85-17d00d9dcfe2",
            "c8590714-6d88-4e2b-bb36-5fbd96165006",
            "3808bec3-37e0-4d6b-a4ba-7a4b1ae06fee",
            "3f5a993f-3433-400c-aed0-5a6b46803868"
          ],
          "display_name": true
        },
        {
          "uuid": "d00b3576-3d85-7b1e-ba94-a8d84ea335e6",
          "name": "HEMIN [JAN]",
          "stdName": "HEMIN [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cb82f7b-5a4b-764b-22b9-5c0ea8973c11"
          ],
          "display_name": false
        },
        {
          "uuid": "1d2acfe8-79df-4ade-9925-bc74cbd9a13b",
          "name": "HEMIN [MI]",
          "stdName": "HEMIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6efe51de-8783-4fc6-bbdb-63b3006d0e2a",
            "f613a757-93b1-4a69-b0a0-43a11abb7aae"
          ],
          "display_name": false
        },
        {
          "uuid": "f43f5b29-425a-4c11-a993-80e4b936eada",
          "name": "HEMIN [VANDF]",
          "stdName": "HEMIN [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f613a757-93b1-4a69-b0a0-43a11abb7aae",
            "3f5a993f-3433-400c-aed0-5a6b46803868"
          ],
          "display_name": false
        },
        {
          "uuid": "0189c2fd-a5d8-8a18-92d1-203f63143e69",
          "name": "Hemin [WHO-DD]",
          "stdName": "HEMIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3fb9c079-0162-5af0-dbb1-70692422a607"
          ],
          "display_name": false
        },
        {
          "uuid": "4ac810a5-46f6-4260-840b-08acd585f6df",
          "name": "NSC-122707",
          "stdName": "NSC-122707",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f613a757-93b1-4a69-b0a0-43a11abb7aae",
            "9de5688f-185a-4d5a-a862-e88f8e4f3afa"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e13abb51-89f2-411b-beca-96ac35bd92f1",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f613a757-93b1-4a69-b0a0-43a11abb7aae",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6efe51de-8783-4fc6-bbdb-63b3006d0e2a",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8590714-6d88-4e2b-bb36-5fbd96165006",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3f5a993f-3433-400c-aed0-5a6b46803868",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9de5688f-185a-4d5a-a862-e88f8e4f3afa",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "56a21d48-32f2-419b-9078-72c233a4c96f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390845000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ccd6c5e9-f9d7-4676-b1fd-3755162bdfd2",
          "citation": "SRS import [743LRP9S7N]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=743LRP9S7N",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390845000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ec524a2-87db-4340-829b-ca42a4cca513",
          "citation": "HEMIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3808bec3-37e0-4d6b-a4ba-7a4b1ae06fee",
          "citation": "HEMIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9bfb7664-d5bf-4221-ad85-17d00d9dcfe2",
          "citation": "HEMIN [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0dfc371b-9480-891d-d0a5-22453dc9011f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=16009-13-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b4fe09bf-5412-b328-0e37-76fa75695d6c",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "3cb82f7b-5a4b-764b-22b9-5c0ea8973c11",
          "citation": "JAN",
          "doc_type": "JAN",
          "public_domain": true
        },
        {
          "uuid": "09b414a9-a8b7-9d43-1a1e-1e2673715c0f",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "29350901-6d98-4598-bc35-765465fac20a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3138b356-6b43-0ca5-f727-7042c32013b5",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "3fb9c079-0162-5af0-dbb1-70692422a607",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "dfc0dfdb-e949-0aa4-8cc0-db6267535026",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d13e7fa2-afda-4747-ac83-af67459b58eb",
          "id": "d13e7fa2-afda-4747-ac83-af67459b58eb",
          "molfile": "\n  Marvin  01132110492D          \n\n  1  0  0  0  0  0            999 V2000\n    6.3916    3.6744    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c8702bce-caf4-45c4-a2d3-43c6cf7b2050"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "dbad4551-e0a9-4c3c-96eb-5c36eeeb7304",
          "id": "dbad4551-e0a9-4c3c-96eb-5c36eeeb7304",
          "molfile": "\n  Marvin  01132111242D          \n\n  1  0  0  0  0  0            999 V2000\n    6.1875    0.4445    0.0000 Fe  0  1  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   3\nM  END",
          "smiles": "[Fe+3]",
          "formula": "Fe",
          "atropisomerism": "No",
          "charge": 3,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "41219551-50fa-4a25-be0d-1327d86c4153"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "55.8451",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "b4edbb61-2306-4b08-a0ec-118829f5304e",
          "id": "b4edbb61-2306-4b08-a0ec-118829f5304e",
          "molfile": "\n  Marvin  01132109222D          \n\n 42 46  0  0  0  0            999 V2000\n    3.5267   -0.5071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0944   -0.5071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8142   -1.6480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5789   -2.4357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7775   -2.6287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5424   -3.4165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1085   -4.0155    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.7410   -3.6051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6362   -1.2759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5038   -1.6714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3448   -1.2926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3448   -0.5394    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0879   -0.1939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5212    0.5893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1079    1.3070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2793    1.5703    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2726    2.2812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4681    2.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6040    2.2657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6129    1.5937    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8142    1.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4130    0.6049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8663   -0.1517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6362   -0.5782    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2576    1.8646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5467    1.8646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1508    2.6823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1527    3.5077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4394    3.9222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0135    2.6179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0135    3.2598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6844    1.5703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4742    1.3420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0728    1.9133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7435   -0.5071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5976   -0.5071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0879   -1.6158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3431   -2.3974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1490   -2.5701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4042   -3.3517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8533   -3.9649    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   10.2102   -3.5246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n 23  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  9  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  2  0  0  0  0\n  9 10  1  0  0  0  0\n 24  9  2  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 11 37  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 35  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 15 32  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 17 30  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 19 27  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 21 25  1  0  0  0  0\n 23 22  2  0  0  0  0\n 24 23  1  0  0  0  0\n 25 26  1  0  0  0  0\n 27 25  2  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  2  0  0  0  0\n 30 31  1  0  0  0  0\n 32 30  2  0  0  0  0\n 32 33  1  0  0  0  0\n 33 34  2  0  0  0  0\n 35 36  1  0  0  0  0\n 37 35  2  0  0  0  0\n 37 38  1  0  0  0  0\n 38 39  1  0  0  0  0\n 39 40  1  0  0  0  0\n 40 41  1  0  0  0  0\n 40 42  2  0  0  0  0\nM  CHG  2   7  -1  41  -1\nM  END",
          "smiles": "C=Cc1c(C)c2cc3c(C)c(CCC(=O)[O-])c(cc4c(CCC(=O)[O-])c(C)c(cc5c(C=C)c(C)c(cc1n2)n5)n4)n3",
          "formula": "C34H30N4O4",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "adea0d0d-7997-454d-ab42-77fbf5a31a8b"
          },
          "defined_stereo": 0,
          "ez_centers": 4,
          "molecular_weight": "558.6277",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e8d477e7-4443-4dd6-815f-e3c05a320696",
      "version": "14",
      "structure": {
        "id": "24709a51-421f-4d11-8970-bdfbd5e444d1",
        "molfile": "\n  Marvin  01132102022D          \n\n 44 46  0  0  0  0            999 V2000\n    7.3448   -0.5394    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6362   -0.5782    0.0000 N   0  5  0  0  0  0  0  0  0  0  0  0\n    7.2793    1.5703    0.0000 N   0  5  0  0  0  0  0  0  0  0  0  0\n    5.6129    1.5937    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3448   -1.2926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0879   -0.1939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6362   -1.2759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8663   -0.1517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1079    1.3070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2726    2.2812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6040    2.2657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8142    1.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5038   -1.6714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0879   -1.6158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5212    0.5893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7435   -0.5071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8142   -1.6480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4130    0.6049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0944   -0.5071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6844    1.5703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4681    2.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0135    2.6179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1508    2.6823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2576    1.8646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3431   -2.3974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5976   -0.5071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5789   -2.4357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5267   -0.5071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4742    1.3420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0135    3.2598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1527    3.5077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5467    1.8646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7775   -2.6287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0728    1.9133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4394    3.9222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5424   -3.4165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1085   -4.0155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7410   -3.6051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1490   -2.5701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4042   -3.3517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2102   -3.5246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8533   -3.9649    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1875    0.4445    0.0000 Fe  0  1  0  0  0  0  0  0  0  0  0  0\n    6.3916    3.6744    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n  1  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  2  7  1  0  0  0  0\n  2  8  1  0  0  0  0\n  3  9  1  0  0  0  0\n  3 10  1  0  0  0  0\n  4 11  1  0  0  0  0\n  4 12  2  0  0  0  0\n  5 13  1  0  0  0  0\n  5 14  1  0  0  0  0\n  6 15  2  0  0  0  0\n  6 16  1  0  0  0  0\n  7 17  1  0  0  0  0\n  8 18  2  0  0  0  0\n  8 19  1  0  0  0  0\n  9 20  2  0  0  0  0\n 10 21  1  0  0  0  0\n 10 22  2  0  0  0  0\n 11 23  1  0  0  0  0\n 12 24  1  0  0  0  0\n 14 25  1  0  0  0  0\n 16 26  1  0  0  0  0\n 17 27  1  0  0  0  0\n 19 28  1  0  0  0  0\n 20 29  1  0  0  0  0\n 22 30  1  0  0  0  0\n 23 31  1  0  0  0  0\n 24 32  1  0  0  0  0\n 27 33  1  0  0  0  0\n 29 34  2  0  0  0  0\n 31 35  2  0  0  0  0\n 33 36  1  0  0  0  0\n 36 37  1  0  0  0  0\n 36 38  2  0  0  0  0\n  7 13  2  0  0  0  0\n  9 15  1  0  0  0  0\n 11 21  2  0  0  0  0\n 12 18  1  0  0  0  0\n 14 16  2  0  0  0  0\n 17 19  2  0  0  0  0\n 20 22  1  0  0  0  0\n 23 24  2  0  0  0  0\n 25 39  1  0  0  0  0\n 39 40  1  0  0  0  0\n 40 41  2  0  0  0  0\n 40 42  1  0  0  0  0\nM  CHG  4   2  -1   3  -1  43   3  44  -1\nM  END",
        "smiles": "C=CC1=C(C)c2cc3c(C)c(CCC(=O)O)c(cc4C(=C(C)c(cc5c(C=C)c(C)c(cc1n2)[n-]5)n4)CCC(=O)O)[n-]3.[Cl-].[Fe+3]",
        "formula": "C34H32N4O4.Cl.Fe",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 4,
        "molecular_weight": "651.9416",
        "optical_activity": "NONE",
        "references": [
          "e13abb51-89f2-411b-beca-96ac35bd92f1",
          "ccd6c5e9-f9d7-4676-b1fd-3755162bdfd2"
        ],
        "stereo_centers": 0
      },
      "unii": "743LRP9S7N"
    }
  ]
}