{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "41e2566d-f35c-43d8-96e7-a411bbed6187",
          "code": "N0000006801",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Polycyclic Compounds [Chemical/Ingredient]|Steroids [Chemical/Ingredient]|Bile Acids and Salts [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000006801",
          "code_system": "NDF-RT",
          "references": [
            "1bb7f471-f70f-4ce4-8c9a-01a99ba3bd75"
          ]
        },
        {
          "uuid": "e23fb883-b509-45aa-bfbb-e837aa31ebc6",
          "code": "A05AA02",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|BILE AND LIVER THERAPY|BILE THERAPY|Bile acid preparations|ursodeoxycholic acid",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A05AA02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "1bb7f471-f70f-4ce4-8c9a-01a99ba3bd75"
          ]
        },
        {
          "uuid": "9a5062c4-f448-4552-a514-7baaa31225e3",
          "code": "N0000175802",
          "comments": "Established Pharmacologic Class [EPC]|Bile Acid [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175802",
          "code_system": "NDF-RT",
          "references": [
            "1bb7f471-f70f-4ce4-8c9a-01a99ba3bd75"
          ]
        },
        {
          "uuid": "a92fa457-844b-460a-a04b-cc47f54cf521",
          "code": "QA05AA02",
          "comments": "VATC|BILE AND LIVER THERAPY|BILE THERAPY|Bile acid preparations|ursodeoxycholic acid",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA05AA02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "1bb7f471-f70f-4ce4-8c9a-01a99ba3bd75"
          ]
        },
        {
          "uuid": "7f4e01b1-b2f4-4c9c-bea2-31b0822d089f",
          "code": "128-13-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=128-13-2",
          "code_system": "CAS",
          "references": [
            "1bb7f471-f70f-4ce4-8c9a-01a99ba3bd75",
            "9aa3337f-fe84-4ab2-a5a2-7edc43c05b0c"
          ]
        },
        {
          "uuid": "ab518e1f-5134-420a-b4f3-c14a93b62556",
          "code": "C1818",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1818",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1bb7f471-f70f-4ce4-8c9a-01a99ba3bd75"
          ]
        },
        {
          "uuid": "ddf97b37-43d7-46a9-9514-f29681e4ffbe",
          "code": "NBK548309",
          "comments": "LiverTox|Gastroinestinal|Primary biliary cirrhosis|Bile acid",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548309/",
          "code_system": "LIVERTOX",
          "references": [
            "7448090c-ebf3-c0c5-08dd-3cff7002f7cc"
          ]
        },
        {
          "uuid": "70545bf1-787f-473b-a2af-d8e1c10fd15b",
          "code": "D014580",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68014580",
          "code_system": "MESH",
          "references": [
            "1bb7f471-f70f-4ce4-8c9a-01a99ba3bd75"
          ]
        },
        {
          "uuid": "fec215ca-316e-4a72-95f7-9fe2728c528d",
          "code": "URSODIOL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Ursodiol",
          "code_system": "WIKIPEDIA",
          "references": [
            "1bb7f471-f70f-4ce4-8c9a-01a99ba3bd75"
          ]
        },
        {
          "uuid": "65150409-2c39-46f1-875c-d135ca10eebf",
          "code": "SUB11389MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "1bb7f471-f70f-4ce4-8c9a-01a99ba3bd75"
          ]
        },
        {
          "uuid": "e5c733b2-310e-4e92-a596-ae1cfcb3f8da",
          "code": "4920",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=4920",
          "code_system": "INN",
          "references": [
            "1bb7f471-f70f-4ce4-8c9a-01a99ba3bd75"
          ]
        },
        {
          "uuid": "c5414704-858d-4273-a7ac-c57e61ecedf3",
          "code": "7104",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7104",
          "code_system": "IUPHAR",
          "references": [
            "1bb7f471-f70f-4ce4-8c9a-01a99ba3bd75"
          ]
        },
        {
          "uuid": "93778a04-dec7-4eeb-9d78-89c919bb9c74",
          "code": "m11344",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11344?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "1bb7f471-f70f-4ce4-8c9a-01a99ba3bd75"
          ]
        },
        {
          "uuid": "8850b5ef-7e9e-4d8f-9c65-a302f7a430a8",
          "code": "62427",
          "type": "ALTERNATIVE",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/62427/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "1bb7f471-f70f-4ce4-8c9a-01a99ba3bd75"
          ]
        },
        {
          "uuid": "e98a42fa-a614-4e05-9400-e1d5c9f91171",
          "code": "11065",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/11065/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "1bb7f471-f70f-4ce4-8c9a-01a99ba3bd75"
          ]
        },
        {
          "uuid": "c4f0e2ff-64e8-40ee-9e92-bce85f37cb59",
          "code": "DB01586",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01586",
          "code_system": "DRUG BANK",
          "references": [
            "1bb7f471-f70f-4ce4-8c9a-01a99ba3bd75"
          ]
        },
        {
          "uuid": "434c50cf-33de-4869-b892-351a1e000c47",
          "code": "CHEMBL1551",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1551",
          "code_system": "ChEMBL",
          "references": [
            "1bb7f471-f70f-4ce4-8c9a-01a99ba3bd75"
          ]
        },
        {
          "uuid": "0baf4471-1140-4a47-b30c-c026cb826373",
          "code": "31401",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/31401",
          "code_system": "PUBCHEM",
          "references": [
            "1bb7f471-f70f-4ce4-8c9a-01a99ba3bd75"
          ]
        },
        {
          "uuid": "16f4e310-74f6-455c-a4b8-43db8d10a50b",
          "code": "204-879-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.437",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "1bb7f471-f70f-4ce4-8c9a-01a99ba3bd75"
          ]
        },
        {
          "uuid": "c808c964-c509-8270-f4ea-8cf361e9911e",
          "code": "Z-35",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/Z-35/relevant/1/",
          "code_system": "USAN",
          "references": [
            "99cba135-4233-8802-67fa-741ab881dbe2"
          ]
        },
        {
          "uuid": "46271300-0f1d-af91-64c5-3ef5fa53eba0",
          "code": "DTXSID6023731",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6023731",
          "code_system": "EPA CompTox",
          "references": [
            "c0f00c4b-e966-2577-ea45-19221fb60e03"
          ]
        },
        {
          "uuid": "ab186d3d-683c-e17b-d378-5245881e0a96",
          "code": "22187",
          "comments": "ORPHAN DRUG|Designated/Approved|Treatment of patients with primary biliary cirrhosis",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=22187",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "6f873297-afc6-808f-8774-427ee387db17",
          "code": "55390",
          "comments": "ORPHAN DRUG|Designated/Withdrawn|Management of the clinical signs and symptoms associated with primary biliary cirrhosis.",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=55390",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "651be649-0e3f-1c23-2430-47189b259ac6",
          "code": "242607",
          "comments": "ORPHAN DRUG|Designated|Treatment of cystic fibrosis liver disease",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=242607",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "7e3819f7-e48f-d164-08ae-f8d76be136c4",
          "code": "191204",
          "comments": "ORPHAN DRUG|Designated|Treatment of pruritus in patients with Alagille Syndrome",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=191204",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "cbf665d2-4363-1854-fbff-25fa21661ee7",
          "code": "636718",
          "comments": "ORPHAN DRUG|Designated|Treatment of Niemann-Pick disease, type C",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=636718",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "da26fa9e-32ec-352c-465f-a6891b8c9ffb",
          "code": "C2089",
          "comments": "Pharmacologic Substance[C1909]|Enzyme Inhibitor[C471]|Protein Kinase Inhibitor[C1404]|Serine/Threonine Kinase Inhibitor[C61074]|Protein Kinase C Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2089",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7448090c-ebf3-c0c5-08dd-3cff7002f7cc"
          ]
        },
        {
          "uuid": "e71410cb-4738-8388-722d-b25b9ee5ca74",
          "code": "C29703",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Digestive System or Metabolism[C78276]|Antilipidemic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29703",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7448090c-ebf3-c0c5-08dd-3cff7002f7cc"
          ]
        },
        {
          "uuid": "7735a9d4-0db0-fbfa-aa57-625ea1255d60",
          "code": "55159-8",
          "comments": "LOINC|ACTIVE|CHEM|Ser|Ursodeoxycholate [Moles/volume] in Serum",
          "type": "PRIMARY",
          "url": "https://loinc.org/55159-8/",
          "code_system": "LOINC",
          "references": [
            "7448090c-ebf3-c0c5-08dd-3cff7002f7cc"
          ]
        },
        {
          "uuid": "b658ced7-618b-3c44-3c6f-dedd67dfd9a6",
          "code": "EU/3/17/1878",
          "comments": "EU ORPHAN DRUG|Positive|Treatment of Niemann-Pick disease",
          "type": "PRIMARY",
          "url": "https://www.ema.europa.eu/en/medicines/human/orphan-designations/eu3171878",
          "code_system": "EU-Orphan Drug",
          "references": [
            "7448090c-ebf3-c0c5-08dd-3cff7002f7cc"
          ]
        },
        {
          "uuid": "73ff7758-7df7-4f88-a710-d963b0cd754a",
          "code": "724L30Y2QR",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "040ab379-c9bd-fcf7-0754-f9e0e151297b",
          "code": "Ursodiol",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM510/",
          "code_system": "LACTMED",
          "references": [
            "7448090c-ebf3-c0c5-08dd-3cff7002f7cc"
          ]
        },
        {
          "uuid": "d486d07e-1ed3-5d0f-ea6f-c3e63d00894f",
          "code": "2797",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2797",
          "code_system": "DRUG CENTRAL",
          "references": [
            "7448090c-ebf3-c0c5-08dd-3cff7002f7cc"
          ]
        },
        {
          "uuid": "d1d7877e-bfdd-e3ed-3574-55597eff6856",
          "code": "9907",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9907",
          "code_system": "CHEBI",
          "references": [
            "7448090c-ebf3-c0c5-08dd-3cff7002f7cc"
          ]
        },
        {
          "uuid": "9ec62583-08be-d2d9-7880-7878377bf900",
          "code": "78604",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:78604",
          "code_system": "CHEBI",
          "references": [
            "7448090c-ebf3-c0c5-08dd-3cff7002f7cc"
          ]
        },
        {
          "uuid": "ae7b4876-1aee-5e31-fcf0-3eb94d4e7798",
          "code": "1707806",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1707806",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "7448090c-ebf3-c0c5-08dd-3cff7002f7cc"
          ]
        },
        {
          "uuid": "bc90e829-b00c-9eb7-ab81-725f4ab6aced",
          "code": "724L30Y2QR",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=724L30Y2QR",
          "code_system": "DAILYMED",
          "references": [
            "2bf12ea6-bd30-2279-8bf7-fde15fcf17bc"
          ]
        },
        {
          "uuid": "1f8a0ab7-11dc-6710-8259-380355d3bc2e",
          "code": "100000092107",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "593fc500-21cd-8ca4-6eb8-38ad67887718"
          ]
        },
        {
          "uuid": "56096f7d-9981-b3d7-6919-a19a028cc79e",
          "code": "683769",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=683769",
          "code_system": "NSC",
          "references": [
            "8b59d257-3eae-676e-d115-fa0a69a47371"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "568211c5-d194-4715-b702-cb79d43f5542",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "f989c7ce-f2ea-468d-8a8b-b40500b0b6a8",
            "refuuid": "2d863d83-dd6a-47f2-a515-88c3e8b0bc9a",
            "name": "URSODIOL",
            "unii": "724L30Y2QR",
            "linking_id": "724L30Y2QR",
            "ref_pname": "URSODIOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "334f8f7a-a3b8-4d0d-be56-df24f7120858",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "d04b29a5-3bac-4372-97b3-3ff0a0e99900",
            "refuuid": "7397f08b-8526-462a-9333-b8a6009a0c04",
            "name": "URSODEOXYCHOLATE SODIUM",
            "unii": "YKU915YJNV",
            "linking_id": "YKU915YJNV",
            "ref_pname": "URSODEOXYCHOLATE SODIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "47e40190-256f-4c17-b55f-2196b3838ce8",
          "qualification": "PLASMA",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MAJOR",
          "references": [
            "b0f43311-bdda-4133-923e-e559eb65e0dd"
          ],
          "related_substance": {
            "uuid": "5a18a261-c85d-4f51-98ee-9a64ea35c7fb",
            "refuuid": "c4738fd5-05ea-41eb-83e6-ca1a6f9f3202",
            "name": "URSODEOXYCHOLYLGLYCINE",
            "unii": "PF1G5J2X2A",
            "linking_id": "PF1G5J2X2A",
            "ref_pname": "URSODEOXYCHOLYLGLYCINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0c2c571e-b243-4004-ac34-42b6afbdc082",
          "qualification": "PLASMA",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MAJOR",
          "references": [
            "b0f43311-bdda-4133-923e-e559eb65e0dd"
          ],
          "related_substance": {
            "uuid": "01529920-43e0-423b-ba20-b03af711ec69",
            "refuuid": "c6c2b7dd-bcc5-412a-ab5a-e5f6f9cef668",
            "name": "TAURURSODIOL",
            "unii": "60EUX8MN5X",
            "linking_id": "60EUX8MN5X",
            "ref_pname": "TAURURSODIOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2645ff60-7128-4578-bd74-fd4d977fca21",
          "qualification": "FECAL",
          "type": "METABOLITE->PARENT",
          "references": [
            "74c576bc-ef20-4b35-9874-77873598dfc5"
          ],
          "related_substance": {
            "uuid": "e73e4c98-2a74-4ada-9776-6c80de9d02c9",
            "refuuid": "f9b9fef8-42e9-4d9b-aad0-0654d4b9ddcf",
            "name": "LITHOCHOLIC ACID",
            "unii": "5QU0I8393U",
            "linking_id": "5QU0I8393U",
            "ref_pname": "LITHOCHOLIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d82cdece-cb86-4778-a9e0-8fdb36126320",
          "qualification": "BILE",
          "type": "METABOLITE->PARENT",
          "references": [
            "74c576bc-ef20-4b35-9874-77873598dfc5"
          ],
          "related_substance": {
            "uuid": "84f632b1-2f51-420e-885d-1d12c38bd6b7",
            "refuuid": "75e0299d-d7e5-4e08-b5cf-03553f99919a",
            "name": "CHENODIOL",
            "unii": "0GEI24LG0J",
            "linking_id": "0GEI24LG0J",
            "ref_pname": "CHENODIOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f5b89825-f317-402c-9154-008b074b2a22",
          "qualification": "BILE",
          "type": "METABOLITE->PARENT",
          "references": [
            "74c576bc-ef20-4b35-9874-77873598dfc5"
          ],
          "related_substance": {
            "uuid": "1109ff28-6fb7-45ec-a47f-187b52551889",
            "refuuid": "6c993f24-4919-464e-8966-0588f60e48c0",
            "name": "SULFOLITHOCHOLIC ACID",
            "unii": "0ENK5NMI1I",
            "linking_id": "0ENK5NMI1I",
            "ref_pname": "SULFOLITHOCHOLIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c0acbb9f-cbeb-459b-b90d-b3728606d0db",
          "amount": {
            "uuid": "879b1944-fed6-4a5a-a9bc-9bb29db99fea",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "6f17d2a3-234f-4095-9860-b0deeb0209bf"
          ],
          "related_substance": {
            "uuid": "b190e4e7-c56d-4426-a77e-107d16d796ed",
            "refuuid": "856fd9e3-bc15-45b7-9eed-eb01fd16604c",
            "name": "URSOCHOLIC ACID",
            "unii": "MLP1T05RBX",
            "linking_id": "MLP1T05RBX",
            "ref_pname": "URSOCHOLIC ACID"
          }
        },
        {
          "uuid": "7a96d04e-296a-419c-bcd1-32941ec46673",
          "amount": {
            "uuid": "c06e295f-7545-40cf-97af-a016656ca428",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "dfd59ec6-ea68-42a8-b0d4-39150816084b"
          ],
          "related_substance": {
            "uuid": "ddeb8124-5fb2-4b59-8fb7-2fe943653f0e",
            "refuuid": "5aa87323-6ad7-4d01-a5db-0e1beefd1ccb",
            "name": "NUTRIACHOLIC ACID",
            "unii": "Y1357H1A28",
            "linking_id": "Y1357H1A28",
            "ref_pname": "NUTRIACHOLIC ACID"
          }
        },
        {
          "uuid": "7b35b55c-4315-4d6d-ace6-2772cb080025",
          "amount": {
            "uuid": "3b198735-f623-4c13-a731-f80135028920",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "4c18cf15-0254-4903-b830-4dbd349b4534"
          ],
          "related_substance": {
            "uuid": "78ddcb65-7b84-419c-b3fa-da66241ff3d2",
            "refuuid": "b87da8a0-2644-433d-814a-8e1f3c5cd45f",
            "name": "CHOLIC ACID",
            "unii": "G1JO7801AE",
            "linking_id": "G1JO7801AE",
            "ref_pname": "CHOLIC ACID"
          }
        },
        {
          "uuid": "dad6ca0a-8602-40fa-b89f-8b2e45792dfa",
          "amount": {
            "uuid": "e01f0184-f0b0-49be-a402-290c3971d7cb",
            "units": "%",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (TLC)",
          "references": [
            "e1ea67d9-bb89-4cfd-bdd0-40971cf2f930"
          ],
          "related_substance": {
            "uuid": "d6ac1cb8-4f8a-4dc3-8fbb-d80e0ef822f9",
            "refuuid": "f9b9fef8-42e9-4d9b-aad0-0654d4b9ddcf",
            "name": "LITHOCHOLIC ACID",
            "unii": "5QU0I8393U",
            "linking_id": "5QU0I8393U",
            "ref_pname": "LITHOCHOLIC ACID"
          }
        },
        {
          "uuid": "b086ef21-7f7f-4f74-92ca-c4a8b7273639",
          "amount": {
            "uuid": "b1fd8f21-7b41-468d-b359-5bb76bafa665",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "2476dbda-3b5d-420e-9010-9541a7135ca1"
          ],
          "related_substance": {
            "uuid": "88458b12-5f63-4f6a-93be-a09be2423c59",
            "refuuid": "94f17c1d-badd-4056-81d5-a3544ef0dd3d",
            "name": "3.BETA.,7.BETA.-DIHYDROXY-5.BETA.-CHOLAN-24-OIC ACID",
            "unii": "2R6LC4J3N9",
            "linking_id": "2R6LC4J3N9",
            "ref_pname": "3.BETA.,7.BETA.-DIHYDROXY-5.BETA.-CHOLAN-24-OIC ACID"
          }
        },
        {
          "uuid": "a2cd4e02-1ca8-4749-bd90-9cf9f59f09c5",
          "amount": {
            "uuid": "95cab316-debb-4561-a95d-9c4e771fb3c0",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "c76ba6b9-8dfa-414d-914b-12fc371284e5"
          ],
          "related_substance": {
            "uuid": "9a85710f-ad67-4851-afd2-3ca55709499a",
            "refuuid": "6b353a5e-5958-470f-a7be-f289f0a3bb9e",
            "name": "(3.ALPHA.,5.BETA.,7.BETA.)-CHOLANE-3,7,24-TRIOL",
            "unii": "49AM7E73PT",
            "linking_id": "49AM7E73PT",
            "ref_pname": "(3.ALPHA.,5.BETA.,7.BETA.)-CHOLANE-3,7,24-TRIOL"
          }
        },
        {
          "uuid": "37ab0957-565e-4604-b4d3-c975036e1f84",
          "amount": {
            "uuid": "92d2e391-31a7-4475-836a-490bcd1ee6e0",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "32baf74a-eb59-429e-b126-b7d44de961a1"
          ],
          "related_substance": {
            "uuid": "654471ff-f495-4411-9cb0-5419b6f49380",
            "refuuid": "26792403-f64c-44d2-a21a-e8d124b34f19",
            "name": "DEOXYCHOLIC ACID",
            "unii": "005990WHZZ",
            "linking_id": "005990WHZZ",
            "ref_pname": "DEOXYCHOLIC ACID"
          }
        },
        {
          "uuid": "f5075a66-4e87-4bed-a705-51ed4490a291",
          "amount": {
            "uuid": "35225649-4f40-4027-a977-9fbd3118c267",
            "units": "PERCENT PEAK AREA",
            "high_limit": 1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "080dad7d-8288-427f-8e72-548598d921d7"
          ],
          "related_substance": {
            "uuid": "82ffd707-f271-4c1c-aa2c-4a23f5b967c4",
            "refuuid": "75e0299d-d7e5-4e08-b5cf-03553f99919a",
            "name": "CHENODIOL",
            "unii": "0GEI24LG0J",
            "linking_id": "0GEI24LG0J",
            "ref_pname": "CHENODIOL"
          }
        },
        {
          "uuid": "630019ec-5bac-45a0-9d61-8d5dd7a79df9",
          "amount": {
            "uuid": "ed2189c9-17c6-41c6-aa02-c5dae3f52d2e",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "80ea2ab2-07bb-44bd-978e-17a48a215b6d"
          ],
          "related_substance": {
            "uuid": "35385e13-186c-40d9-a779-2ea76eb836b8",
            "refuuid": "75047595-1206-49c7-89bf-08b5c87d0885",
            "name": "METHYL CHENODEOXYCHOLATE",
            "unii": "48O35JP4YI",
            "linking_id": "48O35JP4YI",
            "ref_pname": "METHYL CHENODEOXYCHOLATE"
          }
        },
        {
          "uuid": "a8bb9e79-1775-44f5-bb43-f7f596dd0f99",
          "amount": {
            "uuid": "e9caa343-4a16-4c6a-95a3-3175d49307c7"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "d5a309e5-1268-45f7-b200-89a80be45624"
          ],
          "related_substance": {
            "uuid": "55ba26fe-e64c-44a3-a792-9c1060017ae6",
            "refuuid": "8827cb93-6ffe-4495-a6cf-0f295ed73ed7",
            "name": "URSODIOL SULFATE",
            "unii": "84SS8Q4EEQ",
            "linking_id": "84SS8Q4EEQ",
            "ref_pname": "URSODIOL SULFATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b3861482-0efe-443e-aa6f-fd63d0aec55e",
          "amount": {
            "uuid": "1872a6ea-9f3f-4083-92f4-78733b17d7a3"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "7645e692-3c88-49ac-9db1-5c46836d9844",
            "refuuid": "90f24399-9d8d-4cdf-a1d4-f659d50a32a6",
            "name": "Berberine Ursodeoxycholate",
            "unii": "VM8KQ3W8GM",
            "linking_id": "VM8KQ3W8GM",
            "ref_pname": "Berberine Ursodeoxycholate",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "50cedf0f-3a20-4ddf-ad71-8f1612897cc8",
          "name": "3.ALPHA.,7.BETA.-DIHYDROXY-5B-CHOLAN-24-OIC ACID",
          "stdName": "3.ALPHA.,7.BETA.-DIHYDROXY-5B-CHOLAN-24-OIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f3601d8-7cc0-4d51-8020-fc793185b12f",
            "1c90d05d-db8b-48a2-9c36-472e0dc82dc9"
          ],
          "display_name": false
        },
        {
          "uuid": "c52078a9-08a1-4e2d-a3ed-18ce78f6c16b",
          "name": "ACTIGALL",
          "stdName": "ACTIGALL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f3601d8-7cc0-4d51-8020-fc793185b12f",
            "1c90d05d-db8b-48a2-9c36-472e0dc82dc9"
          ],
          "display_name": false
        },
        {
          "uuid": "f467ef86-5085-4bf0-ae84-5db374a37513",
          "name": "CHOLAN-24-OIC ACID, 3,7-DIHYDROXY-, (3.ALPHA.,5.BETA.,7.BETA.)-",
          "stdName": "CHOLAN-24-OIC ACID, 3,7-DIHYDROXY-, (3.ALPHA.,5.BETA.,7.BETA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f3601d8-7cc0-4d51-8020-fc793185b12f",
            "1c90d05d-db8b-48a2-9c36-472e0dc82dc9"
          ],
          "display_name": false
        },
        {
          "uuid": "10caf5e0-2ac5-4708-96dd-2c2d71f1c392",
          "name": "NSC-683769",
          "stdName": "NSC-683769",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30a676d4-7c8b-47ce-bd7b-329177e16130",
            "1c90d05d-db8b-48a2-9c36-472e0dc82dc9"
          ],
          "display_name": false
        },
        {
          "uuid": "cefeec8b-e39d-4816-9e88-d4e6eda86957",
          "name": "UDCA",
          "stdName": "UDCA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64d0772f-7d26-416b-918d-a584d0a297e6",
            "1c90d05d-db8b-48a2-9c36-472e0dc82dc9"
          ],
          "display_name": false
        },
        {
          "uuid": "8f74a727-d737-4a62-a5d5-79954458807b",
          "name": "URSO",
          "stdName": "URSO",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f3601d8-7cc0-4d51-8020-fc793185b12f",
            "1c90d05d-db8b-48a2-9c36-472e0dc82dc9"
          ],
          "display_name": false
        },
        {
          "uuid": "ff781770-2ef8-427e-a122-dc9fae9acd29",
          "name": "URSODEOXYCHOLATE",
          "stdName": "URSODEOXYCHOLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c763bcac-947b-45cc-819a-f9f3ec5c662c",
            "1c90d05d-db8b-48a2-9c36-472e0dc82dc9"
          ],
          "display_name": false
        },
        {
          "uuid": "ee379e90-ef34-4cfc-90b7-8ecdde82e5c7",
          "name": "URSODEOXYCHOLIC ACID",
          "stdName": "URSODEOXYCHOLIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "efcf174e-fd55-461b-bba7-20795a4574ff",
            "bbe5c3f4-b64c-4040-a0e0-dcb4574465b4",
            "eb065b38-8971-4118-b31e-0966f0af4d09",
            "5214af73-6249-43a6-9c63-d76ca9b6face",
            "b6eac32f-26dd-4edc-a06f-6b8fce3fb22b",
            "35cfcf5d-84b0-4f0f-a05c-0e9844603156",
            "1c90d05d-db8b-48a2-9c36-472e0dc82dc9",
            "bf6bb7c5-0843-4539-bc49-d4c1fe5921b3",
            "4fc18eb6-0cbc-4477-ae8f-3d44c8bc7058",
            "3299e927-fbd1-4af5-8145-23f44a926ddd"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "af253c1a-9f10-409e-ba35-797bb392236f",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "645afdd5-ec59-a2ab-3369-8d04768547c3",
          "name": "URSODEOXYCHOLIC ACID [EP IMPURITY]",
          "stdName": "URSODEOXYCHOLIC ACID [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bf6bb7c5-0843-4539-bc49-d4c1fe5921b3"
          ],
          "display_name": false
        },
        {
          "uuid": "c50f27a2-4730-1c5d-f2d4-b921efac058c",
          "name": "URSODEOXYCHOLIC ACID [EP MONOGRAPH]",
          "stdName": "URSODEOXYCHOLIC ACID [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fcd9776-df30-c9f7-0137-b670f3a090b1"
          ],
          "display_name": false
        },
        {
          "uuid": "de01de11-8a85-0d27-15ad-985f9026f484",
          "name": "URSODEOXYCHOLIC ACID [JAN]",
          "stdName": "URSODEOXYCHOLIC ACID [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f3b8c6e-96b7-dc27-6e8d-d47af283b3a1"
          ],
          "display_name": false
        },
        {
          "uuid": "0436803f-8a33-4d73-be58-c04c9b36fb17",
          "name": "URSODEOXYCHOLIC ACID [MART.]",
          "stdName": "URSODEOXYCHOLIC ACID [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6eac32f-26dd-4edc-a06f-6b8fce3fb22b"
          ],
          "display_name": false
        },
        {
          "uuid": "8f95fd50-9a74-4fa6-bd28-bb967eaf468a",
          "name": "URSODESOXYCHOLIC ACID",
          "stdName": "URSODESOXYCHOLIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35cfcf5d-84b0-4f0f-a05c-0e9844603156",
            "1c90d05d-db8b-48a2-9c36-472e0dc82dc9"
          ],
          "display_name": false
        },
        {
          "uuid": "c032fe39-6674-4e2e-9b04-4ebf5fb56583",
          "name": "URSODIOL",
          "stdName": "URSODIOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe45a8d7-7a51-4d4c-b845-8e9f7f4605d3",
            "40e139ad-8abc-47d6-affd-8b480649dc42",
            "a1c9d98d-352f-4d23-bb8c-a9e28be0d5a7",
            "e83b041e-0c6c-44f8-a575-a598fb1b8c73",
            "a951ec08-86d5-4bce-9f13-7a13be7954f4",
            "164c6233-6b7a-4577-905d-d5c691a67427",
            "4f3601d8-7cc0-4d51-8020-fc793185b12f",
            "512afc4d-87d0-4f18-8cd8-e377b559bfb9",
            "b5062284-bfa2-4b01-a910-667ca1556e83",
            "5ead3b3b-7a88-4fe5-a8b6-9db717eac558",
            "ba29636d-8e42-4792-b5d0-c13dc3414505",
            "4938592d-77db-48bc-9f37-d01564387414",
            "e31f9b21-083f-4985-94a2-7e7d5648a142",
            "1c90d05d-db8b-48a2-9c36-472e0dc82dc9",
            "d5799393-b512-4eba-9d4f-e05d130429b8",
            "d48ee7e6-15a1-45ff-baf4-f4a83aac700f"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b7789720-87a3-430f-8efa-0b1b21b7d3b0",
              "name_org": "USAN"
            },
            {
              "uuid": "761c9ac1-0e4d-49ae-a906-009eb10fb89b",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "4d27b37e-16ad-4f53-8cb3-8c21577165f7",
          "name": "URSODIOL [MI]",
          "stdName": "URSODIOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "40e139ad-8abc-47d6-affd-8b480649dc42",
            "1c90d05d-db8b-48a2-9c36-472e0dc82dc9"
          ],
          "display_name": false
        },
        {
          "uuid": "b0cb0fb4-65f2-43ab-a9c6-22a5603fac5e",
          "name": "URSODIOL [ORANGE BOOK]",
          "stdName": "URSODIOL [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e83b041e-0c6c-44f8-a575-a598fb1b8c73"
          ],
          "display_name": false
        },
        {
          "uuid": "81114b7c-bf29-463e-aaff-cbcedfb56e4c",
          "name": "URSODIOL [USAN]",
          "stdName": "URSODIOL [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba29636d-8e42-4792-b5d0-c13dc3414505"
          ],
          "display_name": false
        },
        {
          "uuid": "362825c5-4a59-5991-cc05-0a0599ae5db1",
          "name": "URSODIOL [USP MONOGRAPH]",
          "stdName": "URSODIOL [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "939283e3-cc98-64aa-9e46-6a20fcf30729"
          ],
          "display_name": false
        },
        {
          "uuid": "fa53f6b8-5cd7-49df-943e-6efdfc3f4773",
          "name": "URSODIOL [USP-RS]",
          "stdName": "URSODIOL [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1c9d98d-352f-4d23-bb8c-a9e28be0d5a7",
            "1c90d05d-db8b-48a2-9c36-472e0dc82dc9"
          ],
          "display_name": false
        },
        {
          "uuid": "d03ba002-3b01-4db1-94e2-360a81605449",
          "name": "URSODIOL [VANDF]",
          "stdName": "URSODIOL [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d48ee7e6-15a1-45ff-baf4-f4a83aac700f",
            "1c90d05d-db8b-48a2-9c36-472e0dc82dc9"
          ],
          "display_name": false
        },
        {
          "uuid": "df98b9be-f32c-f1b2-4863-37006a7d4077",
          "name": "URSONORM",
          "stdName": "URSONORM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5170e650-19a4-84e9-24a0-5e828b63879e"
          ],
          "display_name": false
        },
        {
          "uuid": "fbef3663-3be6-45e9-c93d-16e0fa4774f6",
          "name": "Ursodeoxycholic acid [WHO-DD]",
          "stdName": "URSODEOXYCHOLIC ACID [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5c1158f-b4f2-13ed-4edb-62acf42ecc6a"
          ],
          "display_name": false
        },
        {
          "uuid": "f402a95d-97d9-4b6c-a260-4e68bb54500d",
          "name": "ursodeoxycholic acid [INN]",
          "stdName": "URSODEOXYCHOLIC ACID [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fc18eb6-0cbc-4477-ae8f-3d44c8bc7058",
            "da99a243-e04c-444a-a80a-28984c632aef"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2476dbda-3b5d-420e-9010-9541a7135ca1",
          "citation": "European Pharmacopoeia Online 9.8, Ursodeoxycholic Acid Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c76ba6b9-8dfa-414d-914b-12fc371284e5",
          "citation": "European Pharmacopoeia Online 9.8, Ursodeoxycholic Acid Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4c18cf15-0254-4903-b830-4dbd349b4534",
          "citation": "European Pharmacopoeia Online 9.8, Ursodeoxycholic Acid Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e1ea67d9-bb89-4cfd-bdd0-40971cf2f930",
          "citation": "European Pharmacopoeia Online 9.8, Ursodeoxycholic Acid Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "32baf74a-eb59-429e-b126-b7d44de961a1",
          "citation": "European Pharmacopoeia Online 9.8, Ursodeoxycholic Acid Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4f3601d8-7cc0-4d51-8020-fc793185b12f",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "35cfcf5d-84b0-4f0f-a05c-0e9844603156",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c90d05d-db8b-48a2-9c36-472e0dc82dc9",
          "citation": "INN",
          "doc_type": "INN",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c763bcac-947b-45cc-819a-f9f3ec5c662c",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4fc18eb6-0cbc-4477-ae8f-3d44c8bc7058",
          "citation": "INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba29636d-8e42-4792-b5d0-c13dc3414505",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf6bb7c5-0843-4539-bc49-d4c1fe5921b3",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe45a8d7-7a51-4d4c-b845-8e9f7f4605d3",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e83b041e-0c6c-44f8-a575-a598fb1b8c73",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b6eac32f-26dd-4edc-a06f-6b8fce3fb22b",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "40e139ad-8abc-47d6-affd-8b480649dc42",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "164c6233-6b7a-4577-905d-d5c691a67427",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a1c9d98d-352f-4d23-bb8c-a9e28be0d5a7",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "efcf174e-fd55-461b-bba7-20795a4574ff",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d48ee7e6-15a1-45ff-baf4-f4a83aac700f",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "64d0772f-7d26-416b-918d-a584d0a297e6",
          "citation": "NCT01337440",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "30a676d4-7c8b-47ce-bd7b-329177e16130",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e328afae-b51c-41bb-9a74-b0bf378c5edc",
          "citation": "CLINICAL TRIALS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1bb7f471-f70f-4ce4-8c9a-01a99ba3bd75",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389685000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b0f43311-bdda-4133-923e-e559eb65e0dd",
          "citation": "E-JOURNAL OF CHEMISTRY, 2012, 9(3), 1605-1612",
          "url": "http://www.accessdata.fda.gov/spl/data/a8b08d72-9446-42c7-8b7b-d46561d3b4ae/a8b08d72-9446-42c7-8b7b-d46561d3b4ae.xml",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "74c576bc-ef20-4b35-9874-77873598dfc5",
          "citation": "http://www.accessdata.fda.gov/spl/data/a8b08d72-9446-42c7-8b7b-d46561d3b4ae/a8b08d72-9446-42c7-8b7b-d46561d3b4ae.xml",
          "url": "http://www.accessdata.fda.gov/spl/data/a8b08d72-9446-42c7-8b7b-d46561d3b4ae/a8b08d72-9446-42c7-8b7b-d46561d3b4ae.xml",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e1211d4b-cab4-4762-af37-6fccf8a92060",
          "citation": "SRS import [724L30Y2QR]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=724L30Y2QR",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389685000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11090b38-79b6-4874-a848-48641bfa06d7",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eb065b38-8971-4118-b31e-0966f0af4d09",
          "citation": "URSODEOXYCHOLIC ACID [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b5062284-bfa2-4b01-a910-667ca1556e83",
          "citation": "URSODIOL [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5214af73-6249-43a6-9c63-d76ca9b6face",
          "citation": "URSODEOXYCHOLIC ACID [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e31f9b21-083f-4985-94a2-7e7d5648a142",
          "citation": "URSODIOL [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "512afc4d-87d0-4f18-8cd8-e377b559bfb9",
          "citation": "URSODIOL [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3299e927-fbd1-4af5-8145-23f44a926ddd",
          "citation": "URSODEOXYCHOLIC ACID [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d5799393-b512-4eba-9d4f-e05d130429b8",
          "citation": "URSODIOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a951ec08-86d5-4bce-9f13-7a13be7954f4",
          "citation": "URSODIOL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4938592d-77db-48bc-9f37-d01564387414",
          "citation": "URSODIOL [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bbe5c3f4-b64c-4040-a0e0-dcb4574465b4",
          "citation": "URSODEOXYCHOLIC ACID [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5ead3b3b-7a88-4fe5-a8b6-9db717eac558",
          "citation": "URSODIOL [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c0f00c4b-e966-2577-ea45-19221fb60e03",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=128-13-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8eb672a8-e6af-ad46-d234-439693213e81",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+128-13-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7448090c-ebf3-c0c5-08dd-3cff7002f7cc",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "6f3b8c6e-96b7-dc27-6e8d-d47af283b3a1",
          "citation": "JAN",
          "doc_type": "JAN",
          "public_domain": true
        },
        {
          "uuid": "99cba135-4233-8802-67fa-741ab881dbe2",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "9aa3337f-fe84-4ab2-a5a2-7edc43c05b0c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "080dad7d-8288-427f-8e72-548598d921d7",
          "citation": "European Pharmacopoeia Online 9.8, Ursodeoxycholic Acid Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "80ea2ab2-07bb-44bd-978e-17a48a215b6d",
          "citation": "European Pharmacopoeia Online 9.8, Ursodeoxycholic Acid Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6f17d2a3-234f-4095-9860-b0deeb0209bf",
          "citation": "European Pharmacopoeia Online 9.8, Ursodeoxycholic Acid Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dfd59ec6-ea68-42a8-b0d4-39150816084b",
          "citation": "European Pharmacopoeia Online 9.8, Ursodeoxycholic Acid Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5170e650-19a4-84e9-24a0-5e828b63879e",
          "citation": "https://clinicaltrials.gov/ct2/show/NCT03840005",
          "url": "https://clinicaltrials.gov/ct2/show/NCT03840005",
          "doc_type": "CLINICAL_TRIALS.GOV",
          "public_domain": true
        },
        {
          "uuid": "da99a243-e04c-444a-a80a-28984c632aef",
          "citation": "INN Proposed List 44",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL44.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d5a309e5-1268-45f7-b200-89a80be45624",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "939283e3-cc98-64aa-9e46-6a20fcf30729",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "7fcd9776-df30-c9f7-0137-b670f3a090b1",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "8b59d257-3eae-676e-d115-fa0a69a47371",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "2bf12ea6-bd30-2279-8bf7-fde15fcf17bc",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "b5c1158f-b4f2-13ed-4edb-62acf42ecc6a",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "593fc500-21cd-8ca4-6eb8-38ad67887718",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7a64f519-56e8-4165-ac29-93665dd6953b",
          "id": "7a64f519-56e8-4165-ac29-93665dd6953b",
          "molfile": "\n  Marvin  01132106222D          \n\n 28 31  0  0  1  0            999 V2000\n    4.2317   -0.6506    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    3.5172   -0.2382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9461   -0.2382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6607   -0.6506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3692   -0.2353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3692    0.5867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0838   -0.6477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2404   -1.4725    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.7137   -2.1492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2171   -2.8114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4301   -2.5500    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.7156   -2.9480    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    2.7156   -3.7757    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.4301   -4.1881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9983   -4.1852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2866   -3.7698    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    0.5751   -4.1765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1365   -3.7698    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -0.8538   -4.1765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1365   -2.9450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5751   -2.5239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2895   -2.9450    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    1.2866   -2.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0040   -2.5326    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.0127   -1.6962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7359   -1.2982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4503   -1.7194    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    3.4416   -0.8974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  8  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  5  2  0  0  0  0\n  8  9  1  1  0  0  0\n 27  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  6  0  0  0\n 11 27  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 24  1  0  0  0  0\n 13 14  1  1  0  0  0\n 13 15  1  0  0  0  0\n 16 15  1  6  0  0  0\n 16 17  1  0  0  0  0\n 22 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  6  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  1  0  0  0\n 24 22  1  0  0  0  0\n 24 25  1  1  0  0  0\n 25 26  1  0  0  0  0\n 27 26  1  0  0  0  0\n 27 28  1  1  0  0  0\nM  END",
          "smiles": "C[C@H](CCC(=O)O)[C@H]1CC[C@@H]2[C@H]3[C@H](CC[C@]12C)[C@@]4(C)CC[C@H](C[C@H]4C[C@@H]3O)O",
          "formula": "C24H40O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cf9c259d-4379-42d7-8da7-7e5880d46383"
          },
          "defined_stereo": 10,
          "ez_centers": 0,
          "molecular_weight": "392.5729",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 10
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2d863d83-dd6a-47f2-a515-88c3e8b0bc9a",
      "version": "53",
      "structure": {
        "id": "16e61256-6e34-400c-852b-a188bbf20b57",
        "molfile": "\n  Marvin  01132101232D          \n\n 33 36  0  0  1  0            999 V2000\n    3.4506   -1.7195    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.2896   -2.9452    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.4304   -2.5502    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.0042   -2.5328    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.7158   -2.9482    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.2867   -3.7701    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.7158   -3.7760    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.2407   -1.4726    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.7361   -1.2983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9984   -4.1855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0129   -1.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2174   -2.8116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5751   -2.5241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7141   -2.1494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3697   -0.2353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5751   -4.1768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3697    0.5867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2320   -0.6506    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.9465   -0.2382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4304   -4.1884    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6611   -0.6506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4419   -0.8975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1365   -2.9452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1365   -3.7701    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.2867   -2.1232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0843   -0.6477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8539   -4.1768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5175   -0.2382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2781   -4.5921    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4304   -3.3722    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9552   -1.0601    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0012   -3.3548    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7129   -2.1262    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  4  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4 11  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  1  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  7  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12  3  1  0  0  0  0\n 13  2  1  0  0  0  0\n 14  8  1  0  0  0  0\n 15 21  1  0  0  0  0\n 16  6  1  0  0  0  0\n 17 15  2  0  0  0  0\n 18  8  1  0  0  0  0\n 19 18  1  0  0  0  0\n  7 20  1  1  0  0  0\n 21 19  1  0  0  0  0\n  1 22  1  1  0  0  0\n 23 13  1  0  0  0  0\n 24 23  1  0  0  0  0\n  2 25  1  1  0  0  0\n 26 15  1  0  0  0  0\n 24 27  1  6  0  0  0\n 18 28  1  6  0  0  0\n  6 29  1  1  0  0  0\n  3 30  1  6  0  0  0\n  8 31  1  6  0  0  0\n  4 32  1  6  0  0  0\n  5 33  1  1  0  0  0\n 12 14  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6 10  1  0  0  0  0\n 16 24  1  0  0  0  0\nM  END",
        "smiles": "C[C@H](CCC(=O)O)[C@@]1([H])CC[C@@]2([H])[C@@]3([H])[C@]([H])(CC[C@]12C)[C@@]4(C)CC[C@H](C[C@@]4([H])C[C@@H]3O)O",
        "formula": "C24H40O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 10,
        "ez_centers": 0,
        "molecular_weight": "392.5729",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "11090b38-79b6-4874-a848-48641bfa06d7",
          "e1211d4b-cab4-4762-af37-6fccf8a92060",
          "da99a243-e04c-444a-a80a-28984c632aef"
        ],
        "stereo_centers": 10
      },
      "unii": "724L30Y2QR"
    }
  ]
}