{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "12e1dcc7-69c7-4573-b2b2-e46ca7fe57a7",
          "code": "137-30-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=137-30-4",
          "code_system": "CAS",
          "references": [
            "ce5367a5-95df-415e-b081-238c2fc566c7",
            "9022f556-378b-4543-9cfc-26f00b8b0191"
          ]
        },
        {
          "uuid": "b6d21c3d-2162-4747-874c-7b08375f0845",
          "code": "D015039",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68015039",
          "code_system": "MESH",
          "references": [
            "ce5367a5-95df-415e-b081-238c2fc566c7"
          ]
        },
        {
          "uuid": "022a5a11-5ef0-4e88-bf34-2122b2ee3385",
          "code": "34805",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:4457",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "ce5367a5-95df-415e-b081-238c2fc566c7"
          ]
        },
        {
          "uuid": "c9965001-da18-4a02-8f25-fd605dbcc2bb",
          "code": "205-288-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.808",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ce5367a5-95df-415e-b081-238c2fc566c7"
          ]
        },
        {
          "uuid": "c5279dd0-6213-44ee-9e00-1ffb1a301fb0",
          "code": "m11642",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11642?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "ce5367a5-95df-415e-b081-238c2fc566c7"
          ]
        },
        {
          "uuid": "3e522a3b-86f9-4963-d7b2-867d252f215c",
          "code": "1788",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1788",
          "code_system": "HSDB",
          "references": [
            "8bf4ac56-786c-1d78-a93e-26ca9d6576a6"
          ]
        },
        {
          "uuid": "45d9c257-ee1d-7b65-37af-3f661432028a",
          "code": "DTXSID0021464",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0021464",
          "code_system": "EPA CompTox",
          "references": [
            "32bf5d12-15bf-e112-4fbd-5865fcffc34f"
          ]
        },
        {
          "uuid": "1097f52f-ac72-2428-581a-2c6cd467b770",
          "code": "8722",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8722",
          "code_system": "PUBCHEM",
          "references": [
            "f5127f56-cc9b-c594-2090-5544e340560e"
          ]
        },
        {
          "uuid": "479d8505-20b3-4690-b759-e3a894731fd6",
          "code": "73D8UA974J",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "db5bd58b-39f8-a052-c160-2eb7265aa345",
          "code": "79736",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:79736",
          "code_system": "CHEBI",
          "references": [
            "c1376e16-73c9-e1d5-306d-af112efd3dee"
          ]
        },
        {
          "uuid": "f8534358-81d5-861f-9d13-bbe72e50fcfa",
          "code": "Zinc bis(dimethyldithiocarbamate)",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Zinc_bis(dimethyldithiocarbamate)",
          "code_system": "WIKIPEDIA",
          "references": [
            "728a71e2-53c9-106d-60cb-59cba6d89e33"
          ]
        },
        {
          "uuid": "0d676fc1-aa05-ca92-4206-25d00fcc899a",
          "code": "ziram",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/ziram.html",
          "code_system": "ALANWOOD",
          "references": [
            "6a190e6a-f501-724a-678f-b106a638c39b"
          ]
        },
        {
          "uuid": "d1693ec0-b208-08a2-2ae9-de491d4ff6ae",
          "code": "737",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=737",
          "code_system": "NSC",
          "references": [
            "ad4eb87f-7a0a-3f74-cd30-fe53937c2dd6"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6d04b318-f385-483d-8416-51ac5f914b37",
          "name": "(T-4)-BIS(N,N-DIMETHYLCARBAMODITHIOATO-.KAPPA.S,.KAPPA.S')ZINC",
          "stdName": "(T-4)-BIS(N,N-DIMETHYLCARBAMODITHIOATO-.KAPPA.S,.KAPPA.S')ZINC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0360e57c-be46-471f-9d43-6fbe2c47f3a7",
            "1e24750e-fc41-415b-a3a8-51e29fe3d8d2"
          ],
          "display_name": false
        },
        {
          "uuid": "86ac2fa8-2caf-44e8-a5b2-f325f0a60fb8",
          "name": "CARBAMODITHIOIC ACID, N,N-DIMETHYL-, ZINC SALT (2:1)",
          "stdName": "CARBAMODITHIOIC ACID, N,N-DIMETHYL-, ZINC SALT (2:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "468f7704-4dcf-4186-a9c8-7cda5c4c9c8e",
            "1e24750e-fc41-415b-a3a8-51e29fe3d8d2"
          ],
          "display_name": false
        },
        {
          "uuid": "f8287853-b75d-4feb-a757-08177896727d",
          "name": "CRITTAM",
          "stdName": "CRITTAM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0360e57c-be46-471f-9d43-6fbe2c47f3a7",
            "1e24750e-fc41-415b-a3a8-51e29fe3d8d2"
          ],
          "display_name": false
        },
        {
          "uuid": "4d4b8fc5-82ed-4843-896c-bd4ece36e08f",
          "name": "DIMETHYLDITHIOCARBAMIC ACID ZINC SALT",
          "stdName": "DIMETHYLDITHIOCARBAMIC ACID ZINC SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0360e57c-be46-471f-9d43-6fbe2c47f3a7",
            "1e24750e-fc41-415b-a3a8-51e29fe3d8d2"
          ],
          "display_name": false
        },
        {
          "uuid": "c0b82a81-9305-4e89-9a1e-8f6bce7892a2",
          "name": "METHYL CYMATE",
          "stdName": "METHYL CYMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0360e57c-be46-471f-9d43-6fbe2c47f3a7",
            "1e24750e-fc41-415b-a3a8-51e29fe3d8d2"
          ],
          "display_name": false
        },
        {
          "uuid": "1a5993dc-296d-4729-8b87-4bf148458bde",
          "name": "MEZENE",
          "stdName": "MEZENE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0360e57c-be46-471f-9d43-6fbe2c47f3a7",
            "1e24750e-fc41-415b-a3a8-51e29fe3d8d2"
          ],
          "display_name": false
        },
        {
          "uuid": "0ba91b53-66ca-4e6e-ac92-3f6a24b96321",
          "name": "NSC-737",
          "stdName": "NSC-737",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c845256-a6ad-4890-890a-53eed3f98ab6",
            "1e24750e-fc41-415b-a3a8-51e29fe3d8d2"
          ],
          "display_name": false
        },
        {
          "uuid": "a70492c3-7151-4049-b93d-1a5fbb4612a5",
          "name": "POMARSOL Z",
          "stdName": "POMARSOL Z",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0360e57c-be46-471f-9d43-6fbe2c47f3a7",
            "1e24750e-fc41-415b-a3a8-51e29fe3d8d2"
          ],
          "display_name": false
        },
        {
          "uuid": "12771d67-f6c2-439c-9c56-67344f36b305",
          "name": "THIONIC",
          "stdName": "THIONIC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0360e57c-be46-471f-9d43-6fbe2c47f3a7",
            "1e24750e-fc41-415b-a3a8-51e29fe3d8d2"
          ],
          "display_name": false
        },
        {
          "uuid": "2728c632-5a59-406c-afcd-c2ac20e0af88",
          "name": "TRISCABOL",
          "stdName": "TRISCABOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0360e57c-be46-471f-9d43-6fbe2c47f3a7",
            "1e24750e-fc41-415b-a3a8-51e29fe3d8d2"
          ],
          "display_name": false
        },
        {
          "uuid": "0a44b5b9-96ac-439c-838d-10609c494cf8",
          "name": "ZINC BIS(DIMETHYLCARBAMODITHIOATE)",
          "stdName": "ZINC BIS(DIMETHYLCARBAMODITHIOATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "468f7704-4dcf-4186-a9c8-7cda5c4c9c8e",
            "1e24750e-fc41-415b-a3a8-51e29fe3d8d2"
          ],
          "display_name": false
        },
        {
          "uuid": "b2ac85cb-a3e4-44f7-a1b7-a7f4ece365d2",
          "name": "ZINC DIMETHYLDITHIOCARBAMATE",
          "stdName": "ZINC DIMETHYLDITHIOCARBAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0360e57c-be46-471f-9d43-6fbe2c47f3a7",
            "1e24750e-fc41-415b-a3a8-51e29fe3d8d2"
          ],
          "display_name": false
        },
        {
          "uuid": "a6344024-0bde-4ac6-80e9-9925f7fd74a8",
          "name": "ZIRAM",
          "stdName": "ZIRAM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ed6404d-2721-452f-81f8-d9b2a71b052f",
            "531512d8-7119-4e84-89fe-e482556ea485",
            "7c845256-a6ad-4890-890a-53eed3f98ab6",
            "e42d4218-a2d7-458d-b45e-e983f2738ef5",
            "7dd790eb-bc9a-4072-97a0-42347f4ababf",
            "0ce712af-1380-45bb-879d-4a74e88d23de",
            "1e24750e-fc41-415b-a3a8-51e29fe3d8d2",
            "8c212f12-6f10-4614-8394-7bcc704cd109"
          ],
          "display_name": true
        },
        {
          "uuid": "cf7b2207-0dd1-4376-84a1-e157cd5f6ea6",
          "name": "ZIRAM (ZINC DIMETHYLDITHIOCARBAMATE)",
          "stdName": "ZIRAM (ZINC DIMETHYLDITHIOCARBAMATE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "724a5939-3790-4592-8a85-96c93b15cff2",
            "1e24750e-fc41-415b-a3a8-51e29fe3d8d2"
          ],
          "display_name": false
        },
        {
          "uuid": "b7876646-5888-44ea-bf26-3973a1c5dbb6",
          "name": "ZIRAM [HSDB]",
          "stdName": "ZIRAM [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "531512d8-7119-4e84-89fe-e482556ea485",
            "1e24750e-fc41-415b-a3a8-51e29fe3d8d2"
          ],
          "display_name": false
        },
        {
          "uuid": "db21799b-05d9-6bf4-635f-5b6de1d48f66",
          "name": "ZIRAM [IARC]",
          "stdName": "ZIRAM [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cf592605-782c-6858-b5a3-c2f59b5f6cf5"
          ],
          "display_name": false
        },
        {
          "uuid": "0e841943-979b-487f-8c8d-45a6581f9d8f",
          "name": "ZIRAM [ISO]",
          "stdName": "ZIRAM [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c845256-a6ad-4890-890a-53eed3f98ab6",
            "1e24750e-fc41-415b-a3a8-51e29fe3d8d2"
          ],
          "display_name": false
        },
        {
          "uuid": "9bc07bb0-6223-4931-98e3-f49ca3aa68a1",
          "name": "ZIRAM [MI]",
          "stdName": "ZIRAM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e42d4218-a2d7-458d-b45e-e983f2738ef5",
            "1e24750e-fc41-415b-a3a8-51e29fe3d8d2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0ce712af-1380-45bb-879d-4a74e88d23de",
          "citation": "http://www.alanwood.net/pesticides/ziram.html",
          "url": "http://www.alanwood.net/pesticides/ziram.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1e24750e-fc41-415b-a3a8-51e29fe3d8d2",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e42d4218-a2d7-458d-b45e-e983f2738ef5",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "468f7704-4dcf-4186-a9c8-7cda5c4c9c8e",
          "citation": "CHEMSPIDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "531512d8-7119-4e84-89fe-e482556ea485",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0360e57c-be46-471f-9d43-6fbe2c47f3a7",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c845256-a6ad-4890-890a-53eed3f98ab6",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "724a5939-3790-4592-8a85-96c93b15cff2",
          "citation": "21CFR175.105",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce5367a5-95df-415e-b081-238c2fc566c7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391751000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9058993d-3773-4784-a955-afe831dfb619",
          "citation": "SRS import [73D8UA974J]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=73D8UA974J",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391751000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5ed6404d-2721-452f-81f8-d9b2a71b052f",
          "citation": "ZIRAM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8c212f12-6f10-4614-8394-7bcc704cd109",
          "citation": "ZIRAM [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7dd790eb-bc9a-4072-97a0-42347f4ababf",
          "citation": "ZIRAM [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8bf4ac56-786c-1d78-a93e-26ca9d6576a6",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+137-30-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "32bf5d12-15bf-e112-4fbd-5865fcffc34f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=137-30-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cf592605-782c-6858-b5a3-c2f59b5f6cf5",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "728a71e2-53c9-106d-60cb-59cba6d89e33",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "f5127f56-cc9b-c594-2090-5544e340560e",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "9022f556-378b-4543-9cfc-26f00b8b0191",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6a190e6a-f501-724a-678f-b106a638c39b",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "c1376e16-73c9-e1d5-306d-af112efd3dee",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ad4eb87f-7a0a-3f74-cd30-fe53937c2dd6",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b7c7b1a2-3cf0-4d52-8957-a29b4086421f",
          "id": "b7c7b1a2-3cf0-4d52-8957-a29b4086421f",
          "molfile": "\n  Marvin  01132109302D          \n\n  1  0  0  0  0  0            999 V2000\n    4.6979   -3.1367    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Zn+2]",
          "formula": "Zn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "84f18fd8-8a88-4933-bf0d-c837c1e4a355"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "65.3956",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "9a04fc30-5dfb-42be-a1e8-18690ca0af44",
          "id": "9a04fc30-5dfb-42be-a1e8-18690ca0af44",
          "molfile": "\n  Marvin  01132108002D          \n\n  6  5  0  0  0  0            999 V2000\n   -0.3370   -2.7224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3780   -3.1343    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3780   -3.9582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0928   -2.7224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8079   -3.1343    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0928   -1.8985    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  2  0  0  0  0\nM  END",
          "smiles": "CN(C)C(=S)S",
          "formula": "C3H7NS2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "464076ac-f581-41fa-a32d-673f72deaf9b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "121.2267",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2925ca47-69c6-40eb-9e6c-545232fd1642",
      "version": "12",
      "structure": {
        "id": "60f6c5a6-2cb8-43ba-959f-2150c85fa2a3",
        "molfile": "\n  Marvin  01132105012D          \n\n 13 10  0  0  0  0            999 V2000\n    4.6979   -3.1367    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\n    1.0928   -2.7224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3780   -3.1343    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3370   -2.7224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3780   -3.9582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8079   -3.1343    0.0000 S   0  5  0  0  0  0  0  0  0  0  0  0\n    1.0928   -1.8985    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0928   -2.7224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3780   -3.1343    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3370   -2.7224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3780   -3.9582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8079   -3.1343    0.0000 S   0  5  0  0  0  0  0  0  0  0  0  0\n    1.0928   -1.8985    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  2  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n  8 12  1  0  0  0  0\n  8 13  2  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\nM  CHG  3   1   2   6  -1  12  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 12   2   3   4   5   6   7   8   9  10  11  12  13\nM  SPA   1  6   2   3   4   5   6   7\nM  SDI   1  4   -0.7570   -4.3782   -0.7570   -1.4785\nM  SDI   1  4    2.2279   -1.4785    2.2279   -4.3782\nM  SMT   1 2\nM  END",
        "smiles": "CN(C)C(=S)[S-].CN(C)C(=S)[S-].[Zn+2]",
        "formula": "2C3H6NS2.Zn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "305.833",
        "optical_activity": "NONE",
        "references": [
          "9058993d-3773-4784-a955-afe831dfb619",
          "0360e57c-be46-471f-9d43-6fbe2c47f3a7"
        ],
        "stereo_centers": 0
      },
      "unii": "73D8UA974J"
    }
  ]
}