{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "bff2908a-8df7-487e-427d-aea6c9cc914d", "code": "25227058", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/25227058", "code_system": "PUBCHEM", "references": [ "c8d9e9f7-2ed3-ab5a-901c-6cc69ca4edf1" ] }, { "uuid": "82e09f89-7054-442f-a177-405d36ab70ac", "code": "76400-25-4", "type": "PRIMARY", "url": "https://chem.nlm.nih.gov/chemidplus/rn/76400-25-4", "code_system": "CAS", "references": [ "8e466b82-b9dd-453d-afcd-132a85bac212", "33da1f29-78ea-4f2e-b0e0-705d6d06ade4" ] }, { "uuid": "c4bea383-cd06-421b-973e-434e656b8449", "code": "73JS489R2Z", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "1eb1030d-94c3-4223-a2f2-702cc24843d1", "name": "Dipeptide-8", "stdName": "DIPEPTIDE-8", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "b27bdfe8-2e55-43fb-a8b8-e6cad65aa209", "8e466b82-b9dd-453d-afcd-132a85bac212" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "78f0dabc-d030-4714-81f6-1cf5c169371e", "name_org": "INCI" } ] }, { "uuid": "3438285b-0064-4e41-be3f-f3f6b7fcdf90", "name": "L-Alanyl-(4R)-4-hydroxy-L-proline", "stdName": "L-ALANYL-(4R)-4-HYDROXY-L-PROLINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "33da1f29-78ea-4f2e-b0e0-705d6d06ade4" ], "display_name": false }, { "uuid": "27b7f21e-280a-4569-bb35-bdfe1c2370cc", "name": "L-Proline, L-alanyl-4-hydroxy-, (4R)-", "stdName": "L-PROLINE, L-ALANYL-4-HYDROXY-, (4R)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "33da1f29-78ea-4f2e-b0e0-705d6d06ade4" ], "display_name": false } ], "references": [ { "uuid": "c8d9e9f7-2ed3-ab5a-901c-6cc69ca4edf1", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "33da1f29-78ea-4f2e-b0e0-705d6d06ade4", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "8e466b82-b9dd-453d-afcd-132a85bac212", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true }, { "uuid": "b27bdfe8-2e55-43fb-a8b8-e6cad65aa209", "citation": "Cosmetic", "doc_type": "BOOK", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "4e42bbd9-c39e-4a4a-9bc2-d001327005ea", "id": "4e42bbd9-c39e-4a4a-9bc2-d001327005ea", "molfile": "L-Alanyl-(4R)-4-hydroxy-L-proline\n CDK 08082416312D\n76400-25-4 Copyright (C) 2024 ACS\n 14 14 0 0 1 0 0 0 0 0999 V2000\n 5.1556 3.8549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9256 5.1886 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.9256 2.5213 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1556 6.5222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4656 5.1886 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1864 1.1444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1559 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6927 0.8242 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 5.5302 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6156 3.8549 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7104 2.6091 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 2.7104 5.1008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2459 3.0849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2459 4.6250 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 2 0 0 0 0\n 1 10 1 0 0 0 0\n 2 4 1 0 0 0 0\n 2 5 1 6 0 0 0\n 6 7 1 0 0 0 0\n 6 8 2 0 0 0 0\n 11 6 1 6 0 0 0\n 14 9 1 1 0 0 0\n 10 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 12 14 1 0 0 0 0\n 13 14 1 0 0 0 0\nM END", "smiles": "C[C@@H](C(=O)N1C[C@@H](C[C@H]1C(=O)O)O)N", "formula": "C8H14N2O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "4a630ca8-d8e5-4aae-8eb5-9ea2e7fb6c0e" }, "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "202.2081", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "306b69f7-7aad-41e4-8e1c-9a793314995d", "version": "4", "structure": { "id": "85ef1301-cd1a-4184-9db5-dee24c93c744", "molfile": "L-Alanyl-(4R)-4-hydroxy-L-proline\n JSDraw208082416312D\n\n 14 14 0 0 1 0 0 V2000\n 26.6093 -7.0945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.3893 -5.7435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.3893 -8.4454 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6093 -4.3925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9493 -5.7435 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 24.6145 -9.8402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.5706 -10.9995 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.1404 -10.1645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3867 -5.3974 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.0493 -7.0945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 24.1323 -8.3565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.1323 -5.8324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.6488 -7.8745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.6488 -6.3144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 2 0 0 0 0\n 1 10 1 0 0 0 0\n 2 4 1 0 0 0 0\n 2 5 1 6 0 0 0\n 6 7 1 0 0 0 0\n 6 8 2 0 0 0 0\n 11 6 1 6 0 0 0\n 14 9 1 1 0 0 0\n 10 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 12 14 1 0 0 0 0\n 13 14 1 0 0 0 0\nM END", "smiles": "C[C@@H](C(=O)N1C[C@@H](C[C@H]1C(=O)O)O)N", "formula": "C8H14N2O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "202.2081", "optical_activity": "UNSPECIFIED", "references": [ "33da1f29-78ea-4f2e-b0e0-705d6d06ade4", "b27bdfe8-2e55-43fb-a8b8-e6cad65aa209", "8e466b82-b9dd-453d-afcd-132a85bac212" ], "stereo_centers": 3 }, "modifications": { "uuid": "8b77a037-06bd-4187-8c9b-e216078a6da1" }, "unii": "73JS489R2Z" } ] }