{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "cd6a8ff7-f3fc-4cbe-9e20-c0714b03ebbc", "code": "1829588-57-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1829588-57-9", "code_system": "CAS", "references": [ "b9bb3099-5461-4090-8f92-0303f71b3387", "3c4c0e95-bb97-45cb-9ba9-8a18fbe6723a" ] }, { "uuid": "eaad653e-91d2-dd54-8d5c-0bb545b9b75d", "code": "135565051", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135565051", "code_system": "PUBCHEM", "references": [ "605d673c-831d-2f61-fb5e-3a6386fb9c62" ] }, { "uuid": "d200e629-6cd0-4a02-a108-de036cb1bc40", "code": "73XZH7LN9B", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "cb224763-8393-404c-aaf6-6b6482d1ee8e", "name": "5-(5-CHLORO-2-ETHOXYPHENYL)-1-METHYL-3-PROPYL-1,6-DIHYDRO-7HPYRAZOLO(4,3-D)PYRIMIDIN-7-ONE", "stdName": "5-(5-CHLORO-2-ETHOXYPHENYL)-1-METHYL-3-PROPYL-1,6-DIHYDRO-7HPYRAZOLO(4,3-D)PYRIMIDIN-7-ONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e16db904-9c8f-4eac-a148-1ce29e1af256", "d2d480c4-2af1-40d9-9397-406f870e7a68" ], "display_name": false }, { "uuid": "47420065-269d-45cc-95e3-c17c549da04b", "name": "5-CHLORO IMIDAZOSAGATRIAZINONE", "stdName": "5-CHLORO IMIDAZOSAGATRIAZINONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e16db904-9c8f-4eac-a148-1ce29e1af256", "d2d480c4-2af1-40d9-9397-406f870e7a68" ], "display_name": false }, { "uuid": "22c14931-b005-4798-9457-cde1ac55c610", "name": "7H-PYRAZOLO(4,3-D)PYRIMIDIN-7-ONE, 5-(5-CHLORO-2-ETHOXYPHENYL)-1,6-DIHYDRO-1-METHYL-3-PROPYL-", "stdName": "7H-PYRAZOLO(4,3-D)PYRIMIDIN-7-ONE, 5-(5-CHLORO-2-ETHOXYPHENYL)-1,6-DIHYDRO-1-METHYL-3-PROPYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e16db904-9c8f-4eac-a148-1ce29e1af256", "d084adbe-1b0c-40cd-8806-19ce4f5f24a6" ], "display_name": false }, { "uuid": "d9c43311-4b97-4786-a39e-18266e3369a3", "name": "CHLOROFIL", "stdName": "CHLOROFIL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e16db904-9c8f-4eac-a148-1ce29e1af256", "1a4eaaa6-7b4a-4c59-a5cc-f2fbbe8c5193" ], "display_name": true } ], "references": [ { "uuid": "d2d480c4-2af1-40d9-9397-406f870e7a68", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "e16db904-9c8f-4eac-a148-1ce29e1af256", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d084adbe-1b0c-40cd-8806-19ce4f5f24a6", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1a4eaaa6-7b4a-4c59-a5cc-f2fbbe8c5193", "citation": "http://www.tandfonline.com/doi/full/10.1080/19440049.2014.992980?af=R10.1080/19440049.2014.992980Nic", "url": "http://www.tandfonline.com/doi/full/10.1080/19440049.2014.992980?af=R10.1080/19440049.2014.992980Nic", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b9bb3099-5461-4090-8f92-0303f71b3387", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392906000, "tags": [ "NOMEN" ] }, { "uuid": "29567985-b629-4639-958c-a39c1d0018a5", "citation": "SRS import [73XZH7LN9B]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=73XZH7LN9B", "doc_type": "SRS", "public_domain": true, "document_date": 1493392906000, "tags": [ "NOMEN" ] }, { "uuid": "3c4c0e95-bb97-45cb-9ba9-8a18fbe6723a", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "605d673c-831d-2f61-fb5e-3a6386fb9c62", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "cbef6b12-d8bb-44ec-a754-e55424a4b5c2", "id": "cbef6b12-d8bb-44ec-a754-e55424a4b5c2", "molfile": "\n Marvin 01132110322D \n\n 24 26 0 0 0 0 999 V2000\n 3.1941 -2.0291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9392 -1.2445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1322 -1.0730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8773 -0.2883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3622 0.3791 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8773 1.0465 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1322 1.8312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0927 0.7916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0927 -0.0334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3782 -0.4459 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3363 -0.0334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3363 0.7916 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3782 1.2041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3782 2.0291 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0507 -0.4459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7652 -0.0334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4797 -0.4459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1941 -0.0334 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4797 -1.2709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7652 -1.6834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0507 -1.2709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3363 -1.6834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3782 -1.2709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0927 -1.6834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 2 0 0 0 0\n 4 9 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 1 0 0 0 0\n 9 8 2 0 0 0 0\n 8 13 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 15 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 2 0 0 0 0\n 15 16 1 0 0 0 0\n 15 21 2 0 0 0 0\n 17 16 2 0 0 0 0\n 17 18 1 0 0 0 0\n 19 17 1 0 0 0 0\n 20 19 2 0 0 0 0\n 21 20 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\nM END", "smiles": "CCCc1c2c(c(=O)nc(-c3cc(ccc3OCC)Cl)[nH]2)n(C)n1", "formula": "C17H19ClN4O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "9201ad3e-5ad7-4b49-bd45-890c3191dd34" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "346.8119", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "e8d4d113-bd13-4e04-b8c9-4c2e3f7be1be", "version": "6", "structure": { "id": "c894c49d-e2bf-4b09-a4e4-b8c9b1c8f8d1", "molfile": "\n Marvin 01132110222D \n\n 24 26 0 0 0 0 999 V2000\n -0.3363 -0.0334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3782 -0.4459 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0927 -0.0334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0927 0.7916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3782 1.2041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3363 0.7916 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3622 0.3791 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8773 1.0465 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8773 -0.2883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3782 2.0291 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1322 -1.0730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9392 -1.2445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1941 -2.0291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1322 1.8312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0507 -0.4459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0507 -1.2709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7652 -1.6834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4797 -1.2709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4797 -0.4459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7652 -0.0334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3363 -1.6834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3782 -1.2709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0927 -1.6834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1941 -0.0334 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 1 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 2 0 0 0 0\n 9 3 1 0 0 0 0\n 8 4 1 0 0 0 0\n 5 10 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 9 11 1 0 0 0 0\n 8 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 15 20 2 0 0 0 0\n 22 23 1 0 0 0 0\n 21 22 1 0 0 0 0\n 16 21 1 0 0 0 0\n 19 24 1 0 0 0 0\n 1 15 1 0 0 0 0\nM END", "smiles": "CCCc1c2c(c(=O)[nH]c(-c3cc(ccc3OCC)Cl)n2)n(C)n1", "formula": "C17H19ClN4O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "346.8119", "optical_activity": "NONE", "references": [ "29567985-b629-4639-958c-a39c1d0018a5", "d084adbe-1b0c-40cd-8806-19ce4f5f24a6" ], "stereo_centers": 0 }, "unii": "73XZH7LN9B" } ] }