{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bf2381de-b43f-4b3d-a7c6-7f6b2386e999",
          "code": "R05CB03",
          "comments": "ATC|RESPIRATORY SYSTEM|COUGH AND COLD PREPARATIONS|EXPECTORANTS, EXCL. COMBINATIONS WITH COUGH SUPPRESSANTS|Mucolytics|carbocisteine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=R05CB03&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "d89d83b6-ce33-4d7b-bad1-e4d2b9b886e6"
          ]
        },
        {
          "uuid": "2fb0dafb-6e83-4162-82db-7026aa994480",
          "code": "QR05CB03",
          "comments": "VATC|COUGH AND COLD PREPARATIONS|EXPECTORANTS, EXCL. COMBINATIONS WITH COUGH SUPPRESSANTS|Mucolytics|carbocisteine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QR05CB03&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "d89d83b6-ce33-4d7b-bad1-e4d2b9b886e6"
          ]
        },
        {
          "uuid": "4f6f2683-34b3-4bc1-977b-73f4684ceac8",
          "code": "638-23-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=638-23-3",
          "code_system": "CAS",
          "references": [
            "d89d83b6-ce33-4d7b-bad1-e4d2b9b886e6",
            "1a97fd94-4f83-46a8-9794-9367cf2f32c8"
          ]
        },
        {
          "uuid": "867c76e9-5ca7-4674-98b2-e8733ca7e1da",
          "code": "D002233",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68002233",
          "code_system": "MESH",
          "references": [
            "d89d83b6-ce33-4d7b-bad1-e4d2b9b886e6"
          ]
        },
        {
          "uuid": "c01db724-9e3a-4226-8f10-729c139ea5de",
          "code": "CARBOCISTEINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Carbocisteine",
          "code_system": "WIKIPEDIA",
          "references": [
            "d89d83b6-ce33-4d7b-bad1-e4d2b9b886e6"
          ]
        },
        {
          "uuid": "589e8073-9dcf-4448-8974-62451f78d446",
          "code": "SUB11790MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "d89d83b6-ce33-4d7b-bad1-e4d2b9b886e6"
          ]
        },
        {
          "uuid": "76247d3d-3179-434c-bc06-eaf1a6cf1387",
          "code": "2884",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2884",
          "code_system": "INN",
          "references": [
            "d89d83b6-ce33-4d7b-bad1-e4d2b9b886e6"
          ]
        },
        {
          "uuid": "1d8cb004-3f40-46b0-af1c-5c6004973038",
          "code": "211-327-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.010.298",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d89d83b6-ce33-4d7b-bad1-e4d2b9b886e6"
          ]
        },
        {
          "uuid": "b1541acc-3acb-4a58-bd3a-593da7bf0e7b",
          "code": "C83591",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C83591",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d89d83b6-ce33-4d7b-bad1-e4d2b9b886e6"
          ]
        },
        {
          "uuid": "2ad35430-1c03-4bee-a748-6b2c05d27224",
          "code": "2023",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2023/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "d89d83b6-ce33-4d7b-bad1-e4d2b9b886e6"
          ]
        },
        {
          "uuid": "bbc10089-1ff4-417f-8e45-523e6824fc0b",
          "code": "m3072",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3072?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d89d83b6-ce33-4d7b-bad1-e4d2b9b886e6"
          ]
        },
        {
          "uuid": "b6a1bcdb-16c9-47c3-b0ca-33eed21526b1",
          "code": "DB04339",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB04339",
          "code_system": "DRUG BANK",
          "references": [
            "d89d83b6-ce33-4d7b-bad1-e4d2b9b886e6"
          ]
        },
        {
          "uuid": "7aebc8d6-7cc6-4300-a829-21e0e70e4a72",
          "code": "SUB21966",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "d89d83b6-ce33-4d7b-bad1-e4d2b9b886e6"
          ]
        },
        {
          "uuid": "30e9265d-3744-4353-91fb-f3d3f33076bb",
          "code": "CHEMBL396416",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL396416",
          "code_system": "ChEMBL",
          "references": [
            "d89d83b6-ce33-4d7b-bad1-e4d2b9b886e6"
          ]
        },
        {
          "uuid": "e83398f3-39cb-4f84-b27e-92e3fc8a4e74",
          "code": "193653",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/193653",
          "code_system": "PUBCHEM",
          "references": [
            "d89d83b6-ce33-4d7b-bad1-e4d2b9b886e6"
          ]
        },
        {
          "uuid": "b5556aaf-448b-0a75-5def-21dc667f1141",
          "code": "DTXSID30110060",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30110060",
          "code_system": "EPA CompTox",
          "references": [
            "9accbe32-f9de-0a5b-1ca5-c14cc710ffa9"
          ]
        },
        {
          "uuid": "5c0e388a-def2-118e-c6d9-8a13b7bd3f3f",
          "code": "C74536",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Respiratory System[C78273]|Mucolytic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C74536",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7bc7a4c6-660e-0724-35d2-5cbd5659b150"
          ]
        },
        {
          "uuid": "fd0b23ec-9e50-4b63-abe9-5268f81dcfc4",
          "code": "740J2QX53R",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7e0a7034-bd7d-55d0-11bb-5111aa8aa470",
          "code": "4160",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4160",
          "code_system": "DRUG CENTRAL",
          "references": [
            "7bc7a4c6-660e-0724-35d2-5cbd5659b150"
          ]
        },
        {
          "uuid": "abd604df-3497-9c14-dba6-00101541bace",
          "code": "16163",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16163",
          "code_system": "CHEBI",
          "references": [
            "7bc7a4c6-660e-0724-35d2-5cbd5659b150"
          ]
        },
        {
          "uuid": "58a63350-491d-cfb5-028f-288c18dbb267",
          "code": "100000092161",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "122e4eb7-5f93-d998-d621-6330899e1935"
          ]
        },
        {
          "uuid": "e1ed93fc-bae1-ca57-2a9b-d142d235d277",
          "code": "14156",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=14156",
          "code_system": "NSC",
          "references": [
            "fd544ec9-50d1-3aec-ef50-1bd1c0921b13"
          ]
        },
        {
          "uuid": "596c7b13-819f-b129-559e-87360b6dc354",
          "code": "740J2QX53R",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=740J2QX53R",
          "code_system": "DAILYMED",
          "references": [
            "f2e09f44-d8d9-ee8f-8f56-614da9bb71c6"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "3fc398fb-0ecb-4de3-b5da-0c51211d7903",
          "amount": {
            "uuid": "15476716-5978-4732-9395-a56c5173430c"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "621e9569-bcef-48dc-a0e3-0a032c7cda00",
            "refuuid": "1cd8ffa0-6cb5-4ad4-8d4e-f7856f838ee8",
            "name": "CARBOCYSTEINE",
            "unii": "740J2QX53R",
            "linking_id": "740J2QX53R",
            "ref_pname": "CARBOCYSTEINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "263c45e2-c73e-4ed9-9e29-d28d8575e08a",
          "amount": {
            "uuid": "686e9391-ca21-48b8-9d03-bcd7309f3573"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "73b00a03-ff38-46a1-8da5-f1cd6e870a4c",
            "refuuid": "0822a6c2-062a-43d1-a7d6-66ff1e31d049",
            "name": "CARBOCYSTEINE LYSINE",
            "unii": "1D1Y95PXXA",
            "linking_id": "1D1Y95PXXA",
            "ref_pname": "CARBOCYSTEINE LYSINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c71879bd-afb9-4405-aaf1-8fd8eb6036fb",
          "amount": {
            "uuid": "d5373687-d1ed-401d-afde-379dee18f742"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "0a052c0d-075d-4c2e-933d-e5f02e697dbc",
            "refuuid": "5057db6e-8a03-4a00-a236-3ac44cf86110",
            "name": "CARBOCYSTEINE LYSINE MONOHYDRATE",
            "unii": "QA5ZP9OL3E",
            "linking_id": "QA5ZP9OL3E",
            "ref_pname": "CARBOCYSTEINE LYSINE MONOHYDRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ff5b4a96-9904-44cd-b66f-6d1d853d6ffc",
          "amount": {
            "uuid": "e2f027de-7606-4333-a45c-6d6ef859926a"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "a351a790-b59a-43af-8a3c-9e1ce0244109",
            "refuuid": "9659ffdc-c389-482c-bbd0-856e8b9f6759",
            "name": "CARBOCYSTEINE SODIUM",
            "unii": "2UZV9PEJ2N",
            "linking_id": "2UZV9PEJ2N",
            "ref_pname": "CARBOCYSTEINE SODIUM",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d3e798fd-03aa-4bca-a9dd-56748c2e29cb",
          "name": "(2R)-2-AMINO-3-((CARBOXYMETHYL)THIO)PROPIONIC ACID",
          "stdName": "(2R)-2-AMINO-3-((CARBOXYMETHYL)THIO)PROPIONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6edff9d-0628-4bee-bfb4-3e4baa148574",
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7"
          ],
          "display_name": false
        },
        {
          "uuid": "b1b1b8ae-9032-4d76-8460-3f6cf642202a",
          "name": "3-((CARBOXYMETHYL)THIO)-L-ALANINE",
          "stdName": "3-((CARBOXYMETHYL)THIO)-L-ALANINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "27d03338-e1f3-46ff-9a84-21e12f46b66f"
          ],
          "display_name": false
        },
        {
          "uuid": "0938e40b-dad4-40d3-a546-a1bfb40eb824",
          "name": "3-[(Carboxymethyl)thio]alanine",
          "stdName": "3-((CARBOXYMETHYL)THIO)ALANINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "7f222ea7-70b0-48ec-9a94-1e1d9afd81f8"
          ],
          "display_name": false
        },
        {
          "uuid": "5e4c638a-dce7-4242-adb8-82b2f80dfe8f",
          "name": "AHR-3053",
          "stdName": "AHR-3053",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "7f222ea7-70b0-48ec-9a94-1e1d9afd81f8"
          ],
          "display_name": false
        },
        {
          "uuid": "22038068-1e6c-4bb8-9f50-a674ac873a5a",
          "name": "CARBOCISTEIN",
          "stdName": "CARBOCISTEIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d76def1-e462-475b-822b-a75458681676",
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7"
          ],
          "display_name": false
        },
        {
          "uuid": "13f80822-bb7b-4270-8a36-6ace08060115",
          "name": "CARBOCISTEINE",
          "stdName": "CARBOCISTEINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cc3b4d7-5691-4cb8-83c1-a03ffa97fa80",
            "a1c630b0-4b43-481a-8d55-c52a2d3fc36a",
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "8c86d0b5-4365-473d-9b4d-a5e88be0ed38",
            "923aeeb4-52d5-4019-b231-9986e0f4462b",
            "1ece4c48-8066-4400-9aa1-cd7f9b88fca4",
            "d69a2001-d16d-4719-af29-a7ed39466adc",
            "5ae5bca2-c7bd-4084-b8ef-aa1a0148d557"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "cd8ae8d6-0d30-4d5d-889a-270936f1a432",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "9646be4f-6cfb-37c2-2b51-49eef66337b4",
          "name": "CARBOCISTEINE [EP MONOGRAPH]",
          "stdName": "CARBOCISTEINE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "402c76fb-a3dc-8cb9-5829-ff9a5d3ad64e"
          ],
          "display_name": false
        },
        {
          "uuid": "834a187b-ef20-4b8d-b855-550e39663372",
          "name": "CARBOCISTEINE [JAN]",
          "stdName": "CARBOCISTEINE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd7fc701-ee53-f85e-85fb-611e158d9b6a"
          ],
          "display_name": false
        },
        {
          "uuid": "cf5200bb-7a8e-46e5-8d2b-dcfab61ed067",
          "name": "CARBOCISTEINE [MART.]",
          "stdName": "CARBOCISTEINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1c630b0-4b43-481a-8d55-c52a2d3fc36a"
          ],
          "display_name": false
        },
        {
          "uuid": "26101795-711a-4942-9f15-c308dc5a0b7d",
          "name": "CARBOCIT",
          "stdName": "CARBOCIT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "deb6f144-738d-448f-b2b9-6317b3c4b46c"
          ],
          "display_name": false
        },
        {
          "uuid": "aa071fd4-b10d-4035-bcdb-b3c7cd3cb938",
          "name": "CARBOCYSTEINE",
          "stdName": "CARBOCYSTEINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7197e7bf-ce4f-496e-ae85-a0ca36b42cc2",
            "90e0091d-07d2-487e-b260-35ec721332e3",
            "d1899c2e-03bd-4daa-aa49-7846dd51853c",
            "91cd4c48-b60a-4a44-8a12-760e64aed14f",
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "f50ddf18-a2ab-454d-b794-dbed63313efb",
            "ef39b348-7029-48d2-90e6-09967d7c9bb3",
            "d373f757-e5a4-411c-8217-71b5e0e977d3"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "3c943a52-87ca-47a0-802e-60fa3cfe7e40",
              "name_org": "USAN"
            },
            {
              "uuid": "f519c0b5-17de-42f3-8942-1247ac9dbe5e",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "9337f930-15b5-4b60-b925-f6a72a3d0ffd",
          "name": "CARBOCYSTEINE [MI]",
          "stdName": "CARBOCYSTEINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "91cd4c48-b60a-4a44-8a12-760e64aed14f"
          ],
          "display_name": false
        },
        {
          "uuid": "b2d4047b-078c-429a-b169-2960181c5ff6",
          "name": "CARBOCYSTEINE [USAN]",
          "stdName": "CARBOCYSTEINE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f50ddf18-a2ab-454d-b794-dbed63313efb"
          ],
          "display_name": false
        },
        {
          "uuid": "f7834895-33ca-4abb-b667-3d3b05bf9d8d",
          "name": "CYSTEINE, S-(CARBOXYMETHYL)-",
          "stdName": "CYSTEINE, S-(CARBOXYMETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "7f222ea7-70b0-48ec-9a94-1e1d9afd81f8"
          ],
          "display_name": false
        },
        {
          "uuid": "98381677-7749-407c-a817-3a542e4fa38c",
          "name": "L-CARBOCISTEINE",
          "stdName": "L-CARBOCISTEINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d76def1-e462-475b-822b-a75458681676",
            "c4f1f3ef-eeb9-4cd3-bad4-b6e4c05b0f20",
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7"
          ],
          "display_name": false
        },
        {
          "uuid": "61fc5848-7027-4229-97b3-c4bb1ed27ae7",
          "name": "L-CARBOCISTEINE [JAN]",
          "stdName": "L-CARBOCISTEINE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d76def1-e462-475b-822b-a75458681676",
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7"
          ],
          "display_name": false
        },
        {
          "uuid": "7608aaf8-1654-45f3-a807-26a76cf8e750",
          "name": "L-CARBOCYSTEINE",
          "stdName": "L-CARBOCYSTEINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7489d1e4-c6ae-4a4b-be1d-6730378e6b77",
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "5e53873b-8d07-41f4-be16-a15b7793af2f"
          ],
          "display_name": false
        },
        {
          "uuid": "b44ed8c0-61ad-2fdd-7620-f09d4a2248a7",
          "name": "L-carbocisteine [WHO-DD]",
          "stdName": "L-CARBOCISTEINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b53f0e60-78f4-c23f-1290-719f4f2d09af"
          ],
          "display_name": false
        },
        {
          "uuid": "35ef2f5c-d86b-4a62-af15-c5c680babebf",
          "name": "LISOMUCIL",
          "stdName": "LISOMUCIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "deb6f144-738d-448f-b2b9-6317b3c4b46c"
          ],
          "display_name": false
        },
        {
          "uuid": "8629e1fa-5bb6-4dd5-a824-3980e614f8f1",
          "name": "LJ-206",
          "stdName": "LJ-206",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "deb6f144-738d-448f-b2b9-6317b3c4b46c"
          ],
          "display_name": false
        },
        {
          "uuid": "f791309d-472f-468c-8824-5ab10fb553ee",
          "name": "LJ206",
          "stdName": "LJ206",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "7f222ea7-70b0-48ec-9a94-1e1d9afd81f8"
          ],
          "display_name": false
        },
        {
          "uuid": "49e625fc-6bed-4e3c-baae-08a08debace5",
          "name": "LOVISCOL",
          "stdName": "LOVISCOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "deb6f144-738d-448f-b2b9-6317b3c4b46c"
          ],
          "display_name": false
        },
        {
          "uuid": "8157a571-d634-49e0-8520-783171e58c08",
          "name": "METHISTA",
          "stdName": "METHISTA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "f88db115-0102-4ab8-8c0b-558b3475c8f4"
          ],
          "display_name": false
        },
        {
          "uuid": "65b596bb-de25-4f85-8dc8-23e9bdffadfb",
          "name": "MUCICLAR",
          "stdName": "MUCICLAR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "deb6f144-738d-448f-b2b9-6317b3c4b46c"
          ],
          "display_name": false
        },
        {
          "uuid": "f0097415-abfc-4812-9136-410024cd5d39",
          "name": "MUCOCIS",
          "stdName": "MUCOCIS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "deb6f144-738d-448f-b2b9-6317b3c4b46c"
          ],
          "display_name": false
        },
        {
          "uuid": "f5bcd326-461f-411c-a70b-4027f957c697",
          "name": "MUCODYNE",
          "stdName": "MUCODYNE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "deb6f144-738d-448f-b2b9-6317b3c4b46c"
          ],
          "display_name": false
        },
        {
          "uuid": "8e890ad6-fe7a-4990-aa36-4ff2ba6b4d98",
          "name": "MUCOFAN",
          "stdName": "MUCOFAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab9f7d7e-4a4f-4090-87db-13a029a02f1d",
            "8b832c35-e96f-4c4b-b12b-b854927768e2"
          ],
          "display_name": false
        },
        {
          "uuid": "02bd9a72-3ab7-414a-a99c-c7d84d99f3c4",
          "name": "MUCOLASE",
          "stdName": "MUCOLASE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "deb6f144-738d-448f-b2b9-6317b3c4b46c"
          ],
          "display_name": false
        },
        {
          "uuid": "a59f6be6-e9cf-4560-a506-757620f53734",
          "name": "MUCOLEX",
          "stdName": "MUCOLEX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "deb6f144-738d-448f-b2b9-6317b3c4b46c"
          ],
          "display_name": false
        },
        {
          "uuid": "af7179ec-8c3a-4bed-aa88-ab90e0cf7ace",
          "name": "MUCOPRONT",
          "stdName": "MUCOPRONT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "deb6f144-738d-448f-b2b9-6317b3c4b46c"
          ],
          "display_name": false
        },
        {
          "uuid": "32ae03c2-58df-4c2c-bc8d-3a836fe269c3",
          "name": "NSC-14156",
          "stdName": "NSC-14156",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "3c252602-009e-4dca-ac1c-8cfdc700af62"
          ],
          "display_name": false
        },
        {
          "uuid": "1ae21cb0-2544-4f8c-a1e2-d73acb14dc00",
          "name": "PECTOX",
          "stdName": "PECTOX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "deb6f144-738d-448f-b2b9-6317b3c4b46c"
          ],
          "display_name": false
        },
        {
          "uuid": "7e974044-e570-4811-b126-18d5ad297974",
          "name": "PULMOCLASE",
          "stdName": "PULMOCLASE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "deb6f144-738d-448f-b2b9-6317b3c4b46c"
          ],
          "display_name": false
        },
        {
          "uuid": "8a0d323a-a94b-4d07-8d0c-bd3bbe76dcb2",
          "name": "R05CB03",
          "stdName": "R05CB03",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11b83d07-2e1a-4bf9-a3f7-488352a70298",
            "c77adc46-542d-4271-bcdd-4f089489f529"
          ],
          "display_name": false
        },
        {
          "uuid": "79ec75a4-5a39-4e11-bdd7-fda9dacf25d1",
          "name": "REOMUCIL",
          "stdName": "REOMUCIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "deb6f144-738d-448f-b2b9-6317b3c4b46c"
          ],
          "display_name": false
        },
        {
          "uuid": "a775b731-d033-4994-8c8d-3a0845f199a8",
          "name": "RHINATHIOL",
          "stdName": "RHINATHIOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "deb6f144-738d-448f-b2b9-6317b3c4b46c"
          ],
          "display_name": false
        },
        {
          "uuid": "8a3c0c6c-ab0d-4ccb-8eea-1ab8f6386a98",
          "name": "S-(CARBOXYMETHYL)-L-CYSTEINE",
          "stdName": "S-(CARBOXYMETHYL)-L-CYSTEINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6edff9d-0628-4bee-bfb4-3e4baa148574",
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7"
          ],
          "display_name": false
        },
        {
          "uuid": "8f7ac7df-4e98-4178-a265-ab57898f8283",
          "name": "SIROXYL",
          "stdName": "SIROXYL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "deb6f144-738d-448f-b2b9-6317b3c4b46c"
          ],
          "display_name": false
        },
        {
          "uuid": "d1ec05bd-8d98-4f6f-985c-c36c211bda41",
          "name": "TRANSBRONCHIN",
          "stdName": "TRANSBRONCHIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
            "deb6f144-738d-448f-b2b9-6317b3c4b46c"
          ],
          "display_name": false
        },
        {
          "uuid": "4ed8dfb9-c9d2-4ee6-ac3b-0a0bfdfe370d",
          "name": "carbocisteine [INN]",
          "stdName": "CARBOCISTEINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ece4c48-8066-4400-9aa1-cd7f9b88fca4",
            "bfbcd746-6364-47bb-a869-10c97ae5ddf4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7197e7bf-ce4f-496e-ae85-a0ca36b42cc2",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a21a4afa-5f30-4064-b1bc-faeec43b17e7",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f222ea7-70b0-48ec-9a94-1e1d9afd81f8",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d69a2001-d16d-4719-af29-a7ed39466adc",
          "citation": "INN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8d76def1-e462-475b-822b-a75458681676",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "deb6f144-738d-448f-b2b9-6317b3c4b46c",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6edff9d-0628-4bee-bfb4-3e4baa148574",
          "citation": "Merck 14.3",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11b83d07-2e1a-4bf9-a3f7-488352a70298",
          "citation": "ATC CODE 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c77adc46-542d-4271-bcdd-4f089489f529",
          "citation": "WHO 2009",
          "doc_type": "INN",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f88db115-0102-4ab8-8c0b-558b3475c8f4",
          "citation": "index name nominum",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ece4c48-8066-4400-9aa1-cd7f9b88fca4",
          "citation": "INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f50ddf18-a2ab-454d-b794-dbed63313efb",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "923aeeb4-52d5-4019-b231-9986e0f4462b",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a1c630b0-4b43-481a-8d55-c52a2d3fc36a",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "91cd4c48-b60a-4a44-8a12-760e64aed14f",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8b832c35-e96f-4c4b-b12b-b854927768e2",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab9f7d7e-4a4f-4090-87db-13a029a02f1d",
          "citation": "D06393",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "90e0091d-07d2-487e-b260-35ec721332e3",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c252602-009e-4dca-ac1c-8cfdc700af62",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27d03338-e1f3-46ff-9a84-21e12f46b66f",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5e53873b-8d07-41f4-be16-a15b7793af2f",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d89d83b6-ce33-4d7b-bad1-e4d2b9b886e6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389710000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d2a603db-ea8f-4248-802f-526794de68f4",
          "citation": "SRS import [740J2QX53R]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=740J2QX53R",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389710000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8c86d0b5-4365-473d-9b4d-a5e88be0ed38",
          "citation": "CARBOCISTEINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ef39b348-7029-48d2-90e6-09967d7c9bb3",
          "citation": "CARBOCYSTEINE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3cc3b4d7-5691-4cb8-83c1-a03ffa97fa80",
          "citation": "CARBOCISTEINE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5ae5bca2-c7bd-4084-b8ef-aa1a0148d557",
          "citation": "CARBOCISTEINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d1899c2e-03bd-4daa-aa49-7846dd51853c",
          "citation": "CARBOCYSTEINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d373f757-e5a4-411c-8217-71b5e0e977d3",
          "citation": "CARBOCYSTEINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c4f1f3ef-eeb9-4cd3-bad4-b6e4c05b0f20",
          "citation": "L-CARBOCISTEINE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7489d1e4-c6ae-4a4b-be1d-6730378e6b77",
          "citation": "L-CARBOCYSTEINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cd7fc701-ee53-f85e-85fb-611e158d9b6a",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9accbe32-f9de-0a5b-1ca5-c14cc710ffa9",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=638-23-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7bc7a4c6-660e-0724-35d2-5cbd5659b150",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "1a97fd94-4f83-46a8-9794-9367cf2f32c8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b53f0e60-78f4-c23f-1290-719f4f2d09af",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "bfbcd746-6364-47bb-a869-10c97ae5ddf4",
          "citation": "INN Proposed List 34",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL34.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "402c76fb-a3dc-8cb9-5829-ff9a5d3ad64e",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "f2e09f44-d8d9-ee8f-8f56-614da9bb71c6",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "fd544ec9-50d1-3aec-ef50-1bd1c0921b13",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "122e4eb7-5f93-d998-d621-6330899e1935",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3a3357a7-2f09-4c0b-b4eb-9b2cecf8d6a1",
          "id": "3a3357a7-2f09-4c0b-b4eb-9b2cecf8d6a1",
          "molfile": "\n  Marvin  01132103052D          \n\n 11 10  0  0  1  0            999 V2000\n    6.5486   -4.9410    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.5486   -6.1738    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2809   -4.5378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9854   -4.9410    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7176   -4.5609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4314   -4.9549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1590   -4.5609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4314   -5.7984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8350   -4.5378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8350   -3.6850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1073   -4.9410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  9  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  2  0  0  0  0\nM  END",
          "smiles": "C([C@@H](C(=O)O)N)SCC(=O)O",
          "formula": "C5H9NO4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5b0cb76d-5925-45e4-b291-8c297536de43"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "179.1956",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1cd8ffa0-6cb5-4ad4-8d4e-f7856f838ee8",
      "version": "21",
      "structure": {
        "id": "e3d79d9b-5efa-4c29-9e4c-2deb3fc39dce",
        "molfile": "\n  Marvin  01132111482D          \n\n 11 10  0  0  1  0            999 V2000\n    5.8350   -4.5378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5486   -4.9410    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.5486   -6.1738    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2809   -4.5378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9854   -4.9410    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7176   -4.5609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4314   -4.9549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1590   -4.5609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4314   -5.7984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8350   -3.6850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1073   -4.9410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  6  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  1  2  0  0  0  0\n 11  1  1  0  0  0  0\nM  END",
        "smiles": "C([C@@H](C(=O)O)N)SCC(=O)O",
        "formula": "C5H9NO4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "179.1956",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "7197e7bf-ce4f-496e-ae85-a0ca36b42cc2",
          "d2a603db-ea8f-4248-802f-526794de68f4",
          "bfbcd746-6364-47bb-a869-10c97ae5ddf4"
        ],
        "stereo_centers": 1
      },
      "unii": "740J2QX53R"
    }
  ]
}