{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "615ed416-2c72-493f-871f-110e7970bd8b",
          "code": "80-51-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=80-51-3",
          "code_system": "CAS",
          "references": [
            "50535362-bfb3-4d67-8574-61eab6c3d5aa",
            "991cac27-05c9-42c7-b498-df36a16d5593"
          ]
        },
        {
          "uuid": "5de104f5-4cca-408a-80ca-93e438105ad9",
          "code": "201-286-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.170",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "50535362-bfb3-4d67-8574-61eab6c3d5aa"
          ]
        },
        {
          "uuid": "327eb8bf-5318-41f1-b2d7-2c7526e19466",
          "code": "6649",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6649",
          "code_system": "PUBCHEM",
          "references": [
            "50535362-bfb3-4d67-8574-61eab6c3d5aa"
          ]
        },
        {
          "uuid": "a777b2f8-fd92-9e3c-6456-97208bb5bc0c",
          "code": "5237",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5237",
          "code_system": "HSDB",
          "references": [
            "32c64145-648c-fd63-fcc9-c0e48236f067"
          ]
        },
        {
          "uuid": "0648ad10-3daa-9acf-3cc2-e760df9a54ca",
          "code": "DTXSID7026499",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7026499",
          "code_system": "EPA CompTox",
          "references": [
            "f864d170-73dc-78b0-a8ac-f5240bd67817"
          ]
        },
        {
          "uuid": "ddad7900-601c-4b8d-b3ed-06470d2b3437",
          "code": "70377EJ95Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5a2b94d3-7dee-fb09-3946-603f8047451f",
          "code": "5318",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=5318",
          "code_system": "NSC",
          "references": [
            "effe0e3b-ac7e-64ed-65bc-6bfc42a2721d"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8a64c537-bcad-4d11-8579-d1e49acee68f",
          "name": "4,4'-OXY-BIS(BENZENE SULFONHYDRAZIDE)",
          "stdName": "4,4'-OXY-BIS(BENZENE SULFONHYDRAZIDE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0428f88d-11c9-4160-907d-1ba1d765e138"
          ],
          "display_name": false
        },
        {
          "uuid": "1ceed44d-f6d7-43a9-8cda-1c33f988db93",
          "name": "4,4'-OXYBIS(BENZENESULFONHYDRAZIDE)",
          "stdName": "4,4'-OXYBIS(BENZENESULFONHYDRAZIDE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "094e4349-8b10-449c-8d26-3e15b15bf6f8"
          ],
          "display_name": false
        },
        {
          "uuid": "5dc1a7c4-e4ed-4515-b67d-a4d3666e8bfe",
          "name": "4,4'-OXYBIS(BENZENESULFONYL HYDRAZIDE)",
          "stdName": "4,4'-OXYBIS(BENZENESULFONYL HYDRAZIDE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a96ea94-d13d-45a8-a680-2dae81ee15c6"
          ],
          "display_name": false
        },
        {
          "uuid": "eb2a4988-b7ec-4404-8cb6-deda555c5c1d",
          "name": "4,4'-OXYDIBENZENESULFONIC ACID DIHYDRAZIDE",
          "stdName": "4,4'-OXYDIBENZENESULFONIC ACID DIHYDRAZIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0428f88d-11c9-4160-907d-1ba1d765e138"
          ],
          "display_name": false
        },
        {
          "uuid": "5a5e085b-6776-4d18-8311-8dc47a578c62",
          "name": "BENZENESULFONIC ACID, 4,4'-OXYBIS-, DIHYDRAZIDE",
          "stdName": "BENZENESULFONIC ACID, 4,4'-OXYBIS-, DIHYDRAZIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1321ebee-fe0c-4a8d-9db2-f54f9874e8b9"
          ],
          "display_name": true
        },
        {
          "uuid": "e635f8ae-c9ff-4992-94e1-b694c6b8a738",
          "name": "CELOGEN OT",
          "stdName": "CELOGEN OT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0428f88d-11c9-4160-907d-1ba1d765e138"
          ],
          "display_name": false
        },
        {
          "uuid": "c7624498-72d3-4f2a-a029-5a3a4b6d0538",
          "name": "NEOCELLBORN N",
          "stdName": "NEOCELLBORN N",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0428f88d-11c9-4160-907d-1ba1d765e138"
          ],
          "display_name": false
        },
        {
          "uuid": "fec7b138-9b52-4a3f-992a-878dd896f94c",
          "name": "NSC-5318",
          "stdName": "NSC-5318",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00fec8ae-1329-4a8b-b498-4b626fe4b0cb"
          ],
          "display_name": false
        },
        {
          "uuid": "0274698a-cfdc-4a41-a30c-a89523e5e86b",
          "name": "P,P'-OXYBIS(BENZENESULFONYL HYDRAZIDE)",
          "stdName": "P,P'-OXYBIS(BENZENESULFONYL HYDRAZIDE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00fec8ae-1329-4a8b-b498-4b626fe4b0cb"
          ],
          "display_name": false
        },
        {
          "uuid": "d2f75643-9ef7-46d3-8dc8-de40a635cfa7",
          "name": "S-250",
          "stdName": "S-250",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0428f88d-11c9-4160-907d-1ba1d765e138"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8a96ea94-d13d-45a8-a680-2dae81ee15c6",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "00fec8ae-1329-4a8b-b498-4b626fe4b0cb",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0428f88d-11c9-4160-907d-1ba1d765e138",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1321ebee-fe0c-4a8d-9db2-f54f9874e8b9",
          "citation": "TOX21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "094e4349-8b10-449c-8d26-3e15b15bf6f8",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "50535362-bfb3-4d67-8574-61eab6c3d5aa",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391640000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "927783bd-1132-4dc6-9761-f856c51ae4c8",
          "citation": "SRS import [70377EJ95Z]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=70377EJ95Z",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391640000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "129079b9-3a06-46e6-95c5-2d6057b59f8b",
          "citation": "CHEMID RECORD 80-51-3",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "32c64145-648c-fd63-fcc9-c0e48236f067",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+80-51-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f864d170-73dc-78b0-a8ac-f5240bd67817",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=80-51-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "991cac27-05c9-42c7-b498-df36a16d5593",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "effe0e3b-ac7e-64ed-65bc-6bfc42a2721d",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "11d07ecd-4edf-4b68-80f3-a5e7659c26a1",
          "id": "11d07ecd-4edf-4b68-80f3-a5e7659c26a1",
          "molfile": "\n  Marvin  01132101092D          \n\n 23 24  0  0  0  0            999 V2000\n    9.1416   -2.2105    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3231   -1.8182    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6087   -2.2307    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1961   -1.5162    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0211   -2.9452    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8942   -2.6432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8942   -3.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1797   -3.8807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4652   -3.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7507   -3.8807    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0362   -3.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3218   -3.8807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6073   -3.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6073   -2.6432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3218   -2.2307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0362   -2.6432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8928   -2.2307    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3053   -1.5162    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4803   -2.9452    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1783   -1.8182    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4638   -2.2307    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4652   -2.6432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1797   -2.2307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  2  0  0  0  0\n  6  3  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 23  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 22  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 16  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  2  0  0  0  0\n 14 17  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  2  0  0  0  0\n 17 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 23 22  1  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1Oc2ccc(cc2)S(=O)(=O)NN)S(=O)(=O)NN",
          "formula": "C12H14N4O5S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "51596392-d0a7-48aa-a692-3252c07e1d43"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "358.396",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c59e8cb5-69d6-416b-b0aa-01299719c6c4",
      "version": "5",
      "structure": {
        "id": "e791b7b3-0786-4937-8beb-5bd267e8d548",
        "molfile": "\n  Marvin  01132111592D          \n\n 23 24  0  0  0  0            999 V2000\n    6.8942   -2.6432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6087   -2.2307    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3231   -1.8182    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1416   -2.2105    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1961   -1.5162    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0211   -2.9452    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8942   -3.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1797   -3.8807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4652   -3.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7507   -3.8807    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0362   -3.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3218   -3.8807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6073   -3.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6073   -2.6432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8928   -2.2307    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1783   -1.8182    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4638   -2.2307    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3053   -1.5162    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4803   -2.9452    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3218   -2.2307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0362   -2.6432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4652   -2.6432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1797   -2.2307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  2  5  2  0  0  0  0\n  2  6  2  0  0  0  0\n  1  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 15 18  2  0  0  0  0\n 15 19  2  0  0  0  0\n 20 14  1  0  0  0  0\n 21 20  2  0  0  0  0\n 11 21  1  0  0  0  0\n 22  9  1  0  0  0  0\n 23 22  2  0  0  0  0\n  1 23  1  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1Oc2ccc(cc2)S(=O)(=O)NN)S(=O)(=O)NN",
        "formula": "C12H14N4O5S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "358.396",
        "optical_activity": "NONE",
        "references": [
          "927783bd-1132-4dc6-9761-f856c51ae4c8",
          "129079b9-3a06-46e6-95c5-2d6057b59f8b"
        ],
        "stereo_centers": 0
      },
      "unii": "70377EJ95Z"
    }
  ]
}