{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "441f1c10-f865-45b8-883d-7d7d0306c597",
          "code": "C75155",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C75155",
          "code_system": "NCI_THESAURUS",
          "references": [
            "82181909-43e4-420f-809b-142920272d4f"
          ]
        },
        {
          "uuid": "749e9768-9dd6-44d4-95f1-a1f830f082fa",
          "code": "208-248-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.500",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "82181909-43e4-420f-809b-142920272d4f"
          ]
        },
        {
          "uuid": "4cada691-6dc9-4c14-92f3-9f6139f7c8b2",
          "code": "m1097",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1097?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "82181909-43e4-420f-809b-142920272d4f"
          ]
        },
        {
          "uuid": "3982152f-ac99-479f-9a30-691db77faf96",
          "code": "CHEMBL2104144",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2104144",
          "code_system": "ChEMBL",
          "references": [
            "82181909-43e4-420f-809b-142920272d4f"
          ]
        },
        {
          "uuid": "70a5ba10-f784-4cef-8e16-d125324ab99e",
          "code": "10606",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10606",
          "code_system": "PUBCHEM",
          "references": [
            "82181909-43e4-420f-809b-142920272d4f"
          ]
        },
        {
          "uuid": "5ff5e013-9515-46a6-886e-bf9824f7c6cb",
          "code": "518-20-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=518-20-7",
          "code_system": "CAS",
          "references": [
            "82181909-43e4-420f-809b-142920272d4f",
            "43d1c59b-ce82-426a-a13a-e3d411698537"
          ]
        },
        {
          "uuid": "5444699a-fd04-ca0a-13ea-1ae398a894d4",
          "code": "C263",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Blood or Body Fluid[C78275]|Anticoagulant Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C263",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b5fbb40e-10bf-8604-18b7-7df65ea7563a"
          ]
        },
        {
          "uuid": "3d67af38-d901-66c5-dbd6-f54b98112b3e",
          "code": "3121",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3121",
          "code_system": "DRUG CENTRAL",
          "references": [
            "b5fbb40e-10bf-8604-18b7-7df65ea7563a"
          ]
        },
        {
          "uuid": "5e51c104-60c1-4c21-80e7-4e6f9ef4d65b",
          "code": "725P8AW50M",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4aef8d7a-493b-dd57-d2bf-999d3e91bbba",
          "code": "DTXSID60862101",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60862101",
          "code_system": "EPA CompTox",
          "references": [
            "b5fbb40e-10bf-8604-18b7-7df65ea7563a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3d919c05-752c-4ed7-9626-7a19100cdf37",
          "name": "CUMOPYRAN",
          "stdName": "CUMOPYRAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67a1f7c7-159f-4897-91ca-09d19a23d85e"
          ],
          "display_name": false
        },
        {
          "uuid": "af178daa-37e3-49d1-a2a0-47e61444cd36",
          "name": "CYCLOCOUMAROL",
          "stdName": "CYCLOCOUMAROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0cb68082-32d6-4b21-a375-8e3012d8f72d"
          ],
          "display_name": false
        },
        {
          "uuid": "dd686c1d-0d8e-4e78-b492-deccc0fcd03d",
          "name": "CYCLOCUMAROL",
          "stdName": "CYCLOCUMAROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67a1f7c7-159f-4897-91ca-09d19a23d85e",
            "cf45a8ac-3071-4340-bbd3-204689a63b9a",
            "8ef3d45f-aff8-442b-b23c-82fb35cc7723",
            "c5827f0b-fcd6-49fb-95c3-f8d261cc6263"
          ],
          "display_name": true
        },
        {
          "uuid": "a0775859-04b7-4406-9139-77fb63d1418a",
          "name": "CYCLOCUMAROL [MI]",
          "stdName": "CYCLOCUMAROL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cf45a8ac-3071-4340-bbd3-204689a63b9a",
            "c5827f0b-fcd6-49fb-95c3-f8d261cc6263"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0cb68082-32d6-4b21-a375-8e3012d8f72d",
          "citation": "USP Dictionary 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "67a1f7c7-159f-4897-91ca-09d19a23d85e",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca940855-4144-4a5e-93e3-eb2d35645022",
          "citation": "STN 2007",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf45a8ac-3071-4340-bbd3-204689a63b9a",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c5827f0b-fcd6-49fb-95c3-f8d261cc6263",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "82181909-43e4-420f-809b-142920272d4f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390553000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fed2b223-c002-4548-b6f9-8b5a1b3c41c5",
          "citation": "SRS import [725P8AW50M]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=725P8AW50M",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390553000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ef3d45f-aff8-442b-b23c-82fb35cc7723",
          "citation": "CYCLOCUMAROL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b5fbb40e-10bf-8604-18b7-7df65ea7563a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "43d1c59b-ce82-426a-a13a-e3d411698537",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8d69b7ee-8ad7-487b-bd15-74c67d67cf5d",
          "id": "8d69b7ee-8ad7-487b-bd15-74c67d67cf5d",
          "molfile": "\n  Marvin  01132107202D          \n\n 24 27  0  0  0  0            999 V2000\n    3.2997   -0.0463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0169   -0.8127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5415   -1.4506    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.0662   -0.8127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2488   -1.8595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2488   -2.6748    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.9663   -3.0837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9663   -3.9093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6711   -4.3208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3886   -3.9093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3886   -3.0837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6711   -2.6748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5415   -3.0837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8394   -2.6748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8394   -1.8595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1218   -3.0837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4120   -2.6748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6969   -3.0837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6969   -3.9093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4120   -4.3208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1218   -3.9093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8394   -4.3208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5415   -3.9093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2488   -4.3208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n 15  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 13  1  0  0  0  0\n  8  7  1  0  0  0  0\n 12  7  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 23 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17 16  1  0  0  0  0\n 16 21  2  0  0  0  0\n 18 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 24 23  2  0  0  0  0\nM  END",
          "smiles": "CC1(CC(c2ccccc2)c3c(c4ccccc4oc3=O)O1)OC",
          "formula": "C20H18O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d3bf42ad-37aa-479c-bf46-897af9bf8a22"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "322.3553",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e2351a15-a27a-44c1-bcc6-58b868f29512",
      "version": "5",
      "structure": {
        "id": "062cb50e-3e97-41da-bf6f-9bf7efa39cee",
        "molfile": "\n  Marvin  01132100362D          \n\n 24 27  0  0  0  0            999 V2000\n    3.5415   -3.0837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8394   -2.6748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5415   -3.9093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2488   -2.6748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8394   -4.3208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1218   -3.0837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8394   -1.8595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5415   -1.4506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1218   -3.9093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2488   -1.8595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2488   -4.3208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9663   -3.0837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0169   -0.8127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4120   -2.6748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0662   -0.8127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4120   -4.3208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6711   -2.6748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9663   -3.9093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2997   -0.0463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6969   -3.0837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6969   -3.9093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6711   -4.3208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3886   -3.0837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3886   -3.9093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  2  1  0  0  0  0\n  8 10  1  0  0  0  0\n  9  5  1  0  0  0  0\n 10  4  1  0  0  0  0\n 11  3  2  0  0  0  0\n  4 12  1  0  0  0  0\n 13  8  1  0  0  0  0\n 14  6  2  0  0  0  0\n  8 15  1  0  0  0  0\n 16  9  2  0  0  0  0\n 17 12  2  0  0  0  0\n 18 12  1  0  0  0  0\n 19 13  1  0  0  0  0\n 20 14  1  0  0  0  0\n 21 16  1  0  0  0  0\n 22 18  2  0  0  0  0\n 23 17  1  0  0  0  0\n 24 22  1  0  0  0  0\n  7  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n 23 24  2  0  0  0  0\n 20 21  2  0  0  0  0\nM  END",
        "smiles": "CC1(CC(c2ccccc2)c3c(c4ccccc4oc3=O)O1)OC",
        "formula": "C20H18O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "322.3553",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "67a1f7c7-159f-4897-91ca-09d19a23d85e",
          "fed2b223-c002-4548-b6f9-8b5a1b3c41c5"
        ],
        "stereo_centers": 2
      },
      "unii": "725P8AW50M"
    }
  ]
}