{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1f63b5de-e5e7-4495-8806-1bc19d1112fb",
          "code": "14350-94-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=14350-94-8",
          "code_system": "CAS",
          "references": [
            "61ca7c20-2eae-45ee-a7fb-d7036c31ec14",
            "25102d5d-e23d-9fdd-fb69-34089ae7d973"
          ]
        },
        {
          "uuid": "9a1993f3-44c9-46c3-85d4-ce41e2f1b6e8",
          "code": "84369",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/84369",
          "code_system": "PUBCHEM",
          "references": [
            "61ca7c20-2eae-45ee-a7fb-d7036c31ec14"
          ]
        },
        {
          "uuid": "a9a8afbe-daae-4e8a-ae95-75e907796764",
          "code": "238-303-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.034.806",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "61ca7c20-2eae-45ee-a7fb-d7036c31ec14"
          ]
        },
        {
          "uuid": "379bd8a8-f075-4a58-99ee-87e72fd64891",
          "code": "73D1PW81SA",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "651648a6-ab27-54ff-250c-732c1fef0c08",
          "code": "DTXSID60904752",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60904752",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "98ecae7b-2641-8d0f-dd2a-4b277f541739",
          "name": "1H-IMIDAZOLIUM, 1-(CARBOXYMETHYL)-4,5-DIHYDRO-1-(2-HYDROXYETHYL)-2-NONYL-, HYDROXIDE, SODIUM SALT (1:1:1)",
          "stdName": "1H-IMIDAZOLIUM, 1-(CARBOXYMETHYL)-4,5-DIHYDRO-1-(2-HYDROXYETHYL)-2-NONYL-, HYDROXIDE, SODIUM SALT (1:1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25102d5d-e23d-9fdd-fb69-34089ae7d973"
          ],
          "display_name": false
        },
        {
          "uuid": "0387d0ee-db68-5ec3-1b0a-a94cfd7b7c87",
          "name": "2-IMIDAZOLINIUM, 1-(CARBOXYMETHYL)-1-(2-HYDROXYETHYL)-2-NONYL-, HYDROXIDE, MONOSODIUM SALT",
          "stdName": "2-IMIDAZOLINIUM, 1-(CARBOXYMETHYL)-1-(2-HYDROXYETHYL)-2-NONYL-, HYDROXIDE, MONOSODIUM SALT",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25102d5d-e23d-9fdd-fb69-34089ae7d973"
          ],
          "display_name": false
        },
        {
          "uuid": "b80e37e0-18db-4f89-9d27-5dc609d30fcb",
          "name": "SODIUM 1-(CARBOXYMETHYL)-4,5-DIHYDRO-1-(2-HYDROXYETHYL)-2-NONYL-1H-IMIDAZOLIUM HYDROXIDE",
          "stdName": "SODIUM 1-(CARBOXYMETHYL)-4,5-DIHYDRO-1-(2-HYDROXYETHYL)-2-NONYL-1H-IMIDAZOLIUM HYDROXIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58f10f52-0456-4ce6-939e-b03359ed4394"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "58f10f52-0456-4ce6-939e-b03359ed4394",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "61ca7c20-2eae-45ee-a7fb-d7036c31ec14",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392158000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "25102d5d-e23d-9fdd-fb69-34089ae7d973",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "10fbaa0c-d4c9-41d1-a07f-d97a863be1da",
          "id": "10fbaa0c-d4c9-41d1-a07f-d97a863be1da",
          "molfile": "\n  Marvin  01132101062D          \n\n  1  0  0  0  0  0            999 V2000\n    1.8994   -0.1112    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "[OH-]",
          "formula": "HO",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cae6850f-63f6-4f93-bc7c-a7bea27d6a0d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "17.0073",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "0ffd5e36-01d1-42f7-b5b8-6ffe64c43fe0",
          "id": "0ffd5e36-01d1-42f7-b5b8-6ffe64c43fe0",
          "molfile": "\n  Marvin  01132101042D          \n\n  1  0  0  0  0  0            999 V2000\n    5.5684   -0.3891    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bda40b36-452f-43ca-b90e-da6332330ab6"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "74d3c876-a768-42c3-81c7-8c4f9ebcc82f",
          "id": "74d3c876-a768-42c3-81c7-8c4f9ebcc82f",
          "molfile": "\n  Marvin  01132106042D          \n\n 21 21  0  0  0  0            999 V2000\n    9.2653   -2.0198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5333   -1.6307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8384   -2.0754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1065   -1.6863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4116   -2.1310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6796   -1.7511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9847   -2.1866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2528   -1.8067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5579   -2.2515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8259   -1.8624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5480   -2.6498    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7141   -2.6128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4824   -1.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1681   -1.3527    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n    1.4361   -0.9543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7227   -1.3898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.9914    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.1224   -1.3620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7061   -0.8246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6968    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5956   -1.2045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 14 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 18  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  2  0  0  0  0\nM  CHG  2  14   1  17  -1\nM  END",
          "smiles": "CCCCCCCCCC1=NCC[N+]1(CC[O-])CC(=O)O",
          "formula": "C16H30N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "918b2727-e88a-4535-8ac5-029aa1139515"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "298.4216",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "INCOMPLETE",
      "uuid": "6fae6396-401b-4098-a7a9-bf52c3f0e946",
      "version": "5",
      "structure": {
        "id": "f656546f-d03d-40a3-8a0a-c99349f26af2",
        "molfile": "\n  Marvin  01132112462D          \n\n 23 21  0  0  0  0            999 V2000\n    2.1681   -1.3527    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    2.8259   -1.8624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5480   -2.6498    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1224   -1.3620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7061   -0.8246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6968    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4824   -1.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4361   -0.9543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7141   -2.6128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5956   -1.2045    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.5579   -2.2515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.9914    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7227   -1.3898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2528   -1.8067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5333   -1.6307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8384   -2.0754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6796   -1.7511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4116   -2.1310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1065   -1.6863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9847   -2.1866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2653   -2.0198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5684   -0.3891    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n    1.8994   -0.1112    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  4  1  0  0  0  0\n  1  7  1  0  0  0  0\n  1  8  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2 11  1  0  0  0  0\n  3  9  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5 10  1  0  0  0  0\n  7  9  1  0  0  0  0\n  8 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 20  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 21  1  0  0  0  0\n 16 19  1  0  0  0  0\n 17 20  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\nM  CHG  4   1   1  10  -1  22   1  23  -1\nM  END",
        "smiles": "CCCCCCCCCC1=NCC[N+]1(CCO)CC(=O)[O-].[Na+].[OH-]",
        "formula": "C16H30N2O3.Na.HO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "338.4187",
        "optical_activity": "( + / - )",
        "references": [
          "58f10f52-0456-4ce6-939e-b03359ed4394",
          "25102d5d-e23d-9fdd-fb69-34089ae7d973"
        ],
        "stereo_centers": 1
      },
      "unii": "73D1PW81SA"
    }
  ]
}