{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4c923eaf-f5e1-4062-b6c2-d1638af61acb",
          "code": "10101-66-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=10101-66-3",
          "code_system": "CAS",
          "references": [
            "a01c49de-a5ff-4a3f-85aa-ad5207fba368",
            "e4dbe492-d283-475c-94ea-fc39334747bc"
          ]
        },
        {
          "uuid": "eff0b49b-4e01-4502-81ff-0e3a711354df",
          "code": "21 CFR 178.3297",
          "comments": "PART 178 -- INDIRECT FOOD ADDITIVES: ADJUVANTS, PRODUCTION AIDS, AND SANITIZERS|Subpart D--Certain Adjuvants and Production Aids|Sec. 178.3297 Colorants for polymers.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/cfrsearch.cfm?fr=178.3297",
          "code_system": "CFR",
          "references": [
            "a01c49de-a5ff-4a3f-85aa-ad5207fba368"
          ]
        },
        {
          "uuid": "4ab4e27b-f585-4db1-9486-9015cf6e7be3",
          "code": "21 CFR 176.170",
          "comments": "PART 176 -- INDIRECT FOOD ADDITIVES: PAPER AND PAPERBOARD COMPONENTS|Subpart B--Substances for Use Only as Components of Paper and Paperboard|Sec. 176.170 Components of paper and paperboard in contact with aqueous and fatty foods.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/cfrsearch.cfm?fr=176.170",
          "code_system": "CFR",
          "references": [
            "a01c49de-a5ff-4a3f-85aa-ad5207fba368"
          ]
        },
        {
          "uuid": "8f51394d-b415-410a-957a-2b4fc4ad1de5",
          "code": "1313243",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1313243/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "a01c49de-a5ff-4a3f-85aa-ad5207fba368"
          ]
        },
        {
          "uuid": "b4c27b08-71ea-4750-997c-d3125c407966",
          "code": "233-257-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.030.221",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a01c49de-a5ff-4a3f-85aa-ad5207fba368"
          ]
        },
        {
          "uuid": "0ff2d99d-aa65-4ab8-a57f-c24be2a4542c",
          "code": "160915",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/160915",
          "code_system": "PUBCHEM",
          "references": [
            "a01c49de-a5ff-4a3f-85aa-ad5207fba368"
          ]
        },
        {
          "uuid": "60c2f917-d338-44fc-40c8-586caddff632",
          "code": "Manganese violet",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Manganese_violet",
          "code_system": "WIKIPEDIA",
          "references": [
            "ae64f535-5b79-8b82-600e-88b8388be54a"
          ]
        },
        {
          "uuid": "ffb5d672-8d5d-4de8-8dcb-275975335beb",
          "code": "72M48QQV8Q",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b55c437a-c4d8-805e-f191-2570ee07bc77",
          "code": "DTXSID70889526",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70889526",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "e127b019-09a4-10dc-1c70-039286ac7217",
          "code": "72M48QQV8Q",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=72M48QQV8Q",
          "code_system": "DAILYMED",
          "references": [
            "8a35cf8c-7a6a-dbe3-532b-250e3c66ba7a"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "139e1627-2084-44ec-88c9-260e7aadbd69",
          "amount": {
            "uuid": "e527e254-3e33-4380-a324-3e09dc279a94"
          },
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "8100bcf7-ce2f-4ad3-8adb-fdb1bf1aa21b",
            "refuuid": "029170db-4e11-45b3-bc18-f9a60e80427a",
            "name": "PYROPHOSPHORIC ACID",
            "unii": "4E862E7GRQ",
            "linking_id": "4E862E7GRQ",
            "ref_pname": "PYROPHOSPHORIC ACID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "939a4144-1435-45e1-a6a6-e0a0bcc9e1e8",
          "name": "C.I. 77742",
          "stdName": "C.I. 77742",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e526a3e-d243-4534-b384-182153e1d05e",
            "323029ed-eb4a-435a-b5d6-3cf3ebe015f4"
          ],
          "display_name": false
        },
        {
          "uuid": "b837c1e6-208d-4d78-ac68-13378e4b8b5f",
          "name": "C.I. PIGMENT VIOLET 16",
          "stdName": "C.I. PIGMENT VIOLET 16",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e526a3e-d243-4534-b384-182153e1d05e",
            "323029ed-eb4a-435a-b5d6-3cf3ebe015f4"
          ],
          "display_name": false
        },
        {
          "uuid": "f6eaa365-53ac-4514-a3ff-73f54de02f89",
          "name": "CI 77742",
          "stdName": "CI 77742",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "323029ed-eb4a-435a-b5d6-3cf3ebe015f4"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "781ae2da-b1fe-4889-a840-83a301b972d0",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "f92b3443-4aca-4b3e-a462-a573980e5c60",
          "name": "MANGO VIOLET",
          "stdName": "MANGO VIOLET",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e526a3e-d243-4534-b384-182153e1d05e",
            "323029ed-eb4a-435a-b5d6-3cf3ebe015f4"
          ],
          "display_name": false
        },
        {
          "uuid": "c9914a92-a7dc-45d6-a7e0-bb198f17f21d",
          "name": "MINERAL VIOLET",
          "stdName": "MINERAL VIOLET",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e526a3e-d243-4534-b384-182153e1d05e",
            "323029ed-eb4a-435a-b5d6-3cf3ebe015f4"
          ],
          "display_name": false
        },
        {
          "uuid": "2c41fe03-3b7a-406a-925a-5dc674f922b3",
          "name": "Manganese Violet",
          "stdName": "MANGANESE VIOLET",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "323029ed-eb4a-435a-b5d6-3cf3ebe015f4",
            "ccaa357f-4026-4f25-9349-ae9dca296ff8",
            "33f37ccc-2683-4822-a927-9b3e48cd472d",
            "d53e5c3c-063e-491d-b838-9aa8447c7d00"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "58962829-e193-4c41-8a3e-647d28349573",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "22328968-c7ee-443e-8ca6-fa4428843adf",
          "name": "NUREMBERG VIOLET",
          "stdName": "NUREMBERG VIOLET",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e526a3e-d243-4534-b384-182153e1d05e",
            "323029ed-eb4a-435a-b5d6-3cf3ebe015f4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ccaa357f-4026-4f25-9349-ae9dca296ff8",
          "citation": "21CFR73.2775",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fb52e20b-fba2-47ce-9f19-b74de5dcf3bf",
          "citation": "ACD 9.0(21CFR)",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33f37ccc-2683-4822-a927-9b3e48cd472d",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "323029ed-eb4a-435a-b5d6-3cf3ebe015f4",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5e526a3e-d243-4534-b384-182153e1d05e",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a01c49de-a5ff-4a3f-85aa-ad5207fba368",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390731000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bac07bd0-8736-44ce-90e5-a6372b025fad",
          "citation": "SRS import [72M48QQV8Q]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=72M48QQV8Q",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390731000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d53e5c3c-063e-491d-b838-9aa8447c7d00",
          "citation": "MANGANESE VIOLET [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ae64f535-5b79-8b82-600e-88b8388be54a",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Nitrogen_dioxide",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e4dbe492-d283-475c-94ea-fc39334747bc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8a35cf8c-7a6a-dbe3-532b-250e3c66ba7a",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "22e2a68f-bd32-4f09-9983-12c6201b23f4",
          "id": "22e2a68f-bd32-4f09-9983-12c6201b23f4",
          "molfile": "\n  Marvin  01132101572D          \n\n  1  0  0  0  0  0            999 V2000\n   -0.3975   -1.0052    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "N",
          "formula": "H3N",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7cfa7b78-4531-4fd2-8006-4f056627f463"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "17.0305",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "561b0c03-65fc-4499-9e23-e0c0ebea8af2",
          "id": "561b0c03-65fc-4499-9e23-e0c0ebea8af2",
          "molfile": "\n  Marvin  01132104292D          \n\n  1  0  0  0  0  0            999 V2000\n   -1.5985   -1.0052    0.0000 Mn  0  1  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   3\nM  END",
          "smiles": "[Mn+3]",
          "formula": "Mn",
          "atropisomerism": "No",
          "charge": 3,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e69b673e-f833-4e34-b1ef-c565543a95ae"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "54.938",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "f7cc5b8e-6f72-4d73-8be6-51763fb58156",
          "id": "f7cc5b8e-6f72-4d73-8be6-51763fb58156",
          "molfile": "\n  Marvin  01132112512D          \n\n  9  8  0  0  0  0            999 V2000\n    3.4279   -0.4501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0188   -1.1660    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7347   -1.5751    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.6038   -0.4529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3057   -1.5810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5898   -1.1718    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8767   -1.5868    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.1748   -0.4588    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.9959   -0.4529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6  8  1  0  0  0  0\n  6  9  2  0  0  0  0\nM  CHG  3   3  -1   7  -1   8  -1\nM  END",
          "smiles": "OP(=O)([O-])OP(=O)([O-])[O-]",
          "formula": "HO7P2",
          "atropisomerism": "No",
          "charge": -3,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ce2b7cb0-5120-4e9e-9b91-f1dd93b5a603"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "174.9513",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5b9b1890-93be-48c4-83fc-e1df878a8ee8",
      "version": "9",
      "structure": {
        "id": "37e1a948-4c17-473e-afee-8ae134c5808f",
        "molfile": "\n  Marvin  01132102582D          \n\n 11  8  0  0  0  0            999 V2000\n    0.8767   -1.5868    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.5898   -1.1718    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3057   -1.5810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0188   -1.1660    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7347   -1.5751    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.1748   -0.4588    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.9959   -0.4529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6038   -0.4529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4279   -0.4501    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -1.5985   -1.0052    0.0000 Mn  0  1  0  0  0  0  0  0  0  0  0  0\n   -0.3975   -1.0052    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n  4  5  1  0  0  0  0\n  1  2  1  0  0  0  0\n  2  6  1  0  0  0  0\n  2  7  2  0  0  0  0\n  2  3  1  0  0  0  0\n  4  8  2  0  0  0  0\n  4  9  1  0  0  0  0\n  3  4  1  0  0  0  0\nM  CHG  6   1  -1   5  -1   6  -1   9  -1  10   3  11   1\nM  END",
        "smiles": "[Mn+3].[NH4+].O=P([O-])([O-])OP(=O)([O-])[O-]",
        "formula": "Mn.O7P2.H4N",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "246.9199",
        "optical_activity": "NONE",
        "references": [
          "ccaa357f-4026-4f25-9349-ae9dca296ff8",
          "bac07bd0-8736-44ce-90e5-a6372b025fad"
        ],
        "stereo_centers": 0
      },
      "unii": "72M48QQV8Q"
    }
  ]
}