{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6195f8d8-42ad-46c0-8bf3-385e86d1397a",
          "code": "64249-01-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=64249-01-0",
          "code_system": "CAS",
          "references": [
            "d3056628-b2d0-4bd8-bc35-b60fb27cf2d9",
            "b9304c47-ab30-48b7-82f6-b7dcd7525f45"
          ]
        },
        {
          "uuid": "34b90c49-3cc8-423f-94df-f7eaf5ef62bc",
          "code": "C435690",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67435690",
          "code_system": "MESH",
          "references": [
            "d3056628-b2d0-4bd8-bc35-b60fb27cf2d9"
          ]
        },
        {
          "uuid": "443c24d8-c4c9-4137-ab8e-df8aee3bc32a",
          "code": "264-756-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.058.851",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d3056628-b2d0-4bd8-bc35-b60fb27cf2d9"
          ]
        },
        {
          "uuid": "76230d6b-616e-42de-918b-125a957810a1",
          "code": "91687",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91687",
          "code_system": "PUBCHEM",
          "references": [
            "d3056628-b2d0-4bd8-bc35-b60fb27cf2d9"
          ]
        },
        {
          "uuid": "ab2d4a2e-1fbe-d19a-656f-8774e7313c9e",
          "code": "DTXSID5058149",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5058149",
          "code_system": "EPA CompTox",
          "references": [
            "027524fe-6afa-a429-2ea3-a7699df04ec1"
          ]
        },
        {
          "uuid": "e4f83b0c-db9d-45d6-aa41-d8644079c2ab",
          "code": "71W48U40S6",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d5f1b62f-24f1-a70f-546f-877007363710",
          "code": "anilofos",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/anilofos.html",
          "code_system": "ALANWOOD",
          "references": [
            "3e9a1e78-b5e4-cace-3973-4cbdfdf7ca58"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fdb44645-cbd8-4536-9a50-b5ab7131b3b4",
          "name": "ANILOFOS",
          "stdName": "ANILOFOS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0585b586-2b5e-4e26-a9f5-1a93d01119ae",
            "f2985092-70c9-487b-ab6a-760cb81a51c2",
            "47af5b2f-7a47-419f-961f-8b3d29635975",
            "c8a0652e-ea6a-455c-8cc7-7694738a552a"
          ],
          "display_name": true
        },
        {
          "uuid": "f5190ee2-d96f-4a43-8039-caa86793a025",
          "name": "ANILOFOS [ISO]",
          "stdName": "ANILOFOS [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f2985092-70c9-487b-ab6a-760cb81a51c2",
            "47af5b2f-7a47-419f-961f-8b3d29635975"
          ],
          "display_name": false
        },
        {
          "uuid": "3a288d58-264e-4c50-a0e6-9b69837bdfed",
          "name": "S-(2-((4-CHLOROPHENYL)(1-METHYLETHYL)AMINO)-2-OXOETHYL) O,O-DIMETHYL PHOSPHORODITHIOATE",
          "stdName": "S-(2-((4-CHLOROPHENYL)(1-METHYLETHYL)AMINO)-2-OXOETHYL) O,O-DIMETHYL PHOSPHORODITHIOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0498d613-59d3-4ce7-83b6-8f3ec36b248f",
            "82e19eec-a1a9-47a9-8ca7-8f2c19ebf5d9"
          ],
          "display_name": false
        },
        {
          "uuid": "3245e7a5-10e9-4042-b993-03f306a8fa69",
          "name": "S-4-CHLORO-N-ISOPROPYLCARBANILOYLMETHYL O,O-DIMETHYL PHOSPHORODITHIOATE",
          "stdName": "S-4-CHLORO-N-ISOPROPYLCARBANILOYLMETHYL O,O-DIMETHYL PHOSPHORODITHIOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0498d613-59d3-4ce7-83b6-8f3ec36b248f",
            "aabb0d50-14e1-40d1-b605-9ce84cca1b90"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "47af5b2f-7a47-419f-961f-8b3d29635975",
          "citation": "http://www.alanwood.net/pesticides/anilofos.html",
          "url": "http://www.alanwood.net/pesticides/anilofos.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f2985092-70c9-487b-ab6a-760cb81a51c2",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d3056628-b2d0-4bd8-bc35-b60fb27cf2d9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390942000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b86e2cca-825b-45d4-99f7-faf59fd725ea",
          "citation": "SRS import [71W48U40S6]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=71W48U40S6",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390942000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2c81bc27-d4b4-47b0-8b0b-339bf46b1c6e",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0585b586-2b5e-4e26-a9f5-1a93d01119ae",
          "citation": "ANILOFOS [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c8a0652e-ea6a-455c-8cc7-7694738a552a",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0498d613-59d3-4ce7-83b6-8f3ec36b248f",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aabb0d50-14e1-40d1-b605-9ce84cca1b90",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "82e19eec-a1a9-47a9-8ca7-8f2c19ebf5d9",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "027524fe-6afa-a429-2ea3-a7699df04ec1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=64249-01-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3e9a1e78-b5e4-cace-3973-4cbdfdf7ca58",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "b9304c47-ab30-48b7-82f6-b7dcd7525f45",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2f603a17-650b-455e-a201-686543e6ec8f",
          "id": "2f603a17-650b-455e-a201-686543e6ec8f",
          "molfile": "\n  Marvin  01132102332D          \n\n 21 21  0  0  0  0            999 V2000\n   10.2270   -5.3216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4018   -5.3216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9916   -4.6059    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5768   -3.8855    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7072   -4.1911    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4618   -4.1911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2759   -5.0160    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5582   -4.6012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8470   -5.0115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8470   -5.8310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1259   -4.5953    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1259   -3.7758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4124   -3.3597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8448   -3.3611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4102   -5.0055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6966   -4.5915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9809   -5.0064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9809   -5.8305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2666   -6.2432    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.6945   -6.2399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4102   -5.8343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  7  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11  9  1  0  0  0  0\n 11 12  1  0  0  0  0\n 15 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 21 15  2  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
          "smiles": "CC(C)N(c1ccc(cc1)Cl)C(=O)CSP(=S)(OC)OC",
          "formula": "C13H19ClNO3PS2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "55bdffef-1d92-4b2c-81c3-9971ae3221b4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "367.8542",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "207532cf-84aa-4aca-bc3e-3394d1f1a88b",
      "version": "4",
      "structure": {
        "id": "3b58a099-5ea8-42df-ab1d-43987e0076dc",
        "molfile": "\n  Marvin  01132103092D          \n\n 21 21  0  0  0  0            999 V2000\n    4.6966   -4.5915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9809   -5.0064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9809   -5.8305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2666   -6.2432    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.6945   -6.2399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4102   -5.8343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4102   -5.0055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1259   -4.5953    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1259   -3.7758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4124   -3.3597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8448   -3.3611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8470   -5.0115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8470   -5.8310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5582   -4.6012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2759   -5.0160    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9916   -4.6059    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5768   -3.8855    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4018   -5.3216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2270   -5.3216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7072   -4.1911    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4618   -4.1911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  1  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  8 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 16 20  1  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
        "smiles": "CC(C)N(c1ccc(cc1)Cl)C(=O)CSP(=S)(OC)OC",
        "formula": "C13H19ClNO3PS2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "367.8542",
        "optical_activity": "NONE",
        "references": [
          "2c81bc27-d4b4-47b0-8b0b-339bf46b1c6e",
          "b86e2cca-825b-45d4-99f7-faf59fd725ea"
        ],
        "stereo_centers": 0
      },
      "unii": "71W48U40S6"
    }
  ]
}