{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4cb89851-e16b-4a48-bb11-6d73c538c8c0",
          "code": "2997-92-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2997-92-4",
          "code_system": "CAS",
          "references": [
            "e51a59ff-de9f-49d5-88c5-4a99611c4ef7",
            "63ddc446-3d79-461a-99ff-b3c57b2369a1"
          ]
        },
        {
          "uuid": "117ccb12-7dc7-456e-963f-560662a58172",
          "code": "221-070-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.019.155",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e51a59ff-de9f-49d5-88c5-4a99611c4ef7"
          ]
        },
        {
          "uuid": "8ecf5533-1989-29c0-ab18-31d8788ada3e",
          "code": "DTXSID3049756",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3049756",
          "code_system": "EPA CompTox",
          "references": [
            "10678fa1-a195-8720-e130-766eeccd2a5c"
          ]
        },
        {
          "uuid": "10546476-372e-42ad-a860-eed8d2c72d82",
          "code": "7381JDR72F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "49c2e917-f712-f73c-de17-633588621fbd",
          "code": "2,2'-Azobis(2-amidinopropane) dihydrochloride",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/2,2%27-Azobis(2-amidinopropane)_dihydrochloride",
          "code_system": "WIKIPEDIA",
          "references": [
            "f1ac1d15-b09c-ffc7-da1f-d3602422eb51"
          ]
        },
        {
          "uuid": "655cd748-3d51-5c25-ed03-53136425206b",
          "code": "668416",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=668416",
          "code_system": "NSC",
          "references": [
            "cf7a7cc1-479a-7099-0a58-bf7d62b128fe"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8501d9d2-aa47-48a5-b287-bdfd5e4bd941",
          "name": "2,2'-AZOBIS(2-AMIDINOPROPANE) DIHYDROCHLORIDE",
          "stdName": "2,2'-AZOBIS(2-AMIDINOPROPANE) DIHYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c554793-f967-4722-8f48-470dcdf46637",
            "2d4bdb34-3d6f-4255-9df8-9237e77fc0c4"
          ],
          "display_name": false
        },
        {
          "uuid": "47b63eec-0e1e-437f-b89f-f82e42d445eb",
          "name": "2,2'-AZOBIS(2-METHYLPROPANIMIDAMIDE) DIHYDROCHLORIDE",
          "stdName": "2,2'-AZOBIS(2-METHYLPROPANIMIDAMIDE) DIHYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "76f38460-2895-4921-9340-1864b53f3f8a"
          ],
          "display_name": true
        },
        {
          "uuid": "f5ca83aa-ffa6-426e-8e62-8906eb37f978",
          "name": "2,2'-AZOBIS(2-METHYLPROPIONAMIDINE) DIHYDROCHLORIDE",
          "stdName": "2,2'-AZOBIS(2-METHYLPROPIONAMIDINE) DIHYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c554793-f967-4722-8f48-470dcdf46637",
            "2d4bdb34-3d6f-4255-9df8-9237e77fc0c4"
          ],
          "display_name": false
        },
        {
          "uuid": "b8ecfe03-8361-4afb-bffb-bde4a8771c55",
          "name": "2,2'-AZOBIS(ISOBUTYRAMIDINE HYDROCHLORIDE)",
          "stdName": "2,2'-AZOBIS(ISOBUTYRAMIDINE HYDROCHLORIDE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c554793-f967-4722-8f48-470dcdf46637",
            "2d4bdb34-3d6f-4255-9df8-9237e77fc0c4"
          ],
          "display_name": false
        },
        {
          "uuid": "3da19dcd-b467-4bc6-b246-ad78d4ccd703",
          "name": "2,2'-AZOBIS(ISOBUTYRAMIDINE) DIHYDROCHLORIDE",
          "stdName": "2,2'-AZOBIS(ISOBUTYRAMIDINE) DIHYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c554793-f967-4722-8f48-470dcdf46637",
            "2d4bdb34-3d6f-4255-9df8-9237e77fc0c4"
          ],
          "display_name": false
        },
        {
          "uuid": "423b6237-96d6-4a13-8c6a-3324bd370fd4",
          "name": "2,2'-AZOBIS(PROPANE-2-CARBOXAMIDINE) DIHYDROCHLORIDE",
          "stdName": "2,2'-AZOBIS(PROPANE-2-CARBOXAMIDINE) DIHYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c554793-f967-4722-8f48-470dcdf46637",
            "2d4bdb34-3d6f-4255-9df8-9237e77fc0c4"
          ],
          "display_name": false
        },
        {
          "uuid": "af67c7c5-2970-4292-a869-347619f5c756",
          "name": "2,2'-AZOBISAMIDINOPROPANE DIHYDROCHLORIDE",
          "stdName": "2,2'-AZOBISAMIDINOPROPANE DIHYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c554793-f967-4722-8f48-470dcdf46637",
            "2d4bdb34-3d6f-4255-9df8-9237e77fc0c4"
          ],
          "display_name": false
        },
        {
          "uuid": "08ba69d7-7891-4f81-9c67-6da0a80b79e8",
          "name": "2,2'-AZOBISISOBUTYRAMIDINIUM CHLORIDE",
          "stdName": "2,2'-AZOBISISOBUTYRAMIDINIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c554793-f967-4722-8f48-470dcdf46637",
            "2d4bdb34-3d6f-4255-9df8-9237e77fc0c4"
          ],
          "display_name": false
        },
        {
          "uuid": "5b966e49-e839-48fa-a186-11c009074f02",
          "name": "2,2'-AZODIISOBUTYLAMIDINE DIHYDROCHLORIDE",
          "stdName": "2,2'-AZODIISOBUTYLAMIDINE DIHYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c554793-f967-4722-8f48-470dcdf46637",
            "2d4bdb34-3d6f-4255-9df8-9237e77fc0c4"
          ],
          "display_name": false
        },
        {
          "uuid": "90c65821-42f4-4f45-9648-63616ba6b743",
          "name": "2,2'-AZODIISOBUTYRAMIDINE DIHYDROCHLORIDE",
          "stdName": "2,2'-AZODIISOBUTYRAMIDINE DIHYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c554793-f967-4722-8f48-470dcdf46637",
            "2d4bdb34-3d6f-4255-9df8-9237e77fc0c4"
          ],
          "display_name": false
        },
        {
          "uuid": "c60dc360-7281-45f3-8f99-d6fc483e0c9c",
          "name": "2,2-AZOBIS(2-AMIDINOPROPANE) DIHYDROCHLORIDE",
          "stdName": "2,2-AZOBIS(2-AMIDINOPROPANE) DIHYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c554793-f967-4722-8f48-470dcdf46637",
            "2d4bdb34-3d6f-4255-9df8-9237e77fc0c4"
          ],
          "display_name": false
        },
        {
          "uuid": "ea4472f7-a1e0-43f8-bbfd-aa63cb201267",
          "name": "AAPH",
          "stdName": "AAPH",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c554793-f967-4722-8f48-470dcdf46637",
            "2d4bdb34-3d6f-4255-9df8-9237e77fc0c4"
          ],
          "display_name": false
        },
        {
          "uuid": "78568c92-6dcd-4943-8407-459469c27d51",
          "name": "AIBA",
          "stdName": "AIBA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c554793-f967-4722-8f48-470dcdf46637",
            "2d4bdb34-3d6f-4255-9df8-9237e77fc0c4"
          ],
          "display_name": false
        },
        {
          "uuid": "4a383f30-7370-4650-b8bd-2b7e0e3456d8",
          "name": "AZOBIS(ISOBUTYL)AMIDINE HYDROCHLORIDE",
          "stdName": "AZOBIS(ISOBUTYL)AMIDINE HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c554793-f967-4722-8f48-470dcdf46637",
            "2d4bdb34-3d6f-4255-9df8-9237e77fc0c4"
          ],
          "display_name": false
        },
        {
          "uuid": "d80a4606-6e9a-40c0-bae5-e403d1376b85",
          "name": "AZOBIS(ISOBUTYRAMIDINE) DIHYDROCHLORIDE",
          "stdName": "AZOBIS(ISOBUTYRAMIDINE) DIHYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c554793-f967-4722-8f48-470dcdf46637",
            "2d4bdb34-3d6f-4255-9df8-9237e77fc0c4"
          ],
          "display_name": false
        },
        {
          "uuid": "9f259d54-b49e-45ed-a1cc-33c5600a9684",
          "name": "AZOBISISOBUTYRAMIDINIUM DICHLORIDE",
          "stdName": "AZOBISISOBUTYRAMIDINIUM DICHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c554793-f967-4722-8f48-470dcdf46637",
            "2d4bdb34-3d6f-4255-9df8-9237e77fc0c4"
          ],
          "display_name": false
        },
        {
          "uuid": "1ec4816f-1b36-b156-2d7a-961dc54dd525",
          "name": "NSC-668416",
          "stdName": "NSC-668416",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cf7a7cc1-479a-7099-0a58-bf7d62b128fe"
          ],
          "display_name": false
        },
        {
          "uuid": "974e56a0-ad97-48bb-bbc0-30db6f2e121f",
          "name": "PROPANIMIDAMIDE, 2,2'-AZOBIS(2-METHYL-, DIHYDROCHLORIDE",
          "stdName": "PROPANIMIDAMIDE, 2,2'-AZOBIS(2-METHYL-, DIHYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c554793-f967-4722-8f48-470dcdf46637",
            "2d4bdb34-3d6f-4255-9df8-9237e77fc0c4"
          ],
          "display_name": false
        },
        {
          "uuid": "a07a29a4-ff4e-4a8d-a002-08bfc3818b79",
          "name": "PROPIONAMIDINE, 2,2'-AZOBIS(2-METHYL-, DIHYDROCHLORIDE",
          "stdName": "PROPIONAMIDINE, 2,2'-AZOBIS(2-METHYL-, DIHYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c554793-f967-4722-8f48-470dcdf46637",
            "2d4bdb34-3d6f-4255-9df8-9237e77fc0c4"
          ],
          "display_name": false
        },
        {
          "uuid": "ca227752-a6b0-4e10-a5d0-73688b7a6184",
          "name": "WAKO V-50",
          "stdName": "WAKO V-50",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c554793-f967-4722-8f48-470dcdf46637",
            "2af1dfe5-ef4d-41f4-aaea-93f636d78e88"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "76f38460-2895-4921-9340-1864b53f3f8a",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2d4bdb34-3d6f-4255-9df8-9237e77fc0c4",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c554793-f967-4722-8f48-470dcdf46637",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2af1dfe5-ef4d-41f4-aaea-93f636d78e88",
          "citation": "SciFinder",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e51a59ff-de9f-49d5-88c5-4a99611c4ef7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391032000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c4768f24-605a-40d3-8902-32e9c577b44f",
          "citation": "SRS import [7381JDR72F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7381JDR72F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391032000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c0de3a3-688b-48e8-9d03-5aa44e3d5f62",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10678fa1-a195-8720-e130-766eeccd2a5c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2997-92-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f1ac1d15-b09c-ffc7-da1f-d3602422eb51",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "cf7a7cc1-479a-7099-0a58-bf7d62b128fe",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "63ddc446-3d79-461a-99ff-b3c57b2369a1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "23d38bb2-4a00-4865-95fd-00d9a851dbae",
          "id": "23d38bb2-4a00-4865-95fd-00d9a851dbae",
          "molfile": "\n  Marvin  01132102002D          \n\n  1  0  0  0  0  0            999 V2000\n    3.8077   -3.7264    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "312c47d7-be02-4d77-bf1c-ae377c60de46"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "843c6c5a-8c10-4095-90b6-6d3427bcccfc",
          "id": "843c6c5a-8c10-4095-90b6-6d3427bcccfc",
          "molfile": "\n  Marvin  01132106522D          \n\n 14 13  0  0  0  0            999 V2000\n    6.1431   -6.2918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6120   -5.6582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0812   -6.2883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9040   -5.2455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1851   -5.6582    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9040   -4.4202    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3309   -5.2455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0435   -5.6582    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7625   -5.2455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2299   -4.6129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2905   -4.6129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4768   -5.6582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1894   -5.2455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4768   -6.4835    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  2  7  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  6  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\nM  END",
          "smiles": "CC(C)(C(=N)N)/N=N/C(C)(C)C(=N)N",
          "formula": "C8H18N6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3cbefe42-9d4a-440b-8d91-3a8743f35929"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "198.269",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9b9b5854-6105-4cdf-8973-fe457a1c3aed",
      "version": "6",
      "structure": {
        "id": "feeefe5a-e832-44d1-9cf6-0490596849f9",
        "molfile": "\n  Marvin  01132113122D          \n\n 16 13  0  0  0  0            999 V2000\n    3.8077   -3.7264    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.7364   -6.3858    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.1851   -5.6582    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9040   -5.2455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9040   -4.4202    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6120   -5.6582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1431   -6.2918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0812   -6.2883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3309   -5.2455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0435   -5.6582    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7625   -5.2455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2299   -4.6129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2905   -4.6129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4768   -5.6582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1894   -5.2455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4768   -6.4835    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\nM  END",
        "smiles": "CC(C)(C(=N)N)/N=N/C(C)(C)C(=N)N.Cl.Cl",
        "formula": "C8H18N6.2ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "271.1908",
        "optical_activity": "NONE",
        "references": [
          "c4768f24-605a-40d3-8902-32e9c577b44f",
          "3c0de3a3-688b-48e8-9d03-5aa44e3d5f62"
        ],
        "stereo_centers": 0
      },
      "unii": "7381JDR72F"
    }
  ]
}