{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4ed568b8-06b7-466b-ad61-65360763bc24",
          "code": "18916-17-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=18916-17-1",
          "code_system": "CAS",
          "references": [
            "1481a325-b0c1-472e-87fc-e1714695f26e",
            "7687ad28-2ed9-46b3-a8a2-b1682cdcd665"
          ]
        },
        {
          "uuid": "944a2a81-5c5d-45e0-afca-091139d2960c",
          "code": "C005274",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67005274",
          "code_system": "MESH",
          "references": [
            "1481a325-b0c1-472e-87fc-e1714695f26e"
          ]
        },
        {
          "uuid": "403b624d-9225-4cd1-90a2-539abee85736",
          "code": "NARINGIN DIHYDROCHALCONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Naringin_dihydrochalcone",
          "code_system": "WIKIPEDIA",
          "references": [
            "1481a325-b0c1-472e-87fc-e1714695f26e"
          ]
        },
        {
          "uuid": "0d2c2e3f-ad4d-4b1d-9c6e-c20f7c638b5a",
          "code": "9894584",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9894584",
          "code_system": "PUBCHEM",
          "references": [
            "1481a325-b0c1-472e-87fc-e1714695f26e"
          ]
        },
        {
          "uuid": "782f4c54-58dd-4063-ac83-caa612a753d9",
          "code": "7233QDO0QW",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "75bf91c0-b25e-2999-378b-871193d162bd",
          "code": "DTXSID10940428",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10940428",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "4df2a708-7d8e-7e52-cee1-5b36c63d4960",
          "code": "2181",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/2181/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "21ef8b93-0bc0-f2b4-c3d3-ac9880d0163a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bf68b957-3b5d-498c-8783-1c7cf6f667cc",
          "name": "1-PROPANONE, 1-(4-((2-O-(6-DEOXY-.ALPHA.-L-MANNOPYRANOSYL)-.BETA.-D-GLUCOPYRANOSYL)OXY)-2,6-DIHYDROXYPHENYL)-3-(4-HYDROXYPHENYL)-",
          "stdName": "1-PROPANONE, 1-(4-((2-O-(6-DEOXY-.ALPHA.-L-MANNOPYRANOSYL)-.BETA.-D-GLUCOPYRANOSYL)OXY)-2,6-DIHYDROXYPHENYL)-3-(4-HYDROXYPHENYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b45fea11-ef01-4dc1-8cc2-677e61a0a7d4",
            "0399ebc9-938f-4cd3-9f4a-fd0678a05e9c"
          ],
          "display_name": false
        },
        {
          "uuid": "43e0b002-f9b9-4e30-8164-e82c3b795fcd",
          "name": "FEMA NO. 4495",
          "stdName": "FEMA NO. 4495",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b45fea11-ef01-4dc1-8cc2-677e61a0a7d4",
            "777af22a-1c0c-4a53-b048-8cfb787c47a0"
          ],
          "display_name": false
        },
        {
          "uuid": "e1647229-814b-46e0-aedb-025a371b55ba",
          "name": "GLUCOPYRANOSIDE, 3,5-DIHYDROXY-4-(P-HYDROXYHYDROCINNAMOYL)PHENYL 2-O-(6-DEOXY-.ALPHA.-L-MANNOPYRANOSYL)-, .BETA.-D-",
          "stdName": "GLUCOPYRANOSIDE, 3,5-DIHYDROXY-4-(P-HYDROXYHYDROCINNAMOYL)PHENYL 2-O-(6-DEOXY-.ALPHA.-L-MANNOPYRANOSYL)-, .BETA.-D-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b45fea11-ef01-4dc1-8cc2-677e61a0a7d4",
            "0399ebc9-938f-4cd3-9f4a-fd0678a05e9c"
          ],
          "display_name": false
        },
        {
          "uuid": "eae64054-7a3f-42ec-aa35-56556315f22a",
          "name": "NARINGIN DIHYDROCHALCONE",
          "stdName": "NARINGIN DIHYDROCHALCONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b45fea11-ef01-4dc1-8cc2-677e61a0a7d4",
            "0399ebc9-938f-4cd3-9f4a-fd0678a05e9c"
          ],
          "display_name": true
        },
        {
          "uuid": "e5e0aa66-b808-4f1d-a9c1-ebab4b13e275",
          "name": "PHLORETIN, 4'-(2-O-.ALPHA.-L-RHAMNO-.BETA.-D-GLUCOPYRANOSIDE)",
          "stdName": "PHLORETIN, 4'-(2-O-.ALPHA.-L-RHAMNO-.BETA.-D-GLUCOPYRANOSIDE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b45fea11-ef01-4dc1-8cc2-677e61a0a7d4",
            "0399ebc9-938f-4cd3-9f4a-fd0678a05e9c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0399ebc9-938f-4cd3-9f4a-fd0678a05e9c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b45fea11-ef01-4dc1-8cc2-677e61a0a7d4",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "777af22a-1c0c-4a53-b048-8cfb787c47a0",
          "citation": "http://www.thegoodscentscompany.com/data/rw1600501.html",
          "url": "http://www.thegoodscentscompany.com/data/rw1600501.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1481a325-b0c1-472e-87fc-e1714695f26e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391497000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "61348675-708d-4904-9660-4d9bcb22b47d",
          "citation": "SRS import [7233QDO0QW]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7233QDO0QW",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391497000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7687ad28-2ed9-46b3-a8a2-b1682cdcd665",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "21ef8b93-0bc0-f2b4-c3d3-ac9880d0163a",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "12b1706d-8087-48ec-8f92-b12786fbd982",
          "id": "12b1706d-8087-48ec-8f92-b12786fbd982",
          "molfile": "\n  Marvin  01132101112D          \n\n 41 44  0  0  1  0            999 V2000\n    9.9217   -6.9684    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   10.5770   -7.3593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1921   -7.3370    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5405   -6.9349    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.3416   -7.5975    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1316   -6.9795    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.1316   -6.1828    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.8278   -5.7694    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8278   -4.9318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1204   -4.5073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1204   -3.6771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3571   -3.3085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8502   -3.2079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8502   -2.3926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6021   -2.0017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1540   -1.9459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4465   -2.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7056   -1.9235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7056   -1.0747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9311   -0.6390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2089   -1.0747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4792   -0.6837    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2089   -1.9011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9647   -2.3591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5799   -3.6249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2575   -3.1559    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5799   -4.5260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4353   -5.7918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7503   -6.1828    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.0503   -5.7918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3429   -6.1716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7503   -6.9795    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.0391   -7.3816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4353   -7.3928    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.4353   -8.1858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5405   -6.1380    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.8628   -5.7360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2255   -5.7583    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    9.2255   -4.9839    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9217   -6.1604    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.5882   -5.7806    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n 40  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n 36  4  1  0  0  0  0\n  6  5  1  6  0  0  0\n  6  7  1  0  0  0  0\n  6 34  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7 28  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 27  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 25 13  2  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 24  2  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 21  2  0  0  0  0\n 24 23  1  0  0  0  0\n 25 26  1  0  0  0  0\n 27 25  1  0  0  0  0\n 29 28  1  0  0  0  0\n 29 30  1  1  0  0  0\n 32 29  1  0  0  0  0\n 30 31  1  0  0  0  0\n 32 33  1  6  0  0  0\n 34 32  1  0  0  0  0\n 34 35  1  1  0  0  0\n 36 37  1  6  0  0  0\n 38 36  1  0  0  0  0\n 38 39  1  6  0  0  0\n 38 40  1  0  0  0  0\n 40 41  1  1  0  0  0\nM  END",
          "smiles": "C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@@H](CO)O[C@H]2Oc3cc(c(C(=O)CCc4ccc(cc4)O)c(c3)O)O)O)O)O)O)O",
          "formula": "C27H34O14",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d6ad78b8-b849-425a-ad97-7b37750ec14b"
          },
          "defined_stereo": 10,
          "ez_centers": 0,
          "molecular_weight": "582.5515",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 10
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "706f5be0-df7b-48d0-b68d-774b78a29cbf",
      "version": "4",
      "structure": {
        "id": "d8d4551b-7a79-4247-9758-51fa75705ac2",
        "molfile": "\n  Marvin  01132111142D          \n\n 41 44  0  0  1  0            999 V2000\n    2.4792   -0.6837    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2089   -1.0747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9311   -0.6390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2089   -1.9011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7056   -1.0747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9647   -2.3591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7056   -1.9235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4465   -2.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6021   -2.0017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1540   -1.9459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5882   -5.7806    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8502   -2.3926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5770   -7.3593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2255   -4.9839    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9217   -6.1604    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.3571   -3.3085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2575   -3.1559    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8502   -3.2079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9217   -6.9684    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.8628   -5.7360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2255   -5.7583    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.3429   -6.1716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1204   -3.6771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5799   -3.6249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0391   -7.3816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1921   -7.3370    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5405   -6.1380    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.0503   -5.7918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1204   -4.5073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5799   -4.5260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4353   -8.1858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7503   -6.9795    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.5405   -6.9349    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.7503   -6.1828    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.8278   -4.9318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4353   -7.3928    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.3416   -7.5975    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4353   -5.7918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8278   -5.7694    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1316   -6.9795    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.1316   -6.1828    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n  3  2  1  0  0  0  0\n 19 15  1  0  0  0  0\n 23 18  1  0  0  0  0\n 34 32  1  0  0  0  0\n  2  1  1  0  0  0  0\n  4  2  2  0  0  0  0\n  5  3  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n 10  8  1  0  0  0  0\n 12  9  2  0  0  0  0\n 12 10  1  0  0  0  0\n 15 11  1  1  0  0  0\n 18 12  1  0  0  0  0\n 19 13  1  6  0  0  0\n 21 14  1  6  0  0  0\n 21 15  1  0  0  0  0\n 23 16  1  0  0  0  0\n 24 17  1  0  0  0  0\n 24 18  2  0  0  0  0\n 26 19  1  0  0  0  0\n 27 20  1  6  0  0  0\n 27 21  1  0  0  0  0\n 28 22  1  0  0  0  0\n 29 23  2  0  0  0  0\n 30 24  1  0  0  0  0\n 32 25  1  6  0  0  0\n 33 26  1  0  0  0  0\n 33 27  1  0  0  0  0\n 34 28  1  1  0  0  0\n 35 29  1  0  0  0  0\n 35 30  2  0  0  0  0\n 36 31  1  1  0  0  0\n 36 32  1  0  0  0  0\n 33 37  1  1  0  0  0\n 38 34  1  0  0  0  0\n 39 35  1  0  0  0  0\n 40 36  1  0  0  0  0\n 40 37  1  6  0  0  0\n 41 38  1  0  0  0  0\n 41 39  1  1  0  0  0\n 41 40  1  0  0  0  0\nM  END",
        "smiles": "C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@@H](CO)O[C@H]2Oc3cc(c(C(=O)CCc4ccc(cc4)O)c(c3)O)O)O)O)O)O)O",
        "formula": "C27H34O14",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 10,
        "ez_centers": 0,
        "molecular_weight": "582.5515",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "61348675-708d-4904-9660-4d9bcb22b47d",
          "0399ebc9-938f-4cd3-9f4a-fd0678a05e9c"
        ],
        "stereo_centers": 10
      },
      "unii": "7233QDO0QW"
    }
  ]
}