{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "e7f8ddc1-135c-4f5e-9b78-058a5d3184cc", "code": "1164-38-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1164-38-1", "code_system": "CAS", "references": [ "85720ad4-1939-405e-8169-63ca266b9a10", "2adf5eaf-7b1f-4625-9eea-6c4d396b389c" ] }, { "uuid": "16c399a7-60c1-4cad-b0c4-bf03f4d04fee", "code": "C81456", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C81456", "code_system": "NCI_THESAURUS", "references": [ "85720ad4-1939-405e-8169-63ca266b9a10" ] }, { "uuid": "101d59d9-e176-41f3-8dd0-ae04bc2bee9d", "code": "C005089", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67005089", "code_system": "MESH", "references": [ "85720ad4-1939-405e-8169-63ca266b9a10" ] }, { "uuid": "2671de9a-b324-4c5e-828c-3865927eaf9b", "code": "214-610-1", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.013.282", "code_system": "ECHA (EC/EINECS)", "references": [ "85720ad4-1939-405e-8169-63ca266b9a10" ] }, { "uuid": "4307ed42-c61b-443e-a34c-53d74f241a38", "code": "103231", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/103231/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "85720ad4-1939-405e-8169-63ca266b9a10" ] }, { "uuid": "b062ac32-3b8a-4918-8de1-e250f29e3327", "code": "m791", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m791?q=authorize", "code_system": "MERCK INDEX", "references": [ "85720ad4-1939-405e-8169-63ca266b9a10" ] }, { "uuid": "f26750b2-4ccf-4f9e-a87c-d2430903a5f0", "code": "CHEMBL2110848", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2110848", "code_system": "ChEMBL", "references": [ "85720ad4-1939-405e-8169-63ca266b9a10" ] }, { "uuid": "f0c40a84-798f-4524-a379-99f6053f1e5e", "code": "14415", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/14415", "code_system": "PUBCHEM", "references": [ "85720ad4-1939-405e-8169-63ca266b9a10" ] }, { "uuid": "f7f89008-0cec-60e5-4580-6c8c03588dd8", "code": "C66880", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anticholinergic Agent", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66880", "code_system": "NCI_THESAURUS", "references": [ "1b6eae81-678a-0693-a59c-d87af2dc6806" ] }, { "uuid": "c5c49865-dbc2-43ed-9102-df89eb119c53", "code": "720J8565ZF", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "4814df23-e62f-43e7-58a6-811a4a2487f2", "code": "DTXSID60922037", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60922037", "code_system": "EPA CompTox", "references": [ "1b6eae81-678a-0693-a59c-d87af2dc6806" ] } ], "relationships": [ { "uuid": "6f660279-6f3f-4878-9df0-e46d63a3ee34", "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "76800589-bd00-4b38-8f01-09055027d8b3", "refuuid": "bda5f4ea-6627-45c4-b1e2-1d3e78984582", "name": "LACHESINE", "unii": "676774V4XX", "linking_id": "676774V4XX", "ref_pname": "LACHESINE", "substance_class": "reference" } }, { "uuid": "4441d8d8-e8e7-4533-a212-cac35b501317", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "60a9f600-3a20-47ae-b92e-7c86762fb9b0", "refuuid": "bda5f4ea-6627-45c4-b1e2-1d3e78984582", "name": "LACHESINE", "unii": "676774V4XX", "linking_id": "676774V4XX", "ref_pname": "LACHESINE", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "f37ce741-0eea-443f-95b1-d9a3b77bc399", "name": "(2-BENZILOYLOXYETHYL)ETHYLDIMETHYLAMMONIUM CHLORIDE", "stdName": "(2-BENZILOYLOXYETHYL)ETHYLDIMETHYLAMMONIUM CHLORIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1e2279f2-7b00-4da7-a2e5-a3cb19cf0f31" ], "display_name": false }, { "uuid": "9ee54189-3d1e-4caf-a4a1-7942203a8662", "name": "LACHESINE CHLORIDE", "stdName": "LACHESINE CHLORIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1e2279f2-7b00-4da7-a2e5-a3cb19cf0f31", "127a6074-f84d-4af0-915a-f390be918a53", "ec458145-8e77-4e94-857d-8950f1c6ddd2" ], "display_name": true }, { "uuid": "63346500-d2e9-4bbf-9a86-51f6da884c92", "name": "LACHESINE CHLORIDE [MART.]", "stdName": "LACHESINE CHLORIDE [MART.]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "127a6074-f84d-4af0-915a-f390be918a53" ], "display_name": false }, { "uuid": "3b153446-20ae-412f-a459-ddd5aa030298", "name": "LACHESINE [MI]", "stdName": "LACHESINE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a561ccc1-0245-449f-b771-c0bf7c5fb52a", "a4b36740-7808-4f5b-a936-a53b711cda1d" ], "display_name": false } ], "references": [ { "uuid": "1e2279f2-7b00-4da7-a2e5-a3cb19cf0f31", "citation": "USP DICTIONARY 2008", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "127a6074-f84d-4af0-915a-f390be918a53", "citation": "MARTINDALE 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a4b36740-7808-4f5b-a936-a53b711cda1d", "citation": "MERCK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a561ccc1-0245-449f-b771-c0bf7c5fb52a", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "85720ad4-1939-405e-8169-63ca266b9a10", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390708000, "tags": [ "NOMEN" ] }, { "uuid": "73b36c03-e9d2-4707-aea6-8f7ca4ca60e3", "citation": "SRS import [720J8565ZF]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=720J8565ZF", "doc_type": "SRS", "public_domain": true, "document_date": 1493390708000, "tags": [ "NOMEN" ] }, { "uuid": "ec458145-8e77-4e94-857d-8950f1c6ddd2", "citation": "LACHESINE CHLORIDE [MART.]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "1b6eae81-678a-0693-a59c-d87af2dc6806", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "2adf5eaf-7b1f-4625-9eea-6c4d396b389c", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "614030f7-4b06-47d9-b727-76b176274247", "id": "614030f7-4b06-47d9-b727-76b176274247", "molfile": "\n Marvin 01132105022D \n\n 1 0 0 0 0 0 999 V2000\n 5.8856 1.3417 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\nM END", "smiles": "Cl", "formula": "ClH", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "350e0a66-74aa-4374-8365-29d3c516be35" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "36.4609", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "37d19473-09bf-485e-910a-c6cc8d6e8259", "id": "37d19473-09bf-485e-910a-c6cc8d6e8259", "molfile": "\n Marvin 01132102582D \n\n 24 25 0 0 0 0 999 V2000\n 5.6382 -1.7015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6382 -0.8829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9237 -0.4689 0.0000 N 0 3 0 0 0 0 0 0 0 3 0 0\n 5.3398 0.2572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5120 -1.1766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2114 -0.0527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5061 -0.4689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7776 -0.0527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0538 -0.4689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0399 -1.2992 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3276 -0.0366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8998 -0.7626 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 0.6085 0.3913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1061 -0.0249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8184 0.3913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8184 1.2076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1061 1.6239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6085 1.2076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7485 0.6850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5764 0.6850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9926 1.3973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5764 2.1094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7485 2.1094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3462 1.3973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 5 1 0 0 0 0\n 6 3 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 2 0 0 0 0\n 11 9 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 11 19 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 18 2 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 17 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 24 2 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 23 22 2 0 0 0 0\n 24 23 1 0 0 0 0\nM CHG 2 3 1 12 -1\nM END", "smiles": "CC[N+](C)(C)CCOC(=O)C(c1ccccc1)(c2ccccc2)[O-]", "formula": "C20H25NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "b270dca0-f8f6-4aa6-bf96-1388a6f59228" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "327.4182", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "96c27382-5ab7-42eb-90cb-10ea67b1fa29", "version": "4", "structure": { "id": "169639ef-0bb3-41b4-ab2b-1f92494c6286", "molfile": "\n Marvin 01132101222D \n\n 25 25 0 0 0 0 999 V2000\n 1.3276 -0.0366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6085 0.3913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7485 0.6850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0538 -0.4689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8998 -0.7626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6085 1.2076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1061 -0.0249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3462 1.3973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5764 0.6850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7776 -0.0527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0399 -1.2992 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1061 1.6239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8184 0.3913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7485 2.1094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9926 1.3973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5061 -0.4689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8184 1.2076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5764 2.1094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2114 -0.0527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9237 -0.4689 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 5.6382 -0.8829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3398 0.2572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5120 -1.1766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6382 -1.7015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8856 1.3417 0.0000 Cl 0 5 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 1 4 1 0 0 0 0\n 1 5 1 0 0 0 0\n 2 6 2 0 0 0 0\n 2 7 1 0 0 0 0\n 3 8 1 0 0 0 0\n 3 9 2 0 0 0 0\n 4 10 1 0 0 0 0\n 4 11 2 0 0 0 0\n 6 12 1 0 0 0 0\n 7 13 2 0 0 0 0\n 8 14 2 0 0 0 0\n 9 15 1 0 0 0 0\n 10 16 1 0 0 0 0\n 12 17 2 0 0 0 0\n 14 18 1 0 0 0 0\n 16 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 22 1 0 0 0 0\n 20 23 1 0 0 0 0\n 21 24 1 0 0 0 0\n 13 17 1 0 0 0 0\n 15 18 2 0 0 0 0\nM CHG 2 20 1 25 -1\nM END", "smiles": "CC[N+](C)(C)CCOC(=O)C(c1ccccc1)(c2ccccc2)O.[Cl-]", "formula": "C20H26NO3.Cl", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "363.879", "optical_activity": "NONE", "references": [ "1e2279f2-7b00-4da7-a2e5-a3cb19cf0f31", "73b36c03-e9d2-4707-aea6-8f7ca4ca60e3" ], "stereo_centers": 0 }, "unii": "720J8565ZF" } ] }