{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "6ee49c80-4bf9-4204-b21a-58866ccd4ac1", "code": "57533-90-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=57533-90-1", "code_system": "CAS", "references": [ "f253bced-63d2-4837-bf79-ca0def85059e", "d8c49d5d-a02c-45be-946a-08e1a621ac16" ] }, { "uuid": "485173fb-96b4-4cdf-8ee3-be918de5e1b4", "code": "260-799-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.055.254", "code_system": "ECHA (EC/EINECS)", "references": [ "f253bced-63d2-4837-bf79-ca0def85059e" ] }, { "uuid": "77023d92-b557-46f0-bfff-d607954a239c", "code": "93706", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/93706", "code_system": "PUBCHEM", "references": [ "f253bced-63d2-4837-bf79-ca0def85059e" ] }, { "uuid": "f9ac774f-2679-4f8e-a7fe-c0fb7dd5d33d", "code": "700593SCJB", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "5e58ac53-f506-753c-6e3b-31d0d0921fef", "code": "DTXSID40973067", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40973067", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "0c704a3b-ea32-4cab-8426-c3b4da8cea1f", "name": "(±)-DIHEXYLDECYL ADIPATE", "stdName": "(+/-)-DIHEXYLDECYL ADIPATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ec16f1c3-6883-4710-b8b5-b88b591cbd3d", "c7930b6b-26ba-43e5-9d98-ddbf5f714a5d" ], "display_name": false }, { "uuid": "df8a069d-331d-45b7-9cf6-2c8a3f2d60aa", "name": "ADIPIC ACID, DIHYEXYLDECYL ESTER", "stdName": "ADIPIC ACID, DIHYEXYLDECYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "cc98d83a-de7f-42fd-b0c7-c8821a6d0ae0", "ec16f1c3-6883-4710-b8b5-b88b591cbd3d" ], "display_name": false }, { "uuid": "e20185f7-d7cc-46cc-802a-149462a733d1", "name": "BIS(2-HEXYLDECYL) ADIPATE", "stdName": "BIS(2-HEXYLDECYL) ADIPATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ec16f1c3-6883-4710-b8b5-b88b591cbd3d", "74d5fdf4-c7e2-484b-9b63-4dd2d82b5852" ], "display_name": false }, { "uuid": "9c393ff5-fc22-4571-b2f9-08b161db981f", "name": "DIHEXYLDECYL ADIPATE", "stdName": "DIHEXYLDECYL ADIPATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "cc98d83a-de7f-42fd-b0c7-c8821a6d0ae0", "ec16f1c3-6883-4710-b8b5-b88b591cbd3d", "10d0ae66-726d-474e-a5fa-6af6f2646fe7" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "3392b2af-9310-40eb-a0b9-0b6ecca491e7", "name_org": "INCI" } ] }, { "uuid": "80477742-ae44-4a4e-bf61-a318c6d2ce71", "name": "HEXANEDIOIC ACID, 1,6-BIS(2-HEXYLDECYL) ESTER", "stdName": "HEXANEDIOIC ACID, 1,6-BIS(2-HEXYLDECYL) ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ec16f1c3-6883-4710-b8b5-b88b591cbd3d", "96352004-b0d3-4f50-96f2-3b08cd9249ff" ], "display_name": false }, { "uuid": "91e762f6-7047-4223-ae28-9ad93a87a5ed", "name": "HEXANEDIOIC ACID, BIS(2-HEXYLDECYL) ESTER", "stdName": "HEXANEDIOIC ACID, BIS(2-HEXYLDECYL) ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ec16f1c3-6883-4710-b8b5-b88b591cbd3d", "96352004-b0d3-4f50-96f2-3b08cd9249ff" ], "display_name": false } ], "references": [ { "uuid": "cc98d83a-de7f-42fd-b0c7-c8821a6d0ae0", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "ec16f1c3-6883-4710-b8b5-b88b591cbd3d", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c7930b6b-26ba-43e5-9d98-ddbf5f714a5d", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "74d5fdf4-c7e2-484b-9b63-4dd2d82b5852", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "96352004-b0d3-4f50-96f2-3b08cd9249ff", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f253bced-63d2-4837-bf79-ca0def85059e", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391494000, "tags": [ "NOMEN" ] }, { "uuid": "ff57f869-fa9f-4397-b0f7-73f1a6e1dfbf", "citation": "SRS import [700593SCJB]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=700593SCJB", "doc_type": "SRS", "public_domain": true, "document_date": 1493391494000, "tags": [ "NOMEN" ] }, { "uuid": "10d0ae66-726d-474e-a5fa-6af6f2646fe7", "citation": "DIHEXYLDECYL ADIPATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "d8c49d5d-a02c-45be-946a-08e1a621ac16", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "e4ba7303-80c3-4b53-9486-309bc29e24d0", "id": "e4ba7303-80c3-4b53-9486-309bc29e24d0", "molfile": "\n Marvin 01132111502D \n\n 42 41 0 0 0 0 999 V2000\n 16.2663 -1.4095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5519 -1.8220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5519 -2.6470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8374 -3.0595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8374 -3.8845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1229 -4.2970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1229 -5.1220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4085 -5.5345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4085 -6.3595 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 14.1229 -6.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8374 -6.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5519 -6.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2663 -6.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9808 -6.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6953 -6.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6940 -6.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9796 -6.3595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2651 -6.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2651 -7.5970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5506 -6.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8362 -6.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1217 -6.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4072 -6.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6928 -6.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6928 -5.5345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9783 -6.7720 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2638 -6.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5493 -6.7720 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 4.8349 -6.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1204 -6.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4059 -6.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6914 -6.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9770 -6.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2625 -6.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5493 -7.5970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8349 -8.0095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8349 -8.8345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1204 -9.2470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1204 -10.0720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4059 -10.4844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4059 -11.3095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6914 -11.7220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 16 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 2 0 0 0 0\n 18 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 24 25 2 0 0 0 0\n 26 24 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 1 0 0 0 0\n 28 35 1 0 0 0 0\n 30 29 1 0 0 0 0\n 31 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 32 1 0 0 0 0\n 33 34 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\nM END", "smiles": "CCCCCCCCC(CCCCCC)COC(=O)CCCCC(=O)OCC(CCCCCC)CCCCCCCC", "formula": "C38H74O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "0a7c0c18-7385-47aa-9e1c-21822f952675" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "594.9932", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "eb5a9602-9a29-4144-bf9e-2b2eac7061ca", "version": "4", "structure": { "id": "6ec67336-f2d0-4aa2-91e4-738d010e2a40", "molfile": "\n Marvin 01132105452D \n\n 42 41 0 0 0 0 999 V2000\n 11.2651 -6.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2651 -7.5970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9796 -6.3595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6940 -6.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4085 -6.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1229 -6.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8374 -6.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5519 -6.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2663 -6.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9808 -6.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6953 -6.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5506 -6.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8362 -6.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6928 -5.5345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9770 -6.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6914 -6.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4059 -6.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1204 -6.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8349 -6.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5493 -6.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2638 -6.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9783 -6.7720 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6928 -6.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1217 -6.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4072 -6.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4085 -5.5345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1229 -5.1220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1229 -4.2970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8374 -3.8845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8374 -3.0595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5519 -2.6470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5519 -1.8220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2663 -1.4095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5493 -7.5970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8349 -8.0095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8349 -8.8345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1204 -9.2470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1204 -10.0720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4059 -10.4844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4059 -11.3095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6914 -11.7220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2625 -6.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 1 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 1 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 23 14 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 25 1 0 0 0 0\n 25 24 1 0 0 0 0\n 24 13 1 0 0 0 0\n 5 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 20 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 15 42 1 0 0 0 0\nM END", "smiles": "CCCCCCCCC(CCCCCC)COC(=O)CCCCC(=O)OCC(CCCCCC)CCCCCCCC", "formula": "C38H74O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "594.9932", "optical_activity": "UNSPECIFIED", "references": [ "ff57f869-fa9f-4397-b0f7-73f1a6e1dfbf", "96352004-b0d3-4f50-96f2-3b08cd9249ff" ], "stereo_centers": 2 }, "unii": "700593SCJB" } ] }