{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "56c6aabe-9cd9-4f91-b40d-ae77c2668318",
          "code": "856414-52-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=856414-52-3",
          "code_system": "CAS",
          "references": [
            "d96b05da-ad77-4917-a1b9-1055ebddc6cb",
            "353645bc-40c4-44d1-96d2-91cece00c54f"
          ]
        },
        {
          "uuid": "2ccad79c-4bd3-45fa-acdc-0a1ae3ebb6fa",
          "code": "11177417",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11177417",
          "code_system": "PUBCHEM",
          "references": [
            "d96b05da-ad77-4917-a1b9-1055ebddc6cb"
          ]
        },
        {
          "uuid": "74f141ff-1293-8faa-7b2b-9c7ecdbf83a3",
          "code": "DTXSID60234889",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60234889",
          "code_system": "EPA CompTox",
          "references": [
            "40fab2bc-de8b-95f3-1346-83b3aee69af0"
          ]
        },
        {
          "uuid": "aed44e5c-e099-4cbc-a8ae-f518ab7a4693",
          "code": "73O50WVY91",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ded23312-0467-496f-98e8-f2303408902d",
          "name": "2H-1-BENZOPYRAN-6-OL, 3,4-DIHYDRO-2-((3E,7E,9R)-9-HYDROXY-4,8,12-TRIMETHYL-3,7,11-TRIDECATRIEN-1-YL)-2,8-DIMETHYL-, (2R)-",
          "stdName": "2H-1-BENZOPYRAN-6-OL, 3,4-DIHYDRO-2-((3E,7E,9R)-9-HYDROXY-4,8,12-TRIMETHYL-3,7,11-TRIDECATRIEN-1-YL)-2,8-DIMETHYL-, (2R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f0316cb1-57e7-4619-af12-f3e2d56bab33",
            "9cd9e3bf-3600-43d8-9d29-32faa4017b5b"
          ],
          "display_name": false
        },
        {
          "uuid": "da3947fe-baca-4fbc-9fb7-7d624eba045e",
          "name": "2H-1-BENZOPYRAN-6-OL, 3,4-DIHYDRO-2-((3E,7E,9R)-9-HYDROXY-4,8,12-TRIMETHYL-3,7,11-TRIDECATRIENYL)-2,8-DIMETHYL-, (2R)-",
          "stdName": "2H-1-BENZOPYRAN-6-OL, 3,4-DIHYDRO-2-((3E,7E,9R)-9-HYDROXY-4,8,12-TRIMETHYL-3,7,11-TRIDECATRIENYL)-2,8-DIMETHYL-, (2R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f0316cb1-57e7-4619-af12-f3e2d56bab33",
            "9cd9e3bf-3600-43d8-9d29-32faa4017b5b"
          ],
          "display_name": false
        },
        {
          "uuid": "93606271-4c56-49d3-b20b-4fe655b68eb3",
          "name": "SARGACHROMANOL C",
          "stdName": "SARGACHROMANOL C",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8afe0c5-7639-4603-9ebd-183f2286e8c6",
            "45a3a301-2b63-499a-b625-1e2022e4e52a",
            "f0316cb1-57e7-4619-af12-f3e2d56bab33"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "216dbc58-e0f8-422b-8a70-c6aa94ee696f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "9b5d62c2-0a1e-415f-8a10-10485b5df456",
          "name": "SARGACHROMANOL C, (+)-",
          "stdName": "SARGACHROMANOL C, (+)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f0316cb1-57e7-4619-af12-f3e2d56bab33",
            "1e26fc6d-6481-4c44-9fab-ca53f0cb4971"
          ],
          "display_name": false
        },
        {
          "uuid": "9d976e40-3d23-411c-bbb5-eec91e85fcac",
          "name": "SARGASOL C",
          "stdName": "SARGASOL C",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "45a3a301-2b63-499a-b625-1e2022e4e52a",
            "f0316cb1-57e7-4619-af12-f3e2d56bab33"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "45a3a301-2b63-499a-b625-1e2022e4e52a",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f0316cb1-57e7-4619-af12-f3e2d56bab33",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9cd9e3bf-3600-43d8-9d29-32faa4017b5b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1e26fc6d-6481-4c44-9fab-ca53f0cb4971",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d96b05da-ad77-4917-a1b9-1055ebddc6cb",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391600000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "747f9503-6a7d-4be5-ab70-e837403adb52",
          "citation": "SRS import [73O50WVY91]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=73O50WVY91",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391600000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8afe0c5-7639-4603-9ebd-183f2286e8c6",
          "citation": "SARGACHROMANOL C [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "40fab2bc-de8b-95f3-1346-83b3aee69af0",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=856414-52-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "353645bc-40c4-44d1-96d2-91cece00c54f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "acfb2de3-fadc-412b-894b-e392c4f9ae89",
          "id": "acfb2de3-fadc-412b-894b-e392c4f9ae89",
          "molfile": "\n  Marvin  01132108582D          \n\n 30 31  0  0  1  0            999 V2000\n   13.0027   -7.3361    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   13.0027   -6.5112    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7171   -7.7487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4315   -7.3361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1460   -7.7487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8604   -7.3361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1460   -8.5736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2882   -7.7487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2882   -8.5736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5738   -7.3361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8594   -7.7487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1449   -7.3361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4305   -7.7487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4305   -8.5736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7160   -7.3361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0016   -7.7487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2872   -7.3361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5727   -7.7487    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.5565   -7.0481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5727   -8.5738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8580   -8.9864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1434   -8.5738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4333   -8.9856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7169   -8.5775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0029   -8.9898    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7169   -7.7490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4315   -7.3367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4315   -6.5143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1434   -7.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8580   -7.3360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  8  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 13  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  1  0  0  0\n 20 18  1  0  0  0  0\n 18 30  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 22 29  2  0  0  0  0\n 24 23  2  0  0  0  0\n 24 25  1  0  0  0  0\n 26 24  1  0  0  0  0\n 27 26  2  0  0  0  0\n 27 28  1  0  0  0  0\n 29 27  1  0  0  0  0\n 29 30  1  0  0  0  0\nM  END",
          "smiles": "CC(=CC[C@H](/C(=C/CC/C(=C/CC[C@]1(C)CCc2cc(cc(C)c2O1)O)/C)/C)O)C",
          "formula": "C27H40O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "883aa42c-0205-407f-9161-50f83fe693f5"
          },
          "defined_stereo": 2,
          "ez_centers": 2,
          "molecular_weight": "412.6057",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1865efd6-ffce-4cf5-83fd-c862b0d2dc98",
      "version": "4",
      "structure": {
        "id": "13aab91b-8ec3-412f-9aa6-a8b53888dc52",
        "molfile": "\n  Marvin  01132101142D          \n\n 30 31  0  0  1  0            999 V2000\n    3.7169   -7.7490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4315   -7.3367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1434   -7.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1434   -8.5738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4333   -8.9856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7169   -8.5775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8580   -7.3360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5727   -7.7487    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.5727   -8.5738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8580   -8.9864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2872   -7.3361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0016   -7.7487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7160   -7.3361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4305   -7.7487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1449   -7.3361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8594   -7.7487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5738   -7.3361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2882   -7.7487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0027   -7.3361    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.4315   -6.5143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5565   -7.0481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4305   -8.5736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2882   -8.5736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0029   -8.9898    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0027   -6.5112    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7171   -7.7487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4315   -7.3361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1460   -7.7487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8604   -7.3361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1460   -8.5736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  4 10  1  0  0  0  0\n  3  7  1  0  0  0  0\n  8 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n  2 20  1  0  0  0  0\n  8 21  1  1  0  0  0\n 14 22  1  0  0  0  0\n 18 23  1  0  0  0  0\n  6 24  1  0  0  0  0\n 19 25  1  6  0  0  0\n 19 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  2  0  0  0  0\n 28 29  1  0  0  0  0\n 28 30  1  0  0  0  0\nM  END",
        "smiles": "CC(=CC[C@H](/C(=C/CC/C(=C/CC[C@]1(C)CCc2cc(cc(C)c2O1)O)/C)/C)O)C",
        "formula": "C27H40O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 2,
        "molecular_weight": "412.6057",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "9cd9e3bf-3600-43d8-9d29-32faa4017b5b",
          "747f9503-6a7d-4be5-ab70-e837403adb52"
        ],
        "stereo_centers": 2
      },
      "unii": "73O50WVY91"
    }
  ]
}