{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "7739a7c2-672d-4965-8949-6640666f5d94", "code": "N02AA09", "comments": "ATC|NERVOUS SYSTEM|ANALGESICS|OPIOIDS|Natural opium alkaloids|diamorphine", "type": "SUPERSEDED", "code_system": "WHO-ATC", "references": [ "b00dcbce-6e9b-47c5-a3bb-f75e52056097" ] }, { "uuid": "6d6939c8-1c62-4a31-bd87-2ee78bb656c3", "code": "QN07BC06", "comments": "VATC|OTHER NERVOUS SYSTEM DRUGS|DRUGS USED IN ADDICTIVE DISORDERS|Drugs used in opioid dependence|diamorphine", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN07BC06&showdescription=yes", "code_system": "WHO-VATC", "references": [ "b00dcbce-6e9b-47c5-a3bb-f75e52056097" ] }, { "uuid": "d3834521-6e79-419a-a2ef-42d8ac40d6ab", "code": "561-27-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=561-27-3", "code_system": "CAS", "references": [ "b00dcbce-6e9b-47c5-a3bb-f75e52056097", "8f262f7d-9895-4432-9c38-6c166fab1691" ] }, { "uuid": "67875e73-cff1-492c-ab7d-79930f29e4fa", "code": "C424", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C424", "code_system": "NCI_THESAURUS", "references": [ "b00dcbce-6e9b-47c5-a3bb-f75e52056097" ] }, { "uuid": "18023989-a30d-4754-a962-7fee90540f21", "code": "N07BC06", "comments": "ATC|NERVOUS SYSTEM|OTHER NERVOUS SYSTEM DRUGS|DRUGS USED IN ADDICTIVE DISORDERS|Drugs used in opioid dependence|diamorphine", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=N07BC06&showdescription=yes", "code_system": "WHO-ATC", "references": [ "b00dcbce-6e9b-47c5-a3bb-f75e52056097" ] }, { "uuid": "dcbd4d04-a5dd-4a89-b4ef-d7f5708a7965", "code": "D003932", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/68003932", "code_system": "MESH", "references": [ "b00dcbce-6e9b-47c5-a3bb-f75e52056097" ] }, { "uuid": "8cd4450b-ba5c-4537-83c4-65b496f306cd", "code": "HEROIN", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Heroin", "code_system": "WIKIPEDIA", "references": [ "b00dcbce-6e9b-47c5-a3bb-f75e52056097" ] }, { "uuid": "72f86cbd-6e96-4c6d-a3b0-0e904a6649ec", "code": "9200", "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule I.|Opium derivatives", "type": "PRIMARY", "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111", "code_system": "DEA NO.", "references": [ "b00dcbce-6e9b-47c5-a3bb-f75e52056097" ] }, { "uuid": "ad7d8af3-a60a-4705-bb86-a3015439e4f6", "code": "209-217-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.380", "code_system": "ECHA (EC/EINECS)", "references": [ "b00dcbce-6e9b-47c5-a3bb-f75e52056097" ] }, { "uuid": "6a4c0bf7-81dd-47d7-a8a3-a3617bc14fe7", "code": "3304", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/3304/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "b00dcbce-6e9b-47c5-a3bb-f75e52056097" ] }, { "uuid": "6b77845d-a364-4ba1-b0dc-196454e91e33", "code": "m4241", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m4241?q=authorize", "code_system": "MERCK INDEX", "references": [ "b00dcbce-6e9b-47c5-a3bb-f75e52056097" ] }, { "uuid": "77c2c07e-29ca-4ba5-a2e2-b411491d3510", "code": "DB01452", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB01452", "code_system": "DRUG BANK", "references": [ "b00dcbce-6e9b-47c5-a3bb-f75e52056097" ] }, { "uuid": "33ed062a-a18a-4fa2-8154-86e7366624ac", "code": "SUB13556MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "b00dcbce-6e9b-47c5-a3bb-f75e52056097" ] }, { "uuid": "8b9f85f4-4edb-47d6-a97c-3f0520ce6a1c", "code": "CHEMBL459324", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL459324", "code_system": "ChEMBL", "references": [ "b00dcbce-6e9b-47c5-a3bb-f75e52056097" ] }, { "uuid": "b063a2d3-76ba-4d6e-9bfc-acc128bc296e", "code": "5462328", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5462328", "code_system": "PUBCHEM", "references": [ "b00dcbce-6e9b-47c5-a3bb-f75e52056097" ] }, { "uuid": "e118b0a2-ddb9-3ade-e2ac-71ed1dd35723", "code": "6473", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6473", "code_system": "HSDB", "references": [ "6d06d922-4804-83b0-1a9b-194be1ca1f7c" ] }, { "uuid": "e283174d-4d54-fcc3-be4a-9edbc13375b5", "code": "DTXSID6046761", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6046761", "code_system": "EPA CompTox", "references": [ "336ec424-a9da-650f-a7d1-f9a7203e3fdb" ] }, { "uuid": "2641549f-b112-257a-8557-63e0fe6e7016", "code": "C1657", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Opioid Receptor Agonist[C67413]|Opiate", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1657", "code_system": "NCI_THESAURUS", "references": [ "9b91a04b-5204-453c-919f-949954f24d78" ] }, { "uuid": "ffe44cc6-75d7-e619-c934-e42747efc207", "code": "Heroin", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM1205/", "code_system": "LACTMED", "references": [ "9b91a04b-5204-453c-919f-949954f24d78" ] }, { "uuid": "3d7ef166-144d-ba98-c042-85fb401ed281", "code": "4412", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/4412", "code_system": "DRUG CENTRAL", "references": [ "9b91a04b-5204-453c-919f-949954f24d78" ] }, { "uuid": "0a8204bc-4caa-459e-8811-282fd38ffec7", "code": "70D95007SX", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "d481b98b-b151-a82a-eabd-0d2deedea1ad", "code": "27808", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:27808", "code_system": "CHEBI", "references": [ "9b91a04b-5204-453c-919f-949954f24d78" ] }, { "uuid": "f6f8bcae-fcb0-bffa-db3d-41beec32f8c1", "code": "100000079547", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "55f8bff9-c9f5-892a-30cd-fbe16e1ce963" ] } ], "relationships": [ { "uuid": "9a7250d6-39cb-41b7-8e9a-fd2d666fdf07", "amount": { "uuid": "6ae84808-1f37-4e94-a0eb-66e4e2d59906" }, "type": "ACTIVE MOIETY", "related_substance": { "uuid": "77f8cdd6-e6d7-4aef-9824-f3617ad8cf9c", "refuuid": "edd3c0c6-17f2-4514-a3df-81e9d7a0edb0", "name": "MORPHINE", "unii": "76I7G6D29C", "linking_id": "76I7G6D29C", "ref_pname": "MORPHINE", "substance_class": "reference" } }, { "uuid": "205b27e6-aef4-41e3-b6c6-b9e523323f29", "amount": { "uuid": "848c3179-eb74-4481-90bd-96c2b777d46a" }, "type": "METABOLITE ACTIVE->PRODRUG", "references": [ "8c87fdea-2b5d-4766-9c1e-54d277343122" ], "related_substance": { "uuid": "954fa57f-85ac-4916-931a-7ba6572bb0b3", "refuuid": "edd3c0c6-17f2-4514-a3df-81e9d7a0edb0", "name": "MORPHINE", "unii": "76I7G6D29C", "linking_id": "76I7G6D29C", "ref_pname": "MORPHINE", "substance_class": "reference" } }, { "uuid": "6b67fe3c-1b87-468e-b86a-3edecd5e329c", "amount": { "uuid": "c770d97e-a816-41da-8175-9870bfb06e0e" }, "comments": "6-MAM is a metabolite unique to heroin", "type": "METABOLITE ACTIVE->PRODRUG", "references": [ "d0ec7c17-8157-4e69-a88f-e1bf705b43b2" ], "related_substance": { "uuid": "1a3d3a78-29d7-4183-a657-f00a5dd60b59", "refuuid": "01a5992a-4ac3-43b4-ae7c-1ec6d9aafe1f", "name": "6-ACETYLMORPHINE", "unii": "M5E47P1ZCH", "linking_id": "M5E47P1ZCH", "ref_pname": "6-ACETYLMORPHINE", "substance_class": "reference" } }, { "uuid": "5725d4a2-dcae-41be-9695-c98e665cc0e4", "amount": { "uuid": "8ff58838-e1b4-4beb-94d2-6d66f31d5c02", "average": 0, "units": "%" }, "comments": "Reported not to bind to serum proteins", "type": "BINDER->LIGAND", "interaction_type": "BINDING", "references": [ "89b2e746-a767-b55e-e159-fec8e3cbff3e" ], "related_substance": { "uuid": "8162421f-72f2-4cd1-8ebb-a60189e5e1e7", "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30", "name": "PLASMA PROTEIN FRACTION (HUMAN)", "unii": "6D53G0FD0Z", "linking_id": "6D53G0FD0Z", "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)", "substance_class": "reference" } }, { "uuid": "93cec64f-3d31-4888-8feb-a7f93a6b0326", "amount": { "uuid": "296cffeb-5ea7-4f0a-8614-e1777c222514" }, "type": "METABOLITE LESS ACTIVE->PARENT", "related_substance": { "uuid": "0c84fa77-c9e6-48ca-8e4a-749973f886f7", "refuuid": "0bbc719a-3b3f-46aa-afc4-ec98c6906eef", "name": "3-MONOACETYLMORPHINE", "unii": "9N7243EY5T", "linking_id": "9N7243EY5T", "ref_pname": "3-MONOACETYLMORPHINE", "substance_class": "reference" } }, { "uuid": "b08c8017-4ac1-4771-88dc-8998d4ac2707", "amount": { "uuid": "e013705b-6bde-4279-ab46-9eddac0d395d" }, "type": "SALT/SOLVATE->PARENT", "references": [ "367172cd-9fb7-4ccd-b55e-c8cab5875b16" ], "related_substance": { "uuid": "b1ceb7a6-6bb9-4963-bb5a-46adc8e299e5", "refuuid": "5abb3452-2e58-4cf6-bdf2-e85bce3971e1", "name": "DIAMORPHINE HYDROCHLORIDE ANHYDROUS", "unii": "8H672SHT8E", "linking_id": "8H672SHT8E", "ref_pname": "DIAMORPHINE HYDROCHLORIDE ANHYDROUS" } }, { "uuid": "8c4ea566-ac2b-4f2d-bb89-b3082311fc48", "amount": { "uuid": "ddde8075-e18c-4cc3-9b09-8e15423ee85c" }, "type": "METABOLITE->PARENT", "references": [ "2aa41110-4089-40c2-99b0-b5a0a7c0e530" ], "related_substance": { "uuid": "ccdb91cd-d03d-4675-91b2-7762bca79e23", "refuuid": "c7788cb4-e04c-4641-bd83-75095810c17d", "name": "MORPHINE-3-GLUCURONIDE", "unii": "O27Z9CH39A", "linking_id": "O27Z9CH39A", "ref_pname": "MORPHINE-3-GLUCURONIDE", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "b0e69e47-2b95-41f6-882f-4be929a0ec4e", "name": "(5.ALPHA.,6.ALPHA.)-7,8-DIDEHYDRO-4,5-EPOXY-17-METHYLMORPHINAN-3,6-DIOL DIACETATE (ESTER)", "stdName": "(5.ALPHA.,6.ALPHA.)-7,8-DIDEHYDRO-4,5-EPOXY-17-METHYLMORPHINAN-3,6-DIOL DIACETATE (ESTER)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ad81c91f-5f15-49ae-b326-ee6adfc73022" ], "display_name": false }, { "uuid": "fcd86d5f-feb1-42e6-b381-3449851f7524", "name": "ACETOMORPHINE", "stdName": "ACETOMORPHINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ad81c91f-5f15-49ae-b326-ee6adfc73022" ], "display_name": false }, { "uuid": "d0d9e054-67f1-4830-84f1-bb281ff6bada", "name": "CHINA WHITE", "stdName": "CHINA WHITE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7170db24-3c29-46a4-b7ca-b4a66d029878" ], "display_name": false }, { "uuid": "680d65f6-bb91-45f1-8232-03868917b2ea", "name": "DIACETYLMORPHINE", "stdName": "DIACETYLMORPHINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0bc9c187-339f-4905-b47d-6b937dfb85ac", "598016ef-a992-4a1b-ad7a-924ec5c87aec", "03b04bf5-41ac-4a29-a46c-4fe2fbc56d44" ], "display_name": false }, { "uuid": "719ea70a-2925-4ca9-9b17-f9252530eaf9", "name": "DIACETYLMORPHINE [MI]", "stdName": "DIACETYLMORPHINE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "598016ef-a992-4a1b-ad7a-924ec5c87aec" ], "display_name": false }, { "uuid": "dfc6013c-ffcd-4828-888e-b68313f996e6", "name": "DIAMORPHINE", "stdName": "DIAMORPHINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ee5af431-d490-45b0-84a7-7dfa43ef5117", "ad81c91f-5f15-49ae-b326-ee6adfc73022", "ebbb4ee9-35a3-4f0c-b43f-f8fd3e76ee3b" ], "display_name": true }, { "uuid": "5bf7f9c7-83fd-49ec-b95e-25d9e198f900", "name": "DIAMORPHINE-", "stdName": "DIAMORPHINE-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c6577a8d-ef0a-4a8d-a981-d3dc9a0e6935" ], "display_name": false }, { "uuid": "0adc4a3f-f5f6-4e24-9b5a-e3b246bed517", "name": "DIAPHORM", "stdName": "DIAPHORM", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c6577a8d-ef0a-4a8d-a981-d3dc9a0e6935" ], "display_name": false }, { "uuid": "aa7f45f3-7055-a0e3-7c13-c79768faa2fa", "name": "Diamorphine [WHO-DD]", "stdName": "DIAMORPHINE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "20c2d097-c817-2416-0a23-8dee4af672b7" ], "display_name": false }, { "uuid": "9ac7b58b-c4ce-458a-ac3d-516148fc3470", "name": "ECLORION", "stdName": "ECLORION", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c6577a8d-ef0a-4a8d-a981-d3dc9a0e6935" ], "display_name": false }, { "uuid": "d3898b3c-7273-4dde-ad22-95bb4fafb9f1", "name": "HEROIN", "stdName": "HEROIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0bc9c187-339f-4905-b47d-6b937dfb85ac", "21c0a722-c1d1-40ae-a6b8-1d24958eaa25", "ec6734d6-bd3a-4a32-9dcb-eb41a7e15820" ], "display_name": false }, { "uuid": "9cc6c72c-d8bb-4666-a1e2-71627c241f2c", "name": "HEROIN [HSDB]", "stdName": "HEROIN [HSDB]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "21c0a722-c1d1-40ae-a6b8-1d24958eaa25" ], "display_name": false }, { "uuid": "fc39e545-f53f-4264-9447-fe63e2c51177", "name": "IDS-NH-001", "stdName": "IDS-NH-001", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "02922847-a060-4da0-8f46-e7634e268f87" ], "display_name": false }, { "uuid": "8658ddc4-a293-49e3-9afb-042dff08f604", "name": "IDS-NH-001(SECT.3)", "stdName": "IDS-NH-001(SECT.3)", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "02922847-a060-4da0-8f46-e7634e268f87" ], "display_name": false }, { "uuid": "fcbcb625-ae7d-49b2-8e6f-a8652dd65a6d", "name": "J6.494G", "stdName": "J6.494G", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "1bfedad8-7361-4ee8-b682-f5b761689605" ], "display_name": false }, { "uuid": "ff77cb8e-89d0-42ca-81fa-fe3426fca339", "name": "MORPHACETIN", "stdName": "MORPHACETIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c6577a8d-ef0a-4a8d-a981-d3dc9a0e6935" ], "display_name": false } ], "references": [ { "uuid": "d0ec7c17-8157-4e69-a88f-e1bf705b43b2", "citation": "https://en.wikipedia.org/wiki/Heroin", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+561-27-3", "doc_type": "WIKI", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "02922847-a060-4da0-8f46-e7634e268f87", "citation": "INCB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c6577a8d-ef0a-4a8d-a981-d3dc9a0e6935", "citation": "SCIFINDER", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7170db24-3c29-46a4-b7ca-b4a66d029878", "citation": "SCIFIINDER", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ebbb4ee9-35a3-4f0c-b43f-f8fd3e76ee3b", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1bfedad8-7361-4ee8-b682-f5b761689605", "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J6.494G", "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J6.494G", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b00dcbce-6e9b-47c5-a3bb-f75e52056097", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389650000, "tags": [ "NOMEN" ] }, { "uuid": "faa7e94c-2656-48ca-a566-9e340592614f", "citation": "SRS import [70D95007SX]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=70D95007SX", "doc_type": "SRS", "public_domain": true, "document_date": 1493389650000, "tags": [ "NOMEN" ] }, { "uuid": "03b04bf5-41ac-4a29-a46c-4fe2fbc56d44", "citation": "DIACETYLMORPHINE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "ec6734d6-bd3a-4a32-9dcb-eb41a7e15820", "citation": "HEROIN [HSDB]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "ee5af431-d490-45b0-84a7-7dfa43ef5117", "citation": "DIAMORPHINE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "0bc9c187-339f-4905-b47d-6b937dfb85ac", "citation": "USP DICTIONARY 2009", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "ad81c91f-5f15-49ae-b326-ee6adfc73022", "citation": "Merck 14.3", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "598016ef-a992-4a1b-ad7a-924ec5c87aec", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "21c0a722-c1d1-40ae-a6b8-1d24958eaa25", "citation": "HSDB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6d06d922-4804-83b0-1a9b-194be1ca1f7c", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+561-27-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "336ec424-a9da-650f-a7d1-f9a7203e3fdb", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=561-27-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "89b2e746-a767-b55e-e159-fec8e3cbff3e", "citation": "https://en.wikipedia.org/wiki/Heroin", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+561-27-3", "doc_type": "WIKI", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "55f8bff9-c9f5-892a-30cd-fbe16e1ce963", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "9b91a04b-5204-453c-919f-949954f24d78", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "8f262f7d-9895-4432-9c38-6c166fab1691", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "367172cd-9fb7-4ccd-b55e-c8cab5875b16", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "20c2d097-c817-2416-0a23-8dee4af672b7", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "8c87fdea-2b5d-4766-9c1e-54d277343122", "citation": "https://en.wikipedia.org/wiki/Heroin", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+561-27-3", "doc_type": "WIKI", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "2aa41110-4089-40c2-99b0-b5a0a7c0e530", "citation": "Rook, Elisabeth J., et al. \"Pharmacokinetics and pharmacodynamics of high doses of pharmaceutically prepared heroin, by intravenous or by inhalation route in opioid‐dependent patients.\" Basic & clinical pharmacology & toxicology 98.1 (2006): 86-96.", "url": "https://onlinelibrary.wiley.com/doi/pdfdirect/10.1111/j.1742-7843.2006.pto_233.x", "doc_type": "JA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "5607c880-3ff7-4df5-983d-aad59eee58db", "id": "5607c880-3ff7-4df5-983d-aad59eee58db", "molfile": "\n Marvin 01132104282D \n\n 27 31 0 0 1 0 999 V2000\n 8.8436 -8.3653 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.9502 -9.0278 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1772 -8.3051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6391 -7.6174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2576 -6.9148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6993 -6.2522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4972 -6.2522 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 8.7582 -5.5395 0.0000 N 0 0 2 0 0 0 0 0 0 0 0 0\n 8.1108 -4.9221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7420 -5.5395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1297 -7.6174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4722 -7.6174 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 8.8888 -6.9699 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 9.6867 -6.9699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0682 -7.7278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6265 -8.3653 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 10.3795 -9.0629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2327 -8.7969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8851 -9.3992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4234 -7.9236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3893 -6.9148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9676 -7.5873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3743 -8.3051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7368 -8.9324 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8885 -8.6665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2311 -9.2737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6928 -7.7981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 12 1 0 0 0 0\n 1 16 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 23 3 2 0 0 0 0\n 5 4 2 0 0 0 0\n 12 4 1 1 0 0 0\n 6 5 1 0 0 0 0\n 21 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 1 0 0 0\n 13 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 8 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 6 0 0 0\n 15 14 2 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 1 6 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 18 2 0 0 0 0\n 22 21 2 0 0 0 0\n 22 23 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 25 2 0 0 0 0\nM END", "smiles": "CC(=O)Oc1ccc2C[C@@H]3[C@@H]4C=C[C@@H]([C@H]5[C@]4(CCN3C)c2c1O5)OC(=O)C", "formula": "C21H23NO5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "92608887-842b-471e-87f2-f37aafac9db8" }, "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "369.4118", "optical_activity": "UNSPECIFIED", "stereo_centers": 5 } ], "definition_level": "COMPLETE", "uuid": "da48bb06-4799-44f6-905f-7a81bbba6c14", "version": "25", "structure": { "id": "0892fb47-2723-4f94-8370-324664ef206d", "molfile": "\n Marvin 01132100432D \n\n 30 34 0 0 1 0 999 V2000\n 8.4722 -7.6174 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.6391 -7.6174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1772 -8.3051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3743 -8.3051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7368 -8.9324 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8885 -8.6665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6928 -7.7981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2311 -9.2737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9676 -7.5873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3893 -6.9148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2576 -6.9148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6993 -6.2522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4972 -6.2522 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.8888 -6.9699 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.6867 -6.9699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0682 -7.7278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6265 -8.3653 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.8436 -8.3653 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.9502 -9.0278 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1014 -9.3273 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3795 -9.0629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2327 -8.7969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4234 -7.9236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8851 -9.3992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2011 -6.9699 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7582 -5.5395 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7420 -5.5395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1297 -7.6174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1108 -4.9221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7930 -5.5480 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 2 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 2 0 0 0 0\n 8 6 1 0 0 0 0\n 9 4 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 2 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 1 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 2 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 1 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 3 1 0 0 0 0\n 18 20 1 1 0 0 0\n 17 21 1 6 0 0 0\n 22 21 1 0 0 0 0\n 23 22 2 0 0 0 0\n 24 22 1 0 0 0 0\n 14 25 1 1 0 0 0\n 13 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 1 28 1 1 0 0 0\n 29 26 1 0 0 0 0\n 13 30 1 6 0 0 0\nM END", "smiles": "CC(=O)Oc1ccc2C[C@]3([H])[C@]4([H])C=C[C@@H]([C@@]5([H])[C@]4(CCN3C)c2c1O5)OC(=O)C", "formula": "C21H23NO5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "369.4118", "optical_activity": "UNSPECIFIED", "references": [ "faa7e94c-2656-48ca-a566-9e340592614f", "0bc9c187-339f-4905-b47d-6b937dfb85ac" ], "stereo_centers": 5 }, "unii": "70D95007SX" } ] }