{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "668c0047-0e2e-4b7d-8e76-883bce3eadae",
          "code": "1843-05-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1843-05-6",
          "code_system": "CAS",
          "references": [
            "0e898216-c2ad-4328-b9ec-067d54980f27",
            "8018451c-4580-4861-8af2-a78c2b53ff87"
          ]
        },
        {
          "uuid": "a5186054-5db3-4791-8e30-396f26d69c78",
          "code": "C74364",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C74364",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0e898216-c2ad-4328-b9ec-067d54980f27"
          ]
        },
        {
          "uuid": "8d6058c9-d69f-4e8b-98b3-8b4f6e5a4771",
          "code": "C104570",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67104570",
          "code_system": "MESH",
          "references": [
            "0e898216-c2ad-4328-b9ec-067d54980f27"
          ]
        },
        {
          "uuid": "db3c9c60-0488-49e9-a926-6b60a2cc60aa",
          "code": "OCTABENZONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Octabenzone",
          "code_system": "WIKIPEDIA",
          "references": [
            "0e898216-c2ad-4328-b9ec-067d54980f27"
          ]
        },
        {
          "uuid": "36777f63-fc6b-4cde-a4f6-6d24aaf21686",
          "code": "SUB09400MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "0e898216-c2ad-4328-b9ec-067d54980f27"
          ]
        },
        {
          "uuid": "9205c910-c081-411b-815c-0e3584b7d5be",
          "code": "2364",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2364",
          "code_system": "INN",
          "references": [
            "0e898216-c2ad-4328-b9ec-067d54980f27"
          ]
        },
        {
          "uuid": "0dcc0184-21b9-4936-8dea-5dea05f5784e",
          "code": "m8101",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8101?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "0e898216-c2ad-4328-b9ec-067d54980f27"
          ]
        },
        {
          "uuid": "9a0a7a4d-c226-4bf8-94ce-d5223ee2fad8",
          "code": "CHEMBL1977129",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1977129",
          "code_system": "ChEMBL",
          "references": [
            "0e898216-c2ad-4328-b9ec-067d54980f27"
          ]
        },
        {
          "uuid": "0dd478b5-6e69-428d-b7bf-275b3d4eeaaf",
          "code": "217-421-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.015.838",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "0e898216-c2ad-4328-b9ec-067d54980f27"
          ]
        },
        {
          "uuid": "26754a42-a1e5-4b3f-adf4-7df5079c802c",
          "code": "15797",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/15797",
          "code_system": "PUBCHEM",
          "references": [
            "0e898216-c2ad-4328-b9ec-067d54980f27"
          ]
        },
        {
          "uuid": "3316fbb3-433f-2ef3-63e9-0889eb5ace32",
          "code": "5858",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5858",
          "code_system": "HSDB",
          "references": [
            "1c85a607-3b4a-f442-fd4c-05a56dfeeaf9"
          ]
        },
        {
          "uuid": "82de24ca-15ea-f426-6b22-40d9996824e8",
          "code": "DTXSID9027441",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9027441",
          "code_system": "EPA CompTox",
          "references": [
            "881cb76a-78bb-af4c-b69e-3fbe20ed4820"
          ]
        },
        {
          "uuid": "748990a7-3917-b576-5948-52e60c06608a",
          "code": "C45678",
          "comments": "Industrial Aid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45678",
          "code_system": "NCI_THESAURUS",
          "references": [
            "fbdf4280-3953-94c6-5716-7db009840589"
          ]
        },
        {
          "uuid": "cd70a8ec-d74c-49a1-b996-7c77f0d1aa54",
          "code": "73P3618V2E",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5f3991a0-5c29-cebd-04d0-dbf980fe3077",
          "code": "3392",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3392",
          "code_system": "DRUG CENTRAL",
          "references": [
            "fbdf4280-3953-94c6-5716-7db009840589"
          ]
        },
        {
          "uuid": "0e56d688-d5ac-2687-2d04-00b301f7c4d5",
          "code": "163400",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=163400",
          "code_system": "NSC",
          "references": [
            "fbb04236-63ee-4c5b-c88e-336db424b0f2"
          ]
        },
        {
          "uuid": "241c6f42-ddcd-99cc-5812-3f980a8033e0",
          "code": "100000083859",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "882a9b91-0a73-3f04-a617-2a38ab97292a"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "7ec0418f-ff07-4322-90e3-1c740ebba2ef",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "320cbb10-f93f-4abc-aeba-844af6316ddf",
            "refuuid": "b355d1cf-5536-44de-bb44-d56b5fe1f5da",
            "name": "OCTABENZONE",
            "unii": "73P3618V2E",
            "linking_id": "73P3618V2E",
            "ref_pname": "OCTABENZONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f525a777-e52a-4d44-ad75-3e935389dfa5",
          "name": "2-Hydroxy-4-(octyloxy)benzophenone",
          "stdName": "2-HYDROXY-4-(OCTYLOXY)BENZOPHENONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5641e39e-d723-4661-9769-91d2f9e6c252"
          ],
          "display_name": false
        },
        {
          "uuid": "0520b19e-4df7-4d74-82aa-d93187ec2b9a",
          "name": "BENZOPHENONE-12",
          "stdName": "BENZOPHENONE-12",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "5f1f3fce-27b3-4b9c-99fc-ce28774fe576",
            "5f8fadbd-bee7-478e-a73a-7b6a26c93c74",
            "bbfe0fb3-3a67-4a50-bbba-19039ccb246c"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "518b0bdc-29b7-42ae-ad3d-c3af97b916ba",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "ef79da0a-3b99-453a-8b70-cc0a6e1ec119",
          "name": "METHANONE, (2-HYDROXY-4-(OCTYLOXY)PHENYL)PHENYL-",
          "stdName": "METHANONE, (2-HYDROXY-4-(OCTYLOXY)PHENYL)PHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5641e39e-d723-4661-9769-91d2f9e6c252"
          ],
          "display_name": false
        },
        {
          "uuid": "54767ceb-9322-4f51-b2f6-7485182911f3",
          "name": "NSC-163400",
          "stdName": "NSC-163400",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f1f3fce-27b3-4b9c-99fc-ce28774fe576",
            "c9f2063c-ca60-4697-acb0-165c13115f77"
          ],
          "display_name": false
        },
        {
          "uuid": "a2330fe4-776c-4e4d-a070-c8f43ce381d7",
          "name": "OCTABENZONE",
          "stdName": "OCTABENZONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f8472e57-8733-44a7-bde1-d27e609c2ec0",
            "4476e2e9-c39c-4bea-926f-d081b7e5e868",
            "224ab704-5850-4f83-95d9-507deb56b4bf",
            "fe1ef773-af40-465e-a4f6-aff349d3994f",
            "007d08a9-f3ff-45b7-a3ad-c65c52d65878",
            "2ac9a59e-42d3-482e-b545-a5d41c9f3f28",
            "5f1f3fce-27b3-4b9c-99fc-ce28774fe576",
            "f96c4ec5-8415-4d96-8dae-c02f63a3bde6",
            "7341132e-1260-4775-9e50-6cb8dace0541",
            "5641e39e-d723-4661-9769-91d2f9e6c252"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "d26bc001-f07e-4fc8-9a26-0917e9207d77",
              "name_org": "INN"
            },
            {
              "uuid": "cc4f9a3b-37a7-48f3-b892-15f18fdb9d66",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "8bea9700-ea9f-4abe-a510-8fec277f82d9",
          "name": "OCTABENZONE [HSDB]",
          "stdName": "OCTABENZONE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f8472e57-8733-44a7-bde1-d27e609c2ec0",
            "5f1f3fce-27b3-4b9c-99fc-ce28774fe576"
          ],
          "display_name": false
        },
        {
          "uuid": "7deaaab8-f8d3-4515-9034-70bb779f7f07",
          "name": "OCTABENZONE [MI]",
          "stdName": "OCTABENZONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f1f3fce-27b3-4b9c-99fc-ce28774fe576",
            "2ac9a59e-42d3-482e-b545-a5d41c9f3f28"
          ],
          "display_name": false
        },
        {
          "uuid": "54e7fef1-8975-4010-9b7e-ee789d8e15ae",
          "name": "OCTABENZONE [USAN]",
          "stdName": "OCTABENZONE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe1ef773-af40-465e-a4f6-aff349d3994f"
          ],
          "display_name": false
        },
        {
          "uuid": "9b7c0be5-cfa9-4103-bc64-fab604a3002a",
          "name": "octabenzone [INN]",
          "stdName": "OCTABENZONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4476e2e9-c39c-4bea-926f-d081b7e5e868"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5641e39e-d723-4661-9769-91d2f9e6c252",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4476e2e9-c39c-4bea-926f-d081b7e5e868",
          "citation": "INN Proposed List 18",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL18.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fe1ef773-af40-465e-a4f6-aff349d3994f",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ac9a59e-42d3-482e-b545-a5d41c9f3f28",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5f1f3fce-27b3-4b9c-99fc-ce28774fe576",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bbfe0fb3-3a67-4a50-bbba-19039ccb246c",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f8472e57-8733-44a7-bde1-d27e609c2ec0",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c9f2063c-ca60-4697-acb0-165c13115f77",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e898216-c2ad-4328-b9ec-067d54980f27",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390815000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "90f2486b-904a-40dc-9221-ee5b6e811a19",
          "citation": "SRS import [73P3618V2E]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=73P3618V2E",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390815000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "224ab704-5850-4f83-95d9-507deb56b4bf",
          "citation": "OCTABENZONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f96c4ec5-8415-4d96-8dae-c02f63a3bde6",
          "citation": "OCTABENZONE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "007d08a9-f3ff-45b7-a3ad-c65c52d65878",
          "citation": "OCTABENZONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5f8fadbd-bee7-478e-a73a-7b6a26c93c74",
          "citation": "BENZOPHENONE-12 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7341132e-1260-4775-9e50-6cb8dace0541",
          "citation": "OCTABENZONE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1c85a607-3b4a-f442-fd4c-05a56dfeeaf9",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+1843-05-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "881cb76a-78bb-af4c-b69e-3fbe20ed4820",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1843-05-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "882a9b91-0a73-3f04-a617-2a38ab97292a",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "fbdf4280-3953-94c6-5716-7db009840589",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "8018451c-4580-4861-8af2-a78c2b53ff87",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "fbb04236-63ee-4c5b-c88e-336db424b0f2",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3630318c-ae5a-4930-be51-c8fba1f8c714",
          "id": "3630318c-ae5a-4930-be51-c8fba1f8c714",
          "molfile": "\n  Marvin  01132102532D          \n\n 24 25  0  0  0  0            999 V2000\n    0.0000   -4.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6910   -3.7615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4103   -4.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1347   -3.7538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8385   -4.1611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5604   -3.7357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2720   -4.1405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9758   -3.7228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6874   -4.1405    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3989   -3.7151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3989   -2.9030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0924   -2.4853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8143   -2.8849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5259   -2.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2452   -2.8849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5182   -1.6552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8040   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7963   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4950    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2297   -0.4048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2297   -1.2298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8040   -3.7074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5336   -4.0941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1182   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 24  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 22 13  2  0  0  0  0\n 15 14  2  0  0  0  0\n 16 14  1  0  0  0  0\n 17 16  1  0  0  0  0\n 21 16  2  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 22  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCCCOc1ccc(c(c1)O)C(=O)c2ccccc2",
          "formula": "C21H26O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2f4a0dfc-f020-42c4-b8cb-7257452f083b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "326.4301",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b355d1cf-5536-44de-bb44-d56b5fe1f5da",
      "version": "10",
      "structure": {
        "id": "ede80892-e565-42d1-8897-96b6995200fb",
        "molfile": "\n  Marvin  01132112192D          \n\n 24 25  0  0  0  0            999 V2000\n    7.8143   -2.8849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5259   -2.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8040   -3.7074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0924   -2.4853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1182   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2452   -2.8849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5182   -1.6552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3989   -3.7151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5336   -4.0941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3989   -2.9030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6874   -4.1405    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2297   -1.2298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8040   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9758   -3.7228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2720   -4.1405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6910   -3.7615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4103   -4.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1347   -3.7538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8385   -4.1611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5604   -3.7357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -4.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7963   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2297   -0.4048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4950    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  2  2  0  0  0  0\n  7  2  1  0  0  0  0\n  8 10  1  0  0  0  0\n  9  3  1  0  0  0  0\n 10  4  2  0  0  0  0\n 11  8  1  0  0  0  0\n 12  7  2  0  0  0  0\n 13  7  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 15  1  0  0  0  0\n 21 16  1  0  0  0  0\n 22 13  2  0  0  0  0\n 23 12  1  0  0  0  0\n 24 22  1  0  0  0  0\n  8  5  2  0  0  0  0\n 24 23  2  0  0  0  0\nM  END",
        "smiles": "CCCCCCCCOc1ccc(c(c1)O)C(=O)c2ccccc2",
        "formula": "C21H26O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "326.4301",
        "optical_activity": "NONE",
        "references": [
          "90f2486b-904a-40dc-9221-ee5b6e811a19",
          "5641e39e-d723-4661-9769-91d2f9e6c252",
          "4476e2e9-c39c-4bea-926f-d081b7e5e868"
        ],
        "stereo_centers": 0
      },
      "unii": "73P3618V2E"
    }
  ]
}