{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4fc14022-0e95-4c6a-950f-6100339aac3a",
          "code": "QN07XX59",
          "comments": "VATC|OTHER NERVOUS SYSTEM DRUGS|OTHER NERVOUS SYSTEM DRUGS|Other nervous system drugs|dextromethorphan, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN07XX59&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "8e740bb9-3622-433a-afe9-967598e7caef"
          ]
        },
        {
          "uuid": "6a627c5c-71e5-40c6-9d2d-ec383f00c348",
          "code": "125-71-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=125-71-3",
          "code_system": "CAS",
          "references": [
            "8e740bb9-3622-433a-afe9-967598e7caef",
            "ae35c267-e517-4cae-a6c6-bbb099934d2c"
          ]
        },
        {
          "uuid": "280ab3be-9010-4d5f-928a-bc15672166c5",
          "code": "C62022",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C62022",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8e740bb9-3622-433a-afe9-967598e7caef"
          ]
        },
        {
          "uuid": "f05e3bf9-3218-4493-9e93-dfa985359c7f",
          "code": "D003915",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68003915",
          "code_system": "MESH",
          "references": [
            "8e740bb9-3622-433a-afe9-967598e7caef"
          ]
        },
        {
          "uuid": "e1e99d64-a0c8-4108-b9a0-768c99e74eb1",
          "code": "DEXTROMETHORPHAN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Dextromethorphan",
          "code_system": "WIKIPEDIA",
          "references": [
            "8e740bb9-3622-433a-afe9-967598e7caef"
          ]
        },
        {
          "uuid": "259b4075-4d7c-4b12-a094-b1e698ace6d7",
          "code": "21 CFR 341.14",
          "comments": "PART 341 -- COLD, COUGH, ALLERGY, BRONCHODILATOR, AND ANTIASTHMATIC DRUG PRODUCTS FOR OVER-THE-COUNTER HUMAN USE|Subpart B--Active Ingredients|Sec. 341.14 Antitussive active ingredients.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=341.14",
          "code_system": "CFR",
          "references": [
            "8e740bb9-3622-433a-afe9-967598e7caef"
          ]
        },
        {
          "uuid": "351303a2-d1f7-4c6f-9411-81d63ef301c2",
          "code": "21 CFR 341.74",
          "comments": "PART 341 -- COLD, COUGH, ALLERGY, BRONCHODILATOR, AND ANTIASTHMATIC DRUG PRODUCTS FOR OVER-THE-COUNTER HUMAN USE|Subpart C?Labeling|Sec. 341.74 Labeling of antitussive drug products. d.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=341.74",
          "code_system": "CFR",
          "references": [
            "8e740bb9-3622-433a-afe9-967598e7caef"
          ]
        },
        {
          "uuid": "7bb51292-04ae-4bcb-89fd-7cd162062dde",
          "code": "N0000182149",
          "comments": "Established Pharmacologic Class [EPC]|Sigma-1 Agonist [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000182149",
          "code_system": "NDF-RT",
          "references": [
            "8e740bb9-3622-433a-afe9-967598e7caef"
          ]
        },
        {
          "uuid": "02cb5ea2-3a8e-42ca-a5b0-7c615ecb2dd9",
          "code": "N0000181821",
          "comments": "Established Pharmacologic Class [EPC]|Uncompetitive N-methyl-D-aspartate Receptor Antagonist [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000181821",
          "code_system": "NDF-RT",
          "references": [
            "8e740bb9-3622-433a-afe9-967598e7caef"
          ]
        },
        {
          "uuid": "a1f5b0d8-bddb-490b-bbff-da9f8c3bcebe",
          "code": "N07XX59",
          "comments": "ATC|NERVOUS SYSTEM|OTHER NERVOUS SYSTEM DRUGS|OTHER NERVOUS SYSTEM DRUGS|Other nervous system drugs|dextromethorphan, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N07XX59&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "8e740bb9-3622-433a-afe9-967598e7caef"
          ]
        },
        {
          "uuid": "2a73fe1a-09ce-4e1f-8a45-43e0d3c00e45",
          "code": "166",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=166",
          "code_system": "INN",
          "references": [
            "8e740bb9-3622-433a-afe9-967598e7caef"
          ]
        },
        {
          "uuid": "88baba4c-6b61-4036-909b-4a7c34d1300a",
          "code": "204-752-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.321",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8e740bb9-3622-433a-afe9-967598e7caef"
          ]
        },
        {
          "uuid": "ba165bc7-7924-4217-b6ec-f9a36f590c95",
          "code": "6953",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=6953",
          "code_system": "IUPHAR",
          "references": [
            "8e740bb9-3622-433a-afe9-967598e7caef"
          ]
        },
        {
          "uuid": "d8ff0b71-b3a8-48ef-b1dd-0f178aec968c",
          "code": "3289",
          "comments": "RxNorm",
          "type": "ALTERNATIVE",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/3289/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "8e740bb9-3622-433a-afe9-967598e7caef"
          ]
        },
        {
          "uuid": "2a1c5a56-6011-4cb3-9746-755027675757",
          "code": "m4227",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4227?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "8e740bb9-3622-433a-afe9-967598e7caef"
          ]
        },
        {
          "uuid": "b56a660c-dc78-4af8-8131-4a7f3db0bffc",
          "code": "DB00514",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00514",
          "code_system": "DRUG BANK",
          "references": [
            "8e740bb9-3622-433a-afe9-967598e7caef"
          ]
        },
        {
          "uuid": "7b9aefb8-d03a-46aa-be11-1df6116bebf8",
          "code": "SUB07051MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "8e740bb9-3622-433a-afe9-967598e7caef"
          ]
        },
        {
          "uuid": "893a4227-a44c-4fc9-a62e-42b35c09fab9",
          "code": "CHEMBL52440",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL52440",
          "code_system": "ChEMBL",
          "references": [
            "8e740bb9-3622-433a-afe9-967598e7caef"
          ]
        },
        {
          "uuid": "312cd58b-ed08-4e77-8629-d664d40b35c1",
          "code": "N0000181819",
          "comments": "Uncompetitive NMDA Receptor Antagonists [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000181819",
          "code_system": "NDF-RT",
          "references": [
            "8e740bb9-3622-433a-afe9-967598e7caef"
          ]
        },
        {
          "uuid": "95249baf-ce06-462c-8bc7-0fed3bed4d0c",
          "code": "N0000182147",
          "comments": "Sigma-1 Receptor Agonists [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000182147",
          "code_system": "NDF-RT",
          "references": [
            "8e740bb9-3622-433a-afe9-967598e7caef"
          ]
        },
        {
          "uuid": "f31a5bf6-f97e-413c-9576-812a330858e3",
          "code": "5360696",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5360696",
          "code_system": "PUBCHEM",
          "references": [
            "8e740bb9-3622-433a-afe9-967598e7caef"
          ]
        },
        {
          "uuid": "6251fc98-7756-491c-adb0-5071033741b8",
          "code": "R05DA09",
          "comments": "ATC|RESPIRATORY SYSTEM|COUGH AND COLD PREPARATIONS|COUGH SUPPRESSANTS, EXCL. COMBINATIONS WITH EXPECTORANTS|Opium alkaloids and derivatives|dextromethorphan",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=R05DA09&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "8e740bb9-3622-433a-afe9-967598e7caef"
          ]
        },
        {
          "uuid": "5ebcd5c0-d6a0-4134-9a93-c4c87cb70fd4",
          "code": "QR05DA09",
          "comments": "VATC|COUGH AND COLD PREPARATIONS|COUGH SUPPRESSANTS, EXCL. COMBINATIONS WITH EXPECTORANTS|Opium alkaloids and derivatives|dextromethorphan",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QR05DA09&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "8e740bb9-3622-433a-afe9-967598e7caef"
          ]
        },
        {
          "uuid": "55d417ed-d049-ca61-d7f0-ebbede2da2b0",
          "code": "3056",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3056",
          "code_system": "HSDB",
          "references": [
            "85837fe9-73e0-4a70-a3be-6c8bd9e92f86"
          ]
        },
        {
          "uuid": "51e090c7-565f-5dae-3ec1-5bbd5f26324c",
          "code": "DTXSID3022908",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3022908",
          "code_system": "EPA CompTox",
          "references": [
            "db0f5001-1664-1848-688b-b16f604fb4b7"
          ]
        },
        {
          "uuid": "cbd9f625-8b0b-aad9-11ac-1b3aaebb3d68",
          "code": "Dextromethorphan",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM572/",
          "code_system": "LACTMED",
          "references": [
            "b58a590c-f4bc-c094-67d1-f79d878ad2f9"
          ]
        },
        {
          "uuid": "fc424e08-3454-4eb6-88b2-72635b6fab5b",
          "code": "236146",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/236146/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "e22941e7-57b4-5cec-453b-272abde80c14"
          ]
        },
        {
          "uuid": "ceaadaca-16dd-74fd-1767-34b4215a6359",
          "code": "C2199",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Analgesic Agent[C241]|Adjuvant Analgesic",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2199",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b58a590c-f4bc-c094-67d1-f79d878ad2f9"
          ]
        },
        {
          "uuid": "cba0bd24-3f42-4279-b648-69acf066065f",
          "code": "7355X3ROTS",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b0b20b76-f9bf-2e06-6fb4-8fce647a7b74",
          "code": "842",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/842",
          "code_system": "DRUG CENTRAL",
          "references": [
            "b58a590c-f4bc-c094-67d1-f79d878ad2f9"
          ]
        },
        {
          "uuid": "00b3a925-d893-af33-5f68-60f9cf978653",
          "code": "1180503",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1180503",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "b58a590c-f4bc-c094-67d1-f79d878ad2f9"
          ]
        },
        {
          "uuid": "41636b74-3bd2-3640-4849-fc051495b77a",
          "code": "4470",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:4470",
          "code_system": "CHEBI",
          "references": [
            "b58a590c-f4bc-c094-67d1-f79d878ad2f9"
          ]
        },
        {
          "uuid": "e42b34a1-c9ba-02a5-d6c5-862f1f8a3a04",
          "code": "100000092321",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "aee3cc55-0ec6-d538-2bdb-e71b84297814"
          ]
        },
        {
          "uuid": "cc22ae76-c0a4-692d-3f00-a3c96eaeaf10",
          "code": "7355X3ROTS",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=7355X3ROTS",
          "code_system": "DAILYMED",
          "references": [
            "ff9e1f74-b939-2750-c37b-271ccb50fd1c"
          ]
        },
        {
          "uuid": "28b61822-43a8-cc41-b233-5652fed7fe08",
          "code": "751452",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=751452",
          "code_system": "NSC",
          "references": [
            "aac523bb-5c39-0672-3748-68476513f94d"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "c911e2ba-39d4-4185-abf8-70713554662d",
          "amount": {
            "uuid": "d2307310-1765-45b8-9f91-70b39d25d75b"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "86694ef4-99d0-49f7-810b-bec4a27a6de9",
            "refuuid": "18e34494-7681-4990-aa38-cf7c8d40bce1",
            "name": "Dextromethorphan",
            "unii": "7355X3ROTS",
            "linking_id": "7355X3ROTS",
            "ref_pname": "Dextromethorphan",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "572eaf69-aca2-40de-b604-645fdccb2bf4",
          "amount": {
            "uuid": "42dc6764-4bee-44ed-9353-af4292205e2e"
          },
          "qualification": "PLASMA",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MAJOR",
          "mediator_substance": {
            "uuid": "bf6a896c-0dd9-4358-9321-c2e3b0339dff",
            "refuuid": "4275827d-e329-4907-95b5-7d690692872a",
            "name": "CYTOCHROME P450 3A4",
            "unii": "PUO0521HZV",
            "linking_id": "PUO0521HZV",
            "ref_pname": "CYTOCHROME P450 3A4",
            "substance_class": "reference"
          },
          "references": [
            "2aabeb58-9ac0-4ac0-8873-7239a3e9f3f9"
          ],
          "related_substance": {
            "uuid": "3e979e27-c8b5-4aa2-aafb-577d1ccd6def",
            "refuuid": "3cb1383f-2ba4-4af5-a8ef-c0149135e8a1",
            "name": "ENT-3-METHOXYMORPHINAN",
            "unii": "SH6R750LWZ",
            "linking_id": "SH6R750LWZ",
            "ref_pname": "ENT-3-METHOXYMORPHINAN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a53006e6-4478-421e-9206-ce52682b9061",
          "amount": {
            "uuid": "c919665d-5e73-4ae5-bee2-66d46d02d045"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "1b110e44-6dc1-41ca-a439-a177e49a7b6f"
          ],
          "related_substance": {
            "uuid": "7bea3c0a-d64a-424d-bf12-eaaddfc0d357",
            "refuuid": "3cb1383f-2ba4-4af5-a8ef-c0149135e8a1",
            "name": "ENT-3-METHOXYMORPHINAN",
            "unii": "SH6R750LWZ",
            "linking_id": "SH6R750LWZ",
            "ref_pname": "ENT-3-METHOXYMORPHINAN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "01192ae5-970f-4e6e-b8a3-e9d1ff079399",
          "amount": {
            "uuid": "44e58019-e730-4155-9943-c095ffa90697"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "40ec8c8e-6c4c-4a13-8753-0a309266dd02",
            "refuuid": "8f10bb44-7f1d-46e3-af28-247996fbe0f3",
            "name": "DEXTROMETHORPHAN HYDRIODIDE",
            "unii": "086F8ZEM77",
            "linking_id": "086F8ZEM77",
            "ref_pname": "DEXTROMETHORPHAN HYDRIODIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9693ff19-537b-4e4a-b400-c6ff045e00d4",
          "amount": {
            "uuid": "757e3006-0884-4e62-9e3a-f6a0bd523099"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "87462e8c-5d21-49d4-8477-a60501265433",
            "refuuid": "3bfb00f8-00ad-4dab-b189-67f8a774ae27",
            "name": "DEXTROMETHORPHAN HYDROBROMIDE",
            "unii": "9D2RTI9KYH",
            "linking_id": "9D2RTI9KYH",
            "ref_pname": "DEXTROMETHORPHAN HYDROBROMIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "29a9bedb-3fb9-4047-9d10-1d4d8fcee84d",
          "amount": {
            "uuid": "7486c079-b848-40b0-bda5-e433c31dd406"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "5a8bb092-6896-48ab-877f-99159b1f3a75",
            "refuuid": "1fe8642c-c8e0-4a8e-8c0b-8e4520cdbf32",
            "name": "DEXTROMETHORPHAN HYDROBROMIDE ANHYDROUS",
            "unii": "Z0CG3115FG",
            "linking_id": "Z0CG3115FG",
            "ref_pname": "DEXTROMETHORPHAN HYDROBROMIDE ANHYDROUS",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b138c6df-5993-4470-8641-6a28781852c9",
          "amount": {
            "uuid": "cf016455-3885-4684-88f9-1d74fe8df63c"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "4fa1b835-b431-465f-8b00-6f3edbac9111",
            "refuuid": "d281c512-5367-4503-99da-f3c47e00b001",
            "name": "DEXTROMETHORPHAN HYDROCHLORIDE",
            "unii": "351KFH969D",
            "linking_id": "351KFH969D",
            "ref_pname": "DEXTROMETHORPHAN HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "25227eb0-daeb-471c-aa3a-263955b1e4e2",
          "amount": {
            "uuid": "3328134c-fc95-42a6-8146-bae1ed3de719"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "bb285fb0-dde2-496e-8eb5-c0e6f0b7de4c",
            "refuuid": "70de239f-8a33-4f6c-a26d-95b5aab6273e",
            "name": "DEXTROMETHORPHAN SALICYLATE",
            "unii": "B2F298X1AJ",
            "linking_id": "B2F298X1AJ",
            "ref_pname": "DEXTROMETHORPHAN SALICYLATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "44591a23-c79e-4650-b3dc-a77a55c70c4d",
          "amount": {
            "uuid": "f10917f1-2275-403e-8b78-2a6d05fc58c0"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "b3ca7c9e-8915-4c87-90eb-c5d6a47f108e",
            "refuuid": "60f000f3-e45f-4ff6-99c4-954d5426b005",
            "name": "DEXTROMETHORPHAN TANNATE",
            "unii": "554R584P9K",
            "linking_id": "554R584P9K",
            "ref_pname": "DEXTROMETHORPHAN TANNATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "50b600ea-c0f2-4d4d-a8a6-fd2a610b87a2",
          "amount": {
            "uuid": "733a6a92-75be-4f5f-a223-13dfe88974fa"
          },
          "comments": "SECONDARY METABOLITE CYP3A4 ALSO INVOLED IN PRIMARY",
          "qualification": "PLASMA",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MAJOR",
          "mediator_substance": {
            "uuid": "1107db51-7cba-4fd5-a271-9b9c32c66078",
            "refuuid": "cc92795c-ba54-4e71-a72b-1af36b57df6b",
            "name": "CYTOCHROME P450 2D6",
            "unii": "8E4LAA4357",
            "linking_id": "8E4LAA4357",
            "ref_pname": "CYTOCHROME P450 2D6",
            "substance_class": "reference"
          },
          "references": [
            "2aabeb58-9ac0-4ac0-8873-7239a3e9f3f9"
          ],
          "related_substance": {
            "uuid": "3a75c230-0afe-4258-a72a-1df71b9c1f02",
            "refuuid": "e741fec6-e9a2-485a-a6b0-7c6388621f6f",
            "name": "NORDEXTRORPHAN",
            "unii": "AG3VB17119",
            "linking_id": "AG3VB17119",
            "ref_pname": "NORDEXTRORPHAN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3968a5fb-a91e-4083-8dc6-7bc099a8b55e",
          "amount": {
            "uuid": "0b0cb45e-a9e0-407a-a7ce-e3604c06df95"
          },
          "comments": "Metabolizing reaction by CYP2D6: O-demethylation\nPharmacological action: Antitusive agent",
          "qualification": "Unidentified",
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "interaction_type": "MAJOR",
          "references": [
            "44e470e8-c8d6-4ad2-8040-22e8885102ac"
          ],
          "related_substance": {
            "uuid": "53235701-e69b-4a91-8add-3122026b7a6b",
            "refuuid": "cc92795c-ba54-4e71-a72b-1af36b57df6b",
            "name": "CYTOCHROME P450 2D6",
            "unii": "8E4LAA4357",
            "linking_id": "8E4LAA4357",
            "ref_pname": "CYTOCHROME P450 2D6",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3c5491b0-7c8b-44c9-9fa8-d0f549bb5594",
          "amount": {
            "uuid": "c4508352-25f5-4a66-9618-24a6272c66df"
          },
          "type": "METABOLITE ACTIVE->PARENT",
          "mediator_substance": {
            "uuid": "f03ad2cb-95db-492c-a3af-b734b92ea1da",
            "refuuid": "cc92795c-ba54-4e71-a72b-1af36b57df6b",
            "name": "CYTOCHROME P450 2D6",
            "unii": "8E4LAA4357",
            "linking_id": "8E4LAA4357",
            "ref_pname": "CYTOCHROME P450 2D6",
            "substance_class": "reference"
          },
          "references": [
            "ab7d41bd-7671-4bf3-9306-11cdf990c592"
          ],
          "related_substance": {
            "uuid": "0fe4cceb-304e-4bae-84b1-6d563bb10bb8",
            "refuuid": "51a85df4-9166-48b8-8c72-78d69cc474ae",
            "name": "DEXTRORPHAN",
            "unii": "04B7QNO9WS",
            "linking_id": "04B7QNO9WS",
            "ref_pname": "DEXTRORPHAN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0bbe0ea3-1d18-4cf7-b878-455b46f8382d",
          "amount": {
            "uuid": "ad2bb1da-bd74-4249-96cd-ead45deab232"
          },
          "type": "SUB_CONCEPT->SUBSTANCE",
          "references": [
            "dcaceb7e-02be-4f17-8263-a664afafddb7"
          ],
          "related_substance": {
            "uuid": "9de22420-f856-4cd0-bfec-0d744124d632",
            "refuuid": "34cbd8ea-57a3-4244-b335-b19872e698af",
            "name": "DEXTROMETHORPHAN POLISTIREX",
            "linking_id": "34cbd8ea-57a3-4244-b335-b19872e698af",
            "ref_pname": "DEXTROMETHORPHAN POLISTIREX",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d1e14392-24b7-4f9d-85b7-5de9266a1353",
          "amount": {
            "uuid": "2f715eb0-5f76-40e5-a4b1-4c3aba88019a"
          },
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "related_substance": {
            "uuid": "f7ca8598-42bf-4b69-86f2-06152bb7a136",
            "refuuid": "1b41bc94-8610-42e2-b998-11fc453053d8",
            "name": "CYTOCHROME P450 2D15 (CANINE)",
            "unii": "2XX4SF4LD9",
            "linking_id": "2XX4SF4LD9",
            "ref_pname": "CYTOCHROME P450 2D15 (CANINE)"
          }
        },
        {
          "uuid": "e18306e1-a63a-4878-82fa-3b9c9f8961a5",
          "amount": {
            "uuid": "c5449ec3-eb3d-45d9-862f-ef8f83865276"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "f42cec7b-e2b8-42ff-bdd6-0f22843388b0"
          ],
          "related_substance": {
            "uuid": "5c2d7eac-f793-4e37-a8f3-342091c8d471",
            "refuuid": "2ded3533-ff18-4359-aa10-0e63a21a43ed",
            "name": "3-METHOXYMORPHINAN",
            "unii": "497WV2EY4T",
            "linking_id": "497WV2EY4T",
            "ref_pname": "3-METHOXYMORPHINAN"
          }
        },
        {
          "uuid": "78f58fbf-5983-4ccf-82e9-3713eb53f6b9",
          "amount": {
            "uuid": "3396ee1c-7152-414a-9523-7c946032cb70",
            "high": 8945,
            "low": 2120,
            "units": "NANOMOLAR"
          },
          "comments": "Rat. Prodrug of dextrorphan, which is the actual mediator of most of its dissociative effects through acting as a more potent NMDA receptor antagonist than dextromethorphan itself.",
          "qualification": "Ki",
          "type": "TARGET->WEAK INHIBITOR",
          "related_substance": {
            "uuid": "f66c4758-af6b-471a-a7a0-24d8afb6bf30",
            "refuuid": "562fff79-34fb-400d-9fc2-ec5e206f85b6",
            "name": "NMDA RECEPTOR",
            "unii": "4R3XO922WS",
            "linking_id": "4R3XO922WS",
            "ref_pname": "NMDA RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8ba18cb6-e511-4651-9dc1-72cb7e70445a",
          "amount": {
            "uuid": "fa8ade91-4d13-4088-aa57-9977e6f91b6e",
            "high": 652,
            "low": 142,
            "units": "NANOMOLAR"
          },
          "qualification": "Ki",
          "type": "TARGET->AGONIST",
          "related_substance": {
            "uuid": "15f94c6f-734f-481e-b13a-1220ebadedb7",
            "refuuid": "3a053309-c4c6-4e71-81a6-2057ebef0f44",
            "name": "SIGMA NON-OPIOID INTRACELLULAR RECEPTOR 1",
            "unii": "X6OG5T1C4M",
            "linking_id": "X6OG5T1C4M",
            "ref_pname": "SIGMA NON-OPIOID INTRACELLULAR RECEPTOR 1",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d54ff5f7-9bbc-4fe2-937c-f93ad7462658",
          "amount": {
            "uuid": "c2767c12-be8b-4a8f-868a-d9c4fa9eac11",
            "high": 40,
            "low": 23,
            "units": "NANOMOLAR"
          },
          "comments": "Rat",
          "qualification": "Ki",
          "type": "TARGET->INHIBITOR",
          "references": [
            "bc5f68b7-5e2d-4949-9847-31822257a4eb"
          ],
          "related_substance": {
            "uuid": "12b9bfee-0c47-4d89-80bb-f37c7c4f485a",
            "refuuid": "06df8044-d6c0-4403-85ab-26c75e41e405",
            "name": "SODIUM-DEPENDENT SEROTONIN TRANSPORTER",
            "unii": "CJZ26L1EGI",
            "linking_id": "CJZ26L1EGI",
            "ref_pname": "SODIUM-DEPENDENT SEROTONIN TRANSPORTER",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9c398b18-c1c1-469b-b082-295130c965ad",
          "name": "(+)-DEXTROMETHORPHAN",
          "stdName": "(+)-DEXTROMETHORPHAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "26a54bbc-8647-4e95-bb75-12bc94c2f6d1"
          ],
          "display_name": false
        },
        {
          "uuid": "e565af2c-2d61-4f15-93d4-c934d34c0b4b",
          "name": "3-Methoxy-17-methyl-9α,13α,14α-morphinan",
          "stdName": "3-METHOXY-17-METHYL-9.ALPHA.,13.ALPHA.,14.ALPHA.-MORPHINAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58437718-6e81-4b55-97be-9f4f3241161b"
          ],
          "display_name": false
        },
        {
          "uuid": "0fa3371e-5eb7-4128-b006-c9c688c2140d",
          "name": "BA 2666",
          "stdName": "BA 2666",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "26a54bbc-8647-4e95-bb75-12bc94c2f6d1"
          ],
          "display_name": false
        },
        {
          "uuid": "04c52b2d-3b58-4cf9-bcd7-a771a951ab35",
          "name": "BA-2666",
          "stdName": "BA-2666",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f62f70c9-f02a-41ec-85f9-156868ba7c16"
          ],
          "display_name": false
        },
        {
          "uuid": "8e28c0e4-fa22-49b2-a41f-a55d06ff595c",
          "name": "D-METHORPHAN",
          "stdName": "D-METHORPHAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "26a54bbc-8647-4e95-bb75-12bc94c2f6d1"
          ],
          "display_name": false
        },
        {
          "uuid": "44d54938-4fce-43b3-b87d-9cff46a660d6",
          "name": "DEX",
          "stdName": "DEX",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "26a54bbc-8647-4e95-bb75-12bc94c2f6d1"
          ],
          "display_name": false
        },
        {
          "uuid": "f18057bb-95e9-4587-bf21-a1cf9cb309f7",
          "name": "DEXTROMETHORPHAN [HSDB]",
          "stdName": "DEXTROMETHORPHAN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "faadd2aa-6de3-4a42-b522-751f907efa59"
          ],
          "display_name": false
        },
        {
          "uuid": "cd3d44a1-eb07-45d4-87e3-4f2c3f325bd9",
          "name": "DEXTROMETHORPHAN [MART.]",
          "stdName": "DEXTROMETHORPHAN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e4a6f605-04d3-404d-8571-a08b27f9a790"
          ],
          "display_name": false
        },
        {
          "uuid": "7c781b2d-70de-4eef-8e2a-230805cf1770",
          "name": "DEXTROMETHORPHAN [MI]",
          "stdName": "DEXTROMETHORPHAN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a639f786-8b17-4e14-92ce-d3e6b91f5116"
          ],
          "display_name": false
        },
        {
          "uuid": "c9dc3a0b-0c9f-8269-ad8b-cb1c6b33947d",
          "name": "DEXTROMETHORPHAN [USP MONOGRAPH]",
          "stdName": "DEXTROMETHORPHAN [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30fbd1be-1936-4402-c05a-ad05b8af9d11"
          ],
          "display_name": false
        },
        {
          "uuid": "f567b51f-4eb1-482b-bba0-3b54600f631b",
          "name": "DEXTROMETHORPHAN [USP-RS]",
          "stdName": "DEXTROMETHORPHAN [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "85734885-66b0-4a5b-9eb5-49ecba033bfa"
          ],
          "display_name": false
        },
        {
          "uuid": "532439f8-22af-472a-b51a-c398c57aa120",
          "name": "DEXTROMETHORPHAN [VANDF]",
          "stdName": "DEXTROMETHORPHAN [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e125e34c-f7ea-43d8-85eb-0f021da24bc5"
          ],
          "display_name": false
        },
        {
          "uuid": "a3d2e0d4-b424-42c9-8c87-4bb4425fc4a3",
          "name": "DXM",
          "stdName": "DXM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc5f68b7-5e2d-4949-9847-31822257a4eb"
          ],
          "display_name": false
        },
        {
          "uuid": "0062fa8f-570f-444d-9f44-78b70594a548",
          "name": "Dextromethorphan",
          "stdName": "DEXTROMETHORPHAN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c82650cb-930c-4f02-af3a-1305deba27b3",
            "d97470e5-1831-47b8-9795-fe4f1d738777",
            "0a1b7528-8b5d-4830-9db2-d82edd4c02ca",
            "33c89284-e681-436f-99cb-c8389d513080",
            "6bd43cfe-727b-4860-bd6a-236fdc588fd1",
            "e1ebb73e-9ef9-4b49-a29b-7504ee71c3cf",
            "926a78d9-4be1-4bfb-92ca-b1e00c16ea6a",
            "85734885-66b0-4a5b-9eb5-49ecba033bfa",
            "4ad19c8b-787f-47b0-82bb-3addc183472e",
            "faadd2aa-6de3-4a42-b522-751f907efa59",
            "e125e34c-f7ea-43d8-85eb-0f021da24bc5",
            "a639f786-8b17-4e14-92ce-d3e6b91f5116",
            "1231235f-6d6b-4c2f-a7a6-01b9d075ce19",
            "dcaceb7e-02be-4f17-8263-a664afafddb7",
            "3af5d7d4-6987-4fac-a4ad-d2509a75a008",
            "043b158d-2b83-4442-af38-f7b17007d3de",
            "e4a6f605-04d3-404d-8571-a08b27f9a790"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "e5877f75-2815-40ec-a3f9-087242adcd12",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "55b4bbd3-4bd2-3309-35b4-ee1d7b7a5c65",
          "name": "Dextromethorphan [WHO-DD]",
          "stdName": "DEXTROMETHORPHAN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "450ad1f0-77ae-5ce7-b52f-aca956fad006"
          ],
          "display_name": false
        },
        {
          "uuid": "dfdc85b6-228d-4d14-96b2-5becc578d0f5",
          "name": "MORPHINAN, 3-METHOXY-17-METHYL-, (9.ALPHA.,13.ALPHA.,14.ALPHA.)-",
          "stdName": "MORPHINAN, 3-METHOXY-17-METHYL-, (9.ALPHA.,13.ALPHA.,14.ALPHA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58437718-6e81-4b55-97be-9f4f3241161b"
          ],
          "display_name": false
        },
        {
          "uuid": "56150ab0-70b3-4f09-ae6d-8644e656de5a",
          "name": "NODEX",
          "stdName": "NODEX",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "26a54bbc-8647-4e95-bb75-12bc94c2f6d1"
          ],
          "display_name": false
        },
        {
          "uuid": "479be275-9a0e-d6d5-c8cc-5def7db8ff45",
          "name": "NSC-751452",
          "stdName": "NSC-751452",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aac523bb-5c39-0672-3748-68476513f94d"
          ],
          "display_name": false
        },
        {
          "uuid": "f52b9e28-bc80-44f3-884d-5c82390c275f",
          "name": "dextromethorphan [INN]",
          "stdName": "DEXTROMETHORPHAN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3af5d7d4-6987-4fac-a4ad-d2509a75a008"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "dcaceb7e-02be-4f17-8263-a664afafddb7",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "58437718-6e81-4b55-97be-9f4f3241161b",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3af5d7d4-6987-4fac-a4ad-d2509a75a008",
          "citation": "INN Proposed List 1",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL01.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e1ebb73e-9ef9-4b49-a29b-7504ee71c3cf",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4a6f605-04d3-404d-8571-a08b27f9a790",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "faadd2aa-6de3-4a42-b522-751f907efa59",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85734885-66b0-4a5b-9eb5-49ecba033bfa",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33c89284-e681-436f-99cb-c8389d513080",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e125e34c-f7ea-43d8-85eb-0f021da24bc5",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a639f786-8b17-4e14-92ce-d3e6b91f5116",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "26a54bbc-8647-4e95-bb75-12bc94c2f6d1",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f62f70c9-f02a-41ec-85f9-156868ba7c16",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e740bb9-3622-433a-afe9-967598e7caef",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389675000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2aabeb58-9ac0-4ac0-8873-7239a3e9f3f9",
          "citation": "DOI: 10.1124/PR.111.005116 \\\\nPHARMACOLOGICAL REVIEWS APRIL 2014 VOL. 66 NO. 2 468-512",
          "url": "http://pharmrev.aspetjournals.org/content/66/2/468.full.pdf+html",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b110e44-6dc1-41ca-a439-a177e49a7b6f",
          "citation": "XENOBIOTICA, VOLUME 16, ISSUE 5, PAGES 421-33, JOURNAL 1986",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "44e470e8-c8d6-4ad2-8040-22e8885102ac",
          "citation": "HANDBOOK OF DRUG METABOLISM; EDS PAUL PEARSON AND LARRY WIENKERS; INFORMA HEALTHCARE USA, INC.; ISBN-10 1-4200-7647-7; 2009",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab7d41bd-7671-4bf3-9306-11cdf990c592",
          "citation": "J CLIN PSYCHOPHARMACOL. 1998 AUG;18(4):332-7.",
          "url": "https://www.ncbi.nlm.nih.gov/pubmed/9690700",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "17d5effd-f586-4943-a9a1-a6cd0f8c2515",
          "citation": "SRS import [7355X3ROTS]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7355X3ROTS",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389675000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a1b7528-8b5d-4830-9db2-d82edd4c02ca",
          "citation": "DEXTROMETHORPHAN [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c82650cb-930c-4f02-af3a-1305deba27b3",
          "citation": "DEXTROMETHORPHAN [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "926a78d9-4be1-4bfb-92ca-b1e00c16ea6a",
          "citation": "DEXTROMETHORPHAN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "043b158d-2b83-4442-af38-f7b17007d3de",
          "citation": "DEXTROMETHORPHAN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4ad19c8b-787f-47b0-82bb-3addc183472e",
          "citation": "DEXTROMETHORPHAN [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6bd43cfe-727b-4860-bd6a-236fdc588fd1",
          "citation": "DEXTROMETHORPHAN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d97470e5-1831-47b8-9795-fe4f1d738777",
          "citation": "DEXTROMETHORPHAN [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1231235f-6d6b-4c2f-a7a6-01b9d075ce19",
          "citation": "DEXTROMETHORPHAN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "85837fe9-73e0-4a70-a3be-6c8bd9e92f86",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+125-71-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "db0f5001-1664-1848-688b-b16f604fb4b7",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=125-71-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e22941e7-57b4-5cec-453b-272abde80c14",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d10a881f-ed21-0e08-6d26-afd110325eb0",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+125-71-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b58a590c-f4bc-c094-67d1-f79d878ad2f9",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ae35c267-e517-4cae-a6c6-bbb099934d2c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f42cec7b-e2b8-42ff-bdd6-0f22843388b0",
          "citation": "J Pharm Sci 1980;69(12):1447",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "30fbd1be-1936-4402-c05a-ad05b8af9d11",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "aac523bb-5c39-0672-3748-68476513f94d",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "ff9e1f74-b939-2750-c37b-271ccb50fd1c",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "450ad1f0-77ae-5ce7-b52f-aca956fad006",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "bc5f68b7-5e2d-4949-9847-31822257a4eb",
          "citation": "https://en.wikipedia.org/wiki/Dextromethorphan",
          "url": "https://en.wikipedia.org/wiki/Dextromethorphan",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "aee3cc55-0ec6-d538-2bdb-e71b84297814",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ae9733ba-9096-4001-8e87-d08ae6e28c89",
          "id": "ae9733ba-9096-4001-8e87-d08ae6e28c89",
          "molfile": "\n  Marvin  01132109042D          \n\n 20 23  0  0  1  0            999 V2000\n    5.8890   -2.1348    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.0483   -2.1348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6403   -2.8765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8202   -2.8765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4040   -3.5771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8202   -4.2942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2762   -4.8258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5715   -4.8258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6403   -4.2942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0483   -3.5771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8890   -3.5771    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.3052   -4.2942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1253   -4.2942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5415   -3.5936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1459   -2.8765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3052   -2.8765    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.4068   -2.8395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4068   -1.4877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2846   -1.4919    0.0000 N   0  0  1  0  0  0  0  0  0  0  0  0\n    6.2681   -0.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 16  1  0  0  0  0\n  1 19  1  6  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3 10  2  0  0  0  0\n  5  4  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6  9  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  6  0  0  0\n 16 11  1  0  0  0  0\n 11 17  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  1  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\nM  END",
          "smiles": "CN1CC[C@]23CCCC[C@@H]3[C@@H]1Cc4ccc(cc42)OC",
          "formula": "C18H25NO",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "03d0bdf5-9dc5-4916-815d-c48dbbef401a"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "271.3979",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "18e34494-7681-4990-aa38-cf7c8d40bce1",
      "version": "42",
      "structure": {
        "id": "99d0f97e-940c-4049-9fdb-358a9ab52a2e",
        "molfile": "\n  Marvin  01132107592D          \n\n 21 24  0  0  1  0            999 V2000\n    5.8890   -3.5771    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.0483   -3.5771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8890   -2.1348    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.3052   -2.8765    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.2846   -1.4919    0.0000 N   0  0  1  0  0  0  0  0  0  0  0  0\n    4.6403   -2.8765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0483   -2.1348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4068   -2.8395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4068   -1.4877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6403   -4.2942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8202   -2.8765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8202   -4.2942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3052   -4.2942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4040   -3.5771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2681   -0.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1459   -2.8765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2762   -4.8258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5715   -4.8258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1253   -4.2942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5415   -3.5936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7050   -2.1719    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  9  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  3  1  0  0  0  0\n  1  8  1  6  0  0  0\n  9  8  1  0  0  0  0\n 10  2  2  0  0  0  0\n 11  6  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13  1  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15  5  1  0  0  0  0\n 16  4  1  0  0  0  0\n 17 12  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 13  1  0  0  0  0\n 20 16  1  0  0  0  0\n  4 21  1  6  0  0  0\n  3  5  1  6  0  0  0\n 20 19  1  0  0  0  0\n  7  6  1  0  0  0  0\n 14 12  2  0  0  0  0\nM  END",
        "smiles": "CN1CC[C@]23CCCC[C@]3([H])[C@@H]1Cc4ccc(cc42)OC",
        "formula": "C18H25NO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "271.3979",
        "optical_activity": "( + )",
        "references": [
          "17d5effd-f586-4943-a9a1-a6cd0f8c2515",
          "dcaceb7e-02be-4f17-8263-a664afafddb7",
          "3af5d7d4-6987-4fac-a4ad-d2509a75a008"
        ],
        "stereo_centers": 3
      },
      "unii": "7355X3ROTS"
    }
  ]
}