{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "44f73232-8323-4d54-9592-33c5c0c6dc92",
          "code": "71868-10-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=71868-10-5",
          "code_system": "CAS",
          "references": [
            "441c3d85-1757-4e30-b6d0-7620844232bc",
            "b76ca4e9-3069-43a2-93ab-453c79391c1b"
          ]
        },
        {
          "uuid": "2a5aa629-1661-454b-abf5-bad2df4bbc18",
          "code": "C552725",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67552725",
          "code_system": "MESH",
          "references": [
            "441c3d85-1757-4e30-b6d0-7620844232bc"
          ]
        },
        {
          "uuid": "1ecbcf61-a2b9-447a-bc4a-2bce22d1b671",
          "code": "92387",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/92387",
          "code_system": "PUBCHEM",
          "references": [
            "441c3d85-1757-4e30-b6d0-7620844232bc"
          ]
        },
        {
          "uuid": "2dc7fc17-4c54-70c6-dc37-585202b7287e",
          "code": "DTXSID8038857",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8038857",
          "code_system": "EPA CompTox",
          "references": [
            "c60812ac-9a78-a011-8c1b-5fbf5a7a0ec6"
          ]
        },
        {
          "uuid": "f5b46c47-5433-4d52-b6a8-61dc6e591df0",
          "code": "722CLJ6H6K",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d4da3f60-5dc7-a9a0-a22d-12661714dd34",
          "code": "300000053724",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "2a3b309c-3ddf-0f9f-d7da-aed7d4451a4d"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "720dd498-1915-4542-a976-8118a23f7b6b",
          "amount": {
            "uuid": "f36d89ca-f228-40db-bc8d-d52745a9401a"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "867c88f6-9659-4433-9cb1-9ccdeef0aa13"
          ],
          "related_substance": {
            "uuid": "bc913d19-3d67-41fc-bb3e-21f334a85262",
            "refuuid": "f2c148f8-04ab-459c-bbd9-4f25ccdc5586",
            "name": "1-PROPANONE, 2-METHYL-1-(4-(METHYLTHIO)PHENYL)-2-(4-MORPHOLINYL)-, HYDROCHLORIDE (1:1)",
            "unii": "V529G23NWF",
            "linking_id": "V529G23NWF",
            "ref_pname": "1-PROPANONE, 2-METHYL-1-(4-(METHYLTHIO)PHENYL)-2-(4-MORPHOLINYL)-, HYDROCHLORIDE (1:1)"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4ac89d80-0f89-4841-bae2-8277d05568db",
          "name": "1-PROPANONE, 2-METHYL-1-(4-(METHYLTHIO)PHENYL)-2-(4-MORPHOLINYL)-",
          "stdName": "1-PROPANONE, 2-METHYL-1-(4-(METHYLTHIO)PHENYL)-2-(4-MORPHOLINYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24c65557-adb5-4b8b-bae9-6e1dd4ec9588",
            "de495444-ab17-4894-9ff5-5e32c8549eab"
          ],
          "display_name": false
        },
        {
          "uuid": "dd756ec7-bf68-4705-8386-f197cc2a22db",
          "name": "2-Methyl-4'-(methylthio)-2-morpholinopropiophenone",
          "stdName": "2-METHYL-4'-(METHYLTHIO)-2-MORPHOLINOPROPIOPHENONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e253bb0-2f14-4b96-bccf-9f6b2ab03856"
          ],
          "display_name": true
        },
        {
          "uuid": "31cb2df8-a3b0-4204-9b17-920bd06ba300",
          "name": "CACCURE 907",
          "stdName": "CACCURE 907",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "530324fe-cc59-44a0-89ac-516fc67f4324",
            "de495444-ab17-4894-9ff5-5e32c8549eab"
          ],
          "display_name": false
        },
        {
          "uuid": "c6108dba-5971-4c51-a943-ebf1cc320322",
          "name": "IR-907",
          "stdName": "IR-907",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "530324fe-cc59-44a0-89ac-516fc67f4324",
            "de495444-ab17-4894-9ff5-5e32c8549eab"
          ],
          "display_name": false
        },
        {
          "uuid": "69b9a393-110c-4016-9630-0fde82f16174",
          "name": "IRGANOX 907",
          "stdName": "IRGANOX 907",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "530324fe-cc59-44a0-89ac-516fc67f4324",
            "de495444-ab17-4894-9ff5-5e32c8549eab"
          ],
          "display_name": false
        },
        {
          "uuid": "4a605bd8-1368-49c4-a6fe-ebf4e6e8bf4c",
          "name": "MMMP",
          "stdName": "MMMP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e253bb0-2f14-4b96-bccf-9f6b2ab03856"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "24c65557-adb5-4b8b-bae9-6e1dd4ec9588",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "de495444-ab17-4894-9ff5-5e32c8549eab",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "530324fe-cc59-44a0-89ac-516fc67f4324",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "441c3d85-1757-4e30-b6d0-7620844232bc",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391657000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "55d414e8-67cb-4e5f-b3b5-92bdcd2c526d",
          "citation": "SRS import [722CLJ6H6K]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=722CLJ6H6K",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391657000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a1733147-695e-4b5a-9ea5-9cf7e5135be1",
          "citation": "CHEMID RECORD 71868-10-5",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c60812ac-9a78-a011-8c1b-5fbf5a7a0ec6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=71868-10-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "867c88f6-9659-4433-9cb1-9ccdeef0aa13",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b76ca4e9-3069-43a2-93ab-453c79391c1b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6e253bb0-2f14-4b96-bccf-9f6b2ab03856",
          "citation": "https://www.caymanchem.com/product/31612",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "2a3b309c-3ddf-0f9f-d7da-aed7d4451a4d",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3d8814c0-0d35-4f2c-a7d1-7915117dcbb9",
          "id": "3d8814c0-0d35-4f2c-a7d1-7915117dcbb9",
          "molfile": "\n  Marvin  01132103152D          \n\n 19 20  0  0  0  0            999 V2000\n    1.4878   -7.1155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1893   -6.7031    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8764   -7.1153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5901   -6.7015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3029   -7.1084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3060   -7.9363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5923   -8.3501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8754   -7.9360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0217   -8.3468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0244   -9.1745    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7316   -7.9348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4538   -7.1653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0157   -8.7093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5563   -7.9372    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9729   -7.2217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7936   -7.2257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2050   -7.9408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7955   -8.6521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9676   -8.6524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3  8  2  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  9  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n 10  9  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 19 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C(=O)c1ccc(cc1)SC)N2CCOCC2",
          "formula": "C15H21NO2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "96d204c7-2a5f-4ca3-8300-3c16aa2c79a8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "279.3994",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "00f74af3-78b6-4088-9e11-d198968b6093",
      "version": "7",
      "structure": {
        "id": "46adcb5b-a76c-4491-96af-0544e919ec80",
        "molfile": "\n   JSDraw202252309592D\n\n 19 20  0  0  0  0              0 V2000\n   29.0770   -5.0128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.4880   -5.7645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   29.1843   -8.0961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.7883   -7.3060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5278   -7.2497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8853   -8.0388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.6030   -8.0388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.3740   -9.3233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1704   -8.0388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1704   -9.6104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5278  -10.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8853   -9.6104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8068  -10.3792    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6000   -9.6104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.7883   -5.7645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.4880   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.2266   -7.0406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8402   -9.3233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.2266   -5.4753    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 15  1  0  0  0  0\n  2 16  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 16  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n  4  7  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  9  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n  6 12  1  0  0  0  0\n  7 18  1  0  0  0  0\n  6 17  1  0  0  0  0\n  7 17  1  0  0  0  0\n  4 15  1  0  0  0  0\n 10 13  1  0  0  0  0\n 10 11  1  0  0  0  0\n 17 19  2  0  0  0  0\nM  END",
        "smiles": "CC(C)(C(=O)c1ccc(cc1)SC)N2CCOCC2",
        "formula": "C15H21NO2S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "279.3994",
        "optical_activity": "NONE",
        "references": [
          "55d414e8-67cb-4e5f-b3b5-92bdcd2c526d",
          "a1733147-695e-4b5a-9ea5-9cf7e5135be1"
        ],
        "stereo_centers": 0
      },
      "unii": "722CLJ6H6K"
    }
  ]
}