{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "049d4b61-8fb3-49e1-b52b-611e160b0a4c",
          "code": "1364318-34-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1364318-34-2",
          "code_system": "CAS",
          "references": [
            "9bd23610-9ca7-4a66-addc-5ffeb2ee57b4",
            "68ff5a8f-a456-4696-8033-a67452f04746"
          ]
        },
        {
          "uuid": "872cf94c-a55b-4b58-a3fe-dc5c509e2dce",
          "code": "76967600",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/76967600",
          "code_system": "PUBCHEM",
          "references": [
            "9bd23610-9ca7-4a66-addc-5ffeb2ee57b4"
          ]
        },
        {
          "uuid": "399d9f92-1edb-e8ce-d257-1b50afc7bd96",
          "code": "DTXSID20159786",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20159786",
          "code_system": "EPA CompTox",
          "references": [
            "bb6c59ef-b037-4c2f-8fc6-b92f1bb99fa2"
          ]
        },
        {
          "uuid": "a454132f-79c5-45c3-84fa-41595055f9e8",
          "code": "709518JB2Q",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "50b6d903-73fe-454b-aadd-02b6c2a8cead",
          "name": "L-PROLINE, 1-(1-OXODECYL)-, SODIUM SALT (1:1)",
          "stdName": "L-PROLINE, 1-(1-OXODECYL)-, SODIUM SALT (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ddca9e8b-6ba3-46f9-aeed-dc8267c9d790"
          ],
          "display_name": false
        },
        {
          "uuid": "130a356a-25d2-4ead-aa14-d97c95a6d12e",
          "name": "SODIUM (S)-1-DECANOYLPYRROLIDINE-2-CARBOXYLATE",
          "stdName": "SODIUM (S)-1-DECANOYLPYRROLIDINE-2-CARBOXYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a88b502b-bc9d-47bc-ae7b-070306369b43"
          ],
          "display_name": false
        },
        {
          "uuid": "fc399a4f-deba-4c01-97b9-22b4aed6c5e3",
          "name": "SODIUM CAPROYL PROLINE",
          "stdName": "SODIUM CAPROYL PROLINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "31824a16-d1de-4a46-a321-314938b12c9a"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "31824a16-d1de-4a46-a321-314938b12c9a",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ddca9e8b-6ba3-46f9-aeed-dc8267c9d790",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a88b502b-bc9d-47bc-ae7b-070306369b43",
          "citation": "CHEMIDBIODRAW",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9bd23610-9ca7-4a66-addc-5ffeb2ee57b4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391653000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e7ad245-5d49-435b-8fac-753773660182",
          "citation": "SRS import [709518JB2Q]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=709518JB2Q",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391653000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a842ab5-67a9-8efc-a3a9-ee3fc06bcd95",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1364318-34-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "68ff5a8f-a456-4696-8033-a67452f04746",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "bb6c59ef-b037-4c2f-8fc6-b92f1bb99fa2",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "660f76f4-de4d-45f5-b2ac-ca17c13de6f3",
          "id": "660f76f4-de4d-45f5-b2ac-ca17c13de6f3",
          "molfile": "\n  Marvin  01132105192D          \n\n  1  0  0  0  1  0            999 V2000\n   11.4362   -8.0083    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "67f6f26d-c379-4f17-98a2-305e3587f2f6"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "417457c2-9af0-419d-8049-04ec00d98a61",
          "id": "417457c2-9af0-419d-8049-04ec00d98a61",
          "molfile": "\n  Marvin  01132103272D          \n\n 19 19  0  0  1  0            999 V2000\n   11.1716   -5.9454    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   11.5967   -5.2284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0708   -4.6213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2931   -4.9453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3697   -5.7668    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5846   -5.8034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1721   -5.0889    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1721   -6.5179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3471   -6.5179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9346   -5.8034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1096   -5.8034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6971   -5.0889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8721   -5.0889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4596   -4.3745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6346   -4.3745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2221   -3.6600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4967   -6.6991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0008   -7.3584    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   12.3496   -6.8119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  5  1  0  0  0  0\n  1 17  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  2  0  0  0  0\nM  CHG  1  18  -1\nM  END",
          "smiles": "CCCCCCCCCC(=O)N1CCC[C@H]1C(=O)[O-]",
          "formula": "C15H26NO3",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bb65adcd-c064-427b-b1fb-dc43d8784eaf"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "268.3724",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e9aeffb7-5f5c-4225-835f-8620cf385250",
      "version": "5",
      "structure": {
        "id": "baa72408-aad2-4f5d-90ee-61f35c16758c",
        "molfile": "\n  Marvin  01132109392D          \n\n 20 19  0  0  1  0            999 V2000\n   11.1716   -5.9454    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.4967   -6.6991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0008   -7.3584    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   12.3496   -6.8119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5967   -5.2284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0708   -4.6213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2931   -4.9453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3697   -5.7668    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5846   -5.8034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1721   -5.0889    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1721   -6.5179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3471   -6.5179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9346   -5.8034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1096   -5.8034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6971   -5.0889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8721   -5.0889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4596   -4.3745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6346   -4.3745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2221   -3.6600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4362   -8.0083    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\n  1  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  1  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\nM  CHG  2   3  -1  20   1\nM  END",
        "smiles": "CCCCCCCCCC(=O)N1CCC[C@H]1C(=O)[O-].[Na+]",
        "formula": "C15H26NO3.Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "291.3622",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "0e7ad245-5d49-435b-8fac-753773660182",
          "ddca9e8b-6ba3-46f9-aeed-dc8267c9d790"
        ],
        "stereo_centers": 1
      },
      "unii": "709518JB2Q"
    }
  ]
}