{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "825ed1d6-8059-4765-9e6e-3acb3fbae245",
          "code": "492-80-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=492-80-8",
          "code_system": "CAS",
          "references": [
            "f0ccb8d4-0a8c-41c5-9388-0bbb91e55e12",
            "8ca4c8f2-fbd0-4eb0-82b4-efc169bcc742"
          ]
        },
        {
          "uuid": "cdacc637-15ea-46c5-aac0-c7ed0de57ce5",
          "code": "39501",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1274",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "f0ccb8d4-0a8c-41c5-9388-0bbb91e55e12"
          ]
        },
        {
          "uuid": "11874435-36f5-41f7-97d8-a92ba89100de",
          "code": "207-762-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.057",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f0ccb8d4-0a8c-41c5-9388-0bbb91e55e12"
          ]
        },
        {
          "uuid": "c779814c-eff4-41cf-8cb9-3dca415aba07",
          "code": "10298",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10298",
          "code_system": "PUBCHEM",
          "references": [
            "f0ccb8d4-0a8c-41c5-9388-0bbb91e55e12"
          ]
        },
        {
          "uuid": "cbf21b8e-448f-e582-af91-ab6747aa7593",
          "code": "2935",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2935",
          "code_system": "HSDB",
          "references": [
            "d37fa528-2a3e-3042-1bf8-ce0bd8ad0eb0"
          ]
        },
        {
          "uuid": "f6f87bfe-6935-4584-77c9-cde8e076f1ca",
          "code": "DTXSID7043821",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7043821",
          "code_system": "EPA CompTox",
          "references": [
            "3ed78a8d-4bdd-fddc-b493-256a4683cdf5"
          ]
        },
        {
          "uuid": "8e851f89-b7ea-45ac-8d12-15dad1baeea0",
          "code": "73O74R443B",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "59735b6b-2b38-1633-560b-18fcdcb318d7",
          "code": "51874",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:51874",
          "code_system": "CHEBI",
          "references": [
            "fac09ef3-17f2-0f2e-229c-967c497e7429"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c5b07b9f-d2e4-486d-9f7c-8dea7b1e378e",
          "name": "4,4'-(IMIDOCARBONYL)BIS(N,N-DIMETHYLANILINE)",
          "stdName": "4,4'-(IMIDOCARBONYL)BIS(N,N-DIMETHYLANILINE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09f61001-bb85-4c94-aaa5-e36605b95d5d",
            "07e441b1-bfe1-4e8b-9891-df9519810b92"
          ],
          "display_name": false
        },
        {
          "uuid": "518c2c40-71db-4a34-b7f8-385cb16cd254",
          "name": "4,4'-CARBONIMIDOYLBIS(N,N-DIMETHYLANILINE)",
          "stdName": "4,4'-CARBONIMIDOYLBIS(N,N-DIMETHYLANILINE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "580e564a-7e42-4b00-9ada-766e63b48a46",
            "09f61001-bb85-4c94-aaa5-e36605b95d5d"
          ],
          "display_name": false
        },
        {
          "uuid": "381322f0-7011-44d9-ac24-59b8c4c5e2fd",
          "name": "4,4'-CARBONIMIDOYLBIS(N,N-DIMETHYLBENZENAMINE)",
          "stdName": "4,4'-CARBONIMIDOYLBIS(N,N-DIMETHYLBENZENAMINE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "580e564a-7e42-4b00-9ada-766e63b48a46",
            "09f61001-bb85-4c94-aaa5-e36605b95d5d"
          ],
          "display_name": false
        },
        {
          "uuid": "cf6ac934-20da-41d1-9d8e-2eaee269a001",
          "name": "4,4'-DIMETHYLAMINOBENZOPHENONIMIDE",
          "stdName": "4,4'-DIMETHYLAMINOBENZOPHENONIMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09f61001-bb85-4c94-aaa5-e36605b95d5d",
            "07e441b1-bfe1-4e8b-9891-df9519810b92"
          ],
          "display_name": false
        },
        {
          "uuid": "08bb3f54-6c33-444f-a6c0-466b690b98db",
          "name": "ANILINE, 4,4'-(IMIDOCARBONYL)BIS(N,N-DIMETHYL-",
          "stdName": "ANILINE, 4,4'-(IMIDOCARBONYL)BIS(N,N-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "580e564a-7e42-4b00-9ada-766e63b48a46",
            "09f61001-bb85-4c94-aaa5-e36605b95d5d"
          ],
          "display_name": false
        },
        {
          "uuid": "99754270-12d1-41f7-8ed0-0818c329fb43",
          "name": "ANILINE, 4,4'-IMIDOCARBONYLBIS(N,N-DIMETHYL-",
          "stdName": "ANILINE, 4,4'-IMIDOCARBONYLBIS(N,N-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "580e564a-7e42-4b00-9ada-766e63b48a46",
            "09f61001-bb85-4c94-aaa5-e36605b95d5d"
          ],
          "display_name": false
        },
        {
          "uuid": "5b273ac5-c533-4c1e-b9d4-67818cfe13bb",
          "name": "AURAMINE",
          "stdName": "AURAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "580e564a-7e42-4b00-9ada-766e63b48a46",
            "09f61001-bb85-4c94-aaa5-e36605b95d5d"
          ],
          "display_name": false
        },
        {
          "uuid": "b580a3fc-f03e-9f51-fbf8-9a80abf94e31",
          "name": "AURAMINE PRODUCTION [IARC]",
          "stdName": "AURAMINE PRODUCTION [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3a3a7e5-d14f-9a1c-c17e-121918872509"
          ],
          "display_name": false
        },
        {
          "uuid": "6cd5b235-7cec-76b1-f5c1-5816c9ae1562",
          "name": "AURAMINE [IARC]",
          "stdName": "AURAMINE [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3a3a7e5-d14f-9a1c-c17e-121918872509"
          ],
          "display_name": false
        },
        {
          "uuid": "1082d07c-ab3c-4a62-ae03-68c1dd8751c4",
          "name": "BENZENAMINE, 4,4'-CARBONIMIDOYLBIS(N,N-DIMETHYL-",
          "stdName": "BENZENAMINE, 4,4'-CARBONIMIDOYLBIS(N,N-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09f61001-bb85-4c94-aaa5-e36605b95d5d",
            "07e441b1-bfe1-4e8b-9891-df9519810b92"
          ],
          "display_name": false
        },
        {
          "uuid": "53e71187-bfa2-409c-9417-b609c521d32d",
          "name": "BIS(P-DIMETHYLAMINOPHENYL)METHYLENEIMINE [HSDB]",
          "stdName": "BIS(P-DIMETHYLAMINOPHENYL)METHYLENEIMINE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "580e564a-7e42-4b00-9ada-766e63b48a46",
            "09f61001-bb85-4c94-aaa5-e36605b95d5d"
          ],
          "display_name": false
        },
        {
          "uuid": "d3bfe96c-2720-4f3b-88bd-fee6a33e9945",
          "name": "C.I. SOLVENT YELLOW 34",
          "stdName": "C.I. SOLVENT YELLOW 34",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3164682e-2b55-4a86-b56d-562cda26b8dc",
            "09f61001-bb85-4c94-aaa5-e36605b95d5d"
          ],
          "display_name": false
        },
        {
          "uuid": "ee67f448-790a-4ea2-9ea1-4b9a9ce2038b",
          "name": "CI 41000B",
          "stdName": "CI 41000B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09f61001-bb85-4c94-aaa5-e36605b95d5d",
            "07e441b1-bfe1-4e8b-9891-df9519810b92"
          ],
          "display_name": false
        },
        {
          "uuid": "01f15d88-7aa1-47b2-b8c5-53488ec159db",
          "name": "CI BASIC YELLOW 2, FREE BASE",
          "stdName": "CI BASIC YELLOW 2, FREE BASE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "580e564a-7e42-4b00-9ada-766e63b48a46",
            "09f61001-bb85-4c94-aaa5-e36605b95d5d"
          ],
          "display_name": false
        },
        {
          "uuid": "4aa46f0d-63fc-4a9c-92a4-054841c9d90d",
          "name": "CI SOLVENT YELLOW 34",
          "stdName": "CI SOLVENT YELLOW 34",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09f61001-bb85-4c94-aaa5-e36605b95d5d",
            "07e441b1-bfe1-4e8b-9891-df9519810b92"
          ],
          "display_name": false
        },
        {
          "uuid": "774dbf7c-7c78-457a-83ed-3b3d7846d1cb",
          "name": "GLAURAMINE",
          "stdName": "GLAURAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "580e564a-7e42-4b00-9ada-766e63b48a46",
            "09f61001-bb85-4c94-aaa5-e36605b95d5d"
          ],
          "display_name": false
        },
        {
          "uuid": "a5137d84-bb18-403b-8986-7a119e4d8be8",
          "name": "ORIENT OIL YELLOW 101",
          "stdName": "ORIENT OIL YELLOW 101",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "580e564a-7e42-4b00-9ada-766e63b48a46",
            "09f61001-bb85-4c94-aaa5-e36605b95d5d"
          ],
          "display_name": false
        },
        {
          "uuid": "7c1d05c3-b5e4-4618-9de7-25751c1099bf",
          "name": "SOLVENT YELLOW 34",
          "stdName": "SOLVENT YELLOW 34",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "580e564a-7e42-4b00-9ada-766e63b48a46",
            "09f61001-bb85-4c94-aaa5-e36605b95d5d"
          ],
          "display_name": true
        },
        {
          "uuid": "f7e7e874-def6-4642-8bf7-38bcc0593c96",
          "name": "TETRAMETHYL-P-DIAMINO-IMIDO-BENZOPHENONE",
          "stdName": "TETRAMETHYL-P-DIAMINO-IMIDO-BENZOPHENONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "580e564a-7e42-4b00-9ada-766e63b48a46",
            "09f61001-bb85-4c94-aaa5-e36605b95d5d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "07e441b1-bfe1-4e8b-9891-df9519810b92",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "09f61001-bb85-4c94-aaa5-e36605b95d5d",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "580e564a-7e42-4b00-9ada-766e63b48a46",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3164682e-2b55-4a86-b56d-562cda26b8dc",
          "citation": "SWISS MEDIC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f0ccb8d4-0a8c-41c5-9388-0bbb91e55e12",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392182000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "53ea3f13-1214-4522-825e-d57d3b74440d",
          "citation": "SRS import [73O74R443B]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=73O74R443B",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392182000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d37fa528-2a3e-3042-1bf8-ce0bd8ad0eb0",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+492-80-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3ed78a8d-4bdd-fddc-b493-256a4683cdf5",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=492-80-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f3a3a7e5-d14f-9a1c-c17e-121918872509",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "fac09ef3-17f2-0f2e-229c-967c497e7429",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "8ca4c8f2-fbd0-4eb0-82b4-efc169bcc742",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1dcc3864-a0e8-4314-a741-8d43c82b1796",
          "id": "1dcc3864-a0e8-4314-a741-8d43c82b1796",
          "molfile": "\n  Marvin  01132101432D          \n\n 20 21  0  0  0  0            999 V2000\n    9.5331   -6.2837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5331   -5.4587    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2476   -5.0461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8186   -5.0461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8186   -4.2211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1042   -3.8086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3897   -4.2211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3897   -5.0461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1042   -5.4587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6752   -3.8086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6752   -2.9837    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9608   -4.2211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2463   -3.8086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5319   -4.2211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5319   -5.0461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2463   -5.4587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9608   -5.0461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8173   -5.4587    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8173   -6.2837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1029   -5.0461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  9  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n 10  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 17  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 15 18  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\nM  END",
          "smiles": "CN(C)c1ccc(cc1)C(=N)c2ccc(cc2)N(C)C",
          "formula": "C17H21N3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "250ef1ab-a211-49bc-af6b-24e12ea72554"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "267.3694",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7665f924-7af3-4fa0-8afa-1a39e32c57e4",
      "version": "9",
      "structure": {
        "id": "e3c7e5c3-c00f-4330-b062-7fa62e52558f",
        "molfile": "\n  Marvin  01132111472D          \n\n 20 21  0  0  0  0            999 V2000\n    4.5319   -5.0461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5319   -4.2211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2463   -3.8086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9608   -4.2211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9608   -5.0461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2463   -5.4587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6752   -3.8086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6752   -2.9837    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3897   -4.2211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1042   -3.8086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8186   -4.2211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8186   -5.0461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1042   -5.4587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3897   -5.0461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5331   -5.4587    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5331   -6.2837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2476   -5.0461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8173   -5.4587    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8173   -6.2837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1029   -5.0461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  1  1  0  0  0  0\n  4  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14  9  1  0  0  0  0\n 12 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n  1 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\nM  END",
        "smiles": "CN(C)c1ccc(cc1)C(=N)c2ccc(cc2)N(C)C",
        "formula": "C17H21N3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "267.3694",
        "optical_activity": "NONE",
        "references": [
          "580e564a-7e42-4b00-9ada-766e63b48a46",
          "53ea3f13-1214-4522-825e-d57d3b74440d"
        ],
        "stereo_centers": 0
      },
      "unii": "73O74R443B"
    }
  ]
}